AU649990B2 - Vulcanizable liquid compositions - Google Patents
Vulcanizable liquid compositions Download PDFInfo
- Publication number
- AU649990B2 AU649990B2 AU69338/91A AU6933891A AU649990B2 AU 649990 B2 AU649990 B2 AU 649990B2 AU 69338/91 A AU69338/91 A AU 69338/91A AU 6933891 A AU6933891 A AU 6933891A AU 649990 B2 AU649990 B2 AU 649990B2
- Authority
- AU
- Australia
- Prior art keywords
- block
- liquid
- copolymer
- blocks
- conjugated diene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000007788 liquid Substances 0.000 title claims description 58
- 239000000203 mixture Substances 0.000 title claims description 39
- 229920000642 polymer Polymers 0.000 claims abstract description 198
- 150000001993 dienes Chemical class 0.000 claims abstract description 168
- 229920001400 block copolymer Polymers 0.000 claims abstract description 77
- 229920001577 copolymer Polymers 0.000 claims abstract description 71
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims abstract description 70
- 238000000034 method Methods 0.000 claims abstract description 56
- 150000001336 alkenes Chemical class 0.000 claims abstract description 43
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims abstract description 35
- 229920005604 random copolymer Polymers 0.000 claims abstract description 35
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 13
- 238000005984 hydrogenation reaction Methods 0.000 claims description 101
- 229910052740 iodine Inorganic materials 0.000 claims description 53
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 40
- 239000011630 iodine Substances 0.000 claims description 40
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 34
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 230000008569 process Effects 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 30
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 28
- 238000004073 vulcanization Methods 0.000 claims description 22
- UAHWPYUMFXYFJY-UHFFFAOYSA-N beta-myrcene Chemical compound CC(C)=CCCC(=C)C=C UAHWPYUMFXYFJY-UHFFFAOYSA-N 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 125000000129 anionic group Chemical group 0.000 claims description 9
- VYBREYKSZAROCT-UHFFFAOYSA-N alpha-myrcene Natural products CC(=C)CCCC(=C)C=C VYBREYKSZAROCT-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 claims description 5
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 239000007822 coupling agent Substances 0.000 claims description 5
- 238000010168 coupling process Methods 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 claims description 5
- 239000005049 silicon tetrachloride Substances 0.000 claims description 5
- 125000001624 naphthyl group Chemical class 0.000 claims description 4
- 239000003921 oil Substances 0.000 claims description 4
- APPOKADJQUIAHP-GGWOSOGESA-N (2e,4e)-hexa-2,4-diene Chemical compound C\C=C\C=C\C APPOKADJQUIAHP-GGWOSOGESA-N 0.000 claims description 3
- AHAREKHAZNPPMI-AATRIKPKSA-N (3e)-hexa-1,3-diene Chemical compound CC\C=C\C=C AHAREKHAZNPPMI-AATRIKPKSA-N 0.000 claims description 3
- 230000008878 coupling Effects 0.000 claims description 3
- 238000005859 coupling reaction Methods 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- RMWHYWJWLBDARH-WJDMQLPWSA-N (2e,4e)-deca-2,4-diene Chemical compound CCCCC\C=C\C=C\C RMWHYWJWLBDARH-WJDMQLPWSA-N 0.000 claims description 2
- XTJLXXCARCJVPJ-TWTPFVCWSA-N (2e,4e)-hepta-2,4-diene Chemical compound CC\C=C\C=C\C XTJLXXCARCJVPJ-TWTPFVCWSA-N 0.000 claims description 2
- HKEBYUNPANBGPL-WJDMQLPWSA-N (2e,4e)-nona-2,4-diene Chemical compound CCCC\C=C\C=C\C HKEBYUNPANBGPL-WJDMQLPWSA-N 0.000 claims description 2
- YHHHHJCAVQSFMJ-FNORWQNLSA-N (3e)-deca-1,3-diene Chemical compound CCCCCC\C=C\C=C YHHHHJCAVQSFMJ-FNORWQNLSA-N 0.000 claims description 2
- OGQVROWWFUXRST-FNORWQNLSA-N (3e)-hepta-1,3-diene Chemical compound CCC\C=C\C=C OGQVROWWFUXRST-FNORWQNLSA-N 0.000 claims description 2
- CLNYHERYALISIR-ALCCZGGFSA-N (3z)-nona-1,3-diene Chemical compound CCCCC\C=C/C=C CLNYHERYALISIR-ALCCZGGFSA-N 0.000 claims description 2
- CLNYHERYALISIR-UHFFFAOYSA-N (E)-form-1,3-Nonadiene Natural products CCCCCC=CC=C CLNYHERYALISIR-UHFFFAOYSA-N 0.000 claims description 2
- RMWHYWJWLBDARH-UHFFFAOYSA-N (E,E)-2,4-decadiene Natural products CCCCCC=CC=CC RMWHYWJWLBDARH-UHFFFAOYSA-N 0.000 claims description 2
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- UAIFRPNEQVBFHH-UHFFFAOYSA-N nona-3,5-diene Chemical compound CCCC=CC=CCC UAIFRPNEQVBFHH-UHFFFAOYSA-N 0.000 claims description 2
