AU604983B2 - Shaving device - Google Patents
Shaving device Download PDFInfo
- Publication number
- AU604983B2 AU604983B2 AU24270/88A AU2427088A AU604983B2 AU 604983 B2 AU604983 B2 AU 604983B2 AU 24270/88 A AU24270/88 A AU 24270/88A AU 2427088 A AU2427088 A AU 2427088A AU 604983 B2 AU604983 B2 AU 604983B2
- Authority
- AU
- Australia
- Prior art keywords
- shaving
- razor
- razor blades
- sponge
- blade
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000005520 cutting process Methods 0.000 claims description 5
- 239000012633 leachable Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- BFPSDSIWYFKGBC-UHFFFAOYSA-N chlorotrianisene Chemical compound C1=CC(OC)=CC=C1C(Cl)=C(C=1C=CC(OC)=CC=1)C1=CC=C(OC)C=C1 BFPSDSIWYFKGBC-UHFFFAOYSA-N 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 2
- 239000013536 elastomeric material Substances 0.000 description 2
- 210000002414 leg Anatomy 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000002991 molded plastic Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 101100162210 Aspergillus parasiticus (strain ATCC 56775 / NRRL 5862 / SRRC 143 / SU-1) aflM gene Proteins 0.000 description 1
- 101100102500 Caenorhabditis elegans ver-1 gene Proteins 0.000 description 1
- 206010064503 Excessive skin Diseases 0.000 description 1
- 102220515779 Methionine-R-sulfoxide reductase B1_A14V_mutation Human genes 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 101150105729 SLC45A3 gene Proteins 0.000 description 1
- 102100037253 Solute carrier family 45 member 3 Human genes 0.000 description 1
- 240000000359 Triticum dicoccon Species 0.000 description 1
- 210000003423 ankle Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000002437 shaving preparation Substances 0.000 description 1
- 229920002725 thermoplastic elastomer Polymers 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
- B26B21/08—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor involving changeable blades
- B26B21/14—Safety razors with one or more blades arranged transversely to the handle
- B26B21/20—Safety razors with one or more blades arranged transversely to the handle involving blades with more than two cutting edges; involving disc blades
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
- B26B21/54—Razor-blades
- B26B21/56—Razor-blades characterised by the shape
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Forests & Forestry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Dry Shavers And Clippers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/092,021 US4807360A (en) | 1987-09-02 | 1987-09-02 | Shaving device |
| US092021 | 1987-09-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2427088A AU2427088A (en) | 1989-03-31 |
| AU604983B2 true AU604983B2 (en) | 1991-01-03 |
Family
ID=22230899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU24270/88A Ceased AU604983B2 (en) | 1987-09-02 | 1988-08-18 | Shaving device |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4807360A (enExample) |
| EP (1) | EP0305866B1 (enExample) |
| JP (1) | JP2598504B2 (enExample) |
| KR (1) | KR0127021B1 (enExample) |
| AR (1) | AR245027A1 (enExample) |
| AT (1) | ATE81049T1 (enExample) |
| AU (1) | AU604983B2 (enExample) |
| BR (1) | BR8807651A (enExample) |
| CA (1) | CA1319006C (enExample) |
| DE (1) | DE3875039T2 (enExample) |
| ES (1) | ES2035200T3 (enExample) |
| GR (1) | GR3006016T3 (enExample) |
| HK (1) | HK10694A (enExample) |
| MX (1) | MX165291B (enExample) |
| WO (1) | WO1989001852A1 (enExample) |
Families Citing this family (63)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU605374B2 (en) * | 1987-09-02 | 1991-01-10 | Gillette Company, The | Shaving device |
| WO1991001204A1 (en) * | 1989-07-24 | 1991-02-07 | The Gillette Company | Safety razors |
