BG26394A3 - Метод за получаване на цефалоспорини - Google Patents
Метод за получаване на цефалоспориниInfo
- Publication number
- BG26394A3 BG26394A3 BG028956A BG2895675A BG26394A3 BG 26394 A3 BG26394 A3 BG 26394A3 BG 028956 A BG028956 A BG 028956A BG 2895675 A BG2895675 A BG 2895675A BG 26394 A3 BG26394 A3 BG 26394A3
- Authority
- BG
- Bulgaria
- Prior art keywords
- cephalosporins
- obtaining
- obtaining cephalosporins
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/38—One oxygen atom with acyl radicals or hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2407715A DE2407715C2 (de) | 1974-02-18 | 1974-02-18 | Cephalosporine, Verfahren zu ihrer Herstellung sowie Arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BG26394A3 true BG26394A3 (bg) | 1979-03-15 |
Family
ID=5907728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG028956A BG26394A3 (bg) | 1974-02-18 | 1975-02-12 | Метод за получаване на цефалоспорини |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS50116489A (enExample) |
| AR (1) | AR207586A1 (enExample) |
| AT (1) | AT334533B (enExample) |
| BE (1) | BE825623A (enExample) |
| BG (1) | BG26394A3 (enExample) |
| DD (1) | DD118649A5 (enExample) |
| DE (1) | DE2407715C2 (enExample) |
| DK (1) | DK57275A (enExample) |
| EG (1) | EG11586A (enExample) |
| ES (1) | ES434797A1 (enExample) |
| FI (1) | FI750417A7 (enExample) |
| FR (1) | FR2261010B1 (enExample) |
| GB (1) | GB1476905A (enExample) |
| HU (1) | HU168594B (enExample) |
| IL (1) | IL46631A0 (enExample) |
| LU (1) | LU71860A1 (enExample) |
| NL (1) | NL7501914A (enExample) |
| NO (1) | NO750351L (enExample) |
| PL (1) | PL98594B1 (enExample) |
| RO (1) | RO66018A (enExample) |
| SE (1) | SE7501719L (enExample) |
| SU (1) | SU544376A3 (enExample) |
| ZA (1) | ZA75965B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2525541C2 (de) * | 1975-06-07 | 1984-01-12 | Bayer Ag, 5090 Leverkusen | β-Lactam-Antibiotica, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
| DE2528079A1 (de) * | 1975-06-24 | 1977-01-20 | Bayer Ag | Penicilline, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2528077A1 (de) * | 1975-06-24 | 1977-01-20 | Bayer Ag | Beta-lactamantibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| CH624958A5 (en) * | 1975-06-24 | 1981-08-31 | Bayer Ag | Process for the preparation of beta-lactam compounds |
| FR2362146A1 (fr) * | 1976-08-17 | 1978-03-17 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 7-(n-substitue-2-phenylglycinamido)-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus, a activite antibacterienne |
| DE2658906A1 (de) * | 1976-12-24 | 1978-07-06 | Bayer Ag | Beta-lactam-antibiotika, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| JPS545974A (en) * | 1977-06-16 | 1979-01-17 | Ajinomoto Co Inc | Imidazoledicaroboxylic acid derivatives |
| DE2810083A1 (de) | 1978-03-08 | 1979-09-20 | Bayer Ag | Beta-lactam-verbindungen |
| EP0015240A1 (de) * | 1979-02-16 | 1980-09-03 | Ciba-Geigy Ag | Azacyclyl (thio) ureidoacetyl-Verbindungen und Verfahren zu ihrer Herstellung |
| US4464366A (en) * | 1979-12-19 | 1984-08-07 | Ciba Geigy Corporation | Cephem compounds having a terminal aminocarboxylic acid grouping and containing an azacyclyl(thio)ureido group |
| CN114552015B (zh) * | 2022-02-25 | 2024-04-05 | 珠海市赛纬电子材料股份有限公司 | 电解液添加剂、锂离子电池电解液及锂离子电池 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| DE2104580C3 (de) * | 1971-02-01 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | Acylureidopenicilline |
| BE786271A (fr) * | 1971-07-17 | 1973-01-15 | Takeda Chemical Industries Ltd | Cephalosporines |
| BE790440A (enExample) * | 1971-10-23 | 1973-04-24 | Bayer Ag |
-
1974
- 1974-02-18 DE DE2407715A patent/DE2407715C2/de not_active Expired
-
1975
- 1975-01-01 AR AR257669A patent/AR207586A1/es active
- 1975-02-04 NO NO750351A patent/NO750351L/no unknown
- 1975-02-12 BG BG028956A patent/BG26394A3/xx unknown
- 1975-02-14 FI FI750417A patent/FI750417A7/fi not_active Application Discontinuation
- 1975-02-14 IL IL7546631A patent/IL46631A0/xx unknown
- 1975-02-14 SU SU2105526A patent/SU544376A3/ru active
- 1975-02-15 PL PL1975178088A patent/PL98594B1/pl unknown
- 1975-02-15 EG EG64/75A patent/EG11586A/xx active
- 1975-02-17 GB GB658675A patent/GB1476905A/en not_active Expired
- 1975-02-17 ZA ZA00750965A patent/ZA75965B/xx unknown
- 1975-02-17 ES ES434797A patent/ES434797A1/es not_active Expired
- 1975-02-17 DD DD184251A patent/DD118649A5/xx unknown
- 1975-02-17 LU LU71860A patent/LU71860A1/xx unknown
- 1975-02-17 SE SE7501719A patent/SE7501719L/xx unknown
- 1975-02-17 JP JP50018955A patent/JPS50116489A/ja active Pending
- 1975-02-17 DK DK57275*#A patent/DK57275A/da unknown
- 1975-02-17 BE BE153428A patent/BE825623A/xx unknown
- 1975-02-18 AT AT118975A patent/AT334533B/de not_active IP Right Cessation
- 1975-02-18 HU HUBA3208A patent/HU168594B/hu unknown
- 1975-02-18 NL NL7501914A patent/NL7501914A/xx not_active Application Discontinuation
- 1975-02-18 FR FR7505043A patent/FR2261010B1/fr not_active Expired
- 1975-02-18 RO RO197581437A patent/RO66018A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7501914A (nl) | 1975-08-20 |
| JPS50116489A (enExample) | 1975-09-11 |
| EG11586A (en) | 1978-06-30 |
| AR207586A1 (es) | 1976-10-15 |
| ES434797A1 (es) | 1977-02-01 |
| IL46631A0 (en) | 1975-04-25 |
| LU71860A1 (enExample) | 1975-12-09 |
| ATA118975A (de) | 1976-05-15 |
| AT334533B (de) | 1976-01-25 |
| HU168594B (enExample) | 1976-06-28 |
| SU544376A3 (ru) | 1977-01-25 |
| GB1476905A (en) | 1977-06-16 |
| NO750351L (enExample) | 1975-08-19 |
| AU7820875A (en) | 1976-08-19 |
| RO66018A (fr) | 1980-01-15 |
| BE825623A (fr) | 1975-08-18 |
| PL98594B1 (pl) | 1978-05-31 |
| DK57275A (enExample) | 1975-10-20 |
| ZA75965B (en) | 1976-01-28 |
| SE7501719L (enExample) | 1975-08-19 |
| DE2407715A1 (de) | 1975-09-04 |
| FR2261010A1 (enExample) | 1975-09-12 |
| FR2261010B1 (enExample) | 1980-01-11 |
| DE2407715C2 (de) | 1982-12-02 |
| FI750417A7 (enExample) | 1975-08-19 |
| DD118649A5 (enExample) | 1976-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG23212A3 (bg) | Метод за получаване на арилоксифенилпропиламини | |
| BG24812A3 (en) | Method of obtaining 8-thiomethylergolins | |
| TR19139A (tr) | Laktatdehidrojenazenin izoenzimlerinin hepbirden tesbitine mahsus usul | |
| BG26537A3 (bg) | Метод за получаване на ацилуреидо субституирани цефалоспорини | |
| BG21414A3 (bg) | Метод за получаване на цефалоспорини | |
| BG26394A3 (bg) | Метод за получаване на цефалоспорини | |
| BG26395A3 (bg) | Метод за получаване на цефалоспорини | |
| BG26401A3 (bg) | Метод за поликондензация на захариди | |
| BG24539A3 (bg) | Метод за получаване на 1-етил- за- субституирани - фенил - декахидроизохинолини | |
| BG25091A3 (bg) | Метод за получаване на 7-ацилоамида-3-флуорцефалоспоринови съединения | |
| SE7513879L (sv) | Forfarande for syntes av karbamider | |
| SU538660A3 (ru) | Способ получени -трет.-бутиламинометил4-окси- -ксилол- -диола | |
| BG26364A3 (bg) | Метод за получаване на дихлорацетилхлорид | |
| BG27376A3 (en) | Method of obtaining of ureidesubstiputed cefalosporines | |
| PL193421A1 (pl) | Sposob wytwarzania nowych pochodnych chinazoliny | |
| SU484875A1 (ru) | Способ получени робинина | |
| SU531600A1 (ru) | Способ изготовлени змеевиков | |
| JPS512336A (ja) | Terebishingofugokahoshiki | |
| JPS5149490A (ja) | Heisetsusaretafukusujono of keeburuno kyuyuhoho | |
| BE824627R (fr) | Production de fibrilles | |
| SU500858A1 (ru) | Способ изготовлени корпусов банок | |
| SU521279A1 (ru) | Способ получени -непредельных -оксифосфонатов | |
| BG21402A3 (bg) | Метод за получаване на алфа-аминоацил-халоцефалоспорини | |
| SU526508A1 (ru) | Способ получени модифицированной древесины | |
| JPS5173272A (ja) | Gasuzetsuenkaiheisochinichotsuketsusuru of keeburunokyuyuhoshiki |