CA1041307A - Scouring compositions - Google Patents
Scouring compositionsInfo
- Publication number
- CA1041307A CA1041307A CA223,481A CA223481A CA1041307A CA 1041307 A CA1041307 A CA 1041307A CA 223481 A CA223481 A CA 223481A CA 1041307 A CA1041307 A CA 1041307A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- sodium
- weight
- group
- potassium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 188
- 238000009991 scouring Methods 0.000 title claims abstract description 26
- 239000000463 material Substances 0.000 claims abstract description 82
- 239000010839 body fluid Substances 0.000 claims abstract description 40
- 239000000945 filler Substances 0.000 claims abstract description 40
- 210000001124 body fluid Anatomy 0.000 claims abstract description 38
- 239000011236 particulate material Substances 0.000 claims abstract description 8
- -1 polyethylene Polymers 0.000 claims description 44
- 239000007788 liquid Substances 0.000 claims description 36
- 239000004094 surface-active agent Substances 0.000 claims description 36
- 239000007844 bleaching agent Substances 0.000 claims description 33
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 32
- 239000003082 abrasive agent Substances 0.000 claims description 29
- 239000010451 perlite Substances 0.000 claims description 29
- 235000019362 perlite Nutrition 0.000 claims description 29
- 239000004927 clay Substances 0.000 claims description 28
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims description 24
- 239000002245 particle Substances 0.000 claims description 23
- 239000011734 sodium Substances 0.000 claims description 22
- 229910052708 sodium Inorganic materials 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 21
- 230000005484 gravity Effects 0.000 claims description 21
- 239000006172 buffering agent Substances 0.000 claims description 20
- 239000011591 potassium Substances 0.000 claims description 15
- 229910052700 potassium Inorganic materials 0.000 claims description 15
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 14
- 239000007864 aqueous solution Substances 0.000 claims description 12
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 claims description 12
- 239000004743 Polypropylene Substances 0.000 claims description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 10
- 229910021647 smectite Inorganic materials 0.000 claims description 10
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 claims description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 235000011180 diphosphates Nutrition 0.000 claims description 9
- 229920001155 polypropylene Polymers 0.000 claims description 9
- 239000000377 silicon dioxide Substances 0.000 claims description 9
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000008262 pumice Substances 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims description 7
- 239000011521 glass Substances 0.000 claims description 7
- 229910052901 montmorillonite Inorganic materials 0.000 claims description 7
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 6
- 235000013162 Cocos nucifera Nutrition 0.000 claims description 6
- 244000060011 Cocos nucifera Species 0.000 claims description 6
- 239000004115 Sodium Silicate Substances 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 6
- 239000001488 sodium phosphate Substances 0.000 claims description 6
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 6
- 229910000404 tripotassium phosphate Inorganic materials 0.000 claims description 6
- 235000019798 tripotassium phosphate Nutrition 0.000 claims description 6
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims description 6
- 229910000406 trisodium phosphate Inorganic materials 0.000 claims description 6
- 235000019801 trisodium phosphate Nutrition 0.000 claims description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 5
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 5
- 239000010452 phosphate Substances 0.000 claims description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 5
- 239000010453 quartz Substances 0.000 claims description 5
- 239000004576 sand Substances 0.000 claims description 5
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 5
- 241000894007 species Species 0.000 claims description 5
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 4
- 239000005909 Kieselgur Substances 0.000 claims description 4
- 229920000877 Melamine resin Polymers 0.000 claims description 4
- 241000276489 Merlangius merlangus Species 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 4
- 239000004793 Polystyrene Substances 0.000 claims description 4
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 4
- 239000001506 calcium phosphate Substances 0.000 claims description 4
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 4
- 235000011010 calcium phosphates Nutrition 0.000 claims description 4
- 239000010433 feldspar Substances 0.000 claims description 4
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 4
- 239000004005 microsphere Substances 0.000 claims description 4
- 239000005011 phenolic resin Substances 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- 229920001225 polyester resin Polymers 0.000 claims description 4
- 239000004645 polyester resin Substances 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 claims description 4
- 229920002223 polystyrene Polymers 0.000 claims description 4
- 239000005077 polysulfide Substances 0.000 claims description 4
- 150000008117 polysulfides Polymers 0.000 claims description 4
- 235000011181 potassium carbonates Nutrition 0.000 claims description 4
- 239000010458 rotten stone Substances 0.000 claims description 4
- 235000019795 sodium metasilicate Nutrition 0.000 claims description 4
- 239000003760 tallow Substances 0.000 claims description 4
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 4
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 4
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 3
- 229960003237 betaine Drugs 0.000 claims description 3
- 229920001021 polysulfide Polymers 0.000 claims description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 3
- 235000017550 sodium carbonate Nutrition 0.000 claims description 3
- 239000004408 titanium dioxide Substances 0.000 claims description 3
- 235000019354 vermiculite Nutrition 0.000 claims description 3
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 claims description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 2
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 claims description 2
- FUVGZDDOHNQZEO-UHFFFAOYSA-N NS(=O)(=O)NCl Chemical compound NS(=O)(=O)NCl FUVGZDDOHNQZEO-UHFFFAOYSA-N 0.000 claims description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000129 anionic group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 239000003093 cationic surfactant Substances 0.000 claims description 2
- VDQQXEISLMTGAB-UHFFFAOYSA-N chloramine T Chemical compound [Na+].CC1=CC=C(S(=O)(=O)[N-]Cl)C=C1 VDQQXEISLMTGAB-UHFFFAOYSA-N 0.000 claims description 2
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 claims description 2
- YZQBYALVHAANGI-UHFFFAOYSA-N magnesium;dihypochlorite Chemical compound [Mg+2].Cl[O-].Cl[O-] YZQBYALVHAANGI-UHFFFAOYSA-N 0.000 claims description 2
- ARGDYOIRHYLIMT-UHFFFAOYSA-N n,n-dichloro-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N(Cl)Cl)C=C1 ARGDYOIRHYLIMT-UHFFFAOYSA-N 0.000 claims description 2
- PJBJJXCZRAHMCK-UHFFFAOYSA-N n,n-dichlorobenzenesulfonamide Chemical compound ClN(Cl)S(=O)(=O)C1=CC=CC=C1 PJBJJXCZRAHMCK-UHFFFAOYSA-N 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- SATVIFGJTRRDQU-UHFFFAOYSA-N potassium hypochlorite Chemical compound [K+].Cl[O-] SATVIFGJTRRDQU-UHFFFAOYSA-N 0.000 claims description 2
- ONQDVAFWWYYXHM-UHFFFAOYSA-M potassium lauryl sulfate Chemical compound [K+].CCCCCCCCCCCCOS([O-])(=O)=O ONQDVAFWWYYXHM-UHFFFAOYSA-M 0.000 claims description 2
- IFIDXBCRSWOUSB-UHFFFAOYSA-N potassium;1,3-dichloro-1,3,5-triazinane-2,4,6-trione Chemical compound [K+].ClN1C(=O)NC(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-N 0.000 claims description 2
- JTXIPOLAHSBNJM-UHFFFAOYSA-M potassium;decyl sulfate Chemical compound [K+].CCCCCCCCCCOS([O-])(=O)=O JTXIPOLAHSBNJM-UHFFFAOYSA-M 0.000 claims description 2
- XZTJQQLJJCXOLP-UHFFFAOYSA-M sodium;decyl sulfate Chemical compound [Na+].CCCCCCCCCCOS([O-])(=O)=O XZTJQQLJJCXOLP-UHFFFAOYSA-M 0.000 claims description 2
- ASTWEMOBIXQPPV-UHFFFAOYSA-K trisodium;phosphate;dodecahydrate Chemical class O.O.O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[O-]P([O-])([O-])=O ASTWEMOBIXQPPV-UHFFFAOYSA-K 0.000 claims description 2
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 2
- 229940093956 potassium carbonate Drugs 0.000 claims 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 claims 1
- 239000003945 anionic surfactant Substances 0.000 claims 1
- 239000002563 ionic surfactant Substances 0.000 claims 1
- PYILKOIEIHHYGD-UHFFFAOYSA-M sodium;1,5-dichloro-4,6-dioxo-1,3,5-triazin-2-olate;dihydrate Chemical compound O.O.[Na+].[O-]C1=NC(=O)N(Cl)C(=O)N1Cl PYILKOIEIHHYGD-UHFFFAOYSA-M 0.000 claims 1
- 239000012071 phase Substances 0.000 abstract 3
- 230000001747 exhibiting effect Effects 0.000 abstract 1
- 239000007791 liquid phase Substances 0.000 abstract 1
- 235000015424 sodium Nutrition 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000012530 fluid Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- 229910001868 water Inorganic materials 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 10
- 238000013019 agitation Methods 0.000 description 9
- 235000007686 potassium Nutrition 0.000 description 9
- 229960003975 potassium Drugs 0.000 description 9
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 description 7
- 235000010755 mineral Nutrition 0.000 description 7
- 239000011707 mineral Substances 0.000 description 7
- 239000002304 perfume Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 150000001768 cations Chemical class 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 229910052625 palygorskite Inorganic materials 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 229960000892 attapulgite Drugs 0.000 description 5
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 150000002191 fatty alcohols Chemical class 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 5
- 239000000395 magnesium oxide Substances 0.000 description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 5
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229910000275 saponite Inorganic materials 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229940048084 pyrophosphate Drugs 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 4
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical class ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 2
- UBNVDFUEPGQZQS-UHFFFAOYSA-N acetic acid;n,n-dimethyldodecan-1-amine Chemical compound CC([O-])=O.CCCCCCCCCCCC[NH+](C)C UBNVDFUEPGQZQS-UHFFFAOYSA-N 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- CRPOUZQWHJYTMS-UHFFFAOYSA-N dialuminum;magnesium;disilicate Chemical compound [Mg+2].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] CRPOUZQWHJYTMS-UHFFFAOYSA-N 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 description 2
- 229910000271 hectorite Inorganic materials 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910001425 magnesium ion Inorganic materials 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 235000019794 sodium silicate Nutrition 0.000 description 2
- 229940032158 sodium silicate Drugs 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 230000009974 thixotropic effect Effects 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241001050985 Disco Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000252067 Megalops atlanticus Species 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- JTSVYBPWSSQBEB-UHFFFAOYSA-N azanium;hexanoate Chemical compound [NH4+].CCCCCC([O-])=O JTSVYBPWSSQBEB-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- ZMEVAQQMUSEIJD-UHFFFAOYSA-N butanoate;dimethyl(tetradecyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCCCC[NH+](C)C ZMEVAQQMUSEIJD-UHFFFAOYSA-N 0.000 description 1
- XLIRVORAQHWLJE-UHFFFAOYSA-N butanoate;dodecyl(dimethyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C XLIRVORAQHWLJE-UHFFFAOYSA-N 0.000 description 1
- SCEJTWKEWDOCKV-UHFFFAOYSA-N butanoate;hexadecyl(dimethyl)azanium Chemical compound CCCC([O-])=O.CCCCCCCCCCCCCCCC[NH+](C)C SCEJTWKEWDOCKV-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- VNSBYDPZHCQWNB-UHFFFAOYSA-N calcium;aluminum;dioxido(oxo)silane;sodium;hydrate Chemical compound O.[Na].[Al].[Ca+2].[O-][Si]([O-])=O VNSBYDPZHCQWNB-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical class ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- QHNXEVRKFKHMRL-UHFFFAOYSA-N dimethylazanium;acetate Chemical compound CNC.CC(O)=O QHNXEVRKFKHMRL-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- QMMXHYMFTNPOPG-UHFFFAOYSA-N dipropyl(tetradecyl)azanium;pentanoate Chemical compound CCCCC([O-])=O.CCCCCCCCCCCCCC[NH+](CCC)CCC QMMXHYMFTNPOPG-UHFFFAOYSA-N 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- CDMADVZSLOHIFP-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane;decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 CDMADVZSLOHIFP-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QKHKGSULBQVNMO-UHFFFAOYSA-N dodecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C QKHKGSULBQVNMO-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- VGUANSONTIBISX-UHFFFAOYSA-N hexadecyl(dimethyl)azanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCCCN(C)C VGUANSONTIBISX-UHFFFAOYSA-N 0.000 description 1
- BXFPJFWOBWLKSR-UHFFFAOYSA-N hexadecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCCCCCC[NH+](C)C BXFPJFWOBWLKSR-UHFFFAOYSA-N 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical group ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- NHLUVTZJQOJKCC-UHFFFAOYSA-N n,n-dimethylhexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCN(C)C NHLUVTZJQOJKCC-UHFFFAOYSA-N 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 229910000273 nontronite Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910000276 sauconite Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0013—Liquid compositions with insoluble particles in suspension
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
- C11D3/1266—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite in liquid compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/14—Fillers; Abrasives ; Abrasive compositions; Suspending or absorbing agents not provided for in one single group of C11D3/12; Specific features concerning abrasives, e.g. granulometry or mixtures
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16814/74A GB1495549A (en) | 1974-04-17 | 1974-04-17 | Scouring compositions |
| US05/504,218 US3985668A (en) | 1974-04-17 | 1974-09-09 | Scouring compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1041307A true CA1041307A (en) | 1978-10-31 |
Family
ID=26252259
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA223,481A Expired CA1041307A (en) | 1974-04-17 | 1975-04-01 | Scouring compositions |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3985668A (OSRAM) |
| JP (1) | JPS593517B2 (OSRAM) |
| BE (1) | BE827991A (OSRAM) |
| CA (1) | CA1041307A (OSRAM) |
| DE (1) | DE2516003C2 (OSRAM) |
| FR (1) | FR2268071B1 (OSRAM) |
| GB (1) | GB1495549A (OSRAM) |
| IT (1) | IT1037342B (OSRAM) |
| NL (1) | NL185784C (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5190693A (en) * | 1988-07-29 | 1993-03-02 | Ausidet S.P.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2539733C2 (de) * | 1974-09-09 | 1986-08-21 | The Procter & Gamble Co., Cincinnati, Ohio | Flüssiges Reinigungsmittel mit Schmirgelwirkung |
| US4051055A (en) * | 1976-12-21 | 1977-09-27 | The Procter & Gamble Company | Cleansing compositions |
| US4116851A (en) * | 1977-06-20 | 1978-09-26 | The Procter & Gamble Company | Thickened bleach compositions for treating hard-to-remove soils |
| US4158553A (en) * | 1978-01-16 | 1979-06-19 | S. C. Johnson & Son, Inc. | Non-scratching liquid scouring cleanser using abrasives with a Mohs hardness of greater than 3 |
| US4352678A (en) | 1978-10-02 | 1982-10-05 | Lever Brothers Company | Thickened abrasive bleaching compositions |
| US4240919A (en) * | 1978-11-29 | 1980-12-23 | S. C. Johnson & Son, Inc. | Thixotropic abrasive liquid scouring composition |
| US4248728A (en) * | 1979-02-28 | 1981-02-03 | Chemed Corporation | Liquid scouring cleanser |
| NL7908798A (nl) | 1979-12-05 | 1981-07-01 | Unilever Nv | Vloeibaar, verdikt chloorbleekmiddel. |
| EP0030986A1 (en) * | 1979-12-24 | 1981-07-01 | THE PROCTER & GAMBLE COMPANY | Abrasive-containing, built liquid detergent composition |
| US4287079A (en) * | 1980-06-02 | 1981-09-01 | Purex Corporation | Liquid cleanser formula |
| EP0050887B1 (en) * | 1980-10-16 | 1984-05-02 | Unilever N.V. | Stable liquid detergent suspensions |
| US4388204A (en) * | 1982-03-23 | 1983-06-14 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| GB8328075D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| US4599186A (en) * | 1984-04-20 | 1986-07-08 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4657692A (en) * | 1984-04-20 | 1987-04-14 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| NZ212921A (en) * | 1984-08-13 | 1988-06-30 | Colgate Palmolive Co | Process for the manufacture of thixotropic detergent compositions |
| US4927555A (en) * | 1984-08-13 | 1990-05-22 | Colgate-Palmolive Company | Process for making thixotropic detergent compositions |
| US4594175A (en) * | 1984-08-29 | 1986-06-10 | Economics Laboratory, Inc. | Mechanical dishwashing rinse composition having a low foaming sulfonic acid rinsing agent, a hydrotrope and a source of active halogen |
| US4751016A (en) * | 1985-02-26 | 1988-06-14 | The Clorox Company | Liquid aqueous abrasive cleanser |
| US5064553A (en) * | 1989-05-18 | 1991-11-12 | Colgate-Palmolive Co. | Linear-viscoelastic aqueous liquid automatic dishwasher detergent composition |
| US5427707A (en) * | 1985-06-14 | 1995-06-27 | Colgate Palmolive Co. | Thixotropic aqueous compositions containing adipic or azelaic acid stabilizer |
| DE3545288A1 (de) * | 1985-12-20 | 1987-06-25 | Vorwerk Co Interholding | Fluessige reinigungssuspension |
| US4828748A (en) * | 1986-01-03 | 1989-05-09 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| NZ218730A (en) * | 1986-01-03 | 1990-04-26 | Bristol Myers Co | Bleaching composition including thickening agent |
| US4704222A (en) * | 1986-09-05 | 1987-11-03 | Noxell Corporation | Gelled abrasive detergent composition |
| US4895669A (en) * | 1986-11-03 | 1990-01-23 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4804491A (en) * | 1986-11-03 | 1989-02-14 | The Clorox Company | Aqueous based acidic hard surface cleaner |
| US4828723A (en) * | 1987-07-15 | 1989-05-09 | Colgate-Palmolive Company | Stable non-aqueous suspension containing organophilic clay and low density filler |
| US5176713A (en) * | 1987-07-15 | 1993-01-05 | Colgate-Palmolive Co. | Stable non-aqueous cleaning composition method of use |
| US4931195A (en) * | 1987-07-15 | 1990-06-05 | Colgate-Palmolive Company | Low viscosity stable non-aqueous suspension containing organophilic clay and low density filler |
| NZ225316A (en) * | 1987-07-15 | 1990-10-26 | Colgate Palmolive Co | Low density filler stabilised laundry compositions |
| US4838948A (en) * | 1987-07-27 | 1989-06-13 | Phillips Petroleum Company | Process for cleaning polymer processing equipment |
| US4970016A (en) * | 1987-09-29 | 1990-11-13 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US4968445A (en) * | 1987-09-29 | 1990-11-06 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US4968446A (en) * | 1987-11-05 | 1990-11-06 | Colgate-Palmolive Co. | Thixotropic aqueous liquid automatic dishwashing detergent composition |
| US5205954A (en) * | 1987-11-05 | 1993-04-27 | Colgate-Palmolive Co. | Automatic dishwasher powder detergent composition |
| US4844824A (en) * | 1988-02-08 | 1989-07-04 | The Procter & Gamble Company | Stable heavy duty liquid detergent compositions which contain a softener and antistatic agent |
| US4943429A (en) * | 1988-05-23 | 1990-07-24 | Church & Dwight Co., Inc. | Dentifrice gels containing sodium bicarbonate |
| JPH01139131A (ja) * | 1988-07-21 | 1989-05-31 | Takeda Chem Ind Ltd | スラリーの輸送方法 |
| EP0352358A1 (en) * | 1988-07-29 | 1990-01-31 | AUSIDET S.p.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
| US4986926A (en) * | 1989-04-10 | 1991-01-22 | The Drackett Company | Thickened alkali metal hypochlorite compositions |
| US5196139A (en) * | 1989-06-19 | 1993-03-23 | Lever Brothers Company, Division Of Conopco, Inc. | Bleach article containing polyacrylate or copolymer of acrylic and maleic |
| US5041236A (en) | 1989-10-27 | 1991-08-20 | The Procter & Gamble Company | Antimicrobial methods and compositions employing certain lysozymes and endoglycosidases |
| CA2075195C (en) * | 1990-02-16 | 2002-04-16 | Cornelis B. Donker | Liquid cleaning products |
| US5120465A (en) * | 1990-02-22 | 1992-06-09 | Dry Branch Kaolin Company | Detergent or cleansing composition and additive for imparting thixotropic properties thereto |
| EP0517311A1 (en) | 1991-06-07 | 1992-12-09 | Colgate-Palmolive Company | Linear viscoelastic aqueous liquid automatic dishwasher detergent composition |
| US5279755A (en) * | 1991-09-16 | 1994-01-18 | The Clorox Company | Thickening aqueous abrasive cleaner with improved colloidal stability |
| US5346641A (en) * | 1992-01-17 | 1994-09-13 | The Clorox Company | Thickened aqueous abrasive cleanser with improved colloidal stability |
| GB2269597A (en) * | 1992-08-04 | 1994-02-16 | Hee Sun Kaw | Cleaning composition |
| US5393446A (en) * | 1992-12-16 | 1995-02-28 | Eco Japan Co., Ltd. | Process for preparing detergent composition containing sodium and potassium oxides |
| EP0630227B1 (de) * | 1993-01-14 | 1999-04-14 | HAWE NEOS DENTAL Dr. H. V. WEISSENFLUH AG | Zahnpasta |
| GB9315761D0 (en) * | 1993-07-30 | 1993-09-15 | Unilever Plc | Bleach compositions |
| US5470499A (en) * | 1993-09-23 | 1995-11-28 | The Clorox Company | Thickened aqueous abrasive cleanser with improved rinsability |
| US5529711A (en) * | 1993-09-23 | 1996-06-25 | The Clorox Company | Phase stable, thickened aqueous abrasive bleaching cleanser |
| CA2219679A1 (en) * | 1995-05-11 | 1996-11-14 | Reckitt & Colman Inc. | Thickened scouring cleanser containing inorganic abrasives and hypochlorite bleach |
| GB2304113B (en) * | 1995-08-10 | 1999-08-04 | Reckitt & Colman Inc | Hard surface cleaner |
| GB2305434B (en) * | 1995-09-19 | 1999-03-10 | Reckitt & Colmann Sa | Abrasive cleaning composition |
| GB2311996A (en) * | 1996-04-12 | 1997-10-15 | Reckitt & Colman Inc | Hard surface scouring cleansers ` |
| WO1998021289A1 (en) * | 1996-11-14 | 1998-05-22 | Kao Corporation | Abrasive composition for the base of magnetic recording medium and process for producing the base by using the same |
| US6010683A (en) * | 1997-11-05 | 2000-01-04 | Ultradent Products, Inc. | Compositions and methods for reducing the quantity but not the concentration of active ingredients delivered by a dentifrice |
| US5997764A (en) * | 1997-12-04 | 1999-12-07 | The B.F. Goodrich Company | Thickened bleach compositions |
| BR0011261B1 (pt) * | 1999-06-04 | 2013-07-09 | composiÇço oral compreendendo perlita, e, uso de perlita. | |
| US6332708B1 (en) | 2000-08-31 | 2001-12-25 | Cametox 2000 Inc. | Method of shipping manganese dioxide |
| US20030118626A1 (en) * | 2001-09-21 | 2003-06-26 | John Kibbee | Stable pesticidal chemical formulations |
| US7860116B2 (en) * | 2007-05-24 | 2010-12-28 | Worldwide Packets, Inc. | Processing packets of a virtual interface associated with tunnels |
| WO2010039572A1 (en) * | 2008-09-30 | 2010-04-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| WO2010039571A1 (en) * | 2008-09-30 | 2010-04-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| EP2328999A1 (en) * | 2008-09-30 | 2011-06-08 | The Procter & Gamble Company | Liquid hard surface cleaning composition |
| JP5658278B2 (ja) * | 2009-12-22 | 2015-01-21 | ザ プロクター アンド ギャンブルカンパニー | 液体クリーニング及び/又はクレンジング組成物 |
| EP2516609B1 (en) | 2009-12-22 | 2013-11-27 | The Procter and Gamble Company | Liquid cleaning and/or cleansing composition |
| EP2561056A1 (en) | 2010-04-21 | 2013-02-27 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| JP5997161B2 (ja) | 2010-09-21 | 2016-09-28 | ザ プロクター アンド ギャンブル カンパニー | 液体洗浄組成物 |
| EP2431451A1 (en) | 2010-09-21 | 2012-03-21 | The Procter & Gamble Company | Liquid detergent composition with abrasive particles |
| US8445422B2 (en) | 2010-09-21 | 2013-05-21 | The Procter & Gamble Company | Liquid cleaning composition |
| US9546346B2 (en) | 2011-04-07 | 2017-01-17 | The Dial Corporation | Use of polyethylene glycol to control the spray pattern of sprayable liquid abrasive cleansers |
| US8852643B2 (en) | 2011-06-20 | 2014-10-07 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| EP2537917A1 (en) | 2011-06-20 | 2012-12-26 | The Procter & Gamble Company | Liquid detergent composition with abrasive particles |
| MX338952B (es) | 2011-06-20 | 2016-05-05 | Procter & Gamble | Composicion liquida de limpieza y/o lavado. |
| CA2839953C (en) | 2011-06-20 | 2017-02-14 | The Procter & Gamble Company | Liquid cleaning and/or cleansing composition |
| EP2719752B1 (en) | 2012-10-15 | 2016-03-16 | The Procter and Gamble Company | Liquid detergent composition with abrasive particles |
| CN107151580A (zh) * | 2017-05-31 | 2017-09-12 | 江苏精盾节能科技有限公司 | 一种中空玻璃专用清理液及其制备方法 |
| CN108276680B (zh) * | 2018-03-09 | 2020-12-22 | 西华大学 | 一种改性聚丙烯复合材料及其制备方法 |
| US10986841B2 (en) | 2018-11-06 | 2021-04-27 | The Clorox Company | Bleach compositions |
| GB2579252A (en) | 2018-11-28 | 2020-06-17 | For Spills Ltd | Biocidal formulation |
| US11845916B2 (en) | 2020-06-24 | 2023-12-19 | The Clorox Company | Burstable sporicidal cleaning wipe system containing stabilized hypochlorite |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2489848A (en) * | 1947-10-10 | 1949-11-29 | Wyandotte Chemicals Corp | Abrasive scouring powder |
| US3042622A (en) * | 1957-11-01 | 1962-07-03 | Colgate Palmolive Co | Abrasive cleaning composition |
| US3446893A (en) * | 1967-02-23 | 1969-05-27 | Olin Mathieson | Solid deodorizing compositions |
| US3530071A (en) * | 1967-06-26 | 1970-09-22 | Procter & Gamble | Scouring cleanser containing chlorinated trisodium phosphate stabilized against loss of bleaching effectiveness with borax |
| US3558496A (en) * | 1967-11-13 | 1971-01-26 | Barney Joseph Zmoda | Thickened liquid bleach and process for preparing same |
| US3716488A (en) * | 1970-09-04 | 1973-02-13 | Stevens & Co Inc J P | Textile fabric cleaning compositions |
| US3702826A (en) * | 1971-01-25 | 1972-11-14 | Colgate Palmolive Co | Scouring cleanser |
| US3715314A (en) * | 1971-04-02 | 1973-02-06 | Procter & Gamble | Scouring cleanser composition |
-
1974
- 1974-04-17 GB GB16814/74A patent/GB1495549A/en not_active Expired
- 1974-09-09 US US05/504,218 patent/US3985668A/en not_active Expired - Lifetime
-
1975
- 1975-04-01 CA CA223,481A patent/CA1041307A/en not_active Expired
- 1975-04-12 DE DE2516003A patent/DE2516003C2/de not_active Expired
- 1975-04-16 BE BE155450A patent/BE827991A/xx not_active IP Right Cessation
- 1975-04-16 NL NLAANVRAGE7504507,A patent/NL185784C/xx not_active IP Right Cessation
- 1975-04-16 FR FR7511815A patent/FR2268071B1/fr not_active Expired
- 1975-04-17 JP JP50046938A patent/JPS593517B2/ja not_active Expired
- 1975-04-17 IT IT22455/75A patent/IT1037342B/it active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5190693A (en) * | 1988-07-29 | 1993-03-02 | Ausidet S.P.A. | Stable aqueous suspensions of inorganic silica-based materials insoluble in water |
Also Published As
| Publication number | Publication date |
|---|---|
| AU8019775A (en) | 1976-10-21 |
| NL185784B (nl) | 1990-02-16 |
| BE827991A (fr) | 1975-10-16 |
| FR2268071A1 (OSRAM) | 1975-11-14 |
| NL7504507A (nl) | 1975-10-21 |
| DE2516003A1 (de) | 1975-11-06 |
| IT1037342B (it) | 1979-11-10 |
| US3985668A (en) | 1976-10-12 |
| JPS5116308A (OSRAM) | 1976-02-09 |
| GB1495549A (en) | 1977-12-21 |
| NL185784C (nl) | 1990-07-16 |
| JPS593517B2 (ja) | 1984-01-24 |
| FR2268071B1 (OSRAM) | 1979-03-23 |
| DE2516003C2 (de) | 1983-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1041307A (en) | Scouring compositions | |
| US4005027A (en) | Scouring compositions | |
| US4051056A (en) | Abrasive scouring compositions | |
| US4657692A (en) | Thickened aqueous abrasive scouring cleanser | |
| CA1123700A (en) | Thixotropic abrasive liquid scouring composition | |
| AU721818B2 (en) | A thickened aqueous cleaning composition and methods of preparation thereof and cleaning therewith | |
| US4116851A (en) | Thickened bleach compositions for treating hard-to-remove soils | |
| US4235732A (en) | Liquid bleaching compositions | |
| US4695394A (en) | Thickened aqueous cleanser | |
| US4599186A (en) | Thickened aqueous abrasive scouring cleanser | |
| CA1095802A (en) | Cleansing composition | |
| CA1222426A (en) | Thixotropic automatic dishwasher composition with chlorine bleach | |
| CA1322707C (en) | Liquid automatic dishwashing compositions providing silver protection | |
| CA2009051C (en) | Liquid automatic dishwashing compositions providing glassware protection | |
| FI66902C (fi) | Stabila detergentsuspensioner i vaetskeform | |
| US4740327A (en) | Automatic dishwasher detergent compositions with chlorine bleach having thixotropic properties | |
| US4248728A (en) | Liquid scouring cleanser | |
| US5346641A (en) | Thickened aqueous abrasive cleanser with improved colloidal stability | |
| US5279755A (en) | Thickening aqueous abrasive cleaner with improved colloidal stability | |
| US5376297A (en) | Thickened pourable aqueous cleaner | |
| US4824590A (en) | Thickened aqueous compositions with suspended solids | |
| IE41793B1 (en) | Abrasive scouring compositions | |
| US5298181A (en) | Thickened pourable aqueous abrasive cleanser | |
| DE2739776A1 (de) | Reinigungsmittel | |
| AU606130B2 (en) | Thixotropic clay aqueous suspensions |