BE817127R - Acides bis-(triazinylamino)-stilbene sulfoniques utilisables comme azureurs optiques - Google Patents
Acides bis-(triazinylamino)-stilbene sulfoniques utilisables comme azureurs optiquesInfo
- Publication number
- BE817127R BE817127R BE146116A BE146116A BE817127R BE 817127 R BE817127 R BE 817127R BE 146116 A BE146116 A BE 146116A BE 146116 A BE146116 A BE 146116A BE 817127 R BE817127 R BE 817127R
- Authority
- BE
- Belgium
- Prior art keywords
- blasters
- triazinylamino
- bis
- optical
- acids used
- Prior art date
Links
- RWFZHFYWPYSEOZ-UHFFFAOYSA-N 1,2-diphenyl-N,N'-bis(triazin-4-yl)ethene-1,2-diamine Chemical compound N1=NN=C(C=C1)NC(=C(C1=CC=CC=C1)NC1=NN=NC=C1)C1=CC=CC=C1 RWFZHFYWPYSEOZ-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000007513 acids Chemical class 0.000 title 1
- 230000003287 optical effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH959973A CH583212A5 (show.php) | 1973-07-02 | 1973-07-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE817127R true BE817127R (fr) | 1975-01-02 |
Family
ID=4353655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE146116A BE817127R (fr) | 1973-07-02 | 1974-07-01 | Acides bis-(triazinylamino)-stilbene sulfoniques utilisables comme azureurs optiques |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4025507A (show.php) |
| JP (1) | JPS5721586B2 (show.php) |
| AR (1) | AR208669A1 (show.php) |
| BE (1) | BE817127R (show.php) |
| BR (1) | BR7405425D0 (show.php) |
| CA (1) | CA1037952A (show.php) |
| CH (1) | CH583212A5 (show.php) |
| CS (1) | CS171651B2 (show.php) |
| DD (1) | DD113004A6 (show.php) |
| DE (1) | DE2430624C3 (show.php) |
| ES (1) | ES427835A1 (show.php) |
| FR (1) | FR2235935B2 (show.php) |
| GB (1) | GB1471193A (show.php) |
| IN (1) | IN144190B (show.php) |
| IT (1) | IT1046310B (show.php) |
| NL (1) | NL160558C (show.php) |
| PL (1) | PL88865B1 (show.php) |
| ZA (1) | ZA744268B (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5873913A (en) * | 1994-06-23 | 1999-02-23 | Clariant Finance (Bvi) Limited | Optical brightening agents |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2700293A1 (de) * | 1977-01-05 | 1978-07-06 | Bayer Ag | Farbstofflaser |
| US4233167A (en) * | 1979-06-14 | 1980-11-11 | S. C. Johnson & Son, Inc. | Liquid detergent softening and brightening composition |
| DE3502038A1 (de) * | 1985-01-23 | 1986-07-24 | Sandoz-Patent-GmbH, 7850 Lörrach | Waessrige aufhellerpraeparate und deren verwendung im papierstrich |
| US5493022A (en) * | 1989-10-03 | 1996-02-20 | Sandoz Ltd. | Brightener and light stabilizer salts |
| GB9418958D0 (en) * | 1994-09-21 | 1994-11-09 | Ciba Geigy Ag | Fluorescent whitening agents |
| GB9813248D0 (en) | 1998-06-22 | 1998-08-19 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930177D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| DE102004038578A1 (de) * | 2004-08-06 | 2006-03-16 | Lanxess Deutschland Gmbh | Alkanolammoniumhaltige Triazinylflavonataufheller |
| CN100467090C (zh) * | 2005-11-04 | 2009-03-11 | 乔山健康科技股份有限公司 | 可调整踏板轨迹斜度的椭圆机 |
| ES2387941T7 (es) * | 2008-03-26 | 2018-04-20 | Archroma Ip Gmbh | Composiciones mejoradas de abrillantamiento óptico |
| CN107107645A (zh) | 2014-12-24 | 2017-08-29 | 惠普发展公司,有限责任合伙企业 | 涂布印刷介质 |
| US10166806B2 (en) | 2014-12-24 | 2019-01-01 | Hewlett-Packard Development Company, L.P. | Coated print medium |
| EP3237221B1 (en) | 2014-12-24 | 2021-09-08 | Hewlett-Packard Development Company, L.P. | Coated print medium |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL121058C (show.php) * | 1958-11-05 | |||
| US3479349A (en) * | 1967-08-03 | 1969-11-18 | Geigy Chem Corp | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| US3589921A (en) * | 1969-03-18 | 1971-06-29 | Geigy Chem Corp | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| CH522082A (de) | 1969-09-12 | 1972-04-30 | Sandoz Ag | Aufhellpräparat |
| CH529770A (de) * | 1969-12-11 | 1972-10-31 | Sandoz Ag | Verfahren zur Herstellung neuer Stilbenverbindungen |
| GB1350757A (en) * | 1970-05-18 | 1974-04-24 | Ici Ltd | Optical brightening agents |
| IT942451B (it) * | 1970-09-16 | 1973-03-20 | Sandoz Ag | Acidi bis traizinilamino stilbensolfonici |
| US3723425A (en) * | 1970-10-13 | 1973-03-27 | Ciba Geigy Corp | Brighteners of the bis-s-triazinylaminostilbene series |
-
1973
- 1973-07-02 CH CH959973A patent/CH583212A5/xx not_active IP Right Cessation
-
1974
- 1974-06-25 US US05/483,009 patent/US4025507A/en not_active Expired - Lifetime
- 1974-06-26 DE DE2430624A patent/DE2430624C3/de not_active Expired
- 1974-06-28 GB GB2893974A patent/GB1471193A/en not_active Expired
- 1974-06-28 NL NL7408774.A patent/NL160558C/xx active
- 1974-06-28 CA CA203,697A patent/CA1037952A/en not_active Expired
- 1974-07-01 ES ES74427835A patent/ES427835A1/es not_active Expired
- 1974-07-01 BR BR5425/74A patent/BR7405425D0/pt unknown
- 1974-07-01 BE BE146116A patent/BE817127R/xx not_active IP Right Cessation
- 1974-07-01 CS CS4625A patent/CS171651B2/cs unknown
- 1974-07-01 JP JP7438674A patent/JPS5721586B2/ja not_active Expired
- 1974-07-01 PL PL1974172370A patent/PL88865B1/pl unknown
- 1974-07-02 ZA ZA00744268A patent/ZA744268B/xx unknown
- 1974-07-02 IT IT51856/74A patent/IT1046310B/it active
- 1974-07-02 FR FR7422946A patent/FR2235935B2/fr not_active Expired
- 1974-07-02 DD DD179660A patent/DD113004A6/xx unknown
- 1974-07-10 AR AR254520A patent/AR208669A1/es active
-
1975
- 1975-06-26 IN IN1260/CAL/75A patent/IN144190B/en unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5873913A (en) * | 1994-06-23 | 1999-02-23 | Clariant Finance (Bvi) Limited | Optical brightening agents |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2430624B2 (de) | 1981-01-15 |
| DE2430624C3 (de) | 1981-08-27 |
| FR2235935A2 (show.php) | 1975-01-31 |
| AU7075874A (en) | 1976-01-08 |
| DD113004A6 (show.php) | 1975-05-12 |
| CS171651B2 (show.php) | 1976-10-29 |
| PL88865B1 (show.php) | 1976-10-30 |
| US4025507A (en) | 1977-05-24 |
| BR7405425D0 (pt) | 1975-03-25 |
| CA1037952A (en) | 1978-09-05 |
| GB1471193A (en) | 1977-04-21 |
| ZA744268B (en) | 1976-02-25 |
| JPS5721586B2 (show.php) | 1982-05-08 |
| DE2430624A1 (de) | 1975-01-23 |
| IN144190B (show.php) | 1978-04-01 |
| AR208669A1 (es) | 1977-02-28 |
| JPS5043126A (show.php) | 1975-04-18 |
| CH583212A5 (show.php) | 1976-12-31 |
| NL160558C (nl) | 1979-11-15 |
| ES427835A1 (es) | 1976-12-16 |
| IT1046310B (it) | 1980-06-30 |
| FR2235935B2 (show.php) | 1979-08-10 |
| NL7408774A (nl) | 1975-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE819737A (fr) | Pieces decoratives optiques | |
| BR7400037D0 (pt) | Leitor otico manual | |
| BE817127R (fr) | Acides bis-(triazinylamino)-stilbene sulfoniques utilisables comme azureurs optiques | |
| BE811137R (fr) | Acides bis-(triazinylamino)-stilbene-sulfoniques utilisables comme azureurs optiques | |
| BE820227A (fr) | Derives d'acides bis-(triazinylamino)-stilbene-disulfoniques utilisables comme azureurs optiques | |
| SE398675B (sv) | Forbindningsanordning for optiska fibrer | |
| AT341803B (de) | Steckverbindung fur lichtleitfasern | |
| BE772543A (fr) | Acides bis-(triazinylamino)-stilbene-sulfoniques utilisables comme azureurs optiques | |
| BE810853A (fr) | Benzofurannes utilisables comme azureurs optiques | |
| BE751417A (fr) | Composes triazolyl-styryliques utilisables comme azureurs optiques | |
| BE822300A (fr) | Lampe-eclair | |
| FR2343741A1 (fr) | Derives du stilbene utilisables comme azureurs optiques | |
| BE822301A (fr) | Lampe-eclair | |
| IT1012674B (it) | Procedimento per fabbricare fibre acriliche esenti da vuoti | |
| BE809708A (fr) | Application de derives du butadiene comme azureurs optiques | |
| BR7403801D0 (pt) | Processo para a producao das antipodas oticas da pantolactona | |
| BE787575A (fr) | Derives de benzofuranne utilisables comme azureurs optiques | |
| BR7402614D0 (pt) | Projetor optico | |
| BE765901A (fr) | Composes phenanthrotriazoliques utilisables comme azureurs optiques | |
| SU481871A1 (ru) | Способ оптической проекционной фотолитографии | |
| FR2319632A1 (fr) | Derives de la pyrazoline utilisables comme azureurs optiques | |
| AT351286B (de) | Mikroskop-objektiv | |
| FR2303013A1 (fr) | Composes benzofurannyl-oxadiazoliques utilisables comme azureurs optiques | |
| BR7403080D0 (pt) | Processo para a preparacao de etil xantato de sodio | |
| IT1022489B (it) | Ravvivanti ottici |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RE | Patent lapsed |
Owner name: S.A. SANDOZ Effective date: 19890930 |