ZA708216B - 9-azolylfluorene-9-carboxylic acid derivatives,a process for their production,and their use for the regulation of plant growth - Google Patents
9-azolylfluorene-9-carboxylic acid derivatives,a process for their production,and their use for the regulation of plant growthInfo
- Publication number
- ZA708216B ZA708216B ZA708216A ZA708216A ZA708216B ZA 708216 B ZA708216 B ZA 708216B ZA 708216 A ZA708216 A ZA 708216A ZA 708216 A ZA708216 A ZA 708216A ZA 708216 B ZA708216 B ZA 708216B
- Authority
- ZA
- South Africa
- Prior art keywords
- azolylfluorene
- regulation
- production
- carboxylic acid
- acid derivatives
- Prior art date
Links
- RAGOKUUWEHHZCE-UHFFFAOYSA-N 9-(1H-pyrrol-2-yl)fluorene-9-carboxylic acid Chemical class N1C(=CC=C1)C1(C2=CC=CC=C2C=2C=CC=CC12)C(=O)O RAGOKUUWEHHZCE-UHFFFAOYSA-N 0.000 title 1
- 230000008635 plant growth Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/18—Fluorenes; Hydrogenated fluorenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Emergency Lowering Means (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1964996A DE1964996C3 (de) | 1969-12-24 | 1969-12-24 | 9-Azolyl-fluoren-9-carbonsäure-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel zur Regulierung des Pflanzenwachstums |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA708216B true ZA708216B (en) | 1971-09-29 |
Family
ID=5755035
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA708216A ZA708216B (en) | 1969-12-24 | 1970-12-04 | 9-azolylfluorene-9-carboxylic acid derivatives,a process for their production,and their use for the regulation of plant growth |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3754001A (OSRAM) |
| JP (2) | JPS4917263B1 (OSRAM) |
| AT (1) | AT304153B (OSRAM) |
| BE (1) | BE760760A (OSRAM) |
| BG (1) | BG17693A3 (OSRAM) |
| CA (1) | CA930745A (OSRAM) |
| CH (1) | CH551977A (OSRAM) |
| CS (1) | CS178076B2 (OSRAM) |
| DE (1) | DE1964996C3 (OSRAM) |
| DK (1) | DK127426B (OSRAM) |
| EG (1) | EG10588A (OSRAM) |
| ES (1) | ES386796A1 (OSRAM) |
| FI (1) | FI52079C (OSRAM) |
| FR (1) | FR2074282A5 (OSRAM) |
| GB (1) | GB1301505A (OSRAM) |
| HU (1) | HU162197B (OSRAM) |
| IL (1) | IL35659A (OSRAM) |
| NL (1) | NL7018741A (OSRAM) |
| NO (1) | NO129297B (OSRAM) |
| RO (1) | RO56469A (OSRAM) |
| SE (2) | SE386441B (OSRAM) |
| YU (1) | YU34678B (OSRAM) |
| ZA (1) | ZA708216B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3879558A (en) * | 1970-02-03 | 1975-04-22 | Bayer Ag | 9-Azolyl-(1)-fluorene-9-carboxylic acid derivatives and their production |
| DE2314985A1 (de) * | 1973-03-26 | 1974-10-17 | Hoechst Ag | 1-(imidazol-1-yl)-isochinoline und verfahren zu ihrer herstellung |
| IT1009941B (it) * | 1974-04-19 | 1976-12-20 | Sir Soc Italiana Resine Spa | Composto erbicida |
| DE2448060A1 (de) * | 1974-10-09 | 1976-04-15 | Bayer Ag | Mittel zur regulierung des pflanzenwachstums |
| GB1569267A (en) * | 1975-12-16 | 1980-06-11 | Ici Ltd | Substituted propiophenones and herbicidal and fungicidal compositions containing them |
| DE2851143A1 (de) * | 1978-11-25 | 1980-06-04 | Bayer Ag | Fluorenyl-azolylmethyl-carbinole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4474599A (en) * | 1982-07-14 | 1984-10-02 | The Dow Chemical Company | 1-(Pyridyl)-1H-1,2,3-triazole derivatives, and use as herbicidal agents |
| WO1998027979A1 (en) | 1996-12-20 | 1998-07-02 | Bristol-Myers Squibb Company | Heterocyclic inhibitors of microsomal triglyceride transfer protein and method |
-
1969
- 1969-12-24 DE DE1964996A patent/DE1964996C3/de not_active Expired
-
1970
- 1970-11-16 IL IL35659A patent/IL35659A/en unknown
- 1970-11-20 US US00091542A patent/US3754001A/en not_active Expired - Lifetime
- 1970-11-30 DK DK610270AA patent/DK127426B/da unknown
- 1970-11-30 FI FI703215A patent/FI52079C/fi active
- 1970-11-30 RO RO65145A patent/RO56469A/ro unknown
- 1970-12-02 CA CA099640A patent/CA930745A/en not_active Expired
- 1970-12-04 ZA ZA708216A patent/ZA708216B/xx unknown
- 1970-12-08 NO NO04719/70A patent/NO129297B/no unknown
- 1970-12-12 EG EG521/70A patent/EG10588A/xx active
- 1970-12-17 BG BG016345A patent/BG17693A3/xx unknown
- 1970-12-17 GB GB1301505D patent/GB1301505A/en not_active Expired
- 1970-12-17 CS CS8541A patent/CS178076B2/cs unknown
- 1970-12-22 SE SE7017432A patent/SE386441B/xx unknown
- 1970-12-23 ES ES386796A patent/ES386796A1/es not_active Expired
- 1970-12-23 BE BE760760A patent/BE760760A/xx unknown
- 1970-12-23 NL NL7018741A patent/NL7018741A/xx not_active Application Discontinuation
- 1970-12-23 YU YU3145/70A patent/YU34678B/xx unknown
- 1970-12-23 AT AT11574/70A patent/AT304153B/de not_active IP Right Cessation
- 1970-12-24 FR FR7046668A patent/FR2074282A5/fr not_active Expired
- 1970-12-24 CH CH1911070A patent/CH551977A/xx not_active IP Right Cessation
- 1970-12-24 HU HUBA2515A patent/HU162197B/hu unknown
- 1970-12-24 JP JP45116881A patent/JPS4917263B1/ja active Pending
- 1970-12-24 JP JP45116882A patent/JPS4819938B1/ja active Pending
-
1974
- 1974-10-16 SE SE7413025A patent/SE7413025L/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IL35659A0 (en) | 1971-01-28 |
| CS178076B2 (OSRAM) | 1977-08-31 |
| IL35659A (en) | 1973-11-28 |
| US3754001A (en) | 1973-08-21 |
| JPS4917263B1 (OSRAM) | 1974-04-27 |
| BG17693A3 (bg) | 1973-12-25 |
| ES386796A1 (es) | 1973-12-16 |
| FR2074282A5 (OSRAM) | 1971-10-01 |
| GB1301505A (OSRAM) | 1972-12-29 |
| BE760760A (fr) | 1971-06-23 |
| NO129297B (OSRAM) | 1974-03-25 |
| EG10588A (en) | 1976-06-30 |
| DE1964996C3 (de) | 1978-11-30 |
| CA930745A (en) | 1973-07-24 |
| YU314570A (en) | 1979-07-10 |
| DE1964996B2 (de) | 1978-04-13 |
| JPS4819938B1 (OSRAM) | 1973-06-18 |
| SE386441B (sv) | 1976-08-09 |
| NL7018741A (OSRAM) | 1971-06-28 |
| FI52079C (fi) | 1977-06-10 |
| SE7413025L (OSRAM) | 1974-10-16 |
| YU34678B (en) | 1979-12-31 |
| AT304153B (de) | 1972-11-15 |
| RO56469A (OSRAM) | 1974-09-01 |
| FI52079B (OSRAM) | 1977-02-28 |
| CH551977A (de) | 1974-07-31 |
| DK127426B (da) | 1973-11-05 |
| DE1964996A1 (de) | 1971-07-01 |
| HU162197B (OSRAM) | 1973-01-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL35405A (en) | 3-aryl-5-alkylthio-1,2,4-oxa-and thiadiazole derivatives,their production and their use as biocides and plant growth regulants | |
| CA949561A (en) | N-benzyltriazoles, a process for their production and their use for the regulation of plant growth | |
| JPS5265271A (en) | Production of plant growth contorolling agent | |
| IL40052A (en) | Beta-haloethyl-methyl-silanes,their production and their use for the regulation of plant growth | |
| IL39417A (en) | 2-alkylthio-4,6-diamino-5-nitro-pyrimidine derivatives,their production and their use for the regulation of plant growth | |
| IL35301A0 (en) | Bistriazolyl-bisphenyl-methanes and their salts,process for their preparation,and their use as plant growth regulators | |
| ZA708216B (en) | 9-azolylfluorene-9-carboxylic acid derivatives,a process for their production,and their use for the regulation of plant growth | |
| CA977571A (en) | Plant growth regulation | |
| EG10566A (en) | N-aryl-carbamic acid esters and thiolesters,a process for their production and use as herbicides | |
| ZA73832B (en) | Plant growth regulating process and compositions | |
| IL39981A0 (en) | 2-chloroethanephosphonic acid derivatives,their production and their use for regulating the growth of plants | |
| HU175568B (hu) | Vehhestvo dlja regulirovanija rosta rastenij | |
| IL46525A0 (en) | 2-chloroethanephosphonic acid derivatives,their production and their use for regulating plant growth | |
| IL35381A0 (en) | Fermentation process for the production of citric acid | |
| ZA708275B (en) | N-benzyltriazoles,a process for their production and their use for the regulation of plant growth | |
| IL35250A0 (en) | 2-chloroethane-phosphonic and thionophosphonic acid derivatives,their preparation,and their use for the regulation of plant growth | |
| ZA725309B (en) | 1-alkoxycarboxylic acid derivatives for the regulation of plant growth | |
| IL48324A0 (en) | New arylisothiocyanates,their production and their use for the regulation of plant growth | |
| AU450814B2 (en) | 9 azolylfluorene 9 carboxylic acid derivatives, a process for their production, and their use forthe regulation of plant growth | |
| IL45535A0 (en) | 2-dialkylaminopropane derivatives,their production and their use as plant growth regulators | |
| AU2355070A (en) | 9 azolylfluorene 9 carboxylic acid derivatives, a process for their production, and their use forthe regulation of plant growth | |
| IL41110A0 (en) | 6-aminopenicillanic acid derivatives,their manufacture and pharmaceutical their use for regulating plant growth | |
| IL43520A0 (en) | Products from the hydrolysis of -beta halogenoethyl-silanes,their production and their use for the regulation of plant growth | |
| ZA73394B (en) | Pyridazine derivatives,process for their preparation,and their use as plant growth regulators | |
| ZA721191B (en) | Novel pseudothioureas and salts thereof,a process for their preparation and their use for regulation of plant growth |