AU2013276702A1 - Amidophenoxypropanolamines - Google Patents
Amidophenoxypropanolamines Download PDFInfo
- Publication number
- AU2013276702A1 AU2013276702A1 AU2013276702A AU2013276702A AU2013276702A1 AU 2013276702 A1 AU2013276702 A1 AU 2013276702A1 AU 2013276702 A AU2013276702 A AU 2013276702A AU 2013276702 A AU2013276702 A AU 2013276702A AU 2013276702 A1 AU2013276702 A1 AU 2013276702A1
- Authority
- AU
- Australia
- Prior art keywords
- formula
- benzamide
- hydroxy
- propoxy
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 265
- -1 CF 3 Chemical group 0.000 claims description 154
- 125000000217 alkyl group Chemical group 0.000 claims description 118
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 69
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 63
- 125000003118 aryl group Chemical group 0.000 claims description 46
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 36
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 35
- 229910052736 halogen Inorganic materials 0.000 claims description 32
- 239000003814 drug Substances 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 30
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 29
- 150000003839 salts Chemical class 0.000 claims description 28
- 229940079593 drug Drugs 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 239000001257 hydrogen Substances 0.000 claims description 26
- 238000011282 treatment Methods 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- 125000000304 alkynyl group Chemical group 0.000 claims description 19
- 150000002367 halogens Chemical class 0.000 claims description 19
- 230000001404 mediated effect Effects 0.000 claims description 18
- 208000035475 disorder Diseases 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 14
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000000623 heterocyclic group Chemical group 0.000 claims description 12
- 125000004193 piperazinyl group Chemical group 0.000 claims description 12
- 125000003386 piperidinyl group Chemical group 0.000 claims description 12
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 11
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 9
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 7
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 7
- SZHBKAXWRPHISH-UHFFFAOYSA-N 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-n-(4-fluorophenyl)benzamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(F)C=C1 SZHBKAXWRPHISH-UHFFFAOYSA-N 0.000 claims description 7
- RUBUMKVKAWCNHS-UHFFFAOYSA-N 2-[3-[2-adamantyl(methyl)amino]-2-hydroxypropoxy]benzoic acid Chemical compound C1C2CC(C3)CC1CC3C2N(C)CC(O)COC1=CC=CC=C1C(O)=O RUBUMKVKAWCNHS-UHFFFAOYSA-N 0.000 claims description 7
- WTWKISQPLWQAGT-UHFFFAOYSA-N n-(4-fluorophenyl)-2-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propoxy]benzamide Chemical compound C1CC(C=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(F)C=C1 WTWKISQPLWQAGT-UHFFFAOYSA-N 0.000 claims description 7
- ZPTINVLTBADDMU-UHFFFAOYSA-N 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-n-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=CC=C1OCC(O)CN1CCN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 ZPTINVLTBADDMU-UHFFFAOYSA-N 0.000 claims description 6
- UNJMNVIGOPYEDS-UHFFFAOYSA-N 2-[3-(4-benzylpiperidin-1-yl)-2-hydroxypropoxy]-5-bromo-n-(4-fluorophenyl)benzamide Chemical compound C1CC(CC=2C=CC=CC=2)CCN1CC(O)COC1=CC=C(Br)C=C1C(=O)NC1=CC=C(F)C=C1 UNJMNVIGOPYEDS-UHFFFAOYSA-N 0.000 claims description 6
- PFLCGHUEKVNDKP-UHFFFAOYSA-N 2-[3-(benzylamino)-2-hydroxypropoxy]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1OCC(O)CNCC1=CC=CC=C1 PFLCGHUEKVNDKP-UHFFFAOYSA-N 0.000 claims description 6
- KONSCZLKAIRAIC-UHFFFAOYSA-N 5-bromo-n-(4-fluorophenyl)-2-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propoxy]benzamide Chemical compound C1CC(C=2C=CC=CC=2)CCN1CC(O)COC1=CC=C(Br)C=C1C(=O)NC1=CC=C(F)C=C1 KONSCZLKAIRAIC-UHFFFAOYSA-N 0.000 claims description 6
- QQGWFQDFBONPCL-UHFFFAOYSA-N methyl 2-[3-[2-adamantyl(methyl)amino]-2-hydroxypropoxy]benzoate Chemical compound COC(=O)C1=CC=CC=C1OCC(O)CN(C)C1C(C2)CC3CC2CC1C3 QQGWFQDFBONPCL-UHFFFAOYSA-N 0.000 claims description 6
- RUOGZRWQPCUGGV-UHFFFAOYSA-N n-(2-fluorophenyl)-2-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propoxy]benzamide Chemical compound C1CC(C=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=CC=C1F RUOGZRWQPCUGGV-UHFFFAOYSA-N 0.000 claims description 6
- MGPDUDHDPNQQOH-UHFFFAOYSA-N 2-[2-hydroxy-3-(3-methylbutylamino)propoxy]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNCC(O)COC1=CC=CC=C1C(=O)NCCC(C)C MGPDUDHDPNQQOH-UHFFFAOYSA-N 0.000 claims description 5
- GEJKXDWUXSMTSF-UHFFFAOYSA-N 2-[2-hydroxy-3-(propylamino)propoxy]-n-(4-methylphenyl)benzamide Chemical compound CCCNCC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(C)C=C1 GEJKXDWUXSMTSF-UHFFFAOYSA-N 0.000 claims description 5
- WXBQPODTNVIYMG-UHFFFAOYSA-N 2-[2-hydroxy-3-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methylamino]propoxy]-n-(3-methylbutyl)-5-prop-2-ynoxybenzamide Chemical compound CC(C)CCNC(=O)C1=CC(OCC#C)=CC=C1OCC(O)CNCC1=CC=C(C2(N=N2)C(F)(F)F)C=C1 WXBQPODTNVIYMG-UHFFFAOYSA-N 0.000 claims description 5
- QWPSCBFDLGUFGL-UHFFFAOYSA-N 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-5-bromo-n-(4-fluorophenyl)benzamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)COC1=CC=C(Br)C=C1C(=O)NC1=CC=C(F)C=C1 QWPSCBFDLGUFGL-UHFFFAOYSA-N 0.000 claims description 5
- MAZRJBJJQRFRMT-UHFFFAOYSA-N 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-n-(2-fluorophenyl)benzamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=CC=C1F MAZRJBJJQRFRMT-UHFFFAOYSA-N 0.000 claims description 5
- XYTYYJDTUVHEBW-UHFFFAOYSA-N 2-[3-(4-benzylpiperidin-1-yl)-2-hydroxypropoxy]-n-(4-fluorophenyl)benzamide Chemical compound C1CC(CC=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(F)C=C1 XYTYYJDTUVHEBW-UHFFFAOYSA-N 0.000 claims description 5
