YU42274B - Process for continual producing and isolating izo- or terephtalic acid - Google Patents
Process for continual producing and isolating izo- or terephtalic acidInfo
- Publication number
- YU42274B YU42274B YU260576A YU260576A YU42274B YU 42274 B YU42274 B YU 42274B YU 260576 A YU260576 A YU 260576A YU 260576 A YU260576 A YU 260576A YU 42274 B YU42274 B YU 42274B
- Authority
- YU
- Yugoslavia
- Prior art keywords
- izo
- continual
- isolating
- producing
- terephtalic acid
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62567575A | 1975-10-24 | 1975-10-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| YU260576A YU260576A (en) | 1982-05-31 |
| YU42274B true YU42274B (en) | 1988-08-31 |
Family
ID=24507104
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| YU260576A YU42274B (en) | 1975-10-24 | 1976-10-25 | Process for continual producing and isolating izo- or terephtalic acid |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS6048497B2 (enExample) |
| BE (1) | BE847474A (enExample) |
| CA (1) | CA1062279A (enExample) |
| DE (1) | DE2647698A1 (enExample) |
| DK (1) | DK159259C (enExample) |
| FR (1) | FR2328688A1 (enExample) |
| GB (1) | GB1555246A (enExample) |
| IT (1) | IT1073924B (enExample) |
| LU (1) | LU76048A1 (enExample) |
| NL (1) | NL188637C (enExample) |
| YU (1) | YU42274B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2714985C2 (de) * | 1977-04-04 | 1982-05-06 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Reinigung von Terephthalsäure |
| JPS5470235A (en) * | 1977-11-14 | 1979-06-05 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
| US4334086A (en) * | 1981-03-16 | 1982-06-08 | Labofina S.A. | Production of terephthalic acid |
| DE3128147C2 (de) * | 1981-07-16 | 1986-03-06 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von aromatischen Monocarbonsäuren |
| JP2893860B2 (ja) * | 1990-05-17 | 1999-05-24 | 三菱瓦斯化学株式会社 | 高純度イソフタル酸の製造法 |
| US5132450A (en) * | 1990-06-25 | 1992-07-21 | Mitsubishi Gas Chemical Company, Inc. | Process for producing high purity isophthalic acid |
| US5183933A (en) * | 1991-10-15 | 1993-02-02 | Amoco Corporation | Process for preparing 2,6-naphthalene-dicarboxylic acid |
| US7608733B2 (en) | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) * | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7884232B2 (en) | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7358389B2 (en) | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| WO2019005532A1 (en) * | 2017-06-29 | 2019-01-03 | Bp Corporation North America Inc. | METHODS OF MAKING AROMATIC CARBOXYLIC ACIDS |
| CN112110813A (zh) * | 2020-09-18 | 2020-12-22 | 中国石化扬子石油化工有限公司 | 一种促进偏苯三甲酸结晶的方法 |
-
1976
- 1976-10-20 BE BE171665A patent/BE847474A/xx not_active IP Right Cessation
- 1976-10-21 DE DE19762647698 patent/DE2647698A1/de active Granted
- 1976-10-21 LU LU76048A patent/LU76048A1/xx unknown
- 1976-10-22 GB GB4400676A patent/GB1555246A/en not_active Expired
- 1976-10-22 CA CA263,924A patent/CA1062279A/en not_active Expired
- 1976-10-22 IT IT5186376A patent/IT1073924B/it active
- 1976-10-22 DK DK477776A patent/DK159259C/da not_active IP Right Cessation
- 1976-10-22 NL NL7611720A patent/NL188637C/xx not_active IP Right Cessation
- 1976-10-23 JP JP12681576A patent/JPS6048497B2/ja not_active Expired
- 1976-10-25 YU YU260576A patent/YU42274B/xx unknown
- 1976-10-25 FR FR7632100A patent/FR2328688A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NL188637C (nl) | 1992-08-17 |
| DK477776A (da) | 1977-04-25 |
| DK159259B (da) | 1990-09-24 |
| GB1555246A (en) | 1979-11-07 |
| BE847474A (fr) | 1977-04-20 |
| YU260576A (en) | 1982-05-31 |
| DE2647698C2 (enExample) | 1989-06-15 |
| CA1062279A (en) | 1979-09-11 |
| JPS6048497B2 (ja) | 1985-10-28 |
| DK159259C (da) | 1991-04-08 |
| JPS5285136A (en) | 1977-07-15 |
| FR2328688B1 (enExample) | 1978-12-15 |
| NL7611720A (nl) | 1977-04-26 |
| IT1073924B (it) | 1985-04-17 |
| FR2328688A1 (fr) | 1977-05-20 |
| DE2647698A1 (de) | 1977-04-28 |
| LU76048A1 (enExample) | 1977-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU42274B (en) | Process for continual producing and isolating izo- or terephtalic acid | |
| HU172304B (hu) | Sposob poluchenija proizvodnykh 7-tiazolilacetamido-cef-3-em-4-karbonovojj kisloty | |
| HU173005B (hu) | Sposob poluchenija alkiloksim-proizvodnykh 3-zamehhennykh-7-amino-cef-3-em-4-karbonovykh kislot | |
| PT67439A (en) | Process for producing terephtalic acid | |
| YU102976A (en) | Process for producing sulfuric acid | |
| HU173110B (hu) | Sposob poluchenija oksimov 7-skobka-amino-tiazolil-acetajj kisloty | |
| HU174553B (hu) | Sposob poluchenija proizvodnykh 7-beta-amino-3-cefem-3-ol-4-karbonovykh kislot | |
| JPS5248615A (en) | Method of producing formic acid purely | |
| HU178639B (en) | Process for producing 9-thia-12-azaprostanoic acid | |
| GB1537853A (en) | Process for preparing oxalic acid and its esters | |
| GB1553307A (en) | Process for producing sulphuric acid | |
| HU173394B (hu) | Sposob poluchenija proizvodnykh 7-metoksi-7-skobka-geterociklichnye-acilamido-skobka zakryta-acetamido-cef-3-em-4-karbonovykh kislot | |
| GB1534195A (en) | Method for producing l(+)-tartaric acid | |
| YU117776A (en) | Process for producing sulphuric acid | |
| HU179140B (en) | Process for producing new cepheme-carboxylic acids containing alkylsulfonyl-amino-groups | |
| PT67440A (en) | Process for producing terephtalic acid | |
| HU171208B (hu) | Sposob poluchenija proizvodnykh 7-amino-3-metil-cef-3-em-4-karbonovojj kisloty | |
| HU172925B (hu) | Sposob poluchenija al'fa-/m-benzoil-fenil/-propionovoj kisloty | |
| GB1531901A (en) | Method for producing l(+)-tartaric acid | |
| YU33976A (en) | Process for producing diacetone-2-ketogulonic acid | |
| GB1532041A (en) | Method for producing l(+)tartaric acid | |
| HU175444B (hu) | Sposob poluchenija deoksi-klavulannojj kisloty i ejj proizvodnykh | |
| HU174070B (hu) | Sposob poluchenija proizvodnykh 7-amino-3-gidroksi-3-cefem- ili -cefam-4-karbonovykh kislot | |
| HU172532B (hu) | Sposob poluchenija proizvodnykh 7-al'fa-metoksi-cef-3-em-4-karbonovojj kisloty | |
| GB1522099A (en) | Process for preparing an alpha-alkanecarboxylic acid |