- RCJMVGJKROQDCB-UHFFFAOYSA-N 2-methylpenta-1,3-diene Chemical compound CC=CC(C)=C RCJMVGJKROQDCB-UHFFFAOYSA-N 0.000 claims 2
- CJSBUWDGPXGFGA-UHFFFAOYSA-N 4-methylpenta-1,3-diene Chemical compound CC(C)=CC=C CJSBUWDGPXGFGA-UHFFFAOYSA-N 0.000 claims 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims 2
- HWXQYUCHSICMAS-KQQUZDAGSA-N (3e,5e)-octa-3,5-diene Chemical compound CC\C=C\C=C\CC HWXQYUCHSICMAS-KQQUZDAGSA-N 0.000 claims 1
- 241000726103 Atta Species 0.000 claims 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 claims 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 claims 1
- 239000002879 Lewis base Substances 0.000 claims 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229910002092 carbon dioxide Inorganic materials 0.000 claims 1
- 239000001569 carbon dioxide Substances 0.000 claims 1
- KENMWXODTSEHKF-UHFFFAOYSA-N deca-3,5-diene Chemical compound CCCCC=CC=CCC KENMWXODTSEHKF-UHFFFAOYSA-N 0.000 claims 1
- 150000007527 lewis bases Chemical class 0.000 claims 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 abstract description 101
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 abstract description 30
- -1 styrene Chemical class 0.000 abstract description 29
- 239000000178 monomer Substances 0.000 abstract description 12
- 229920002554 vinyl polymer Polymers 0.000 abstract description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract description 5
- 239000003054 catalyst Substances 0.000 description 46
- 238000006116 polymerization reaction Methods 0.000 description 34
- 239000003638 chemical reducing agent Substances 0.000 description 31
- 239000000463 material Substances 0.000 description 29
- 238000007792 addition Methods 0.000 description 23
- 230000015572 biosynthetic process Effects 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 229920001971 elastomer Polymers 0.000 description 21
- 229910052751 metal Inorganic materials 0.000 description 20
- 239000002184 metal Substances 0.000 description 20
- 229910052723 transition metal Inorganic materials 0.000 description 20
- 150000003624 transition metals Chemical class 0.000 description 20
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 239000005062 Polybutadiene Substances 0.000 description 18
- 229920002857 polybutadiene Polymers 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 229920001195 polyisoprene Polymers 0.000 description 15
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 239000005060 rubber Substances 0.000 description 13
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- 150000001450 anions Chemical class 0.000 description 11
- BYDROKITEOVIPQ-UHFFFAOYSA-N buta-1,3-diene;2-methylbuta-1,3-diene Chemical class C=CC=C.CC(=C)C=C.CC(=C)C=C BYDROKITEOVIPQ-UHFFFAOYSA-N 0.000 description 11
- 239000012530 fluid Substances 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- 239000003963 antioxidant agent Substances 0.000 description 9
- 235000006708 antioxidants Nutrition 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000004215 Carbon black (E152) Substances 0.000 description 8
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 8
- 230000003078 antioxidant effect Effects 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000004132 cross linking Methods 0.000 description 8
- 239000000806 elastomer Substances 0.000 description 8
- 229930195733 hydrocarbon Natural products 0.000 description 8
- 150000002430 hydrocarbons Chemical class 0.000 description 8
- 229910052744 lithium Inorganic materials 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 229920000428 triblock copolymer Polymers 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 150000004678 hydrides Chemical class 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910052759 nickel Inorganic materials 0.000 description 6
- 238000010791 quenching Methods 0.000 description 6
- 150000003440 styrenes Chemical class 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 150000003623 transition metal compounds Chemical class 0.000 description 6
- 229920002943 EPDM rubber Polymers 0.000 description 5
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- 238000010539 anionic addition polymerization reaction Methods 0.000 description 5
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 5
- 239000012965 benzophenone Substances 0.000 description 5
- 229920005549 butyl rubber Polymers 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000007385 chemical modification Methods 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 5