- YGEZVRQMLKFAMT-UHFFFAOYSA-N 2-[3-(butylamino)-2-hydroxypropoxy]-n-(3-methylbutyl)benzamide Chemical compound CCCCNCC(O)COC1=CC=CC=C1C(=O)NCCC(C)C YGEZVRQMLKFAMT-UHFFFAOYSA-N 0.000 claims description 5
- VYZKNNVUCSCHLQ-UHFFFAOYSA-N 2-[3-(dibutylamino)-2-hydroxypropoxy]-n-(3-methylbutyl)benzamide Chemical compound CCCCN(CCCC)CC(O)COC1=CC=CC=C1C(=O)NCCC(C)C VYZKNNVUCSCHLQ-UHFFFAOYSA-N 0.000 claims description 5
- MDAMPKZYAWPFJY-UHFFFAOYSA-N 2-[3-(dibutylamino)-2-hydroxypropoxy]-n-(4-fluorophenyl)benzamide Chemical compound CCCCN(CCCC)CC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(F)C=C1 MDAMPKZYAWPFJY-UHFFFAOYSA-N 0.000 claims description 5
- DBPKQWDFDUEKOU-UHFFFAOYSA-N 2-[3-[(4-benzoylphenyl)methylamino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C=1C=CC=C(C(=O)NCC=2C=CC=CC=2)C=1OCC(O)CNCC(C=C1)=CC=C1C(=O)C1=CC=CC=C1 DBPKQWDFDUEKOU-UHFFFAOYSA-N 0.000 claims description 5
- YXYVAJUXVFEZAM-UHFFFAOYSA-N 2-[3-[2-adamantyl(2-phenylethyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C=1C=CC=CC=1CCN(C1C2CC3CC(C2)CC1C3)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 YXYVAJUXVFEZAM-UHFFFAOYSA-N 0.000 claims description 5
- BBFPMSIJPYDHBU-UHFFFAOYSA-N 2-[3-[2-adamantyl(methyl)amino]-2-hydroxypropoxy]-n-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]benzamide Chemical compound C1C2CC(C3)CC1CC3C2N(C)CC(O)COC1=CC=CC=C1C(=O)NCC(C=C1)=CC=C1C1(C(F)(F)F)N=N1 BBFPMSIJPYDHBU-UHFFFAOYSA-N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- BFBRKAYNBFQXHW-UHFFFAOYSA-N n-benzyl-2-[2-hydroxy-3-(3-phenylpropylamino)propoxy]benzamide Chemical compound C=1C=CC=C(C(=O)NCC=2C=CC=CC=2)C=1OCC(O)CNCCCC1=CC=CC=C1 BFBRKAYNBFQXHW-UHFFFAOYSA-N 0.000 claims description 5
- 229960000581 salicylamide Drugs 0.000 claims description 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 4
- SZTYXQJECNAYDU-UHFFFAOYSA-N 2-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propoxy]-n-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=CC=C1OCC(O)CN1CCC(C=2C=CC=CC=2)CC1 SZTYXQJECNAYDU-UHFFFAOYSA-N 0.000 claims description 4
- JOPUZOGJJACPPK-UHFFFAOYSA-N 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-5-chloro-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)COC1=CC=C(Cl)C=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 JOPUZOGJJACPPK-UHFFFAOYSA-N 0.000 claims description 4
- DFRFSOBMMJUOFL-UHFFFAOYSA-N 2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 DFRFSOBMMJUOFL-UHFFFAOYSA-N 0.000 claims description 4
- GPHTZAMSUKXKBU-UHFFFAOYSA-N 2-[3-(4-benzylpiperidin-1-yl)-2-hydroxypropoxy]-5-chloro-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound C1CC(CC=2C=CC=CC=2)CCN1CC(O)COC1=CC=C(Cl)C=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 GPHTZAMSUKXKBU-UHFFFAOYSA-N 0.000 claims description 4
- QNZCHRNDTVPKSL-UHFFFAOYSA-N 2-[3-(4-benzylpiperidin-1-yl)-2-hydroxypropoxy]-n-(2-fluorophenyl)benzamide Chemical compound C1CC(CC=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=CC=C1F QNZCHRNDTVPKSL-UHFFFAOYSA-N 0.000 claims description 4
- UJDSCANMBIUCRU-UHFFFAOYSA-N 2-[3-(4-benzylpiperidin-1-yl)-2-hydroxypropoxy]-n-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=CC=C1OCC(O)CN1CCC(CC=2C=CC=CC=2)CC1 UJDSCANMBIUCRU-UHFFFAOYSA-N 0.000 claims description 4
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 4
- 125000001475 halogen functional group Chemical group 0.000 claims description 4
- 239000007856 photoaffinity label Substances 0.000 claims description 4
- YFNCUBLSBJBLCB-UHFFFAOYSA-N 2-(oxiran-2-ylmethoxy)-n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=C(OCC2OC2)C=1C(=O)NCCC1=CC=CC=C1 YFNCUBLSBJBLCB-UHFFFAOYSA-N 0.000 claims description 3
- YKQKLKSMFKHTEF-UHFFFAOYSA-N 2-(oxiran-2-ylmethoxy)-n-(3-phenylpropyl)benzamide Chemical compound C=1C=CC=C(OCC2OC2)C=1C(=O)NCCCC1=CC=CC=C1 YKQKLKSMFKHTEF-UHFFFAOYSA-N 0.000 claims description 3
- NXECPWUVCSDKQI-UHFFFAOYSA-N 2-(oxiran-2-ylmethoxy)-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound FC(F)(F)C1=CC=CC(NC(=O)C=2C(=CC=CC=2)OCC2OC2)=C1 NXECPWUVCSDKQI-UHFFFAOYSA-N 0.000 claims description 3
- DHKFTMXBPKFEAZ-UHFFFAOYSA-N 2-(oxiran-2-ylmethoxy)-n-[[4-(trifluoromethyl)phenyl]methyl]benzamide Chemical compound C1=CC(C(F)(F)F)=CC=C1CNC(=O)C1=CC=CC=C1OCC1OC1 DHKFTMXBPKFEAZ-UHFFFAOYSA-N 0.000 claims description 3
- CYNCQWHZARYJNA-UHFFFAOYSA-N 2-[3-(1-adamantylamino)-2-hydroxypropoxy]-n-(4-bromophenyl)benzamide Chemical compound C1C(C2)CC(C3)CC2CC13NCC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(Br)C=C1 CYNCQWHZARYJNA-UHFFFAOYSA-N 0.000 claims description 3
- BVAOTHKJTHKBEH-UHFFFAOYSA-N 2-[3-(1-adamantylamino)-2-hydroxypropoxy]-n-(4-fluorophenyl)benzamide Chemical compound C1C(C2)CC(C3)CC2CC13NCC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(F)C=C1 BVAOTHKJTHKBEH-UHFFFAOYSA-N 0.000 claims description 3
- HPLCYHFSKKVYGV-UHFFFAOYSA-N 2-[3-(1-adamantylamino)-2-hydroxypropoxy]-n-[(2-methoxyphenyl)methyl]benzamide Chemical compound COC1=CC=CC=C1CNC(=O)C1=CC=CC=C1OCC(O)CNC1(C2)CC(C3)CC2CC3C1 HPLCYHFSKKVYGV-UHFFFAOYSA-N 0.000 claims description 3
- CMFLNDSRSHWZMJ-UHFFFAOYSA-N 2-[3-(1-adamantylamino)-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C(C2)CC(C3)CC2CC13NCC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 CMFLNDSRSHWZMJ-UHFFFAOYSA-N 0.000 claims description 3
- DGFGZSGPLBZYGH-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-5-chloro-n-(2-phenylethyl)benzamide Chemical compound C1C2CC(C3)CC1CC3C2NCC(O)COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=CC=C1 DGFGZSGPLBZYGH-UHFFFAOYSA-N 0.000 claims description 3
- ZTXKWAGQKGSPKL-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-n-(2-phenylethyl)benzamide Chemical compound C1C2CC(C3)CC1CC3C2NCC(O)COC1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 ZTXKWAGQKGSPKL-UHFFFAOYSA-N 0.000 claims description 3
- GBPYQWRSXLDKLA-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-n-(3-phenylpropyl)benzamide Chemical compound C1C2CC(C3)CC1CC3C2NCC(O)COC1=CC=CC=C1C(=O)NCCCC1=CC=CC=C1 GBPYQWRSXLDKLA-UHFFFAOYSA-N 0.000 claims description 3