| US4977670A (en) * | 1989-12-18 | 1990-12-18 | American Safety Razor Company | Shaving implement |
| US5031318A (en) * | 1990-03-22 | 1991-07-16 | The Gillette Company | Safety razor |
| US5018274A (en) * | 1990-04-05 | 1991-05-28 | The Gillette Company | Safety razor blade |
| US4979298A (en) * | 1990-04-10 | 1990-12-25 | The Gillette Company | Shaving system |
| US4984365A (en) * | 1990-05-04 | 1991-01-15 | The Gillette Company | Safety razor |
| US5088195A (en) | 1990-07-30 | 1992-02-18 | Lazarshik Daniel B | Shaving system |
| US5201253A (en) * | 1990-07-30 | 1993-04-13 | The Gillette Company | Shaving system |
| US5084968A (en) * | 1990-09-10 | 1992-02-04 | The Gillette Company | Razor blade assembly |
| US5031317A (en) * | 1990-09-19 | 1991-07-16 | The Gillette Co. | Razor |
| US5050301A (en) * | 1990-09-19 | 1991-09-24 | The Gillette Company | Razor assembly |
| US5301425A (en) * | 1992-11-04 | 1994-04-12 | Warner-Lambert Company | Rotary powered dynamic shaving system with shaving aid |
| US5604983A (en) * | 1994-04-14 | 1997-02-25 | The Gillette Company | Razor system |
| US5490329A (en) * | 1994-05-17 | 1996-02-13 | The Gillette Company | Shaving system |
| US6185823B1 (en) * | 1995-11-10 | 2001-02-13 | The Gillette Company | Oval frame razor |
| US5802720A (en) * | 1996-10-04 | 1998-09-08 | Pribe; Christopher A. | Shaving cloth |
| US6125857A (en) * | 1998-07-13 | 2000-10-03 | Silber; David | Dual sideburn trimmer |
| US6167625B1 (en) | 1999-05-18 | 2001-01-02 | Warner-Lambert Company | Shaving implement |
| US6996908B2 (en) * | 2000-02-16 | 2006-02-14 | Eveready Battery Company, Inc. | Wet shaving assembly |
| US6584690B2 (en) * | 2000-02-16 | 2003-07-01 | Warner-Lambert Company | Wet shaving assembly |
| US7086159B2 (en) | 2000-02-16 | 2006-08-08 | Eveready Battery Company, Inc. | Razor assembly |
| US7370419B2 (en) * | 2000-02-16 | 2008-05-13 | Eveready Battery Company, Inc. | Replacement cartridge for a razor assembly |
| US7178241B1 (en) | 2000-05-22 | 2007-02-20 | Eveready Battery Company, Inc. | Lubricating shaving assembly |
| US7266895B2 (en) * | 2002-04-24 | 2007-09-11 | Eveready Battery Company, Inc. | Razor assembly |
| US20050278954A1 (en) * | 2002-04-24 | 2005-12-22 | Eveready Battery Company, Inc. | Shaving aid body for a safety razor |
| EP1410884B1 (en) * | 2002-10-08 | 2006-03-22 | The Gillette Company | Shaving system for performing multiple shaving actions |
| US20070101574A1 (en) * | 2002-10-08 | 2007-05-10 | Royle Terence G | Shaving system for performing multiple shaving actions |
| US20040107578A1 (en) * | 2002-12-04 | 2004-06-10 | Steele James M. | Blade sharpening for electric shavers |
| US7162800B2 (en) * | 2003-05-12 | 2007-01-16 | Eveready Battery Company, Inc. | Wet shaving assembly |
| US7103976B2 (en) * | 2004-02-06 | 2006-09-12 | Eveready Battery Company, Inc. | Razor assembly |
| US7197825B2 (en) * | 2004-03-11 | 2007-04-03 | The Gillette Company | Razors and shaving cartridges with guard |
| DE102004015759A1 (de) * | 2004-03-31 | 2005-10-20 | Braun Gmbh | Elektrisches Haarentfernungsgerät zum partiellen oder vollständigen Entfernen von Haaren von der Haut |
| US20060272460A1 (en) * | 2005-06-02 | 2006-12-07 | Cheng-Jih Li | Shaving razors |
| GB2430905A (en) * | 2005-10-04 | 2007-04-11 | George Spitaliotis | Razor with hinge perpendicular to cutting edge |
| US8677628B2 (en) * | 2006-01-24 | 2014-03-25 | II John R. Harris | Scrubbing razor with safety ribs |
| US7500312B2 (en) | 2006-01-24 | 2009-03-10 | Harris Ii John Robert | Scrubbing razor |
| US7856721B2 (en) | 2006-01-24 | 2010-12-28 | Harris Ii John Robert | Scrubbing razor |
| US7730619B2 (en) * | 2006-09-26 | 2010-06-08 | Debra Lynn Ozenick | Ergonomically arcuate multi-blade razor |
