AU555638B2 - 1,3-dioxolane derivatives - Google Patents
1,3-dioxolane derivativesInfo
- Publication number
- AU555638B2 AU555638B2 AU90018/82A AU9001882A AU555638B2 AU 555638 B2 AU555638 B2 AU 555638B2 AU 90018/82 A AU90018/82 A AU 90018/82A AU 9001882 A AU9001882 A AU 9001882A AU 555638 B2 AU555638 B2 AU 555638B2
- Authority
- AU
- Australia
- Prior art keywords
- carbon atoms
- alkyl
- represents hydrogen
- see diagramm
- dioxolane derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical class C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 5
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- CLBGIOQSOGUCTA-UHFFFAOYSA-N 2-[(2-phenyl-1,3-dioxolan-2-yl)methyl]-1h-imidazole Chemical class O1CCOC1(C=1C=CC=CC=1)CC1=NC=CN1 CLBGIOQSOGUCTA-UHFFFAOYSA-N 0.000 abstract 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 1
- 229910052794 bromium Inorganic materials 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 239000000460 chlorine Chemical group 0.000 abstract 1
- 229910052731 fluorine Inorganic materials 0.000 abstract 1
- 239000011737 fluorine Chemical group 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000002184 metal Chemical class 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/16—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Lubricants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813144318 DE3144318A1 (de) | 1981-11-07 | 1981-11-07 | 2-imidazolylmethyl-2-phenyl-1, 3-dioxolane, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE31443184 | 1981-11-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU9001882A AU9001882A (en) | 1983-05-12 |
| AU555638B2 true AU555638B2 (en) | 1986-10-02 |
Family
ID=6145891
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU90018/82A Ceased AU555638B2 (en) | 1981-11-07 | 1982-10-29 | 1,3-dioxolane derivatives |
Country Status (18)
| Country | Link |
|---|---|
| EP (1) | EP0080071B1 (OSRAM) |
| JP (1) | JPS5888377A (OSRAM) |
| AT (1) | ATE27158T1 (OSRAM) |
| AU (1) | AU555638B2 (OSRAM) |
| BR (1) | BR8206434A (OSRAM) |
| CA (1) | CA1187085A (OSRAM) |
| CS (1) | CS235971B2 (OSRAM) |
| DD (1) | DD208534A5 (OSRAM) |
| DE (2) | DE3144318A1 (OSRAM) |
| DK (1) | DK494482A (OSRAM) |
| ES (1) | ES8307799A1 (OSRAM) |
| GR (1) | GR77371B (OSRAM) |
| HU (1) | HU188333B (OSRAM) |
| IL (1) | IL67178A (OSRAM) |
| NZ (1) | NZ202385A (OSRAM) |
| PL (1) | PL133350B1 (OSRAM) |
| PT (1) | PT75759B (OSRAM) |
| ZA (1) | ZA828134B (OSRAM) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI77458C (fi) * | 1981-05-12 | 1989-03-10 | Ciba Geigy Ag | Nya mikrobicida arylfenyleterderivat, foerfarande foer deras framstaellning och deras anvaendning. |
| FI834141A7 (fi) * | 1982-11-16 | 1984-05-17 | Ciba Geigy Ag | Foerfarande foer framstaellning av nya arylfenyleterderivat. |
| ZA853066B (en) * | 1984-05-02 | 1985-12-24 | Uniroyal Inc | Substituted imidazoles and triazoles |
| AU575163B2 (en) * | 1984-05-09 | 1988-07-21 | Hunter Douglas Limited | Roof insert |
| IT1186784B (it) * | 1985-11-04 | 1987-12-16 | Montedison Spa | Azoliderivati ad attivita' antufungina |
| DE3914632A1 (de) * | 1989-05-03 | 1990-11-08 | Basf Ag | 1-hydroxi-azolverbindungen und diese enthaltende fungizide |
| US5274108A (en) * | 1992-06-18 | 1993-12-28 | Syntex (U.S.A.) Inc. | Process for preparing 1,3-dioxolane derivatives |
| TW457240B (en) * | 1995-04-20 | 2001-10-01 | Janssen Pharmaceutica Nv | Novel triazolones as apolipoprotein-B synthesis inhibitors |
| RU2146447C1 (ru) * | 1999-02-10 | 2000-03-20 | Кубанский государственный технологический университет | Средство для одновременной активации прорастания семян пшеницы и повышения устойчивости проростков к водному стрессу |
| WO2004014887A1 (en) * | 2002-08-09 | 2004-02-19 | Central Glass Company, Limited | Process for producing trifluoromethyl-substituted 2-alkoxyacetophenone derivatives |
| EP2745691A1 (en) | 2012-12-19 | 2014-06-25 | Basf Se | Substituted imidazole compounds and their use as fungicides |
| EP3519404A1 (en) * | 2016-09-29 | 2019-08-07 | Bayer CropScience Aktiengesellschaft | 5-substituted imidazolylmethyldioxolane derivatives as fungiciides |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3575999A (en) * | 1968-08-19 | 1971-04-20 | Janssen Pharmaceutica Nv | Ketal derivatives of imidazole |