- OXERWTWOCOKMOK-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-n-[(2-methoxyphenyl)methyl]benzamide Chemical compound COC1=CC=CC=C1CNC(=O)C1=CC=CC=C1OCC(O)CNC1C(C2)CC3CC2CC1C3 OXERWTWOCOKMOK-UHFFFAOYSA-N 0.000 claims description 3
- JPJDEQWIDHFKKR-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-n-[(4-methoxyphenyl)methyl]benzamide Chemical compound C1=CC(OC)=CC=C1CNC(=O)C1=CC=CC=C1OCC(O)CNC1C(C2)CC3CC2CC1C3 JPJDEQWIDHFKKR-UHFFFAOYSA-N 0.000 claims description 3
- TZGATEMHIPZDLE-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C2CC(C3)CC1CC3C2NCC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 TZGATEMHIPZDLE-UHFFFAOYSA-N 0.000 claims description 3
- DXUFRSXLWMCEEB-UHFFFAOYSA-N 2-[3-(2-adamantylamino)-2-hydroxypropoxy]-n-propylbenzamide Chemical compound CCCNC(=O)C1=CC=CC=C1OCC(O)CNC1C(C2)CC3CC2CC1C3 DXUFRSXLWMCEEB-UHFFFAOYSA-N 0.000 claims description 3
- ZKUTVCLAWWFFPM-UHFFFAOYSA-N 2-[3-[1-(1-adamantyl)ethylamino]-2-hydroxypropoxy]-n-(4-methylphenyl)benzamide Chemical compound C1C(C2)CC(C3)CC2CC13C(C)NCC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(C)C=C1 ZKUTVCLAWWFFPM-UHFFFAOYSA-N 0.000 claims description 3
- BWXQEMXIIDYXQT-UHFFFAOYSA-N 2-[3-[1-(1-adamantyl)ethylamino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C(C2)CC(C3)CC2CC13C(C)NCC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 BWXQEMXIIDYXQT-UHFFFAOYSA-N 0.000 claims description 3
- DXNUBTQDYLRPIT-UHFFFAOYSA-N 2-[3-[1-adamantylmethyl(methyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C(C2)CC(C3)CC2CC13CN(C)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 DXNUBTQDYLRPIT-UHFFFAOYSA-N 0.000 claims description 3
- IOARWPNCVFDCKG-UHFFFAOYSA-N 2-[3-[2-(1-adamantyl)ethylamino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C(C2)CC(C3)CC2CC13CCNCC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 IOARWPNCVFDCKG-UHFFFAOYSA-N 0.000 claims description 3
- VOHBDHMMUAANQD-UHFFFAOYSA-N 2-[3-[2-adamantyl(cyclopropyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1CC1N(C1C2CC3CC(C2)CC1C3)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 VOHBDHMMUAANQD-UHFFFAOYSA-N 0.000 claims description 3
- WECAVAZEBMEBLV-UHFFFAOYSA-N 2-[3-[2-adamantyl(methyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C2CC(C3)CC1CC3C2N(C)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 WECAVAZEBMEBLV-UHFFFAOYSA-N 0.000 claims description 3
- COKSCZFBMIUKFK-UHFFFAOYSA-N 2-[3-[2-adamantyl(pentyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C2CC(C3)CC1CC3C2N(CCCCC)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 COKSCZFBMIUKFK-UHFFFAOYSA-N 0.000 claims description 3
- SZIJFAPPCJYRCW-UHFFFAOYSA-N 3-[3-(1-adamantylamino)-2-hydroxypropoxy]-n-(4-fluorophenyl)naphthalene-2-carboxamide Chemical compound C1C(C2)CC(C3)CC2CC13NCC(O)COC1=CC2=CC=CC=C2C=C1C(=O)NC1=CC=C(F)C=C1 SZIJFAPPCJYRCW-UHFFFAOYSA-N 0.000 claims description 3
- KYOZUXWPSBBRJJ-UHFFFAOYSA-N 5-chloro-2-(oxiran-2-ylmethoxy)-n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=CC=1CCNC(=O)C1=CC(Cl)=CC=C1OCC1CO1 KYOZUXWPSBBRJJ-UHFFFAOYSA-N 0.000 claims description 3
- ZCJAVDGQAJOEDZ-UHFFFAOYSA-N 5-chloro-2-(oxiran-2-ylmethoxy)-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound FC(F)(F)C1=CC=CC(NC(=O)C=2C(=CC=C(Cl)C=2)OCC2OC2)=C1 ZCJAVDGQAJOEDZ-UHFFFAOYSA-N 0.000 claims description 3
- AQNXIDDLCLDQMD-UHFFFAOYSA-N 5-chloro-2-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propoxy]-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound C1CC(C=2C=CC=CC=2)CCN1CC(O)COC1=CC=C(Cl)C=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 AQNXIDDLCLDQMD-UHFFFAOYSA-N 0.000 claims description 3
- QTOZDGRIULTXGV-UHFFFAOYSA-N 5-chloro-2-hydroxy-n-(naphthalen-1-ylmethyl)benzamide Chemical compound OC1=CC=C(Cl)C=C1C(=O)NCC1=CC=CC2=CC=CC=C12 QTOZDGRIULTXGV-UHFFFAOYSA-N 0.000 claims description 3
- SRNULMVZIBHMHG-UHFFFAOYSA-N 5-chloro-n-(4-fluorophenyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC(Cl)=CC=C1OCC1OC1 SRNULMVZIBHMHG-UHFFFAOYSA-N 0.000 claims description 3
- MBPDVXFFKFZXRX-UHFFFAOYSA-N 5-chloro-n-(naphthalen-1-ylmethyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound C=1C=CC2=CC=CC=C2C=1CNC(=O)C1=CC(Cl)=CC=C1OCC1CO1 MBPDVXFFKFZXRX-UHFFFAOYSA-N 0.000 claims description 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 3
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 3
- 150000008366 benzophenones Chemical class 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- WYKMNAOWSVPHAE-UHFFFAOYSA-N n-(2,4-difluorophenyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound FC1=CC(F)=CC=C1NC(=O)C1=CC=CC=C1OCC1OC1 WYKMNAOWSVPHAE-UHFFFAOYSA-N 0.000 claims description 3
- HOBPGWGPQYMLJK-UHFFFAOYSA-N n-(2-fluorophenyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound FC1=CC=CC=C1NC(=O)C1=CC=CC=C1OCC1OC1 HOBPGWGPQYMLJK-UHFFFAOYSA-N 0.000 claims description 3
- OXQBIJKCHLFSKT-UHFFFAOYSA-N n-(3-methylbutyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1OCC1OC1 OXQBIJKCHLFSKT-UHFFFAOYSA-N 0.000 claims description 3
- TUZBSOYMLHRWDG-UHFFFAOYSA-N n-(4-fluorophenyl)-2-(oxiran-2-ylmethoxy)-5-prop-2-ynoxybenzamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC(OCC#C)=CC=C1OCC1OC1 TUZBSOYMLHRWDG-UHFFFAOYSA-N 0.000 claims description 3
- NUHXHWGEJVEVQM-UHFFFAOYSA-N n-(4-fluorophenyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC=CC=C1OCC1OC1 NUHXHWGEJVEVQM-UHFFFAOYSA-N 0.000 claims description 3
- LWHTYWYRXYJWEF-UHFFFAOYSA-N n-(4-fluorophenyl)-2-hydroxy-5-prop-2-ynoxybenzamide Chemical compound OC1=CC=C(OCC#C)C=C1C(=O)NC1=CC=C(F)C=C1 LWHTYWYRXYJWEF-UHFFFAOYSA-N 0.000 claims description 3
- XTZPYJJNQZIKTG-UHFFFAOYSA-N n-[(2-methoxyphenyl)methyl]-2-(oxiran-2-ylmethoxy)benzamide Chemical compound COC1=CC=CC=C1CNC(=O)C1=CC=CC=C1OCC1OC1 XTZPYJJNQZIKTG-UHFFFAOYSA-N 0.000 claims description 3
- VIXSJPNJWYSJAC-UHFFFAOYSA-N n-[(4-methoxyphenyl)methyl]-2-(oxiran-2-ylmethoxy)benzamide Chemical compound C1=CC(OC)=CC=C1CNC(=O)C1=CC=CC=C1OCC1OC1 VIXSJPNJWYSJAC-UHFFFAOYSA-N 0.000 claims description 3