| DE102010035866B4 (de) * | 2010-08-30 | 2013-10-24 | Tobias Wagner | Rasierer |
| US20120192432A1 (en) * | 2011-02-01 | 2012-08-02 | Wallace Zane | Flexible Razor Assembly |
| US8808060B2 (en) | 2011-04-12 | 2014-08-19 | Clipp-Aid Llc | Systems and methods for sharpening cutting blades |
| US20130031794A1 (en) * | 2011-08-05 | 2013-02-07 | Duff Jr Ronald Richard | RAZOR BLADES WITH ALUMINUM MAGNESIUM BORIDE (AlMgB14)-BASED COATINGS |
| US9227331B2 (en) | 2012-11-06 | 2016-01-05 | The Gillette Company | Razor blade unit |
| US9738001B2 (en) * | 2012-12-20 | 2017-08-22 | Samir Hanna Safar | Fingertip shaving device |
| US10478982B2 (en) | 2013-05-08 | 2019-11-19 | Lee Innovations, LLC | Compliant or rollable cutting surface and cutting device |
| DE102013213859A1 (de) * | 2013-07-16 | 2015-01-22 | Beiersdorf Ag | Rasierer in schalenförmiger Gestalt |
| US10194942B2 (en) * | 2016-04-14 | 2019-02-05 | Alejandro Arango | Callus removal apparatus |
| US10194941B2 (en) * | 2016-04-14 | 2019-02-05 | Alejandro Arango | Callus removal apparatus |
| US10850412B2 (en) * | 2018-03-02 | 2020-12-01 | II John Robert Harris | Razor with rotatable head |
| KR200490228Y1 (ko) * | 2018-06-25 | 2019-10-14 | 공대영 | 면도기 자동 세척장치 |
| GB2580088C (en) | 2018-12-21 | 2021-05-26 | Brengor Innovation Ltd | Razor |
| CN116615318A (zh) | 2020-11-03 | 2023-08-18 | 吉列有限责任公司 | 具有基于硼化铬的涂层的剃刀刀片 |
| EP4079474A1 (en) * | 2021-04-20 | 2022-10-26 | GFD Gesellschaft für Diamantprodukte mbH | Skin treatment sheet and skin treatment device |
| US20220330984A1 (en) * | 2021-04-20 | 2022-10-20 | The Gillette Company Llc | Frame member for use with treatment sheet |
| US20240227222A1 (en) * | 2023-01-09 | 2024-07-11 | The Gillette Company Llc | Hair removal device |
| US20240227224A1 (en) * | 2023-01-09 | 2024-07-11 | The Gillette Company Llc | Hair removal device |
| US20240227221A1 (en) * | 2023-01-09 | 2024-07-11 | The Gillette Company Llc | Hair removal device |
| US20240227220A1 (en) * | 2023-01-09 | 2024-07-11 | The Gillette Company Llc | Hair removal device |
| USD1084512S1 (en) * | 2023-04-14 | 2025-07-15 | The Gillette Company Llc | Shaving razor handle |
| US20250222605A1 (en) * | 2024-01-08 | 2025-07-10 | The Gillette Company Llc | Hair removal system |
| JP7710557B1 (ja) | 2024-03-15 | 2025-07-18 | 株式会社貝印刃物開発センター | 剃刀 |
| US20260070245A1 (en) * | 2024-09-06 | 2026-03-12 | The Gillette Company Llc | Shaving apparatus |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2040559A (en) * | 1934-12-05 | 1936-05-12 | Charles E Luttrell | Laundry bag |
| US4483068A (en) * | 1980-04-30 | 1984-11-20 | Wilkinson Sword Limited | Razors, razor blades and razor blade dispensers |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2040599A (en) * | 1929-12-23 | 1936-05-12 | James O Davies | Superfluous hair remover |
| GB409902A (en) * | 1933-05-09 | 1934-05-10 | Virgil Vincent Garrett | Improvement in safety razor |
| US2279682A (en) * | 1938-03-31 | 1942-04-14 | Jackson Jesse Atwater | Shearing shaver |
| US2439909A (en) * | 1945-12-12 | 1948-04-20 | George E Hale | Safety razor blade |
| US2598711A (en) * | 1949-07-29 | 1952-06-03 | Musso Ferdinando Pasquale | Shaver |
| US2632242A (en) * | 1950-01-31 | 1953-03-24 | Musso Ferdinando Pasquale | Safety razor |
| US2614321A (en) * | 1950-12-23 | 1952-10-21 | Ackerman Charles | Safety razor |
| DE1076528B (de) * | 1959-02-25 | 1960-02-25 | Richard Antretter | Scherkopf fuer Trockenrasiergeraet |
| US2983041A (en) * | 1959-03-13 | 1961-05-09 | Gadget Of The Month Club Inc | Manually operable dry shaver |
| US2989804A (en) * | 1959-06-30 | 1961-06-27 | Edgar Bernhard | Self protected shaving device having multiple cutting edges |