| CA1065873A (en) * | 1975-01-27 | 1979-11-06 | Janssen Pharmaceutica Naamloze Vennootschap | Imidazole derivatives |
| EP0006722B1 (en) * | 1978-07-03 | 1984-09-05 | Janssen Pharmaceutica N.V. | Derivatives of (4-(piperazin-1-yl-phenyloxymethyl)-1.3-dioxolan-2-ylmethyl)-1h-imidazoles and -1h-1.2.4-triazoles, their preparation and use as fungicides and bactericides |
| CH637392A5 (en) * | 1978-07-24 | 1983-07-29 | Janssen Pharmaceutica Nv | 2-Phenyl-2-azolylmethyl-cyclohexa(d)-1,3-dioxolane derivatives, processes for their preparation, compositions containing these active substances as microbicides, and their use |
| AU526321B2 (en) * | 1978-07-24 | 1983-01-06 | Janssen Pharmaceutica N.V. | 1-(2-aryl-4,5-disubstituted-1,3-dioxolan-2-yl-methyl)-1h- imidazoles and 1h-1,2,4-triazoles |
| CA1173449A (en) * | 1979-11-16 | 1984-08-28 | Adolf Hubele | 1-¬2-(4-diphenyl)ethyl|-1h-azolylketals |
| FI77458C (fi) * | 1981-05-12 | 1989-03-10 | Ciba Geigy Ag | Nya mikrobicida arylfenyleterderivat, foerfarande foer deras framstaellning och deras anvaendning. |
| TR21964A (tr) * | 1981-05-12 | 1985-12-11 | Ciba Geigy Ag | Mikrobisidler olarak yeni arilfenileter tuerevleri bunlarin hazirlanisi icin usuller ve bunlarin kullanilmalari |
-
1981
- 1981-11-07 DE DE19813144318 patent/DE3144318A1/de not_active Withdrawn
-
1982
- 1982-10-28 PT PT75759A patent/PT75759B/pt unknown
- 1982-10-28 DE DE8282109961T patent/DE3276315D1/de not_active Expired
- 1982-10-28 EP EP82109961A patent/EP0080071B1/de not_active Expired
- 1982-10-28 AT AT82109961T patent/ATE27158T1/de not_active IP Right Cessation
- 1982-10-29 AU AU90018/82A patent/AU555638B2/en not_active Ceased
- 1982-11-02 JP JP57191946A patent/JPS5888377A/ja active Granted
- 1982-11-04 HU HU823553A patent/HU188333B/hu not_active IP Right Cessation
- 1982-11-04 IL IL67178A patent/IL67178A/xx unknown
- 1982-11-04 NZ NZ202385A patent/NZ202385A/en unknown
- 1982-11-04 DD DD82244560A patent/DD208534A5/de unknown
- 1982-11-05 PL PL1982238886A patent/PL133350B1/pl unknown
- 1982-11-05 ES ES517158A patent/ES8307799A1/es not_active Expired
- 1982-11-05 BR BR8206434A patent/BR8206434A/pt unknown
- 1982-11-05 CS CS827905A patent/CS235971B2/cs unknown
- 1982-11-05 CA CA000414986A patent/CA1187085A/en not_active Expired
- 1982-11-05 GR GR69731A patent/GR77371B/el unknown
- 1982-11-05 ZA ZA828134A patent/ZA828134B/xx unknown
- 1982-11-05 DK DK494482A patent/DK494482A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DK494482A (da) | 1983-05-08 |
| IL67178A0 (en) | 1983-03-31 |
| JPS5888377A (ja) | 1983-05-26 |
| DE3144318A1 (de) | 1983-05-19 |
| IL67178A (en) | 1986-12-31 |
| ES517158A0 (es) | 1983-08-01 |
| ATE27158T1 (de) | 1987-05-15 |
| JPH0422913B2 (OSRAM) | 1992-04-20 |
| GR77371B (OSRAM) | 1984-09-11 |
| HU188333B (en) | 1986-04-28 |
| AU9001882A (en) | 1983-05-12 |
| EP0080071A3 (en) | 1983-09-07 |
| NZ202385A (en) | 1985-02-28 |
| ZA828134B (en) | 1983-09-28 |
| CA1187085A (en) | 1985-05-14 |
| EP0080071A2 (de) | 1983-06-01 |
| DD208534A5 (de) | 1984-04-04 |
| PL238886A1 (en) | 1983-06-06 |
| DE3276315D1 (en) | 1987-06-19 |
| ES8307799A1 (es) | 1983-08-01 |
| PT75759B (en) | 1985-07-26 |
| PT75759A (en) | 1982-11-01 |
| CS235971B2 (en) | 1985-05-15 |
| EP0080071B1 (de) | 1987-05-13 |
| PL133350B1 (en) | 1985-05-31 |
| BR8206434A (pt) | 1983-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO870160L (no) | Fungicide azolylderivater. | |
| AU555638B2 (en) | 1,3-dioxolane derivatives | |
| IE811085L (en) | Pyridoxine derivatives | |
| DK440183A (da) | Ethanderivater med fungicid virkning | |
| IE812146L (en) | Ethenylimidazole derivatives | |
| ATE16796T1 (de) | Neue indanyl-derivate, ihre herstellung und verwendung. | |
| ATE10629T1 (de) | Benzotriazole, ihre herstellung und ihre verwendung als fungizide. | |
| FI852249A0 (fi) | Foerfarande foer framstaellning av nya isoxazolokinolinoner. | |
| AU2670084A (en) | N-sulphenylated phenethylsulphonamides | |
| DE3367392D1 (en) | Dioxanylazol derivatives, fungicides containing them and their use as fungicides | |
| IE830733L (en) | Pyrazinylthiazine derivatives | |
| ATE18210T1 (de) | Pyridinderivate, ihre herstellung und verwendung. | |
| AU4126185A (en) | N-iodopropargyl-chloromethanesulphonamides |