ZA200608359B - -pyridinylcycloalkylcarboxamide derivatives useful as fungicides - Google Patents
-pyridinylcycloalkylcarboxamide derivatives useful as fungicides Download PDFInfo
- Publication number
- ZA200608359B ZA200608359B ZA200608359A ZA200608359A ZA200608359B ZA 200608359 B ZA200608359 B ZA 200608359B ZA 200608359 A ZA200608359 A ZA 200608359A ZA 200608359 A ZA200608359 A ZA 200608359A ZA 200608359 B ZA200608359 B ZA 200608359B
- Authority
- ZA
- South Africa
- Prior art keywords
- halogen atoms
- alkyl
- group
- het
- general formula
- Prior art date
Links
- 239000000417 fungicide Substances 0.000 title description 3
- 125000005843 halogen group Chemical group 0.000 claims description 199
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 67
- 150000001875 compounds Chemical class 0.000 claims description 59
- 125000000623 heterocyclic group Chemical group 0.000 claims description 41
- -1 formyloxy group Chemical group 0.000 claims description 38
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 25
- 229910052799 carbon Inorganic materials 0.000 claims description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 8
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 230000000855 fungicidal effect Effects 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 2
- 241000233866 Fungi Species 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 230000003032 phytopathogenic effect Effects 0.000 claims description 2
- 241000196324 Embryophyta Species 0.000 claims 4
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 1
- 235000013399 edible fruits Nutrition 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 150000001412 amines Chemical class 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 241000894007 species Species 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 6
- 125000000753 cycloalkyl group Chemical group 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 150000008052 alkyl sulfonates Chemical class 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052752 metalloid Inorganic materials 0.000 description 3
- 150000002738 metalloids Chemical class 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- 125000002348 vinylic group Chemical group 0.000 description 3
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002940 palladium Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- RJNUXEDAPIKMDE-UHFFFAOYSA-M 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium;chloride;hydrate Chemical compound O.[Cl-].COC1=NC(OC)=NC([N+]2(C)CCOCC2)=N1 RJNUXEDAPIKMDE-UHFFFAOYSA-M 0.000 description 1
- 125000001054 5 membered carbocyclic group Chemical group 0.000 description 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 125000001960 7 membered carbocyclic group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 101100070530 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) het-6 gene Proteins 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 150000001638 boron Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005888 cyclopropanation reaction Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- DPOGTJDEMBEUSH-UHFFFAOYSA-N dicyclohexyl(ethyl)phosphane Chemical compound C1CCCCC1P(CC)C1CCCCC1 DPOGTJDEMBEUSH-UHFFFAOYSA-N 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- BSAQKHKYJMRZFK-UHFFFAOYSA-N n-(2-pyridin-2-ylethyl)formamide Chemical class O=CNCCC1=CC=CC=N1 BSAQKHKYJMRZFK-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D411/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen and sulfur atoms as the only ring hetero atoms
- C07D411/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen and sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D411/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen and sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP04356057 | 2004-04-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA200608359B true ZA200608359B (en) | 2008-06-25 |
Family
ID=34931749
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA200608359A ZA200608359B (en) | 2004-04-26 | 2006-10-06 | -pyridinylcycloalkylcarboxamide derivatives useful as fungicides |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US7687067B2 (cs) |
| EP (1) | EP1740544B1 (cs) |
| JP (1) | JP4774043B2 (cs) |
| KR (1) | KR101276929B1 (cs) |
