WO2007069712A1 - アミン化合物及びその医薬用途 - Google Patents
アミン化合物及びその医薬用途 Download PDFInfo
- Publication number
- WO2007069712A1 WO2007069712A1 PCT/JP2006/325016 JP2006325016W WO2007069712A1 WO 2007069712 A1 WO2007069712 A1 WO 2007069712A1 JP 2006325016 W JP2006325016 W JP 2006325016W WO 2007069712 A1 WO2007069712 A1 WO 2007069712A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- reaction
- solvent
- compound
- added
- pharmaceutically acceptable
- Prior art date
Links
- -1 Amine compound Chemical class 0.000 title claims abstract description 228
- 150000001875 compounds Chemical class 0.000 claims abstract description 305
- 239000002253 acid Substances 0.000 claims abstract description 133
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 79
- 150000003839 salts Chemical class 0.000 claims abstract description 63
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 61
- 125000005843 halogen group Chemical group 0.000 claims abstract description 57
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 51
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 50
- 239000012453 solvate Substances 0.000 claims abstract description 42
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 21
- 125000004434 sulfur atom Chemical group 0.000 claims abstract description 20
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 13
- 239000003937 drug carrier Substances 0.000 claims abstract description 4
- 239000002904 solvent Substances 0.000 claims description 322
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 41
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims description 36
- 229910052739 hydrogen Inorganic materials 0.000 claims description 35
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 34
- 239000001257 hydrogen Substances 0.000 claims description 31
- 239000000126 substance Substances 0.000 claims description 29
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 25
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 23
- 229910052736 halogen Inorganic materials 0.000 claims description 23
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 18
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 16
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 claims description 14
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 11
- 230000002265 prevention Effects 0.000 claims description 11
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- 201000010099 disease Diseases 0.000 claims description 9
- 239000001294 propane Substances 0.000 claims description 6
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 5
- 208000023275 Autoimmune disease Diseases 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 210000000056 organ Anatomy 0.000 claims description 5
- 238000002054 transplantation Methods 0.000 claims description 5
- 201000004681 Psoriasis Diseases 0.000 claims description 4
- 230000001154 acute effect Effects 0.000 claims description 4
- 208000026935 allergic disease Diseases 0.000 claims description 4
- 238000010322 bone marrow transplantation Methods 0.000 claims description 4
- 230000001684 chronic effect Effects 0.000 claims description 4
- 150000004677 hydrates Chemical class 0.000 claims description 4
- 206010012438 Dermatitis atopic Diseases 0.000 claims description 3
- 208000005777 Lupus Nephritis Diseases 0.000 claims description 3
- 206010029164 Nephrotic syndrome Diseases 0.000 claims description 3
- 206010039085 Rhinitis allergic Diseases 0.000 claims description 3
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 claims description 3
- 201000010105 allergic rhinitis Diseases 0.000 claims description 3
- 208000006673 asthma Diseases 0.000 claims description 3
- 201000008937 atopic dermatitis Diseases 0.000 claims description 3
- 201000002491 encephalomyelitis Diseases 0.000 claims description 3
- 125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 3
- 201000006417 multiple sclerosis Diseases 0.000 claims description 3
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 3
- 230000001629 suppression Effects 0.000 claims description 3
- 201000000596 systemic lupus erythematosus Diseases 0.000 claims description 3
- 210000001519 tissue Anatomy 0.000 claims description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims description 2
- 201000009961 allergic asthma Diseases 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 229940127557 pharmaceutical product Drugs 0.000 claims 1
- 230000002829 reductive effect Effects 0.000 abstract description 101
- 230000000694 effects Effects 0.000 abstract description 10
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 6
- 208000006218 bradycardia Diseases 0.000 abstract description 4
- 230000036471 bradycardia Effects 0.000 abstract description 4
- 230000001506 immunosuppresive effect Effects 0.000 abstract description 3
- 230000002411 adverse Effects 0.000 abstract description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 abstract 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 372
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 279
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 188
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 186
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 179
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 172
- 239000000047 product Substances 0.000 description 172
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 159
- 239000000243 solution Substances 0.000 description 142
- 239000000203 mixture Substances 0.000 description 141
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 120
- 238000010898 silica gel chromatography Methods 0.000 description 119
- 238000001816 cooling Methods 0.000 description 113
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 110
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 108
- 125000006239 protecting group Chemical group 0.000 description 96
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 86
- 230000015572 biosynthetic process Effects 0.000 description 84
- 238000003786 synthesis reaction Methods 0.000 description 84
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 83
- 238000001953 recrystallisation Methods 0.000 description 79
- 238000005481 NMR spectroscopy Methods 0.000 description 73
- 238000000034 method Methods 0.000 description 73
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 70
- 238000001035 drying Methods 0.000 description 68
- 239000003153 chemical reaction reagent Substances 0.000 description 67
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 66
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 66
- 238000005406 washing Methods 0.000 description 66
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 63
- 239000011541 reaction mixture Substances 0.000 description 62
- 238000000605 extraction Methods 0.000 description 58
- 239000002585 base Substances 0.000 description 57
- 238000010511 deprotection reaction Methods 0.000 description 57
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 55
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 49
- 238000001914 filtration Methods 0.000 description 41
- 239000012044 organic layer Substances 0.000 description 40
- 238000010992 reflux Methods 0.000 description 40
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- 238000006722 reduction reaction Methods 0.000 description 39
- 239000012230 colorless oil Substances 0.000 description 38
- 239000000843 powder Substances 0.000 description 38
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 36
- 230000001476 alcoholic effect Effects 0.000 description 36
- 230000009467 reduction Effects 0.000 description 35
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 33
- 239000003921 oil Substances 0.000 description 32
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 32
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 31
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 30
- 239000012046 mixed solvent Substances 0.000 description 30
- 239000007787 solid Substances 0.000 description 30
- 238000007796 conventional method Methods 0.000 description 29
- 238000000746 purification Methods 0.000 description 29
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 29
- 235000017557 sodium bicarbonate Nutrition 0.000 description 29
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 28
- 239000003960 organic solvent Substances 0.000 description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 27
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 27
- 150000007530 organic bases Chemical class 0.000 description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 25
- 150000007529 inorganic bases Chemical class 0.000 description 25
- 239000002798 polar solvent Substances 0.000 description 25
- 238000003756 stirring Methods 0.000 description 24
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 23
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 22
- 239000012312 sodium hydride Substances 0.000 description 22
- 229910000104 sodium hydride Inorganic materials 0.000 description 22
- 229920006395 saturated elastomer Polymers 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- 238000004821 distillation Methods 0.000 description 20
- 150000002367 halogens Chemical class 0.000 description 20
- 239000004215 Carbon black (E152) Substances 0.000 description 19
- 229930195733 hydrocarbon Natural products 0.000 description 19
- 150000002430 hydrocarbons Chemical class 0.000 description 19
- 150000007522 mineralic acids Chemical class 0.000 description 19
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 17
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 17
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 16
- 238000007239 Wittig reaction Methods 0.000 description 16
- 239000002815 homogeneous catalyst Substances 0.000 description 16
- 229910000027 potassium carbonate Inorganic materials 0.000 description 16
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 125000003277 amino group Chemical group 0.000 description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 14
- 230000003197 catalytic effect Effects 0.000 description 14
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 14
- 239000012279 sodium borohydride Substances 0.000 description 14
- 229910000033 sodium borohydride Inorganic materials 0.000 description 14
- 238000009833 condensation Methods 0.000 description 13
- 230000005494 condensation Effects 0.000 description 13
- 239000002638 heterogeneous catalyst Substances 0.000 description 13
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 13
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 12
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 12
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 12
- 239000004210 ether based solvent Substances 0.000 description 12
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 12
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 238000005804 alkylation reaction Methods 0.000 description 11
- 239000012298 atmosphere Substances 0.000 description 11
- 239000010410 layer Substances 0.000 description 11
- 239000012280 lithium aluminium hydride Substances 0.000 description 11
- 239000011259 mixed solution Substances 0.000 description 11
- 150000003573 thiols Chemical class 0.000 description 11