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 4
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000002877 alkyl aryl group Chemical group 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 238000007306 functionalization reaction Methods 0.000 description 4
- 230000009477 glass transition Effects 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- 230000000737 periodic effect Effects 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000004703 alkoxides Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 238000012661 block copolymerization Methods 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 229920003244 diene elastomer Polymers 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- DZCCLNYLUGNUKQ-UHFFFAOYSA-N n-(4-nitrosophenyl)hydroxylamine Chemical compound ONC1=CC=C(N=O)C=C1 DZCCLNYLUGNUKQ-UHFFFAOYSA-N 0.000 description 3
- 230000002085 persistent effect Effects 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 229920002589 poly(vinylethylene) polymer Polymers 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 238000004566 IR spectroscopy Methods 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229920005605 branched copolymer Polymers 0.000 description 2
- 238000010382 chemical cross-linking Methods 0.000 description 2
- 239000000498 cooling water Substances 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 125000002897 diene group Chemical group 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 229910001507 metal halide Inorganic materials 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 235000015096 spirit Nutrition 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229920001187 thermosetting polymer Polymers 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IJCPWQYDBDFHBH-UHFFFAOYSA-N 1-buta-1,3-dien-2-yl-4-methylbenzene Chemical compound CC1=CC=C(C(=C)C=C)C=C1 IJCPWQYDBDFHBH-UHFFFAOYSA-N 0.000 description 1
- NZLCAHVLJPDRBL-VSAQMIDASA-N 2,4-Octadiene Chemical compound CCC\C=C\C=C\C NZLCAHVLJPDRBL-VSAQMIDASA-N 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- DAWJJMYZJQJLPZ-UHFFFAOYSA-N 2-sulfanylprop-2-enoic acid Chemical compound OC(=O)C(S)=C DAWJJMYZJQJLPZ-UHFFFAOYSA-N 0.000 description 1
- CDVAIHNNWWJFJW-UHFFFAOYSA-N 3,5-diethoxycarbonyl-1,4-dihydrocollidine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C CDVAIHNNWWJFJW-UHFFFAOYSA-N 0.000 description 1
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 1
- 102100027522 Baculoviral IAP repeat-containing protein 7 Human genes 0.000 description 1
- 101710177963 Baculoviral IAP repeat-containing protein 7 Proteins 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- QQTGJVBUIOTPGZ-UHFFFAOYSA-N CCC[Zn]CCC Chemical compound CCC[Zn]CCC QQTGJVBUIOTPGZ-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 241001441571 Hiodontidae Species 0.000 description 1
- 239000004609 Impact Modifier Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000031708 Saprospiraceae Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 229910021552 Vanadium(IV) chloride Inorganic materials 0.000 description 1
- 230000009102 absorption Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- VLLYOYVKQDKAHN-UHFFFAOYSA-N buta-1,3-diene;2-methylbuta-1,3-diene Chemical compound C=CC=C.CC(=C)C=C VLLYOYVKQDKAHN-UHFFFAOYSA-N 0.000 description 1
- RTACIUYXLGWTAE-UHFFFAOYSA-N buta-1,3-diene;2-methylbuta-1,3-diene;styrene Chemical compound C=CC=C.CC(=C)C=C.C=CC1=CC=CC=C1 RTACIUYXLGWTAE-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 239000012967 coordination catalyst Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- HJXBDPDUCXORKZ-UHFFFAOYSA-N diethylalumane Chemical compound CC[AlH]CC HJXBDPDUCXORKZ-UHFFFAOYSA-N 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- GCPCLEKQVMKXJM-UHFFFAOYSA-N ethoxy(diethyl)alumane Chemical compound CCO[Al](CC)CC GCPCLEKQVMKXJM-UHFFFAOYSA-N 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- CETVQRFGPOGIQJ-UHFFFAOYSA-N lithium;hexane Chemical compound [Li+].CCCCC[CH2-] CETVQRFGPOGIQJ-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- KJJBSBKRXUVBMX-UHFFFAOYSA-N magnesium;butane Chemical compound [Mg+2].CCC[CH2-].CCC[CH2-] KJJBSBKRXUVBMX-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- NRQNMMBQPIGPTB-UHFFFAOYSA-N methylaluminum Chemical compound [CH3].