- RFOXQRLNSLJINF-UHFFFAOYSA-N n-naphthalen-2-yl-2-(oxiran-2-ylmethoxy)benzamide Chemical compound C=1C=C2C=CC=CC2=CC=1NC(=O)C1=CC=CC=C1OCC1CO1 RFOXQRLNSLJINF-UHFFFAOYSA-N 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- DPVPROWBYQAGJH-UHFFFAOYSA-N 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-5-chloro-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound C1C(C2)CC(C3)CC2CC13CNCC(O)COC1=CC=C(Cl)C=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 DPVPROWBYQAGJH-UHFFFAOYSA-N 0.000 claims description 2
- SNFKBDLOOQGERI-UHFFFAOYSA-N 2-[3-[2-adamantyl(propyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C1C2CC(C3)CC1CC3C2N(CCC)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 SNFKBDLOOQGERI-UHFFFAOYSA-N 0.000 claims description 2
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 claims description 2
- VNXFXHBZDLNLJB-UHFFFAOYSA-N n-(4-fluorophenyl)-2-[2-hydroxy-3-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methylamino]propoxy]-5-prop-2-ynoxybenzamide Chemical compound C=1C=C(OCC#C)C=C(C(=O)NC=2C=CC(F)=CC=2)C=1OCC(O)CNCC(C=C1)=CC=C1C1(C(F)(F)F)N=N1 VNXFXHBZDLNLJB-UHFFFAOYSA-N 0.000 claims description 2
- SXRZCKQHNGEMQY-UHFFFAOYSA-N n-benzyl-2-[3-(cyclododecylamino)-2-hydroxypropoxy]benzamide Chemical compound C=1C=CC=C(C(=O)NCC=2C=CC=CC=2)C=1OCC(O)CNC1CCCCCCCCCCC1 SXRZCKQHNGEMQY-UHFFFAOYSA-N 0.000 claims description 2
- SLRBLQTUSTYOHS-UHFFFAOYSA-N n-benzyl-2-[3-(cyclooctylamino)-2-hydroxypropoxy]benzamide Chemical compound C=1C=CC=C(C(=O)NCC=2C=CC=CC=2)C=1OCC(O)CNC1CCCCCCC1 SLRBLQTUSTYOHS-UHFFFAOYSA-N 0.000 claims description 2
- SDDOWQFJUIAPBO-UHFFFAOYSA-N 2-[2-hydroxy-3-[(3-hydroxy-1-adamantyl)amino]propoxy]-n-[3-(trifluoromethyl)phenyl]benzamide Chemical compound C1C(C2)CC(C3)CC2(O)CC13NCC(O)COC1=CC=CC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 SDDOWQFJUIAPBO-UHFFFAOYSA-N 0.000 claims 2
- ILKNJFMSLXVHKM-UHFFFAOYSA-N 2-[3-[2-adamantyl(methyl)amino]-2-hydroxypropoxy]-n-[[4-(trifluoromethyl)phenyl]methyl]benzamide Chemical compound C1C2CC(C3)CC1CC3C2N(C)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=C(C(F)(F)F)C=C1 ILKNJFMSLXVHKM-UHFFFAOYSA-N 0.000 claims 2
- WUMWLYKEXQJOQS-UHFFFAOYSA-N 2-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-hydroxypropoxy]-n-[(4-methoxyphenyl)methyl]benzamide Chemical compound C1=CC(OC)=CC=C1CNC(=O)C1=CC=CC=C1OCC(O)CN1CCN(C=2C(=C(C)C=CC=2)C)CC1 WUMWLYKEXQJOQS-UHFFFAOYSA-N 0.000 claims 2
- WZPJXKGAVYXBPT-UHFFFAOYSA-N n-benzyl-2-[2-hydroxy-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl-propylamino]propoxy]benzamide Chemical compound C=1C=C(OC)C(OCC#C)=CC=1CN(CCC)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 WZPJXKGAVYXBPT-UHFFFAOYSA-N 0.000 claims 2
- ITZHXYOJZHGTFF-UHFFFAOYSA-N 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-5-bromo-n-(4-fluorophenyl)benzamide Chemical compound C1C(C2)CC(C3)CC2CC13CNCC(O)COC1=CC=C(Br)C=C1C(=O)NC1=CC=C(F)C=C1 ITZHXYOJZHGTFF-UHFFFAOYSA-N 0.000 claims 1
- GQGKTOWLULPAHN-UHFFFAOYSA-N 3-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-n-(4-fluorophenyl)naphthalene-2-carboxamide Chemical compound C1C(C2)CC(C3)CC2CC13CNCC(O)COC1=CC2=CC=CC=C2C=C1C(=O)NC1=CC=C(F)C=C1 GQGKTOWLULPAHN-UHFFFAOYSA-N 0.000 claims 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 108010011222 cyclo(Arg-Pro) Proteins 0.000 claims 1
- 229940124531 pharmaceutical excipient Drugs 0.000 claims 1
- 238000005481 NMR spectroscopy Methods 0.000 description 175
- 238000006243 chemical reaction Methods 0.000 description 45
- 239000000203 mixture Substances 0.000 description 33
- 238000002360 preparation method Methods 0.000 description 28
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000008186 active pharmaceutical agent Substances 0.000 description 24
- 229940088679 drug related substance Drugs 0.000 description 24
- 239000003430 antimalarial agent Substances 0.000 description 23
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 23
- 201000004792 malaria Diseases 0.000 description 21
- 150000001412 amines Chemical group 0.000 description 16
- 239000000126 substance Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 241000223960 Plasmodium falciparum Species 0.000 description 15
- 239000000543 intermediate Substances 0.000 description 15
- WHTVZRBIWZFKQO-AWEZNQCLSA-N (S)-chloroquine Chemical compound ClC1=CC=C2C(N[C@@H](C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-AWEZNQCLSA-N 0.000 description 14
- 230000000078 anti-malarial effect Effects 0.000 description 14
- 229960003677 chloroquine Drugs 0.000 description 14
- WHTVZRBIWZFKQO-UHFFFAOYSA-N chloroquine Natural products ClC1=CC=C2C(NC(C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-UHFFFAOYSA-N 0.000 description 14
- 238000012512 characterization method Methods 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- BLUAFEHZUWYNDE-NNWCWBAJSA-N artemisinin Chemical compound C([C@](OO1)(C)O2)C[C@H]3[C@H](C)CC[C@@H]4[C@@]31[C@@H]2OC(=O)[C@@H]4C BLUAFEHZUWYNDE-NNWCWBAJSA-N 0.000 description 12
- 201000010099 disease Diseases 0.000 description 12
- 235000019439 ethyl acetate Nutrition 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 238000002965 ELISA Methods 0.000 description 11
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 11
- 125000003342 alkenyl group Chemical group 0.000 description 11
- 229930101531 artemisinin Natural products 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 229960004191 artemisinin Drugs 0.000 description 10
- JWHAUXFOSRPERK-UHFFFAOYSA-N propafenone Chemical compound CCCNCC(O)COC1=CC=CC=C1C(=O)CCC1=CC=CC=C1 JWHAUXFOSRPERK-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 244000045947 parasite Species 0.000 description 9
- 238000007142 ring opening reaction Methods 0.000 description 9
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 8
- 229940033495 antimalarials Drugs 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000003919 heteronuclear multiple bond coherence Methods 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- 229960000203 propafenone Drugs 0.000 description 8
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 7
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical class NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 125000001153 fluoro group Chemical group F* 0.000 description 7
- DYLGFOYVTXJFJP-MYYYXRDXSA-N lumefantrine Chemical compound C12=CC(Cl)=CC=C2C=2C(C(O)CN(CCCC)CCCC)=CC(Cl)=CC=2\C1=C/C1=CC=C(Cl)C=C1 DYLGFOYVTXJFJP-MYYYXRDXSA-N 0.000 description 7
- 229960004985 lumefantrine Drugs 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 208000000230 African Trypanosomiasis Diseases 0.000 description 6
- 208000009182 Parasitemia Diseases 0.000 description 6
- 208000030852 Parasitic disease Diseases 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 208000029080 human African trypanosomiasis Diseases 0.000 description 6
- CDNNMNLILHWPMH-UHFFFAOYSA-N methyl 2-(oxiran-2-ylmethoxy)benzoate Chemical compound COC(=O)C1=CC=CC=C1OCC1OC1 CDNNMNLILHWPMH-UHFFFAOYSA-N 0.000 description 6
- 201000002612 sleeping sickness Diseases 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- OPUPBQQWLWFCPU-UHFFFAOYSA-N 2-benzylbenzamide Chemical compound NC(=O)C1=CC=CC=C1CC1=CC=CC=C1 OPUPBQQWLWFCPU-UHFFFAOYSA-N 0.000 description 5
- 125000003670 adamantan-2-yl group Chemical group [H]C1([H])C(C2([H])[H])([H])C([H])([H])C3([H])C([*])([H])C1([H])C([H])([H])C2([H])C3([H])[H] 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 125000001246 bromo group Chemical group Br* 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000004132 cross linking Methods 0.000 description 5
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 5
- 238000011161 development Methods 0.000 description 5
- SXYIRMFQILZOAM-HVNFFKDJSA-N dihydroartemisinin methyl ether Chemical compound C1C[C@H]2[C@H](C)CC[C@H]3[C@@H](C)[C@@H](OC)O[C@H]4[C@]32OO[C@@]1(C)O4 SXYIRMFQILZOAM-HVNFFKDJSA-N 0.000 description 5
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 125000000466 oxiranyl group Chemical group 0.000 description 5
- 150000003902 salicylic acid esters Chemical class 0.000 description 5
- 239000012453 solvate Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- XEEQGYMUWCZPDN-DOMZBBRYSA-N (-)-(11S,2'R)-erythro-mefloquine Chemical compound C([C@@H]1[C@@H](O)C=2C3=CC=CC(=C3N=C(C=2)C(F)(F)F)C(F)(F)F)CCCN1 XEEQGYMUWCZPDN-DOMZBBRYSA-N 0.000 description 4
- SPEOMHIYFBFKKK-UHFFFAOYSA-N 2-(4-fluorophenyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=C(F)C=C1 SPEOMHIYFBFKKK-UHFFFAOYSA-N 0.000 description 4
- JXMDJGJFYABZEN-UHFFFAOYSA-N 2-[(2-methoxyphenyl)methyl]benzamide Chemical compound COC1=CC=CC=C1CC1=CC=CC=C1C(N)=O JXMDJGJFYABZEN-UHFFFAOYSA-N 0.000 description 4
- QDAVBKJOGAOQJQ-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]benzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=CC(C(F)(F)F)=C1 QDAVBKJOGAOQJQ-UHFFFAOYSA-N 0.000 description 4
- QMLRNTPTRWMCOP-UHFFFAOYSA-N 2-hydroxy-n-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=CC=C1O QMLRNTPTRWMCOP-UHFFFAOYSA-N 0.000 description 4
- 241000224482 Apicomplexa Species 0.000 description 4
- 235000001258 Cinchona calisaya Nutrition 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 102100031001 Hepatoma-derived growth factor-related protein 2 Human genes 0.000 description 4
- 101710169678 Histidine-rich protein Proteins 0.000 description 4
- 101001083788 Homo sapiens Hepatoma-derived growth factor-related protein 2 Proteins 0.000 description 4
- 241000222712 Kinetoplastida Species 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 241000243190 Microsporidia Species 0.000 description 4
- 238000010934 O-alkylation reaction Methods 0.000 description 4
- 241000224017 Plasmodium berghei Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000001345 alkine derivatives Chemical group 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 4
- 210000003743 erythrocyte Anatomy 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229960001962 mefloquine Drugs 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 229960000948 quinine Drugs 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- VAIAMQZKXPXQBE-UHFFFAOYSA-N 2-(3-phenylpropyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1CCCC1=CC=CC=C1 VAIAMQZKXPXQBE-UHFFFAOYSA-N 0.000 description 3
- JCKSUEMHTRAARH-UHFFFAOYSA-N 2-[2-hydroxy-3-[[4-(trifluoromethyl)phenyl]methylamino]propoxy]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1OCC(O)CNCC1=CC=C(C(F)(F)F)C=C1 JCKSUEMHTRAARH-UHFFFAOYSA-N 0.000 description 3
- UXYMTVZHGSBSCD-UHFFFAOYSA-N 2-hydroxy-n-(3-methylbutyl)-5-prop-2-ynoxybenzamide Chemical compound CC(C)CCNC(=O)C1=CC(OCC#C)=CC=C1O UXYMTVZHGSBSCD-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- 208000004881 Amebiasis Diseases 0.000 description 3
- 206010001935 American trypanosomiasis Diseases 0.000 description 3
- 206010001980 Amoebiasis Diseases 0.000 description 3
- 102100034612 Annexin A4 Human genes 0.000 description 3
- 208000024699 Chagas disease Diseases 0.000 description 3
- 208000003495 Coccidiosis Diseases 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 206010023076 Isosporiasis Diseases 0.000 description 3
- 208000004554 Leishmaniasis Diseases 0.000 description 3
- 239000012980 RPMI-1640 medium Substances 0.000 description 3
- 208000001117 Theileriasis Diseases 0.000 description 3
- 201000005485 Toxoplasmosis Diseases 0.000 description 3
- 208000005448 Trichomonas Infections Diseases 0.000 description 3
- 206010044620 Trichomoniasis Diseases 0.000 description 3
- 241000223109 Trypanosoma cruzi Species 0.000 description 3
- 125000003158 alcohol group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000003288 anthiarrhythmic effect Effects 0.000 description 3
- 229960000981 artemether Drugs 0.000 description 3
- 125000001769 aryl amino group Chemical group 0.000 description 3
- 201000008680 babesiosis Diseases 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 201000006592 giardiasis Diseases 0.000 description 3
- 230000009036 growth inhibition Effects 0.000 description 3
- 239000012456 homogeneous solution Substances 0.000 description 3
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- DCQRAXRUXDLKLP-UHFFFAOYSA-N n-(3-methylbutyl)-2-(oxiran-2-ylmethoxy)-5-prop-2-ynoxybenzamide Chemical compound CC(C)CCNC(=O)C1=CC(OCC#C)=CC=C1OCC1OC1 DCQRAXRUXDLKLP-UHFFFAOYSA-N 0.000 description 3
- JDSJUZXPNXZLEA-UHFFFAOYSA-N n-(4-methylphenyl)-2-(oxiran-2-ylmethoxy)benzamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=CC=C1OCC1OC1 JDSJUZXPNXZLEA-UHFFFAOYSA-N 0.000 description 3
- 230000000269 nucleophilic effect Effects 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 201000002311 trypanosomiasis Diseases 0.000 description 3
- BRLQWZUYTZBJKN-GSVOUGTGSA-N (+)-Epichlorohydrin Chemical compound ClC[C@@H]1CO1 BRLQWZUYTZBJKN-GSVOUGTGSA-N 0.000 description 2
- ZXAQFYZQHPGMMN-BZSJEYESSA-N (3R)-3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylcyclohexane-1-carboxamide Chemical compound C1C[C@H](CC(C1)C(=O)NC2=CC=CC=C2)OC3=CC(=CC(=N3)C(F)(F)F)CN ZXAQFYZQHPGMMN-BZSJEYESSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- SZDCASJNCGOZOC-UHFFFAOYSA-N 2-(2-fluorophenyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=CC=C1F SZDCASJNCGOZOC-UHFFFAOYSA-N 0.000 description 2
- RIMLYMAUYDOKDM-UHFFFAOYSA-N 2-(2-phenylethyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 RIMLYMAUYDOKDM-UHFFFAOYSA-N 0.000 description 2
- MVLILGWACDODQX-UHFFFAOYSA-N 2-(4-bromophenyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=C(Br)C=C1 MVLILGWACDODQX-UHFFFAOYSA-N 0.000 description 2
- RYZATFKIDWUPKZ-UHFFFAOYSA-N 2-[3-[2-adamantyl(3-phenylpropyl)amino]-2-hydroxypropoxy]-n-benzylbenzamide Chemical compound C=1C=CC=CC=1CCCN(C1C2CC3CC(C2)CC1C3)CC(O)COC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 RYZATFKIDWUPKZ-UHFFFAOYSA-N 0.000 description 2
- RAUAGPWVCYSUHN-UHFFFAOYSA-N 2-[3-[4-(1-adamantyl)piperazin-1-yl]-2-hydroxypropoxy]-n-(4-fluorophenyl)benzamide Chemical compound C1CN(C23CC4CC(CC(C4)C2)C3)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=C(F)C=C1 RAUAGPWVCYSUHN-UHFFFAOYSA-N 0.000 description 2
- GARLNRUQNQMJAB-UHFFFAOYSA-N 2-bromo-n-(4-fluorophenyl)benzamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC=CC=C1Br GARLNRUQNQMJAB-UHFFFAOYSA-N 0.000 description 2
- PLSUZSSOFMKWLH-UHFFFAOYSA-N 2-chloro-N-(2-phenylethyl)benzamide Chemical compound ClC1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 PLSUZSSOFMKWLH-UHFFFAOYSA-N 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- IZRDLZYOQSBCNG-UHFFFAOYSA-N 2-propylbenzamide Chemical compound CCCC1=CC=CC=C1C(N)=O IZRDLZYOQSBCNG-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- OQCTXMMYAKPOAB-UHFFFAOYSA-N 4-(2-methylphenyl)benzamide Chemical compound CC1=CC=CC=C1C1=CC=C(C(N)=O)C=C1 OQCTXMMYAKPOAB-UHFFFAOYSA-N 0.000 description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- GBUBPVYBEDKNGL-UHFFFAOYSA-N COC1=CC=C(CC2=C(C(=O)N)C=CC=C2)C=C1 Chemical compound COC1=CC=C(CC2=C(C(=O)N)C=CC=C2)C=C1 GBUBPVYBEDKNGL-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 241000283984 Rodentia Species 0.000 description 2
- SBACTKCQVUFKLY-UHFFFAOYSA-N [4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanamine Chemical compound C1=CC(CN)=CC=C1C1(C(F)(F)F)N=N1 SBACTKCQVUFKLY-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001414 amino alcohols Chemical group 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229940098333 coartem Drugs 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000010779 crude oil Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000006352 cycloaddition reaction Methods 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 150000004845 diazirines Chemical class 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 238000007876 drug discovery Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 238000005534 hematocrit Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NYSBGIRCJZXKQI-UHFFFAOYSA-N methyl 2-hydroxy-5-prop-2-ynoxybenzoate Chemical compound COC(=O)C1=CC(OCC#C)=CC=C1O NYSBGIRCJZXKQI-UHFFFAOYSA-N 0.000 description 2
- XGDPKUKRQHHZTH-UHFFFAOYSA-N methyl gentisate Natural products COC(=O)C1=CC(O)=CC=C1O XGDPKUKRQHHZTH-UHFFFAOYSA-N 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- NDEGDTWDBWVOSO-UHFFFAOYSA-N n-(2-phenylethyl)-2-propoxybenzamide Chemical compound CCCOC1=CC=CC=C1C(=O)NCCC1=CC=CC=C1 NDEGDTWDBWVOSO-UHFFFAOYSA-N 0.000 description 2
- VJHCZGBXMDLQHT-UHFFFAOYSA-N n-(3-methylbutyl)-2-propoxybenzamide Chemical compound CCCOC1=CC=CC=C1C(=O)NCCC(C)C VJHCZGBXMDLQHT-UHFFFAOYSA-N 0.000 description 2
- XKGPNSLQHYESJB-UHFFFAOYSA-N n-naphthalen-2-yl-2-propoxybenzamide Chemical compound CCCOC1=CC=CC=C1C(=O)NC1=CC=C(C=CC=C2)C2=C1 XKGPNSLQHYESJB-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- TURAMGVWNUTQKH-UHFFFAOYSA-N propa-1,2-dien-1-one Chemical group C=C=C=O TURAMGVWNUTQKH-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 238000009097 single-agent therapy Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 230000007480 spreading Effects 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- XSOHXMFFSKTSIT-UHFFFAOYSA-N 1-adamantylmethanamine Chemical compound C1C(C2)CC3CC2CC1(CN)C3 XSOHXMFFSKTSIT-UHFFFAOYSA-N 0.000 description 1
- DFPYXQYWILNVAU-UHFFFAOYSA-N 1-hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 DFPYXQYWILNVAU-UHFFFAOYSA-N 0.000 description 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical class C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 1
- KIPNXZZNYXFXBI-UHFFFAOYSA-N 2-[3-(1-adamantylamino)-2-hydroxypropoxy]-5-bromo-n-(4-fluorophenyl)benzamide Chemical compound C1C(C2)CC(C3)CC2CC13NCC(O)COC1=CC=C(Br)C=C1C(=O)NC1=CC=C(F)C=C1 KIPNXZZNYXFXBI-UHFFFAOYSA-N 0.000 description 1
- CMJRWZZVSYGIJA-UHFFFAOYSA-N 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-n-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=CC=C1OCC(O)CNCC1(C2)CC(C3)CC2CC3C1 CMJRWZZVSYGIJA-UHFFFAOYSA-N 0.000 description 1
- FGLKZIXGYMREQW-UHFFFAOYSA-N 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-n-naphthalen-2-ylbenzamide Chemical compound C1=CC=CC2=CC(NC(=O)C3=CC=CC=C3OCC(CNCC34CC5CC(CC(C5)C3)C4)O)=CC=C21 FGLKZIXGYMREQW-UHFFFAOYSA-N 0.000 description 1
- AVKCCNITNZVLNQ-UHFFFAOYSA-N 2-[3-[1-(1-adamantyl)ethylamino]-2-hydroxypropoxy]-n-(3-methylbutyl)benzamide Chemical compound CC(C)CCNC(=O)C1=CC=CC=C1OCC(O)CNC(C)C1(C2)CC(C3)CC2CC3C1 AVKCCNITNZVLNQ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- SONNQRNOTIAJDS-GFCCVEGCSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-[(2R)-2,3-dihydroxypropyl]benzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NC[C@H](CO)O)C=CC=1 SONNQRNOTIAJDS-GFCCVEGCSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- ZFYXJIYPIORSQE-UHFFFAOYSA-N 5-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-(2-methylsulfonylethyl)pyridine-3-carboxamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=NC=C(C(=O)NCCS(=O)(=O)C)C=1 ZFYXJIYPIORSQE-UHFFFAOYSA-N 0.000 description 1
- NALREUIWICQLPS-UHFFFAOYSA-N 7-imino-n,n-dimethylphenothiazin-3-amine;hydrochloride Chemical compound [Cl-].C1=C(N)C=C2SC3=CC(=[N+](C)C)C=CC3=NC2=C1 NALREUIWICQLPS-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- BXFVVDCGQXCZNA-UHFFFAOYSA-N C(C#C)Br.COC(C1=C(C=CC(=C1)OCC#C)O)=O Chemical compound C(C#C)Br.COC(C1=C(C=CC(=C1)OCC#C)O)=O BXFVVDCGQXCZNA-UHFFFAOYSA-N 0.000 description 1
- 208000020446 Cardiac disease Diseases 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 206010059866 Drug resistance Diseases 0.000 description 1
- 238000006736 Huisgen cycloaddition reaction Methods 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 241000224453 Mycoplasma coccoides Species 0.000 description 1
- 241000546176 Mycoplasma haemomuris Species 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 238000011785 NMRI mouse Methods 0.000 description 1
- 241000224016 Plasmodium Species 0.000 description 1
- 238000006529 Prey cleavage reaction Methods 0.000 description 1
- 101710084593 Sensory histidine kinase/phosphatase NtrB Proteins 0.000 description 1
- JWSIZPAOIFLWKM-UHFFFAOYSA-N [3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxyphenyl]-[3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]methanone Chemical compound CN(C)C1CN(CC1O)C(=O)c1cccc(Oc2cc(CN)cc(n2)C(F)(F)F)c1 JWSIZPAOIFLWKM-UHFFFAOYSA-N 0.000 description 1
- 238000003289 [3H]hypoxanthine assay Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 125000005087 alkynylcarbonyl group Chemical group 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- FIHJKUPKCHIPAT-AHIGJZGOSA-N artesunate Chemical compound C([C@](OO1)(C)O2)C[C@H]3[C@H](C)CC[C@@H]4[C@@]31[C@@H]2O[C@@H](OC(=O)CCC(O)=O)[C@@H]4C FIHJKUPKCHIPAT-AHIGJZGOSA-N 0.000 description 1
- 229960004991 artesunate Drugs 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- UULFQJNAQUPEPQ-UHFFFAOYSA-N benzamide;2-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-n-(2-fluorophenyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1.C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)COC1=CC=CC=C1C(=O)NC1=CC=CC=C1F UULFQJNAQUPEPQ-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical group C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 230000005574 cross-species transmission Effects 0.000 description 1
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 230000002498 deadly effect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002118 epoxides Chemical group 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002576 ketones Chemical group 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 125000004492 methyl ester group Chemical group 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- AZJHJQPKYMVIPC-UHFFFAOYSA-N n-(4-fluorophenyl)naphthalene-2-carboxamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC=C(C=CC=C2)C2=C1 AZJHJQPKYMVIPC-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- VSKMVAJFNWCWPG-UHFFFAOYSA-N n-methyladamantan-2-amine Chemical compound C1C(C2)CC3CC1C(NC)C2C3 VSKMVAJFNWCWPG-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ZQBAKBUEJOMQEX-UHFFFAOYSA-N phenyl salicylate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=CC=C1 ZQBAKBUEJOMQEX-UHFFFAOYSA-N 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000008261 resistance mechanism Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- JZWFDVDETGFGFC-UHFFFAOYSA-N salacetamide Chemical group CC(=O)NC(=O)C1=CC=CC=C1O JZWFDVDETGFGFC-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000007962 solid dispersion Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 229960002920 sorbitol Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003239 susceptibility assay Methods 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/165—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide
- A61K31/166—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide having the carbon of a carboxamide group directly attached to the aromatic ring, e.g. procainamide, procarbazine, metoclopramide, labetalol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/396—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having three-membered rings, e.g. aziridine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
- A61P33/04—Amoebicides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
- A61P33/06—Antimalarials
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/46—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/60—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/64—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/66—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings being part of condensed ring systems and singly-bound oxygen atoms, bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D229/00—Heterocyclic compounds containing rings of less than five members having two nitrogen atoms as the only ring hetero atoms
- C07D229/02—Heterocyclic compounds containing rings of less than five members having two nitrogen atoms as the only ring hetero atoms containing three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
- C07C2601/20—Systems containing only non-condensed rings with a ring being at least seven-membered the ring being twelve-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/56—Ring systems containing bridged rings
- C07C2603/58—Ring systems containing bridged rings containing three rings
- C07C2603/70—Ring systems containing bridged rings containing three rings containing only six-membered rings
- C07C2603/74—Adamantanes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Tropical Medicine & Parasitology (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Indole Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP12171729 | 2012-06-13 | ||
| EP12171729.2 | 2012-06-13 | ||
| PCT/EP2013/061880 WO2013186153A2 (en) | 2012-06-13 | 2013-06-10 | Amidophenoxypropanolamines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU2013276702A1 true AU2013276702A1 (en) | 2014-11-27 |
Family
ID=48692426
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2013276702A Abandoned AU2013276702A1 (en) | 2012-06-13 | 2013-06-10 | Amidophenoxypropanolamines |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US20150141437A1 (enExample) |
| EP (1) | EP2861561A2 (enExample) |
| JP (1) | JP2015525224A (enExample) |
| KR (1) | KR20150024329A (enExample) |
| CN (1) | CN104364234A (enExample) |
| AU (1) | AU2013276702A1 (enExample) |
| BR (1) | BR112014030631A2 (enExample) |
| CA (1) | CA2874295A1 (enExample) |
| EA (1) | EA201492291A1 (enExample) |
| IN (1) | IN2014MN02365A (enExample) |
| MX (1) | MX2014014713A (enExample) |
| PH (1) | PH12014502774A1 (enExample) |
| SG (1) | SG11201407434XA (enExample) |
| WO (1) | WO2013186153A2 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN111187212B (zh) * | 2020-01-09 | 2021-04-20 | 西安交通大学 | 一种免洗型光亲和链接体及制备方法和应用 |
| CN119822990B (zh) * | 2025-01-09 | 2025-11-04 | 贵州大学 | 一类金刚烷异丙醇胺结构的化合物及其制备方法和用途 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL40343A0 (en) * | 1971-11-08 | 1972-11-28 | Miles Lab | Novel derivatives of salicylamide |
| EP0691962B1 (en) * | 1993-03-29 | 2000-09-13 | Basf Aktiengesellschaft | 1-amino-3-phenoxy propane derivatives as modulators of multi-drug resistance |
| SE0302755D0 (sv) * | 2003-10-17 | 2003-10-17 | Astrazeneca Ab | Novel compounds |
| US8067620B2 (en) * | 2005-05-04 | 2011-11-29 | Medicines For Malaria Venture Mmv | Dispiro 1,2,4-trioxolane antimalarials |
-
2013
- 2013-06-10 IN IN2365MUN2014 patent/IN2014MN02365A/en unknown
- 2013-06-10 CN CN201380031667.1A patent/CN104364234A/zh active Pending
- 2013-06-10 EA EA201492291A patent/EA201492291A1/ru unknown
- 2013-06-10 KR KR1020147034458A patent/KR20150024329A/ko not_active Withdrawn
- 2013-06-10 US US14/403,916 patent/US20150141437A1/en not_active Abandoned
- 2013-06-10 EP EP13731047.0A patent/EP2861561A2/en not_active Withdrawn
- 2013-06-10 CA CA2874295A patent/CA2874295A1/en not_active Abandoned
- 2013-06-10 AU AU2013276702A patent/AU2013276702A1/en not_active Abandoned
- 2013-06-10 MX MX2014014713A patent/MX2014014713A/es unknown
- 2013-06-10 SG SG11201407434XA patent/SG11201407434XA/en unknown
- 2013-06-10 WO PCT/EP2013/061880 patent/WO2013186153A2/en not_active Ceased
- 2013-06-10 BR BR112014030631A patent/BR112014030631A2/pt not_active IP Right Cessation
- 2013-06-10 JP JP2015516573A patent/JP2015525224A/ja active Pending
-
2014
- 2014-12-10 PH PH12014502774A patent/PH12014502774A1/en unknown
-
2016
- 2016-07-07 US US15/204,585 patent/US20160318887A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| EA201492291A1 (ru) | 2015-05-29 |
| MX2014014713A (es) | 2015-08-05 |
| CA2874295A1 (en) | 2013-12-19 |
| EP2861561A2 (en) | 2015-04-22 |
| WO2013186153A3 (en) | 2014-02-27 |
| PH12014502774A1 (en) | 2015-02-02 |
| US20150141437A1 (en) | 2015-05-21 |
| KR20150024329A (ko) | 2015-03-06 |
| WO2013186153A2 (en) | 2013-12-19 |
| IN2014MN02365A (enExample) | 2015-08-14 |
| SG11201407434XA (en) | 2014-12-30 |
| JP2015525224A (ja) | 2015-09-03 |
| CN104364234A (zh) | 2015-02-18 |
| US20160318887A1 (en) | 2016-11-03 |
| BR112014030631A2 (pt) | 2017-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10004701B2 (en) | Methods and compositions for treating infection | |
| DE60132606T2 (de) | Isochinolinone als kalium-kanal-inhibitoren | |
| EP3892610B1 (en) | Sulfur (vi) fluoride compounds and their use in click-reaction | |
| TWI539947B (zh) | 組蛋白去乙醯基酶之抑制劑 | |
| EP2697213B1 (en) | Inhibitors of viral replication, their process of preparation and their therapeutical uses | |
| EP1899305B1 (en) | Helix 12 directed non-steroidal antiandrogens | |
| SK136395A3 (en) | Hiv protease inhibitors and pharmaceutical composition containing them | |
| EP1051394A1 (en) | Potassium channel inhibitors | |
| FR2932483A1 (fr) | Composes utiles pour le traitement des cancers. | |
| CA2512111A1 (en) | Macrocyclic beta-secretase inhibitors for treatment of alzheimer's disease | |
| WO2000006146A1 (en) | Substituted anilide compounds and methods | |
| JP2000500786A (ja) | エーテルムスカリン様アンタゴニスト | |
| WO2002005819A1 (en) | Compounds and methods | |
| EP2590961A1 (en) | Piperidinyl pyrimidine amides as kv7 potassium channel openers | |
| EP1650186B1 (en) | Novel dicarboxylic acid derivatives | |
| US8680279B2 (en) | Compounds for the treatment of neurological disorders | |
| AU2013276702A1 (en) | Amidophenoxypropanolamines | |
| JP4540984B2 (ja) | 新規アミノベンゾフェノン | |
| US20120116095A1 (en) | Glycine transporter inhibitors | |
| US20220401418A1 (en) | Treatment of malaria using histone deacetylase (hdac) inhibitors | |
| US20080318966A1 (en) | Sinomenine Derivatives and Preparation and Uses Thereof | |
| WO2026006247A1 (en) | 2-(piperidin-3-yl)isoindole-1,3-dione analogs and uses thereof | |
| SK13097A3 (en) | Optically active (-)-(3r)-3-methyl-4-{4-£4-(4-pyridyl)piperazin- -1-yl|phenoxy} butyric acid and its derivatives, preparation method thereof and their use | |
| JPWO2000023437A1 (ja) | 含窒素縮合複素環誘導体、その製造法および剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK5 | Application lapsed section 142(2)(e) - patent request and compl. specification not accepted |