ZM1185A1 - 3-substituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents - Google Patents
3-substituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agentsInfo
- Publication number
- ZM1185A1 ZM1185A1 ZM11/85A ZM1185A ZM1185A1 ZM 1185 A1 ZM1185 A1 ZM 1185A1 ZM 11/85 A ZM11/85 A ZM 11/85A ZM 1185 A ZM1185 A ZM 1185A ZM 1185 A1 ZM1185 A1 ZM 1185A1
- Authority
- ZM
- Zambia
- Prior art keywords
- oxindole
- carboxamides
- analgesic
- substituted
- inflammatory agents
- Prior art date
Links
- UYINJAQCJCYCGO-UHFFFAOYSA-N 2-oxo-3h-indole-1-carboxamide Chemical class C1=CC=C2N(C(=O)N)C(=O)CC2=C1 UYINJAQCJCYCGO-UHFFFAOYSA-N 0.000 title 1
- 230000000202 analgesic effect Effects 0.000 title 1
- 239000000730 antalgic agent Substances 0.000 title 1
- 239000002260 anti-inflammatory agent Substances 0.000 title 1
- 229940121363 anti-inflammatory agent Drugs 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59065984A | 1984-03-19 | 1984-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZM1185A1 true ZM1185A1 (en) | 1985-09-20 |
Family
ID=24363137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZM11/85A ZM1185A1 (en) | 1984-03-19 | 1985-03-19 | 3-substituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS60209564A (cg-RX-API-DMAC10.html) |
| CN (2) | CN1008733B (cg-RX-API-DMAC10.html) |
| DD (1) | DD232039A5 (cg-RX-API-DMAC10.html) |
| EC (1) | ECSP941077A (cg-RX-API-DMAC10.html) |
| IN (1) | IN162090B (cg-RX-API-DMAC10.html) |
| MW (1) | MW685A1 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA851991B (cg-RX-API-DMAC10.html) |
| ZM (1) | ZM1185A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5047554A (en) * | 1989-04-18 | 1991-09-10 | Pfizer Inc. | 3-substituted-2-oxindole derivatives |
| US5059693A (en) * | 1989-10-06 | 1991-10-22 | Pfizer Inc. | Process for making 3-aroyl-2-oxindole-1-carboxamides |
| IL95880A (en) * | 1989-10-13 | 1995-12-31 | Pfizer | Use of 3-Transformed History of 2-Oxindole for the Preparation of Pharmaceuticals for Inhibition of Interlaukio-1 Biosynthesis |
| US5298522A (en) * | 1993-01-22 | 1994-03-29 | Pfizer Inc. | 6-chloro-5-fluoro-3-(2-thenoyl)-2-oxindole-1-carboxamide as an analgesic and anti-inflammatory agent while maintaining a normal urine protein/creatinine ratio |
| AU1671597A (en) * | 1996-02-13 | 1997-09-02 | Chugai Seiyaku Kabushiki Kaisha | Indole derivatives |
| CN103193794B (zh) * | 2013-04-12 | 2016-04-06 | 中国药科大学 | 一种异吲哚酮并异噁唑类稠环化合物及其合成方法 |
-
1985
- 1985-02-21 IN IN147/DEL/85A patent/IN162090B/en unknown
- 1985-03-18 MW MW6/85A patent/MW685A1/xx unknown
- 1985-03-18 DD DD85274214A patent/DD232039A5/de not_active IP Right Cessation
- 1985-03-18 ZA ZA851991A patent/ZA851991B/xx unknown
- 1985-03-19 ZM ZM11/85A patent/ZM1185A1/xx unknown
- 1985-03-19 JP JP60055627A patent/JPS60209564A/ja active Granted
- 1985-04-01 CN CN85101028A patent/CN1008733B/zh not_active Expired
- 1985-04-01 CN CN85101795.9A patent/CN1003855B/zh not_active Expired
-
1994
- 1994-04-27 EC EC1994001077A patent/ECSP941077A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN162090B (cg-RX-API-DMAC10.html) | 1988-03-26 |
| ZA851991B (en) | 1986-11-26 |
| CN85101028A (zh) | 1987-01-17 |
| DD232039A5 (de) | 1986-01-15 |
| ECSP941077A (es) | 1994-12-15 |
| CN1003855B (zh) | 1989-04-12 |
| JPH0437076B2 (cg-RX-API-DMAC10.html) | 1992-06-18 |
| CN1008733B (zh) | 1990-07-11 |
| JPS60209564A (ja) | 1985-10-22 |
| CN85101795A (zh) | 1987-04-08 |
| MW685A1 (en) | 1986-04-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2152815B (en) | Analgesic compositions | |
| GB2167663B (en) | Analgesic compositions | |
| GB8521793D0 (en) | Analgesic & anti-inflammatory compositions | |
| DE3570078D1 (en) | Analgesic and antiinflammatory 1,3-diacyl-2-oxindole compounds | |
| FI862882A7 (fi) | 1-substituoituja oksindoli-3 -karboksiamideja tulehdusta ja kipua estävinä aineina. | |
| ZA861211B (en) | Analgesic composition | |
| ZM785A1 (en) | 1,3-disubstituted oxindoles as analgesic and anti-inflammatory agents | |
| GB2180750B (en) | Topical analgesic anti-inflammatory composition | |
| JPS57179117A (en) | Analgesic composition and use | |
| ZA865019B (en) | 1-substituted oxindole-3-carboxamides as antiinflammatory and analgesic agents | |
| DE3161290D1 (en) | Analgesic and anti-inflammatory agents | |
| AU590640B2 (en) | Dementia-improving and therapeutic agents | |
| ZA861212B (en) | Analgesic composition | |
| ZA853379B (en) | Substituted 1-oxa-dethiachphalosporins as anti-inflammatory and antidegenerative agents | |
| GR861727B (en) | 5-substituted-6-aminopyridine derivatives composition and uses | |
| ZM1185A1 (en) | 3-substituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents | |
| ZA854947B (en) | Beta-lactam derivatives as anti-inflammatory and anti-degenerative agents | |
| DE3261724D1 (en) | Analgesic and anti-inflammatory composition | |
| MW1685A1 (en) | N,3-disubstituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents | |
| NZ211052A (en) | 1,3-disubstituted-2-oxindoles as analgesic and anti-inflammatory agents | |
| GB8319437D0 (en) | Compound with analgesic and anti-inflammatory activity | |
| ZM3185A1 (en) | N,3-disubstituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents | |
| LV5714B4 (lv) | 3-aizvietoti 2-oksindola-1-karboksamidi ar analgetisku un pretiekaisuma iedarbibu | |
| IE853006L (en) | Analgesic composition | |
| IE850098L (en) | Analgesic compositions |