[Al] NRQNMMBQPIGPTB-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002786 myrcene derivatives Chemical class 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- QTOJRHLRJFVPJN-UHFFFAOYSA-L nickel(2+);diphenoxide Chemical compound C=1C=CC=CC=1O[Ni]OC1=CC=CC=C1 QTOJRHLRJFVPJN-UHFFFAOYSA-L 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- XUSYMACRPHWJFJ-UHFFFAOYSA-N penta-1,3-dien-3-ylbenzene Chemical compound CC=C(C=C)C1=CC=CC=C1 XUSYMACRPHWJFJ-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 208000027653 severe early-childhood-onset retinal dystrophy Diseases 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- ZRLCXMPFXYVHGS-UHFFFAOYSA-N tetramethylgermane Chemical compound C[Ge](C)(C)C ZRLCXMPFXYVHGS-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 229920003194 trans-1,4-polybutadiene polymer Polymers 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 1
- ORYGRKHDLWYTKX-UHFFFAOYSA-N trihexylalumane Chemical compound CCCCCC[Al](CCCCCC)CCCCCC ORYGRKHDLWYTKX-UHFFFAOYSA-N 0.000 description 1
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- JTJFQBNJBPPZRI-UHFFFAOYSA-J vanadium tetrachloride Chemical compound Cl[V](Cl)(Cl)Cl JTJFQBNJBPPZRI-UHFFFAOYSA-J 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F293/00—Macromolecular compounds obtained by polymerisation on to a macromolecule having groups capable of inducing the formation of new polymer chains bound exclusively at one or both ends of the starting macromolecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F297/00—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer
- C08F297/02—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer using a catalyst of the anionic type
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F236/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F236/02—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F236/04—Copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/04—Reduction, e.g. hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/08—Epoxidation
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US466135 | 1990-01-16 | ||
| US07/466,135 US5149895A (en) | 1990-01-16 | 1990-01-16 | Vulcanizable liquid compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU6933891A AU6933891A (en) | 1991-07-18 |
| AU649990B2 true AU649990B2 (en) | 1994-06-09 |
Family
ID=23850630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU69338/91A Ceased AU649990B2 (en) | 1990-01-16 | 1991-01-15 | Vulcanizable liquid compositions |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5149895A (esLanguage) |
| EP (1) | EP0441485B1 (esLanguage) |
| JP (1) | JPH07116272B2 (esLanguage) |
| KR (1) | KR100192998B1 (esLanguage) |
| CN (2) | CN1051776C (esLanguage) |
| AT (1) | ATE138083T1 (esLanguage) |
| AU (1) | AU649990B2 (esLanguage) |
| BR (1) | BR9100180A (esLanguage) |
| CA (1) | CA2034196C (esLanguage) |
| DE (1) | DE69119440T2 (esLanguage) |
| DK (1) | DK0441485T3 (esLanguage) |
| ES (1) | ES2087238T3 (esLanguage) |
| FI (1) | FI99210C (esLanguage) |
| GR (1) | GR3020601T3 (esLanguage) |
| IE (1) | IE76314B1 (esLanguage) |
| NO (2) | NO301934B1 (esLanguage) |
| PT (1) | PT96497B (esLanguage) |
| TW (1) | TW206973B (esLanguage) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6034184A (en) * | 1998-06-23 | 2000-03-07 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers: Mannich reaction products |
| US5637783A (en) * | 1990-01-16 | 1997-06-10 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers |
| US6228817B1 (en) | 1990-01-16 | 2001-05-08 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers |
| US6103676A (en) * | 1998-06-23 | 2000-08-15 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers: hydroformylation/reductive amination reaction products |
| US5210359A (en) * | 1990-01-16 | 1993-05-11 | Mobil Oil Corporation | Vulcanizable liquid compositions |
| US5633415A (en) * | 1990-01-16 | 1997-05-27 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers |
| US6162768A (en) * | 1990-01-16 | 2000-12-19 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers: free radically initiated direct grafting reaction products |
| US6248702B1 (en) | 1990-01-16 | 2001-06-19 | Mobil Oil Corporation | Dispersant and dispersant viscosity index improvers from selectively hydrogenated aryl-substituted olefin containing diene copolymers |
| US5780540A (en) * | 1990-01-16 | 1998-07-14 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers |
| US6054539A (en) * | 1998-07-31 | 2000-04-25 | Mobil Oil Corporation | Selectively hydrogenated polymer compositions: polybutadiene-isoprene-polybutadiene |
| US5310814A (en) * | 1991-03-15 | 1994-05-10 | Exxon Chemical Patents Inc. | Viscosity modifier polybutadiene polymers |
| US5399626A (en) * | 1991-04-29 | 1995-03-21 | Shell Oil Company | Viscous conjugated diene block copolymers |
| US5382604A (en) * | 1991-10-07 | 1995-01-17 | Shell Oil Company | Crosslinked epoxy functionalized polydiene block polymers and adhesives |
| US5686535A (en) * | 1991-04-29 | 1997-11-11 | Shell Oil Company | Viscous conjugated diene block copolymers |
| TW226380B (esLanguage) * | 1992-04-03 | 1994-07-11 | Shell Internat Res Schappej B V | |
| US5300586A (en) * | 1992-04-03 | 1994-04-05 | Shell Oil Company | Hydroxyl functional derivatives of epoxidized diene block copolymers and process for making them (II) |
| US5358981A (en) * | 1992-12-07 | 1994-10-25 | Shell Oil Company | Solvent-free water-based emulsions of anionically polymerized polymers |
| US5393818A (en) * | 1993-04-06 | 1995-02-28 | Shell Oil Company | Solvent-free laminating adhesive composition from epoxidized block polymer |
| US5412031A (en) * | 1993-05-25 | 1995-05-02 | Minnesota Mining & Manufacturing Company | Multi-arm block copolymers, and pressure sensitive adhesive and tape employing a multi-arm elastomeric block copolymer |
| US5536772A (en) * | 1993-06-18 | 1996-07-16 | Shell Oil Company | Radiation cured conjugated diene block copolymer compositions |
| USH1786H (en) * | 1993-07-12 | 1999-02-02 | Shell Oil Company | Process for radiation cured conjugated diene-vinyl aromatic hydrocarbon block copolymers |
| US5332783A (en) * | 1993-07-12 | 1994-07-26 | Shell Oil Company | Compatible blends of epoxy resins and epoxidized polydienes |
| US5446104A (en) * | 1993-07-12 | 1995-08-29 | Shell Oil Company | Crosslinkable low viscosity star polymer blends |
| US5356993A (en) * | 1993-07-12 | 1994-10-18 | Shell Oil Company | Coreactive conjugated diene polymer compositions which phase separate when cured |
| USH1517H (en) * | 1993-07-12 | 1996-02-06 | Shell Oil Company | Radiation curable printing ink composition |
| US5393841A (en) * | 1993-11-09 | 1995-02-28 | Shell Oil Company | Dissimilar arm asymmetric radial or star block copolymers for adhesives and sealants |
| US5478885A (en) * | 1994-04-15 | 1995-12-26 | Shell Oil Company | Composition of epoxy resin, epoxidized block polydiene and curing agent |
| US5420202A (en) * | 1994-04-15 | 1995-05-30 | Shell Oil Company | Epoxidized low viscosity rubber toughening modifiers for cycloaliphatic epoxy resins |
| US6255364B1 (en) | 1994-06-21 | 2001-07-03 | Shell Oil Company | Crosslinkable waterborne dispersions of epoxidized polydiene block copolymers and amino resins |
| DE69501531T2 (de) * | 1994-07-18 | 1998-05-20 | Shell Int Research | Vernetzbare wässrige Dispersionen von hydroxyfunktionellen Dienpolymeren und Aminoharzen |
| US5499409A (en) * | 1994-07-18 | 1996-03-19 | Shell Oil Company | Epoxidized polydiene block polymer with epoxy resins |
| US5459200A (en) * | 1994-10-11 | 1995-10-17 | Shell Oil Company | Polyurethane coatings and adhesives containing monohydroxylated diene polymers and epoxidized derivatives thereof |
| US5500481A (en) * | 1995-05-17 | 1996-03-19 | Shell Oil Company | Compositions containing epoxidized monohydroxylated diene polymers, amino resins, and reactive reinforcement agents |
| US5461112A (en) * | 1994-10-11 | 1995-10-24 | Shell Oil Company | Epoxidized monohydroxylated block polymer, epoxy resin, curing agent and epoxy diluent |
| US5576388A (en) * | 1994-10-11 | 1996-11-19 | Shell Oil Company | Telechelic polymers and heterotelechelic polydiene block polymers with dual cure systems |
| US6525142B1 (en) | 1994-10-11 | 2003-02-25 | Kraton Polymers U.S. Llc | Monohydroxylated diene polymers and epoxidized derivatives thereof |
| GB9420645D0 (en) * | 1994-10-13 | 1994-11-30 | Dow Chemical Co | Non-linear stytrenic polymer compositions and articles prepared therefrom |
| USH1622H (en) * | 1995-05-30 | 1996-12-03 | Shell Oil Company | Hydrogenated diblock copolymers for adhesives and sealants with improved resistance to degradation |
| US5721316A (en) * | 1995-07-12 | 1998-02-24 | Shell Oil Company | Process for incorporation of expoxidized polydienes into epoxy resins |
| EP0861292B1 (en) * | 1995-11-16 | 2000-06-07 | Shell Internationale Researchmaatschappij B.V. | Crosslinkable hydroxy functional polydiene polymer coating compostions and a process for preparing them |