| CN (1) | CN1946695B (cs) |
| AT (1) | ATE373643T1 (cs) |
| BR (1) | BRPI0508738B1 (cs) |
| CA (1) | CA2560373C (cs) |
| DE (1) | DE602005002553T2 (cs) |
| DK (1) | DK1740544T3 (cs) |
| ES (1) | ES2300019T3 (cs) |
| IL (1) | IL178771A (cs) |
| IN (1) | IN2012DN02609A (cs) |
| MX (1) | MXPA06012159A (cs) |
| PL (1) | PL1740544T3 (cs) |
| PT (1) | PT1740544E (cs) |
| WO (1) | WO2005103006A1 (cs) |
| ZA (1) | ZA200608359B (cs) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7932396B2 (en) * | 2005-05-18 | 2011-04-26 | Bayer Cropscience Ag | 2-pyridinylcycloalkylbenzamide derivatives and their use as fungicides |
| DE602006020269D1 (en) * | 2005-05-18 | 2011-04-07 | Bayer Cropscience Ag | Neue 2-pyridinylcycloalkylcarboxamid-derivate als fungizide |
| ES2335319T3 (es) * | 2006-05-18 | 2010-03-24 | Syngenta Participations Ag | Nuevos microbiocidas. |
| AU2008218130B2 (en) * | 2007-02-20 | 2011-04-28 | Mitsui Chemicals Crop & Life Solutions, Inc. | Fluorine-containing pyrazolecarbonitrile derivative and method for producing the same, and fluorine-containing pyrazolecarboxylic acid derivative obtained by using the fluorine-containing pyrazolecarbonitrile derivative and method for producing the same |
| US8372982B2 (en) | 2009-02-17 | 2013-02-12 | Bayer Cropscience Ag | Fungicidal N-(Phenylcycloalkyl)carboxamide, N-(Benzylcycloalkyl)carboxamide and thiocarboxamide derivatives |
| EP2289880A1 (en) * | 2009-07-08 | 2011-03-02 | Bayer CropScience AG | 2-Pyridinylcyclopropylbenzamide fungicides |
| ES2533026T3 (es) | 2010-06-03 | 2015-04-07 | Bayer Intellectual Property Gmbh | N-[(het)arilalquil)]pirazol (tio)carboxamidas y sus análogos heterosustituidos |
| ES2515042T3 (es) | 2011-01-05 | 2014-10-29 | Syngenta Participations Ag | Derivados de pirazol-4-il-carboxamida como microbiocidas |
| EP2606728A1 (en) | 2011-12-21 | 2013-06-26 | Bayer CropScience AG | Compounds with nematicidal activity |
| EP2773215A2 (en) | 2011-11-02 | 2014-09-10 | Bayer Intellectual Property GmbH | Compounds with nematicidal activity |
| EP2606727A1 (en) | 2011-12-21 | 2013-06-26 | Bayer CropScience AG | Compounds with nematicidal activity |
| EP2589292A1 (en) | 2011-11-02 | 2013-05-08 | Bayer CropScience AG | Compounds with nematicidal activity |
| BR112014010714A2 (pt) | 2011-11-02 | 2017-05-02 | Bayer Ip Gmbh | compostos com atividade nematicida |
| EP2589294A1 (en) | 2011-11-02 | 2013-05-08 | Bayer CropScience AG | Compounds with nematicidal activity |
| EP2644595A1 (en) | 2012-03-26 | 2013-10-02 | Syngenta Participations AG. | N-Cyclylamides as nematicides |
| BR112016000209B1 (pt) | 2013-07-08 | 2021-10-13 | Syngenta Participations Ag | Compostos de carboxamidas, composição pesticida, método de proteção de culturas de plantas e de material de propagação de plantas, material de propagação de plantas revestido e processo para a preparação de um composto |
| WO2015040141A1 (en) | 2013-09-23 | 2015-03-26 | Syngenta Participations Ag | Cyclobutylcarboxamides as nematicides |
| UY35772A (es) | 2013-10-14 | 2015-05-29 | Bayer Cropscience Ag | Nuevos compuestos plaguicidas |
| EP3283476B1 (en) | 2015-04-13 | 2019-08-14 | Bayer Cropscience AG | N-cycloalkyl-n-(biheterocyclyethylene)-(thio)carboxamide derivatives |
| EP3558956B1 (en) | 2016-12-20 | 2020-10-28 | Syngenta Participations AG | N-cyclobutyl-thiazol-5-carboxamides with nematicidal activity |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR880011105A (ko) * | 1986-05-02 | 1988-10-26 | 죤 알. 페넬 | 살균제 피리딜 스클로프로판 카르복스아미드와 이를 이용한 살균제 조성물 및 억제방법 |
| EP0314427A3 (en) * | 1987-10-29 | 1990-08-01 | Ici Americas Inc. | Fungicidal pyridyl amides |
| JPH0892223A (ja) * | 1994-09-27 | 1996-04-09 | Mitsui Toatsu Chem Inc | ヘテロ環置換アニリン誘導体およびこれを有効成分とする農園芸用殺菌剤 |
| JPH09132567A (ja) * | 1995-11-08 | 1997-05-20 | Mitsui Toatsu Chem Inc | ピラゾールカルボン酸アニリド誘導体およびこれを有効成分とする農園芸用殺菌剤 |
| JP3844533B2 (ja) * | 1995-12-15 | 2006-11-15 | 日本曹達株式会社 | 2,6−ジクロロイソニコチン酸フェネチルアミド誘導体及び植物病害防除剤 |
| DE19629825A1 (de) * | 1996-07-24 | 1998-01-29 | Bayer Ag | Dihydrofuran-carboxamide |
| DE19629826A1 (de) * | 1996-07-24 | 1998-01-29 | Bayer Ag | 1,3-Dimethyl-5-fluor-pyrazol-4-carboxamide |
| AU771975B2 (en) * | 1998-11-04 | 2004-04-08 | Meiji Seika Kaisha Ltd. | Picolinamide derivatives and pest controllers containing the same as the active ingredient |
| EP1204323B1 (en) * | 1999-08-18 | 2004-07-14 | Aventis CropScience GmbH | Fungicides |
| GB0001447D0 (en) * | 2000-01-21 | 2000-03-08 | Novartis Ag | Organic compounds |
| US7074742B2 (en) * | 2000-09-18 | 2006-07-11 | E. I. Du Pont De Nemours And Company | Pyridinyl amides and imides for use as fungicides |
| DE10204391A1 (de) * | 2002-02-04 | 2003-08-14 | Bayer Cropscience Ag | Difluormethylthiazolylcarboxanilide |
| DE10218231A1 (de) * | 2002-04-24 | 2003-11-06 | Bayer Cropscience Ag | Methylthiophencarboxanilide |
| DE10222886A1 (de) * | 2002-05-23 | 2003-12-11 | Bayer Cropscience Ag | Oxathiincarboxamide |
| DE10222884A1 (de) * | 2002-05-23 | 2003-12-04 | Bayer Cropscience Ag | Furancarboxamide |
-
2005
- 2005-04-25 ES ES05742091T patent/ES2300019T3/es not_active Expired - Lifetime
- 2005-04-25 BR BRPI0508738-4A patent/BRPI0508738B1/pt not_active IP Right Cessation
- 2005-04-25 AT AT05742091T patent/ATE373643T1/de not_active IP Right Cessation
- 2005-04-25 IN IN2609DEN2012 patent/IN2012DN02609A/en unknown
- 2005-04-25 DK DK05742091T patent/DK1740544T3/da active
- 2005-04-25 WO PCT/EP2005/005796 patent/WO2005103006A1/en not_active Ceased
- 2005-04-25 DE DE602005002553T patent/DE602005002553T2/de not_active Expired - Lifetime
- 2005-04-25 KR KR1020067024501A patent/KR101276929B1/ko not_active Expired - Fee Related
- 2005-04-25 US US11/587,909 patent/US7687067B2/en not_active Expired - Fee Related
- 2005-04-25 JP JP2007509998A patent/JP4774043B2/ja not_active Expired - Fee Related
- 2005-04-25 EP EP05742091A patent/EP1740544B1/en not_active Expired - Lifetime
- 2005-04-25 CN CN2005800127209A patent/CN1946695B/zh not_active Expired - Fee Related
- 2005-04-25 PT PT05742091T patent/PT1740544E/pt unknown
- 2005-04-25 PL PL05742091T patent/PL1740544T3/pl unknown
- 2005-04-25 MX MXPA06012159A patent/MXPA06012159A/es active IP Right Grant
- 2005-04-25 CA CA2560373A patent/CA2560373C/en not_active Expired - Fee Related
-
2006
- 2006-10-06 ZA ZA200608359A patent/ZA200608359B/en unknown
- 2006-10-19 IL IL178771A patent/IL178771A/en active IP Right Grant
Also Published As
| Publication number | Publication date |
|---|---|
| US20070232655A1 (en) | 2007-10-04 |
| WO2005103006A1 (en) | 2005-11-03 |
| EP1740544B1 (en) | 2007-09-19 |
| IN2012DN02609A (cs) | 2015-09-04 |
| PL1740544T3 (pl) | 2007-11-30 |
| CN1946695A (zh) | 2007-04-11 |
| CA2560373A1 (en) | 2005-11-03 |
| DE602005002553D1 (en) | 2007-10-31 |
| IL178771A (en) | 2011-10-31 |
| BRPI0508738A (pt) | 2007-08-14 |
| JP2007534720A (ja) | 2007-11-29 |
| ES2300019T3 (es) | 2008-06-01 |
| MXPA06012159A (es) | 2007-01-31 |
| ATE373643T1 (de) | 2007-10-15 |
| CA2560373C (en) | 2014-01-28 |
| PT1740544E (pt) | 2007-11-06 |
| KR101276929B1 (ko) | 2013-06-19 |
| CN1946695B (zh) | 2012-04-04 |
| DK1740544T3 (da) | 2007-11-05 |
| KR20070008704A (ko) | 2007-01-17 |
| BRPI0508738B1 (pt) | 2015-01-06 |
| JP4774043B2 (ja) | 2011-09-14 |
| US7687067B2 (en) | 2010-03-30 |
| IL178771A0 (en) | 2007-02-11 |
| EP1740544A1 (en) | 2007-01-10 |
| DE602005002553T2 (de) | 2008-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA200608359B (en) | -pyridinylcycloalkylcarboxamide derivatives useful as fungicides | |
| CN1949966B (zh) | 喹喔啉-2-酮衍生物、含有该化合物的作物保护剂及其制备方法和用途 | |
| US8071627B2 (en) | 2-pyridinylethylcarboxamide derivatives and their use as fungicides | |
| AU2004262580B9 (en) | N-'2-(2-pyridinyl) ethylbenzamide compounds and their use as fungicides | |
| EP1694648B1 (en) | 2-pyridinylethylbenzamide derivatives | |
| CA2443487A1 (en) | Inhibitors of c-jun n-terminal kinases (jnk) and other protein kinases | |
| JP2003528070A5 (cs) | ||
| WO2005085238A1 (en) | 2-pyridinylethylcarboxamide derivatives and their use as fungicides | |
| ZA200608237B (en) | 2-pyridinylcycloalkylbenzamide derivatives and their use as fungicides | |
| Zhang et al. | Synthesis and Biological Activity of a 3, 5-Disubstituted-1, 2, 4-Oxadiazole Fungicide Containing 3-Pyrazole Group | |
| BR112016030359A2 (pt) | derivados de 5-hidroxi-2-heteroaril-3-fenilpentanonitrila substituídos, processos para a sua preparação e seu uso como herbicidas e/ou reguladores do crescimento de plantas | |
| CZ20003415A3 (cs) | Způsob přípravy nitroguanidinových derivátů | |
| PL59595B1 (cs) |