| US3465436A (en) * | 1967-08-08 | 1969-09-09 | Ferdinando Pasquale Musso | Circular safety razor |
| US3702026A (en) * | 1971-10-18 | 1972-11-07 | Unirazor Ltd | Razor |
| GB2024082B (en) * | 1978-05-31 | 1982-05-06 | Gillette Co | Safety razors |
| US4302876A (en) * | 1980-03-14 | 1981-12-01 | Warner-Lambert Company | Razor blade with inclined edge |
| GB2083398B (en) * | 1980-09-09 | 1983-07-13 | Wilkinson Sword Ltd | Razors |
| US4720917A (en) * | 1985-09-13 | 1988-01-26 | Solow Terry S | Flexible blade contour razor |
-
1987
- 1987-09-02 US US07/092,021 patent/US4807360A/en not_active Expired - Lifetime
-
1988
- 1988-08-12 CA CA000574638A patent/CA1319006C/en not_active Expired - Lifetime
- 1988-08-18 AU AU24270/88A patent/AU604983B2/en not_active Ceased
- 1988-08-18 WO PCT/US1988/002849 patent/WO1989001852A1/en not_active Ceased
- 1988-08-18 JP JP63507721A patent/JP2598504B2/ja not_active Expired - Lifetime
- 1988-08-18 KR KR1019890700543A patent/KR0127021B1/ko not_active Expired - Fee Related
- 1988-08-18 BR BR888807651A patent/BR8807651A/pt not_active IP Right Cessation
- 1988-08-23 EP EP88113729A patent/EP0305866B1/en not_active Expired - Lifetime
- 1988-08-23 DE DE8888113729T patent/DE3875039T2/de not_active Expired - Fee Related
- 1988-08-23 AT AT88113729T patent/ATE81049T1/de not_active IP Right Cessation
- 1988-08-23 ES ES198888113729T patent/ES2035200T3/es not_active Expired - Lifetime
- 1988-08-29 MX MX012855A patent/MX165291B/es unknown
- 1988-09-02 AR AR88311842A patent/AR245027A1/es active
-
1992
- 1992-10-16 GR GR920402346T patent/GR3006016T3/el unknown
-
1994
- 1994-02-02 HK HK106/94A patent/HK10694A/en not_active IP Right Cessation
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2040559A (en) * | 1934-12-05 | 1936-05-12 | Charles E Luttrell | Laundry bag |
| US4483068A (en) * | 1980-04-30 | 1984-11-20 | Wilkinson Sword Limited | Razors, razor blades and razor blade dispensers |
Also Published As
| Publication number | Publication date |
|---|---|
| KR890701293A (ko) | 1989-12-20 |
| JPH04503160A (ja) | 1992-06-11 |
| ATE81049T1 (de) | 1992-10-15 |
| DE3875039D1 (de) | 1992-11-05 |
| AU2427088A (en) | 1989-03-31 |
| AR245027A1 (es) | 1993-12-30 |
| US4807360A (en) | 1989-02-28 |
| GR3006016T3 (enExample) | 1993-06-21 |
| DE3875039T2 (de) | 1993-04-22 |
| BR8807651A (pt) | 1990-06-05 |
| ES2035200T3 (es) | 1993-04-16 |
| KR0127021B1 (ko) | 1998-10-15 |
| JP2598504B2 (ja) | 1997-04-09 |
| WO1989001852A1 (en) | 1989-03-09 |
| EP0305866A3 (en) | 1990-03-14 |
| CA1319006C (en) | 1993-06-15 |
| EP0305866A2 (en) | 1989-03-08 |
| MX165291B (es) | 1992-11-04 |
| EP0305866B1 (en) | 1992-09-30 |
| HK10694A (en) | 1994-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU604983B2 (en) | Shaving device | |
| US4964214A (en) | Flexible safety razors | |
| US5249361A (en) | Guard for razor blade assembly | |
| US4875288A (en) | Shaving device | |
| KR100488394B1 (ko) | 면도기 손잡이 | |
| US5084968A (en) | Razor blade assembly | |
| US3724070A (en) | Dual razor blade assembly | |
| US5621971A (en) | Multi-purpose attachment for ladies' shaver | |
| US8061040B2 (en) | Cutter blade assembly and dry shaver for variable height of cut | |
| KR20110024234A (ko) | 면도기 카트리지 | |
| US5208982A (en) | Device to shave concave areas | |
| USRE36816E (en) | Guard for razor blade assembly | |
| JPH0654966A (ja) | 剃 刀 | |
| WO1992006826A1 (en) | Double-curved razor blade | |
| AU595419C (en) | Safety razors | |
| AU605374B2 (en) | Shaving device | |
| JPH0321194B2 (enExample) | ||
| JPS5854984A (ja) | 往復式電気かみそり | |
| JPS6041958B2 (ja) | 電気かみそり | |
| JPH02147086A (ja) | 電気かみそり | |
| MX9604769A (es) | Sistema para afeitar. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |