ATE203749T1 - Verfahren zur herstellung amorphen paroxetin- hydrochlorids - Google Patents
Verfahren zur herstellung amorphen paroxetin- hydrochloridsInfo
- Publication number
- ATE203749T1 ATE203749T1 AT97108713T AT97108713T ATE203749T1 AT E203749 T1 ATE203749 T1 AT E203749T1 AT 97108713 T AT97108713 T AT 97108713T AT 97108713 T AT97108713 T AT 97108713T AT E203749 T1 ATE203749 T1 AT E203749T1
- Authority
- AT
- Austria
- Prior art keywords
- paroxetine hydrochloride
- amorphic
- producing
- producing amorphic
- hydrochloride
- Prior art date
Links
- AHOUBRCZNHFOSL-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine Chemical compound C1=CC(F)=CC=C1C1C(COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-UHFFFAOYSA-N 0.000 title abstract 6
- 229960005183 paroxetine hydrochloride Drugs 0.000 title abstract 3
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000001694 spray drying Methods 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13719296 | 1996-05-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE203749T1 true ATE203749T1 (de) | 2001-08-15 |
Family
ID=15192956
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT97108713T ATE203749T1 (de) | 1996-05-30 | 1997-05-30 | Verfahren zur herstellung amorphen paroxetin- hydrochlorids |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US20010021776A1 (de) |
| EP (2) | EP0810224B1 (de) |
| AT (1) | ATE203749T1 (de) |
| CA (1) | CA2206592A1 (de) |
| DE (1) | DE69705896T2 (de) |
| ES (1) | ES2160871T3 (de) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6638948B1 (en) * | 1996-09-09 | 2003-10-28 | Pentech Pharmaceuticals, Inc. | Amorphous paroxetine composition |
| CA2193939C (en) * | 1996-12-24 | 2002-02-12 | K.S. Keshava Murthy | Useful form of anhydrous paroxetine hydrochloride |
| HUP0000960A3 (en) * | 1997-01-15 | 2001-04-28 | Smithkline Beecham Plc | Spray-dried paroxetine hydrochloride, process for it's preparation,use of the compound and pharmaceutical compositions containing the same |
| KR100543614B1 (ko) | 1997-06-10 | 2006-01-20 | 신톤 비.브이. | 4-페닐피페리딘 화합물 |
| KR20010040711A (ko) * | 1998-02-06 | 2001-05-15 | 피터 기딩스 | 파록세틴의 염 |
| GB9806312D0 (en) * | 1998-03-24 | 1998-05-20 | Smithkline Beecham Plc | Novel formulations |
| US6168805B1 (en) * | 1998-05-07 | 2001-01-02 | Endo Pharmaceuticals, Inc. | Aqueous process for manufacturing paroxetine solid dispersions |
| GB9814316D0 (en) * | 1998-07-02 | 1998-09-02 | Smithkline Beecham Plc | Novel compounds |
| CH689805A8 (fr) * | 1998-07-02 | 2000-02-29 | Smithkline Beecham Plc | Méthanesulfonate de paroxétine, procédé pour sa préparation et compositions pharmaceutiques le contenant. |
| ES2138937B1 (es) | 1998-07-07 | 2000-10-01 | Medichem Sa | Polimorfo de maleato de paroxetina y formulaciones farmaceuticas que lo contienen. |
| EP1102764A1 (de) * | 1998-08-08 | 2001-05-30 | Smithkline Beecham Plc | Salze von paroxetin |
| GB9824298D0 (en) * | 1998-11-05 | 1998-12-30 | Smithkline Beecham Plc | Novel process |
| GB9826180D0 (en) * | 1998-11-30 | 1999-01-20 | Smithkline Beecham Plc | Novel process |
| IN191492B (de) * | 1999-05-25 | 2003-12-06 | Ranbaxy Lab Ltd | |
| GB9914600D0 (en) * | 1999-06-22 | 1999-08-25 | Smithkline Beecham Plc | Novel,process |
| DE60004768T2 (de) | 1999-07-01 | 2004-07-08 | Italfarmaco S.P.A. | Komplexe von paroxetin mit cyclodextrin oder cyclodextrin derivaten |
| HU226912B1 (en) * | 2000-04-07 | 2010-03-01 | Richter Gedeon Nyrt | New paroxetin salt and medicament containing it |
| JPWO2002022609A1 (ja) * | 2000-09-14 | 2004-01-22 | 旭硝子株式会社 | 実質的に有機溶媒を含まないパロキセチン塩類の製造方法 |
| WO2002085360A1 (en) * | 2001-04-25 | 2002-10-31 | Pentech Pharmaceuticals, Inc. | Optimized procedures for the manufacture of paroxetine salts |
| IL159280A0 (en) * | 2001-06-14 | 2004-06-01 | Teva Pharma | A process for preparing paroxetine hcl which limits formation of pink colored compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1422263A (en) * | 1973-01-30 | 1976-01-21 | Ferrosan As | 4-phenyl-piperidine compounds |
| ES2058061T3 (es) * | 1985-10-25 | 1994-11-01 | Beecham Group Plc | Derivado de piperidina, su preparacion y su uso como medicamento. |
| EP0542355A1 (de) * | 1991-11-15 | 1993-05-19 | Merck Frosst Canada Inc. | Amorphe (Chinolin-2-ylmethoxy)Indole als Leukotrien-Antagonisten |
| IT1274241B (it) * | 1993-12-03 | 1997-07-15 | Smithkline Beecham Farma | Complessi agente terapeutico/matrice polimerica dotati di migliorate caratteristiche di sapore e composizioni farmaceutiche che li contengono |
-
1997
- 1997-05-29 CA CA002206592A patent/CA2206592A1/en not_active Abandoned
- 1997-05-30 AT AT97108713T patent/ATE203749T1/de not_active IP Right Cessation
- 1997-05-30 EP EP97108713A patent/EP0810224B1/de not_active Expired - Lifetime
- 1997-05-30 ES ES97108713T patent/ES2160871T3/es not_active Expired - Lifetime
- 1997-05-30 EP EP00125372A patent/EP1090918A1/de not_active Withdrawn
- 1997-05-30 DE DE69705896T patent/DE69705896T2/de not_active Expired - Fee Related
-
2001
- 2001-05-04 US US09/848,337 patent/US20010021776A1/en not_active Abandoned
-
2002
- 2002-12-19 US US10/322,778 patent/US20030181725A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| ES2160871T3 (es) | 2001-11-16 |
| US20030181725A1 (en) | 2003-09-25 |
| EP0810224B1 (de) | 2001-08-01 |
| DE69705896D1 (de) | 2001-09-06 |
| CA2206592A1 (en) | 1997-11-30 |
| US20010021776A1 (en) | 2001-09-13 |
| EP0810224A1 (de) | 1997-12-03 |
| EP1090918A1 (de) | 2001-04-11 |
| DE69705896T2 (de) | 2002-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATE203749T1 (de) | Verfahren zur herstellung amorphen paroxetin- hydrochlorids | |
| ATE359994T1 (de) | Verfahren zur herstellung von oxazolidinonen | |
| DE69834673D1 (de) | Verfahren zur Herstellung einer Elektronenemittierenden Quelle | |
| NO20016226D0 (no) | Fremgangsmåte for fremstilling av substituerte formamider | |
| DE69631298D1 (de) | Verfahren zur Herstellung von Paroxetinhydrochloridanhydrat | |
| DE69621297D1 (de) | Verfahren zur Herstellung wasserlöslicher organischer Silizium-Verbindungen | |
| DE69609796D1 (de) | Verfahren zur herstellung von essigsäure | |
| DE69907037D1 (de) | Verfahren zur herstellung von citalopram | |
| DE69313515D1 (de) | Verfahren zur Herstellung eines aromatischen Carbonats | |
| ATE213237T1 (de) | Verfahren zur herstellung von citalopram | |
| DE69709164D1 (de) | Verfahren zur herstellung von essigsäure | |
| DE69634374D1 (de) | Verfahren zur Herstellung einer elektronenemittierenden Vorrichtung | |
| ATE250113T1 (de) | Verfahren zur herstellung von herbiziden | |
| DE69624825D1 (de) | Eintopfverfahren zur herstellung von 2-oxazolidinonderivate | |
| DE69805608D1 (de) | Verfahren zur herstellung von epoxyverbindungen | |
| DE69701915D1 (de) | Verfahren zur Herstellung eines einbügelbaren Einlagestoffs | |
| DE69909821D1 (de) | Verfahren zur herstellung von weichem seidenpapier | |
| DE69932993D1 (de) | Verfahren zur Herstellung eines elektrophotographischen lichtempfindlichen Elementes | |
| DE69411575D1 (de) | Verfahren zur herstellung lithographischer druckformen | |
| ATE355268T1 (de) | Verfahren zur herstellung von citalopram | |
| DE69704969D1 (de) | Verfahren zur Herstellung einer photoempfinflichen Kunstoffdruckplatte | |
| ATE353937T1 (de) | Verfahren zur synthese einer oxonolverbindung | |
| DE69721812D1 (de) | Verfahren zur herstellung optisch aktiver 3-quinuclidinol derivate | |
| DE69406004D1 (de) | Verfahren zur Herstellung eines verbesserten Bilds | |
| DE59611076D1 (de) | Verfahren zur herstellung von 5,6-dihydro-1,3-oxazinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RER | Ceased as to paragraph 5 lit. 3 law introducing patent treaties |