| US5922467A (en) * | 1996-10-15 | 1999-07-13 | Shell Oil Company | Method for coating crosslinkable epoxidized monohydroxylated diene polymer coating compositions on primed substrates |
| US6043316A (en) * | 1996-11-13 | 2000-03-28 | Shell Oil Company | Crosslinkable hydroxy terminated polydiene polymer coating compositions for use on substrates and a process for preparing them |
| WO1999025744A1 (en) * | 1997-11-18 | 1999-05-27 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers |
| US6215033B1 (en) | 1998-12-11 | 2001-04-10 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers: blends with lower molecular weight components |
| US6319881B1 (en) | 1998-06-23 | 2001-11-20 | Exxonmobil Oil Corporation | Haze free oil additive compositions containing dispersants from selectively hydrogenated diene copolymers |
| DE60112738T2 (de) * | 2000-04-25 | 2006-06-01 | Société de Technologie Michelin | Blockcopolymere für kautschukzusammensetzungen verwendbar für reifen |
| CN100516103C (zh) * | 2001-10-31 | 2009-07-22 | 米其林技术公司 | 轮胎胎面组合物用嵌段共聚物的制备方法,和这样的共聚物 |
| US20030139548A1 (en) * | 2001-12-21 | 2003-07-24 | Hochgesang Paul J. | Solventless liquid EPDM compounds |
| US6812294B2 (en) | 2001-12-21 | 2004-11-02 | Freudenberg-Nok General Partnership | Solventless liquid nitrile compounds |
| US6852805B2 (en) * | 2001-12-21 | 2005-02-08 | Freudenberg-Nok General Partnership | Solventless liquid FKM compounds |
| US7335807B2 (en) * | 2001-12-21 | 2008-02-26 | Freudenberg-Nok General Partnership | Solventless liquid isoprene compounds |
| WO2003099890A2 (en) * | 2002-05-24 | 2003-12-04 | Castrol Limited | Preparation of monomers for grafting to polyolefins, and lubricating oil compositions containing grafted copolymer |
| US7514393B2 (en) * | 2003-11-21 | 2009-04-07 | Castrol Limited | Preparation of functional monomers for grafting to low molecular weight polyalkenes and their use in the preparation of dispersants and lubricating oil compositions containing dispersant polyalkenes |
| US7241540B2 (en) * | 2004-04-27 | 2007-07-10 | Kraton Polymers U.S. Llc | Photocurable compositions and flexographic printing plates comprising the same |
| US20060106150A1 (en) * | 2004-10-29 | 2006-05-18 | Jsr Corporation | Block copolymer, rubber composition containing the same and molded product |
| US8703872B2 (en) | 2005-03-11 | 2014-04-22 | Castrol Limited | Multiple function graft polymer |
| AU2006239259B2 (en) * | 2005-04-28 | 2011-10-13 | Castrol Limited | Multiple-function dispersant graft polymer |
| DE102006014190A1 (de) * | 2006-03-24 | 2007-09-27 | Henkel Kgaa | Hochfeste schlagschälfeste Klebstoffe |
| AU2011235308A1 (en) | 2010-04-01 | 2012-10-11 | Castrol Limited | Multiple function graft polymer |
| EP2556096B1 (en) | 2010-04-07 | 2014-09-17 | Castrol Limited | Graft polymer and related methods and compositions |
| US8999905B2 (en) | 2010-10-25 | 2015-04-07 | Afton Chemical Corporation | Lubricant additive |
| IN2013MU03272A (esLanguage) | 2013-10-18 | 2015-07-17 | Reliance Ind Ltd | |
| CN104945559B (zh) * | 2014-03-26 | 2018-11-20 | 中国石油化工股份有限公司 | 一种氢化聚苯乙烯-b-苯乙烯/丁二烯/异戊二烯无规共聚物及其制备方法和应用 |
| SG11202001266XA (en) * | 2017-08-31 | 2020-03-30 | Ineos Styrolution Group Gmbh | Process for the preparation of low haze and color stable styrenic polymers |
| EP4239024A3 (en) * | 2022-03-03 | 2023-11-22 | Kraton Polymers Nederland B.V. | Compositions based on multi-block polyolefin copolymers |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3823203A (en) * | 1971-03-29 | 1974-07-09 | Shell Oil Co | Vulcanizable selectively hydogenated block copolymer compositions |
| US4134928A (en) * | 1977-06-24 | 1979-01-16 | Phillips Petroleum Company | Tetrablock polydienes |
| EP0387947A2 (en) * | 1989-03-08 | 1990-09-19 | Shell Internationale Researchmaatschappij B.V. | Thermoplastic elastomeric block polymers |
Family Cites Families (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1300240B (de) * | 1964-01-22 | 1969-07-31 | Bayer Ag | Verfahren zur Herstellung von Polymerisaten konjugierter Diolefine |
| US3458600A (en) * | 1965-01-06 | 1969-07-29 | Shell Oil Co | Chloral treatment of conjugated diene block copolymers |
| US3465063A (en) * | 1965-10-06 | 1969-09-02 | Shell Oil Co | Hydrogenated diolefin block copolymers |
| GB1229573A (esLanguage) * | 1967-06-20 | 1971-04-28 | ||
| USRE27145E (en) * | 1969-05-20 | 1971-06-22 | Side-chain | |
| US3634549A (en) * | 1969-08-04 | 1972-01-11 | Shell Oil Co | Conjugated diene block copolymers having a random copolymer elastomeric block and their hydrogenated counterparts |
| US3668263A (en) * | 1970-01-19 | 1972-06-06 | Lithium Corp | Organolithium polymerization initiators and use thereof in polymerization processes |
| DE2013096C3 (de) * | 1970-03-19 | 1975-02-20 | Chemische Werke Huels Ag, 4370 Marl | Verfahren zur Herstellung von Addukten aus Maleinsäureanhydrid und flüssigen niedermolekularen Butadienpolymerisaten |
| US3700748A (en) * | 1970-05-22 | 1972-10-24 | Shell Oil Co | Selectively hydrogenated block copolymers |
| US3810957A (en) * | 1970-08-10 | 1974-05-14 | Shell Oil Co | Selectively hydrogenated block copolymer-polystyrene blends |
| US3830880A (en) * | 1971-04-02 | 1974-08-20 | Shell Oil Co | Diene block copolymers |
| US3795615A (en) * | 1972-07-28 | 1974-03-05 | J Pappas | Hydrogenated copolymers of butadiene with another conjugated diene are useful as oil additives |
| US3975460A (en) * | 1972-10-26 | 1976-08-17 | Shell Oil Company | Blends of certain hydrogenated block copolymers with ABS polymers |
| US3823109A (en) * | 1972-11-03 | 1974-07-09 | Phillips Petroleum Co | Polymer compositions |
| US3937760A (en) * | 1974-04-29 | 1976-02-10 | The Firestone Tire & Rubber Company | Process for producing multiblock copolymer and products produced thereby |
| US3985826A (en) * | 1974-07-01 | 1976-10-12 | The Firestone Tire & Rubber Company | Hydrogenated block copolymers of butadiene and isoprene |
| GB1575507A (en) * | 1976-02-10 | 1980-09-24 | Shell Int Research | Hydrogenated star-shaped polymers and oil compositions thereof |
| US4041103A (en) * | 1976-06-07 | 1977-08-09 | Shell Oil Company | Blends of certain hydrogenated block copolymers |
| US4098980A (en) * | 1976-06-24 | 1978-07-04 | The Goodyear Tire & Rubber Company | Non-aqueous dispersion polymerization of conjugated diolefins |
| US4168286A (en) * | 1977-09-23 | 1979-09-18 | Phillips Petroleum Co. | Tetrablock polymers and their hydrogenated analogs |
| GB2020670A (en) * | 1978-05-09 | 1979-11-21 | Polymer Investments Nv | Liquid polymer and liquid copolymers of Butadiene and the preparation thereof. |
| JPS5527337A (en) * | 1978-08-18 | 1980-02-27 | Asahi Chem Ind Co Ltd | Isoprene-butadiene copolymer rubber having improved processability |
| US4167544A (en) * | 1978-08-23 | 1979-09-11 | Massachusetts Institute Of Technology | Polymer blends |
| JPS56127604A (en) * | 1980-03-12 | 1981-10-06 | Kuraray Co Ltd | Preparation of modified rubber |
| JPS5792014A (en) * | 1980-11-27 | 1982-06-08 | Sumitomo Rubber Ind Ltd | Conjugated diene block polymer |
| US4385151A (en) * | 1980-12-05 | 1983-05-24 | Sumitomo Rubber Industries, Ltd. | Composition containing isoprene polymer |
| US4440965A (en) * | 1982-05-18 | 1984-04-03 | Phillips Petroleum Company | Polymer lubricants |
| JPS5974153A (ja) * | 1982-10-21 | 1984-04-26 | Dainippon Plastics Co Ltd | 樹脂組成物 |
| US4501857A (en) * | 1983-01-20 | 1985-02-26 | Asahi Kasei Kogyo Kabushiki Kaisha | Method for hydrogenation of polymer |
| JPS60220147A (ja) * | 1984-04-18 | 1985-11-02 | Asahi Chem Ind Co Ltd | オレフイン水添触媒および該触媒を用いた重合体の水添方法 |
| US4764572A (en) * | 1985-07-23 | 1988-08-16 | Shell Oil Company | Anionic polymerization process |
| JPS6241213A (ja) * | 1985-08-16 | 1987-02-23 | シエル・インタ−ナシヨネイル・リサ−チ・マ−チヤツピイ・ベ−・ウイ | 変性ブロツクコポリマ−、該コポリマ−を含有する耐衝撃性組成物、及び該コポリマ−の製造法 |
| US4762635A (en) * | 1986-07-24 | 1988-08-09 | Mobil Oil Corporation | High traction synthetic hydrocarbon fluids |
| DE3710002A1 (de) * | 1986-08-14 | 1988-02-18 | Huels Chemische Werke Ag | Abc-blockcopolymerisate auf basis von butadien und isopren, verfahren zu ihrer herstellung und ihre verwendung |
| US4843120A (en) * | 1986-09-29 | 1989-06-27 | The Goodyear Tire & Rubber Company | Rubber composition |
| US4769415A (en) * | 1987-06-09 | 1988-09-06 | Dainippon Plastics Co., Ltd. | Resin composition |
| US4849481A (en) * | 1987-07-10 | 1989-07-18 | Shell Oil Company | Star shaped asymmetric block copolymer of monoalkenyl aromatic hydrocarbon and conjugated diene |
| US4879349A (en) * | 1987-11-05 | 1989-11-07 | Shell Oil Company | Selective hydrogenation process |
| US4880878A (en) * | 1987-12-29 | 1989-11-14 | Shell Oil Company | Block copolymer blends with improved oil absorption resistance |
| JPH01213306A (ja) * | 1988-02-22 | 1989-08-28 | Nippon Zeon Co Ltd | 共役ジエン系重合体の水素化方法 |
| US4910261A (en) * | 1988-06-17 | 1990-03-20 | Edison Polymer Innovation Corp. (Epic) | Thermoplastic elastomers having isobutylene block and cyclized diene blocks |
| US4929699A (en) * | 1989-05-09 | 1990-05-29 | The Dow Chemical Company | Process for hydrogenation of polymers |
-
1990
- 1990-01-16 US US07/466,135 patent/US5149895A/en not_active Expired - Lifetime
-
1991
- 1991-01-15 IE IE12391A patent/IE76314B1/en not_active IP Right Cessation
- 1991-01-15 NO NO910162A patent/NO301934B1/no not_active IP Right Cessation
- 1991-01-15 FI FI910213A patent/FI99210C/fi active
- 1991-01-15 AU AU69338/91A patent/AU649990B2/en not_active Ceased
- 1991-01-15 CA CA002034196A patent/CA2034196C/en not_active Expired - Fee Related
- 1991-01-16 DK DK91300317.4T patent/DK0441485T3/da active
- 1991-01-16 DE DE69119440T patent/DE69119440T2/de not_active Expired - Fee Related
- 1991-01-16 EP EP91300317A patent/EP0441485B1/en not_active Expired - Lifetime
- 1991-01-16 PT PT96497A patent/PT96497B/pt not_active IP Right Cessation
- 1991-01-16 KR KR1019910000861A patent/KR100192998B1/ko not_active Expired - Fee Related
- 1991-01-16 BR BR919100180A patent/BR9100180A/pt not_active IP Right Cessation
- 1991-01-16 ES ES91300317T patent/ES2087238T3/es not_active Expired - Lifetime
- 1991-01-16 AT AT91300317T patent/ATE138083T1/de not_active IP Right Cessation
- 1991-01-16 CN CN91101147A patent/CN1051776C/zh not_active Expired - Fee Related
- 1991-01-16 JP JP3216664A patent/JPH07116272B2/ja not_active Expired - Fee Related
- 1991-02-13 TW TW080101189A patent/TW206973B/zh active
-
1996
- 1996-07-23 GR GR960401960T patent/GR3020601T3/el unknown
-
1997
- 1997-08-04 NO NO973583A patent/NO973583D0/no not_active Application Discontinuation
-
1999
- 1999-05-29 CN CN99106953A patent/CN1238345A/zh active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3823203A (en) * | 1971-03-29 | 1974-07-09 | Shell Oil Co | Vulcanizable selectively hydogenated block copolymer compositions |
| US4134928A (en) * | 1977-06-24 | 1979-01-16 | Phillips Petroleum Company | Tetrablock polydienes |
| EP0387947A2 (en) * | 1989-03-08 | 1990-09-19 | Shell Internationale Researchmaatschappij B.V. | Thermoplastic elastomeric block polymers |
Also Published As
| Publication number | Publication date |
|---|---|
| AU6933891A (en) | 1991-07-18 |
| FI99210C (fi) | 1997-10-27 |
| EP0441485A2 (en) | 1991-08-14 |
| FI910213A0 (fi) | 1991-01-15 |
| NO910162D0 (no) | 1991-01-15 |
| CA2034196A1 (en) | 1991-07-17 |
| PT96497A (pt) | 1991-10-15 |
| NO910162L (no) | 1991-07-17 |
| NO973583L (no) | 1991-07-17 |
| CN1238345A (zh) | 1999-12-15 |
| IE76314B1 (en) | 1997-10-22 |
| DE69119440T2 (de) | 1996-11-14 |
| CN1055743A (zh) | 1991-10-30 |
| TW206973B (esLanguage) | 1993-06-01 |
| EP0441485A3 (en) | 1992-03-18 |
| DK0441485T3 (da) | 1996-06-10 |
| PT96497B (pt) | 1998-06-30 |
| FI99210B (fi) | 1997-07-15 |
| IE910123A1 (en) | 1991-07-17 |
| JPH06128340A (ja) | 1994-05-10 |
| JPH07116272B2 (ja) | 1995-12-13 |
| US5149895A (en) | 1992-09-22 |
| CN1051776C (zh) | 2000-04-26 |
| CA2034196C (en) | 1998-04-28 |
| GR3020601T3 (en) | 1996-10-31 |
| DE69119440D1 (de) | 1996-06-20 |
| NO301934B1 (no) | 1997-12-29 |
| KR100192998B1 (ko) | 1999-06-15 |
| BR9100180A (pt) | 1991-10-22 |
| EP0441485B1 (en) | 1996-05-15 |
| NO973583D0 (no) | 1997-08-04 |
| FI910213A7 (fi) | 1991-07-17 |
| KR910014420A (ko) | 1991-08-31 |
| ES2087238T3 (es) | 1996-07-16 |
| ATE138083T1 (de) | 1996-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU649990B2 (en) | Vulcanizable liquid compositions | |
| US5625100A (en) | Vulcanizable liquid compositions | |
| EP0438287B1 (en) | Solid block and random elastomeric copolymers | |
| CA2074624C (en) | Solid elastomeric block copolymers | |
| US5470914A (en) | Polymer blends containing a solid elastomeric block copolymer | |
| RU2180680C2 (ru) | Диспергирующее вещество для модификации диспергируемости, способ модификации диспергируемости и смазочная жидкость | |
| US5948861A (en) | Star-branched block elastomeric copolymers | |
| EP0626978B1 (en) | Solid elastomeric block copolymers | |
| US5268427A (en) | Solid block and random elastomeric copolymers | |
| US5773524A (en) | Epoxidized liquid elastomeric copolymers | |
| EP0705286B1 (en) | Solid elastomeric block copolymers | |
| EP0458379A2 (en) | Functionalized thermoplastic elastomers | |
| US5510548A (en) | Vulcanizable liquid compositions | |
| US5747598A (en) | Epoxidized solid elastomeric copolymers | |
| US4102849A (en) | Oil-extended hydrogenated diblock copolymer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |