CA1038393A - 2,5 or 2,6 disubstituted benzoxazoles - Google Patents
2,5 or 2,6 disubstituted benzoxazolesInfo
- Publication number
- CA1038393A CA1038393A CA212,029A CA212029A CA1038393A CA 1038393 A CA1038393 A CA 1038393A CA 212029 A CA212029 A CA 212029A CA 1038393 A CA1038393 A CA 1038393A
- Authority
- CA
- Canada
- Prior art keywords
- benzoxazolyl
- group
- acid
- formula
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 2,6 disubstituted benzoxazoles Chemical class 0.000 title claims abstract description 50
- 150000001875 compounds Chemical class 0.000 claims abstract description 78
- 239000001257 hydrogen Substances 0.000 claims abstract description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 24
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 21
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 12
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 8
- 239000003513 alkali Substances 0.000 claims abstract description 7
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 7
- 239000004411 aluminium Substances 0.000 claims abstract description 7
- 150000003863 ammonium salts Chemical class 0.000 claims abstract description 7
- 150000001342 alkaline earth metals Chemical class 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 125000000355 1,3-benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims abstract description 5
- 238000004519 manufacturing process Methods 0.000 claims abstract description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims abstract 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 3
- 239000002253 acid Substances 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 150000002367 halogens Chemical class 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 17
- 150000002148 esters Chemical class 0.000 claims description 13
- 150000002825 nitriles Chemical class 0.000 claims description 12
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 claims description 6
- 125000003368 amide group Chemical group 0.000 claims description 4
- 150000007942 carboxylates Chemical class 0.000 claims description 3
- 230000003301 hydrolyzing effect Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 230000000202 analgesic effect Effects 0.000 abstract description 2
- 230000003110 anti-inflammatory effect Effects 0.000 abstract description 2
- 230000001754 anti-pyretic effect Effects 0.000 abstract description 2
- 239000002221 antipyretic Substances 0.000 abstract description 2
- 230000000144 pharmacologic effect Effects 0.000 abstract 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 67
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 65
- 239000000243 solution Substances 0.000 description 60
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- 235000019260 propionic acid Nutrition 0.000 description 33
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 33
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 31
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- 239000000460 chlorine Substances 0.000 description 28
- 229960000583 acetic acid Drugs 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- 239000003814 drug Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 15
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 150000007513 acids Chemical class 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 235000011152 sodium sulphate Nutrition 0.000 description 10
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 238000004611 spectroscopical analysis Methods 0.000 description 8
- 238000004809 thin layer chromatography Methods 0.000 description 8
- BOONELLSRPCNSI-UHFFFAOYSA-N 2-[2-(n,4-dimethylanilino)-1,3-benzoxazol-6-yl]acetonitrile Chemical compound N=1C2=CC=C(CC#N)C=C2OC=1N(C)C1=CC=C(C)C=C1 BOONELLSRPCNSI-UHFFFAOYSA-N 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 238000004452 microanalysis Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 150000003839 salts Chemical group 0.000 description 6
- YXPLYVSMCTWJGJ-UHFFFAOYSA-N 2-[2-(3,4-dichlorobenzoyl)-1,3-benzoxazol-6-yl]acetic acid Chemical compound O1C2=CC(CC(=O)O)=CC=C2N=C1C(=O)C1=CC=C(Cl)C(Cl)=C1 YXPLYVSMCTWJGJ-UHFFFAOYSA-N 0.000 description 5
- WPXXLWWSAMQJHS-UHFFFAOYSA-N 2-[2-(4-chloroanilino)-1,3-benzoxazol-6-yl]acetonitrile Chemical compound C1=CC(Cl)=CC=C1NC1=NC2=CC=C(CC#N)C=C2O1 WPXXLWWSAMQJHS-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 241001061127 Thione Species 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- PJIFSZJAHFQVCC-UHFFFAOYSA-N 2-[2-(3,4-dichloro-n-methylanilino)-1,3-benzoxazol-5-yl]propanoic acid Chemical compound N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1N(C)C1=CC=C(Cl)C(Cl)=C1 PJIFSZJAHFQVCC-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 4
- 125000002560 nitrile group Chemical group 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- KIMKZFGTFZBTGC-UHFFFAOYSA-N 2-[2-(4-chloroanilino)-1,3-benzoxazol-5-yl]propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1NC1=CC=C(Cl)C=C1 KIMKZFGTFZBTGC-UHFFFAOYSA-N 0.000 description 3
- AQNDUWWLRWWNOP-UHFFFAOYSA-N 2-[2-(N-acetyl-4-chloroanilino)-1,3-benzoxazol-5-yl]propanoic acid Chemical compound C(C)(=O)N(C1=CC=C(C=C1)Cl)C=1OC2=C(N=1)C=C(C=C2)C(C(=O)O)C AQNDUWWLRWWNOP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 241000219161 Theobroma Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 235000010443 alginic acid Nutrition 0.000 description 3
- 229920000615 alginic acid Polymers 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- LPHWCEHIGYXCSG-UHFFFAOYSA-N ethyl 2-(3-amino-4-hydroxyphenyl)propanoate Chemical compound CCOC(=O)C(C)C1=CC=C(O)C(N)=C1 LPHWCEHIGYXCSG-UHFFFAOYSA-N 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000783 alginic acid Substances 0.000 description 2
- 229960001126 alginic acid Drugs 0.000 description 2
- 150000004781 alginic acids Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001408 amides Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- RODGVMGQEZEYOS-UHFFFAOYSA-N ethyl 2-(2-benzyl-1,3-benzoxazol-5-yl)propanoate Chemical compound N=1C2=CC(C(C)C(=O)OCC)=CC=C2OC=1CC1=CC=CC=C1 RODGVMGQEZEYOS-UHFFFAOYSA-N 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 229960002510 mandelic acid Drugs 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JAUFWTSSYRTLLB-UHFFFAOYSA-N (2-phenylacetyl) 2-phenylacetate Chemical compound C=1C=CC=CC=1CC(=O)OC(=O)CC1=CC=CC=C1 JAUFWTSSYRTLLB-UHFFFAOYSA-N 0.000 description 1
- DKSZLDSPXIWGFO-BLOJGBSASA-N (4r,4ar,7s,7ar,12bs)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol;phosphoric acid;hydrate Chemical compound O.OP(O)(O)=O.OP(O)(O)=O.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC DKSZLDSPXIWGFO-BLOJGBSASA-N 0.000 description 1
- ADAKRBAJFHTIEW-UHFFFAOYSA-N 1-chloro-4-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C=C1 ADAKRBAJFHTIEW-UHFFFAOYSA-N 0.000 description 1
- SRYDRKGAHRUWHF-UHFFFAOYSA-N 2,2-dibromo-2-[2-[hydroxy-(4-methylphenyl)methyl]-1,3-benzoxazol-6-yl]acetic acid Chemical compound OC(C1=CC=C(C=C1)C)C=1OC2=C(N=1)C=CC(=C2)C(C(=O)O)(Br)Br SRYDRKGAHRUWHF-UHFFFAOYSA-N 0.000 description 1
- CTXJCWPZFJERJQ-UHFFFAOYSA-N 2-(2-anilino-1,3-benzoxazol-5-yl)propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1NC1=CC=CC=C1 CTXJCWPZFJERJQ-UHFFFAOYSA-N 0.000 description 1
- UZJJCNPILXLBSC-UHFFFAOYSA-N 2-(2-anilino-1,3-benzoxazol-6-yl)propanoic acid Chemical compound O1C2=CC(C(C(O)=O)C)=CC=C2N=C1NC1=CC=CC=C1 UZJJCNPILXLBSC-UHFFFAOYSA-N 0.000 description 1
- KYAPWYOIHFNMBF-UHFFFAOYSA-N 2-(2-benzoyl-1,3-benzoxazol-5-yl)propanoic acid Chemical compound N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C(=O)C1=CC=CC=C1 KYAPWYOIHFNMBF-UHFFFAOYSA-N 0.000 description 1
- KNAGZWWACYZRCH-UHFFFAOYSA-N 2-(2-benzyl-1,3-benzoxazol-5-yl)propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1CC1=CC=CC=C1 KNAGZWWACYZRCH-UHFFFAOYSA-N 0.000 description 1
- AWCHMDSSMSKFFJ-UHFFFAOYSA-N 2-(2-benzyl-1,3-benzoxazol-5-yl)propanoic acid Chemical compound N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1CC1=CC=CC=C1 AWCHMDSSMSKFFJ-UHFFFAOYSA-N 0.000 description 1
- YOCRMABISPGUSN-UHFFFAOYSA-N 2-(3-amino-4-hydroxyphenyl)propanenitrile Chemical compound N#CC(C)C1=CC=C(O)C(N)=C1 YOCRMABISPGUSN-UHFFFAOYSA-N 0.000 description 1
- ZBRNHUSCZGYNLG-UHFFFAOYSA-N 2-(3-amino-4-hydroxyphenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(O)C(N)=C1 ZBRNHUSCZGYNLG-UHFFFAOYSA-N 0.000 description 1
- BWSFWXSSALIZAU-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-hydroxyacetic acid Chemical compound OC(=O)C(O)C1=CC=C(Cl)C=C1 BWSFWXSSALIZAU-UHFFFAOYSA-N 0.000 description 1
- UMQUIRYNOVNYPA-UHFFFAOYSA-N 2-(4-chlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(Cl)C=C1 UMQUIRYNOVNYPA-UHFFFAOYSA-N 0.000 description 1
- MGKPFALCNDRSQD-UHFFFAOYSA-N 2-(4-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(F)C=C1 MGKPFALCNDRSQD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- DQSKJJPZUORSPK-UHFFFAOYSA-N 2-[2-(2,4-dichloroanilino)-1,3-benzoxazol-6-yl]propanoic acid Chemical compound O1C2=CC(C(C(O)=O)C)=CC=C2N=C1NC1=CC=C(Cl)C=C1Cl DQSKJJPZUORSPK-UHFFFAOYSA-N 0.000 description 1
- DFOXVKJPUOHUCQ-UHFFFAOYSA-N 2-[2-(3,4-dichloro-n-methylanilino)-1,3-benzoxazol-5-yl]propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1N(C)C1=CC=C(Cl)C(Cl)=C1 DFOXVKJPUOHUCQ-UHFFFAOYSA-N 0.000 description 1
- FPXIPKUJPIUKBP-UHFFFAOYSA-N 2-[2-(4-bromo-n-methylanilino)-1,3-benzoxazol-5-yl]acetic acid Chemical compound N=1C2=CC(CC(O)=O)=CC=C2OC=1N(C)C1=CC=C(Br)C=C1 FPXIPKUJPIUKBP-UHFFFAOYSA-N 0.000 description 1
- AQHPRIXLILPJNV-UHFFFAOYSA-N 2-[2-(4-chloroanilino)-1,3-benzoxazol-5-yl]propanoic acid Chemical compound N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1NC1=CC=C(Cl)C=C1 AQHPRIXLILPJNV-UHFFFAOYSA-N 0.000 description 1
- INMKXNSLWGREKY-UHFFFAOYSA-N 2-[2-(4-chloroanilino)-1,3-benzoxazol-6-yl]acetic acid Chemical compound O1C2=CC(CC(=O)O)=CC=C2N=C1NC1=CC=C(Cl)C=C1 INMKXNSLWGREKY-UHFFFAOYSA-N 0.000 description 1
- OGUITJKGBOXFNH-UHFFFAOYSA-N 2-[2-(4-chlorobenzoyl)-1,3-benzoxazol-5-yl]acetic acid Chemical compound ClC1=CC=C(C(=O)C=2OC3=C(N2)C=C(C=C3)CC(=O)O)C=C1 OGUITJKGBOXFNH-UHFFFAOYSA-N 0.000 description 1
- GCXVRFVWSSFJNT-UHFFFAOYSA-N 2-[2-(4-hydroxyanilino)-1,3-benzoxazol-6-yl]propanoic acid Chemical compound OC1=CC=C(NC=2OC3=C(N2)C=CC(=C3)C(C(=O)O)C)C=C1 GCXVRFVWSSFJNT-UHFFFAOYSA-N 0.000 description 1
- CXSHWTOGQGBRJL-UHFFFAOYSA-N 2-[2-(4-methoxyanilino)-1,3-benzoxazol-6-yl]propanenitrile Chemical compound C1=CC(OC)=CC=C1NC1=NC2=CC=C(C(C)C#N)C=C2O1 CXSHWTOGQGBRJL-UHFFFAOYSA-N 0.000 description 1
- ALIALYTURIZGQC-UHFFFAOYSA-N 2-[2-(4-methoxyanilino)-1,3-benzoxazol-6-yl]propanoic acid Chemical compound C1=CC(OC)=CC=C1NC1=NC2=CC=C(C(C)C(O)=O)C=C2O1 ALIALYTURIZGQC-UHFFFAOYSA-N 0.000 description 1
- RMRCXLUCIIXYEE-UHFFFAOYSA-N 2-[2-(n,4-dimethylanilino)-1,3-benzoxazol-6-yl]acetic acid Chemical compound N=1C2=CC=C(CC(O)=O)C=C2OC=1N(C)C1=CC=C(C)C=C1 RMRCXLUCIIXYEE-UHFFFAOYSA-N 0.000 description 1
- VKZNOMXDDVJEPG-UHFFFAOYSA-N 2-[2-(n-methylanilino)-1,3-benzoxazol-5-yl]propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1N(C)C1=CC=CC=C1 VKZNOMXDDVJEPG-UHFFFAOYSA-N 0.000 description 1
- XBAPHTXXTYLAOZ-UHFFFAOYSA-N 2-[2-[(3,4-dichlorophenyl)methyl]-1,3-benzoxazol-5-yl]propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1CC1=CC=C(Cl)C(Cl)=C1 XBAPHTXXTYLAOZ-UHFFFAOYSA-N 0.000 description 1
- PGZXQFOYAPOTSX-UHFFFAOYSA-N 2-[2-[(4-chlorophenyl)-ethoxymethyl]-1,3-benzoxazol-5-yl]-2-ethoxypropanoic acid Chemical compound C(C)OC(C1=CC=C(C=C1)Cl)C=1OC2=C(N=1)C=C(C=C2)C(C(=O)O)(C)OCC PGZXQFOYAPOTSX-UHFFFAOYSA-N 0.000 description 1
- PTDSQLPYMDJORU-UHFFFAOYSA-N 2-[2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-5-yl]acetonitrile Chemical compound C1=CC(Cl)=CC=C1CC1=NC2=CC(CC#N)=CC=C2O1 PTDSQLPYMDJORU-UHFFFAOYSA-N 0.000 description 1
- QNNIVSSTTRQVJT-UHFFFAOYSA-N 2-[2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-5-yl]propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1CC1=CC=C(Cl)C=C1 QNNIVSSTTRQVJT-UHFFFAOYSA-N 0.000 description 1
- QFSXTVCZSDAFQQ-UHFFFAOYSA-N 2-[2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-6-yl]acetonitrile Chemical compound C1=CC(Cl)=CC=C1CC1=NC2=CC=C(CC#N)C=C2O1 QFSXTVCZSDAFQQ-UHFFFAOYSA-N 0.000 description 1
- OUBLHFUOPJUISY-UHFFFAOYSA-N 2-[2-[(4-chlorophenyl)methyl]-1,3-benzoxazol-6-yl]propanoic acid Chemical compound O1C2=CC(C(C(O)=O)C)=CC=C2N=C1CC1=CC=C(Cl)C=C1 OUBLHFUOPJUISY-UHFFFAOYSA-N 0.000 description 1
- OGUMRZPVOQKESW-UHFFFAOYSA-N 2-[2-[(4-fluorophenyl)methyl]-1,3-benzoxazol-5-yl]propanenitrile Chemical compound N=1C2=CC(C(C#N)C)=CC=C2OC=1CC1=CC=C(F)C=C1 OGUMRZPVOQKESW-UHFFFAOYSA-N 0.000 description 1
- TZUYQALMQBGDRN-UHFFFAOYSA-N 2-[2-[4-(trifluoromethyl)benzoyl]-1,3-benzoxazol-5-yl]propanoic acid Chemical compound N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C(=O)C1=CC=C(C(F)(F)F)C=C1 TZUYQALMQBGDRN-UHFFFAOYSA-N 0.000 description 1
- BBVQDWDBTWSGHQ-UHFFFAOYSA-N 2-chloro-1,3-benzoxazole Chemical compound C1=CC=C2OC(Cl)=NC2=C1 BBVQDWDBTWSGHQ-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical class C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- SRBFZHDQGSBBOR-HWQSCIPKSA-N L-arabinopyranose Chemical compound O[C@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-HWQSCIPKSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241000288147 Meleagris gallopavo Species 0.000 description 1
- SOWBFZRMHSNYGE-UHFFFAOYSA-N Monoamide-Oxalic acid Natural products NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 1
- TZFAIDWFLGZQGR-UHFFFAOYSA-N N-(4-chlorophenyl)-N-[5-(1-cyanoethyl)-1,3-benzoxazol-2-yl]acetamide Chemical compound C(C)(=O)N(C1=CC=C(C=C1)Cl)C=1OC2=C(N=1)C=C(C=C2)C(C#N)C TZFAIDWFLGZQGR-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 229920001938 Vegetable gum Polymers 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- IBUOZTOZUCMCHZ-UHFFFAOYSA-N acetic acid 2-(2-benzyl-1,3-benzoxazol-5-yl)propanoic acid Chemical compound C(C1=CC=CC=C1)C=1OC2=C(N1)C=C(C=C2)C(C(=O)O)C.C(C)(=O)O IBUOZTOZUCMCHZ-UHFFFAOYSA-N 0.000 description 1
- RRUDCFGSUDOHDG-UHFFFAOYSA-N acetohydroxamic acid Chemical class CC(O)=NO RRUDCFGSUDOHDG-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910021502 aluminium hydroxide Inorganic materials 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- UAZDIGCOBKKMPU-UHFFFAOYSA-O azanium;azide Chemical compound [NH4+].[N-]=[N+]=[N-] UAZDIGCOBKKMPU-UHFFFAOYSA-O 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical class CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 150000008363 butyronitriles Chemical class 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 229960001714 calcium phosphate Drugs 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229960004415 codeine phosphate Drugs 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- XLMALTXPSGQGBX-GCJKJVERSA-N dextropropoxyphene Chemical compound C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 XLMALTXPSGQGBX-GCJKJVERSA-N 0.000 description 1
- 229960004193 dextropropoxyphene Drugs 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- AUPFUMIGGADXGA-UHFFFAOYSA-N ethyl 2-(2-sulfanylidene-3h-1,3-benzoxazol-5-yl)propanoate Chemical compound CCOC(=O)C(C)C1=CC=C2OC(=S)NC2=C1 AUPFUMIGGADXGA-UHFFFAOYSA-N 0.000 description 1
- BIRABQONGBPLBL-UHFFFAOYSA-N ethyl 2-[2-(4-chloroanilino)-1,3-benzoxazol-5-yl]propanoate Chemical compound N=1C2=CC(C(C)C(=O)OCC)=CC=C2OC=1NC1=CC=C(Cl)C=C1 BIRABQONGBPLBL-UHFFFAOYSA-N 0.000 description 1
- CCROZTTVYZOJGI-UHFFFAOYSA-N ethyl 2-[2-[(4-chlorophenyl)-hydroxymethyl]-1,3-benzoxazol-6-yl]propanoate Chemical compound O1C2=CC(C(C)C(=O)OCC)=CC=C2N=C1C(O)C1=CC=C(Cl)C=C1 CCROZTTVYZOJGI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical group COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- UOQQYQILJGCDCO-UHFFFAOYSA-N n-[5-(1-cyanoethyl)-2-hydroxyphenyl]-2-phenylacetamide Chemical compound N#CC(C)C1=CC=C(O)C(NC(=O)CC=2C=CC=CC=2)=C1 UOQQYQILJGCDCO-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 229940060184 oil ingredients Drugs 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229960005489 paracetamol Drugs 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical class CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000003573 thiols Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
- 239000012178 vegetable wax Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB49260/73A GB1491863A (en) | 1973-10-23 | 1973-10-23 | 2,5-or 2,6-disubstituted benzoxazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1038393A true CA1038393A (en) | 1978-09-12 |
Family
ID=10451725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA212,029A Expired CA1038393A (en) | 1973-10-23 | 1974-10-22 | 2,5 or 2,6 disubstituted benzoxazoles |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS5070362A (forum.php) |
| AR (2) | AR207232A1 (forum.php) |
| AT (1) | AT341519B (forum.php) |
| BE (1) | BE821350A (forum.php) |
| BG (1) | BG26197A3 (forum.php) |
| CA (1) | CA1038393A (forum.php) |
| CH (1) | CH605863A5 (forum.php) |
| CS (1) | CS188927B2 (forum.php) |
| DD (1) | DD114609A5 (forum.php) |
| DE (1) | DE2450042A1 (forum.php) |
| DK (1) | DK552774A (forum.php) |
| FR (1) | FR2248039B1 (forum.php) |
| GB (1) | GB1491863A (forum.php) |
| HU (1) | HU170452B (forum.php) |
| IE (1) | IE40080B1 (forum.php) |
| IL (1) | IL45837A (forum.php) |
| NL (1) | NL7413788A (forum.php) |
| PL (1) | PL94057B1 (forum.php) |
| RO (1) | RO72841A (forum.php) |
| SE (1) | SE7413352L (forum.php) |
| SU (1) | SU577992A3 (forum.php) |
| ZA (1) | ZA746341B (forum.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5206255A (en) * | 1989-09-29 | 1993-04-27 | Mitsubishi Kasei Corporation | Heterocyclic compound |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1435721A (en) * | 1972-05-18 | 1976-05-12 | Lilly Industries Ltd | Benzoxazole derivatives |
| US3888864A (en) | 1973-06-29 | 1975-06-10 | Hoffmann La Roche | Amino lower alkyl ether derivatives of opium alkaloids |
| IT1099589B (it) * | 1978-08-04 | 1985-09-18 | Ravizza Spa | Processo per la preparazione di derivati dell'acido benzoxazolil propionico |
| IT1157295B (it) * | 1982-07-19 | 1987-02-11 | Ravizza Spa | Processo perfezionato per la preparazione di derivati dell'acido benzoxazolil propionico |
| DE102006021878A1 (de) * | 2006-05-11 | 2007-11-15 | Sanofi-Aventis | Phenylamino-benzoxazol substituierte Carbonsäuren, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
-
1973
- 1973-10-23 GB GB49260/73A patent/GB1491863A/en not_active Expired
-
1974
- 1974-01-01 AR AR256198A patent/AR207232A1/es active
- 1974-10-04 ZA ZA00746341A patent/ZA746341B/xx unknown
- 1974-10-11 IL IL45837A patent/IL45837A/xx unknown
- 1974-10-16 CS CS747094A patent/CS188927B2/cs unknown
- 1974-10-21 BG BG028005A patent/BG26197A3/xx unknown
- 1974-10-22 CA CA212,029A patent/CA1038393A/en not_active Expired
- 1974-10-22 DE DE19742450042 patent/DE2450042A1/de not_active Withdrawn
- 1974-10-22 NL NL7413788A patent/NL7413788A/xx not_active Application Discontinuation
- 1974-10-22 RO RO7480290A patent/RO72841A/ro unknown
- 1974-10-22 BE BE6044793A patent/BE821350A/xx unknown
- 1974-10-22 SU SU7402074061A patent/SU577992A3/ru active
- 1974-10-22 FR FR7435407A patent/FR2248039B1/fr not_active Expired
- 1974-10-22 IE IE2168/74A patent/IE40080B1/xx unknown
- 1974-10-22 CH CH1414374A patent/CH605863A5/xx not_active IP Right Cessation
- 1974-10-22 DK DK552774A patent/DK552774A/da unknown
- 1974-10-22 HU HULI265A patent/HU170452B/hu unknown
- 1974-10-22 AT AT849374A patent/AT341519B/de not_active IP Right Cessation
- 1974-10-23 JP JP49122355A patent/JPS5070362A/ja active Pending
- 1974-10-23 SE SE7413352A patent/SE7413352L/xx unknown
- 1974-10-23 PL PL1974175042A patent/PL94057B1/pl unknown
- 1974-10-23 DD DD181873A patent/DD114609A5/xx unknown
-
1975
- 1975-01-01 AR AR259897A patent/AR207369A1/es active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5206255A (en) * | 1989-09-29 | 1993-04-27 | Mitsubishi Kasei Corporation | Heterocyclic compound |
Also Published As
| Publication number | Publication date |
|---|---|
| AR207232A1 (es) | 1976-09-22 |
| AT341519B (de) | 1978-02-10 |
| JPS5070362A (forum.php) | 1975-06-11 |
| ATA849374A (de) | 1977-06-15 |
| AU7454674A (en) | 1976-04-29 |
| PL94057B1 (forum.php) | 1977-07-30 |
| DE2450042A1 (de) | 1975-04-24 |
| ZA746341B (en) | 1976-06-30 |
| CH605863A5 (forum.php) | 1978-10-13 |
| AR207369A1 (es) | 1976-09-30 |
| SE7413352L (forum.php) | 1975-04-24 |
| FR2248039A1 (forum.php) | 1975-05-16 |
| FR2248039B1 (forum.php) | 1978-07-28 |
| IL45837A (en) | 1978-03-10 |
| DK552774A (forum.php) | 1975-06-16 |
| BE821350A (fr) | 1975-04-22 |
| GB1491863A (en) | 1977-11-16 |
| IE40080L (en) | 1975-04-23 |
| NL7413788A (nl) | 1975-04-25 |
| IE40080B1 (en) | 1979-03-14 |
| IL45837A0 (en) | 1974-12-31 |
| CS188927B2 (en) | 1979-03-30 |
| HU170452B (forum.php) | 1977-06-28 |
| BG26197A3 (bg) | 1979-02-15 |
| DD114609A5 (forum.php) | 1975-08-12 |
| RO72841A (ro) | 1982-05-10 |
| SU577992A3 (ru) | 1977-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4025637A (en) | 2,5 OR 2,6 Disubstituted benzoxazoles | |
| US3912748A (en) | Benzoxazole derivatives | |
| US4233299A (en) | 4-Hydroxy-2H-1,2-benzothiazine-3-carboxamide-1,1-dioxides and salts thereof | |
| US4126635A (en) | 2-amino-3-(5- and 6-)benzoylphenylacetic acids, esters and metal salts thereof | |
| US4083980A (en) | Derivatives of quinazolone | |
| JPH05507084A (ja) | アルコキシ―置換ジヒドロベンゾピラン―2―カルボン酸およびそれらの誘導体 | |
| JPH0390071A (ja) | 新規化合物、その製法及びそれを含む医薬組成物 | |
| US4476137A (en) | [1-(2-Benzoxazolyl)hydrazino]alkyl nitrile derivatives | |
| US4025636A (en) | 2-(Optionally substituted)phenyl-5 or 6-substituted benzoxazoles | |
| JP2003528096A (ja) | デカヒドロ−イソキノリン | |
| JPS63502031A (ja) | ヒドロキシおよびアミノチオゾリル−ベンゾジアジノン化合物、これを含む強心性組成物、およびその使用 | |
| CA1038393A (en) | 2,5 or 2,6 disubstituted benzoxazoles | |
| US3962452A (en) | Benzoxazole derivatives as therapeutics | |
| US3947449A (en) | Tetrahydroacridones having chemotherapeutic action and process for preparing them | |
| US4822811A (en) | Carbazole lipoxygenase inhibiting compounds, compositions and use | |
| FI96951B (fi) | Menetelmä terapeuttisesti käyttökelpoisten substituoitujen sulfonamidien ja läheisten yhdisteiden valmistamiseksi | |
| JPH01110682A (ja) | 抗アレルギー性活性を有する新規ベンゾチオフエン | |
| JPS6344572A (ja) | 抗不整脈剤 | |
| JPS609716B2 (ja) | 1,2―ベンズインチアゾリン―3―オン類、それらの製造法および医薬としての使用 | |
| US3816443A (en) | 4-(benzothiazol-2-yl)fluoro phenyl-acetic acids | |
| US5900426A (en) | Benzothiazole derivatives | |
| US4897423A (en) | Dinitrobenzenesulfonamides | |
| EP0592664A1 (en) | Novel diphenylthyazole derivative | |
| US4100168A (en) | 2,5 OR 2,6-Disubstituted benzoxazoles | |
| JPH02160A (ja) | アルコキシ基もしくはベンジルオキシ基またはベンジルチオ基で置換されたジーt‐ブチルフェノール |