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 11
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Natural products P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 10
- 150000001336 alkenes Chemical group 0.000 description 10
- 230000029936 alkylation Effects 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- 229910052987 metal hydride Inorganic materials 0.000 description 10
- 150000004681 metal hydrides Chemical class 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 9
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- 229910052731 fluorine Inorganic materials 0.000 description 9
- 125000001153 fluoro group Chemical group F* 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 229910052751 metal Chemical class 0.000 description 9
- 239000002184 metal Chemical class 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- RVYNIIJBIAINNT-UHFFFAOYSA-N propane-1,3-diol;hydrochloride Chemical compound Cl.OCCCO RVYNIIJBIAINNT-UHFFFAOYSA-N 0.000 description 9
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 description 8
- HJQQRKDFYQSTOK-UHFFFAOYSA-N 2-methylbutan-1-ol;hydrochloride Chemical compound Cl.CCC(C)CO HJQQRKDFYQSTOK-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- 150000001241 acetals Chemical class 0.000 description 8
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 8
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 8
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 8
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 8
- 150000008300 phosphoramidites Chemical class 0.000 description 8
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 8
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 8
- GUXJXWKCUUWCLX-UHFFFAOYSA-N 2-methyl-2-oxazoline Chemical compound CC1=NCCO1 GUXJXWKCUUWCLX-UHFFFAOYSA-N 0.000 description 7
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 7
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 7
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 7
- 239000012448 Lithium borohydride Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 150000001299 aldehydes Chemical class 0.000 description 7
- 125000003710 aryl alkyl group Chemical group 0.000 description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
- 239000012442 inert solvent Substances 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 229910052698 phosphorus Inorganic materials 0.000 description 7
- 239000011574 phosphorus Substances 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- 125000004665 trialkylsilyl group Chemical group 0.000 description 7
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 7
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 6
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 6
- 238000005160 1H NMR spectroscopy Methods 0.000 description 6
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 239000002168 alkylating agent Substances 0.000 description 6
- 229940100198 alkylating agent Drugs 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 6
- 239000007800 oxidant agent Substances 0.000 description 6
- 230000002633 protecting effect Effects 0.000 description 6
- 229910052703 rhodium Inorganic materials 0.000 description 6
- 239000010948 rhodium Substances 0.000 description 6
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 238000006467 substitution reaction Methods 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 238000006751 Mitsunobu reaction Methods 0.000 description 5
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 5
- 239000005708 Sodium hypochlorite Substances 0.000 description 5
- ABRVLXLNVJHDRQ-UHFFFAOYSA-N [2-pyridin-3-yl-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound FC(C1=CC(=CC(=N1)C=1C=NC=CC=1)CN)(F)F ABRVLXLNVJHDRQ-UHFFFAOYSA-N 0.000 description 5
- RBYGDVHOECIAFC-UHFFFAOYSA-L acetonitrile;palladium(2+);dichloride Chemical compound [Cl-].[Cl-].[Pd+2].CC#N.CC#N RBYGDVHOECIAFC-UHFFFAOYSA-L 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 5
- 150000001342 alkaline earth metals Chemical class 0.000 description 5
- 150000001639 boron compounds Chemical class 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- 229940071870 hydroiodic acid Drugs 0.000 description 5
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 5
- 150000003003 phosphines Chemical class 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 5
- 150000003283 rhodium Chemical class 0.000 description 5
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 5
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 4
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 4
- ABUSWLOUSQWWLA-UHFFFAOYSA-N 1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone Chemical compound COC1=CC=C(C(C)=O)C=C1C(F)(F)F ABUSWLOUSQWWLA-UHFFFAOYSA-N 0.000 description 4
- LSXKDWGTSHCFPP-UHFFFAOYSA-N 1-bromoheptane Chemical compound CCCCCCCBr LSXKDWGTSHCFPP-UHFFFAOYSA-N 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 4
- CXTXJOFDDHXAQD-UHFFFAOYSA-N 2-amino-2-(2-fluoroethyl)-4-[4-heptoxy-3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride Chemical compound Cl.CCCCCCCOC1=CC=C(CCC(N)(CO)CCF)C=C1C(F)(F)F CXTXJOFDDHXAQD-UHFFFAOYSA-N 0.000 description 4
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 4
- QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 description 4
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 4
- 239000005749 Copper compound Substances 0.000 description 4
- 239000002841 Lewis acid Substances 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 150000004703 alkoxides Chemical class 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 150000001880 copper compounds Chemical class 0.000 description 4
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 4
- 229940043279 diisopropylamine Drugs 0.000 description 4
- 235000011180 diphosphates Nutrition 0.000 description 4
- 210000003128 head Anatomy 0.000 description 4
- 150000007517 lewis acids Chemical class 0.000 description 4
- 210000004698 lymphocyte Anatomy 0.000 description 4
- 230000014759 maintenance of location Effects 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 150000002941 palladium compounds Chemical class 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000002953 preparative HPLC Methods 0.000 description 4
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 4
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 4
- 208000024891 symptom Diseases 0.000 description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 description 4
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 4
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 3
- SSNZFABFUVVRCV-UHFFFAOYSA-N (5-diphenylphosphanyl-1,9-dimethyl-9H-xanthen-4-yl)-diphenylphosphane Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC(C)=C3C(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 SSNZFABFUVVRCV-UHFFFAOYSA-N 0.000 description 3
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 3
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 3
- MGDCBOKBTJIJBT-UHFFFAOYSA-N 2,2-difluoro-1,3-dimethylimidazolidine Chemical compound CN1CCN(C)C1(F)F MGDCBOKBTJIJBT-UHFFFAOYSA-N 0.000 description 3
- QNQKVMUAFHMBTP-UHFFFAOYSA-N 3-(trifluoromethyl)benzene-1,2-diol Chemical compound OC1=CC=CC(C(F)(F)F)=C1O QNQKVMUAFHMBTP-UHFFFAOYSA-N 0.000 description 3
- 101100459319 Arabidopsis thaliana VIII-2 gene Proteins 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- RKYWYVBGYWJNME-UHFFFAOYSA-N C(CCCCCCCCCCCCCCC)NS(F)(F)F Chemical compound C(CCCCCCCCCCCCCCC)NS(F)(F)F RKYWYVBGYWJNME-UHFFFAOYSA-N 0.000 description 3
- VPIAKHNXCOTPAY-UHFFFAOYSA-N Heptane-1-thiol Chemical compound CCCCCCCS VPIAKHNXCOTPAY-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 102100025750 Sphingosine 1-phosphate receptor 1 Human genes 0.000 description 3
- 101710155454 Sphingosine 1-phosphate receptor 1 Proteins 0.000 description 3
- 102000011011 Sphingosine 1-phosphate receptors Human genes 0.000 description 3
- 108050001083 Sphingosine 1-phosphate receptors Proteins 0.000 description 3
- QYTDEUPAUMOIOP-UHFFFAOYSA-N TEMPO Chemical group CC1(C)CCCC(C)(C)N1[O] QYTDEUPAUMOIOP-UHFFFAOYSA-N 0.000 description 3
- LRFKWQGGENFBFO-IBGZPJMESA-N [(2s)-2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butyl] dihydrogen phosphate Chemical compound CCCCCCCCC1=CC=C(CC[C@](N)(CO)COP(O)(O)=O)C=C1 LRFKWQGGENFBFO-IBGZPJMESA-N 0.000 description 3
- 239000005456 alcohol based solvent Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 229940126543 compound 14 Drugs 0.000 description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229960000556 fingolimod Drugs 0.000 description 3
- SWZTYAVBMYWFGS-UHFFFAOYSA-N fingolimod hydrochloride Chemical compound Cl.CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1 SWZTYAVBMYWFGS-UHFFFAOYSA-N 0.000 description 3
- 238000003682 fluorination reaction Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- 239000011981 lindlar catalyst Substances 0.000 description 3
- 210000003563 lymphoid tissue Anatomy 0.000 description 3
- 239000002808 molecular sieve Substances 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- 238000006268 reductive amination reaction Methods 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910001923 silver oxide Inorganic materials 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- DUYSYHSSBDVJSM-KRWOKUGFSA-N sphingosine 1-phosphate Chemical compound CCCCCCCCCCCCC\C=C\[C@@H](O)[C@@H](N)COP(O)(O)=O DUYSYHSSBDVJSM-KRWOKUGFSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 2
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 2
- 229940005561 1,4-benzoquinone Drugs 0.000 description 2
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- YYKBFGMYHQMXIL-UHFFFAOYSA-N 1-phenyl-2,3,4-tri(propan-2-yl)benzene Chemical group CC(C)C1=C(C(C)C)C(C(C)C)=CC=C1C1=CC=CC=C1 YYKBFGMYHQMXIL-UHFFFAOYSA-N 0.000 description 2
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 2
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- NVLPDIRQWJSXLZ-UHFFFAOYSA-N 3-hydroxypyridine-4-carbaldehyde Chemical compound OC1=CN=CC=C1C=O NVLPDIRQWJSXLZ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 238000006218 Arndt-Eistert homologation reaction Methods 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- FWRDKVPNOZYUFN-UHFFFAOYSA-N C(C)(=O)Cl.[Na] Chemical compound C(C)(=O)Cl.[Na] FWRDKVPNOZYUFN-UHFFFAOYSA-N 0.000 description 2
- QWOJMRHUQHTCJG-UHFFFAOYSA-N CC([CH2-])=O Chemical compound CC([CH2-])=O QWOJMRHUQHTCJG-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 description 2
- 108010036949 Cyclosporine Proteins 0.000 description 2
- ZDQWESQEGGJUCH-UHFFFAOYSA-N Diisopropyl adipate Chemical compound CC(C)OC(=O)CCCCC(=O)OC(C)C ZDQWESQEGGJUCH-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 244000000231 Sesamum indicum Species 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- 239000005858 Triflumizole Substances 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 description 2
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 2
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 229960001265 ciclosporin Drugs 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229930182912 cyclosporin Natural products 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 210000002216 heart Anatomy 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 238000003797 solvolysis reaction Methods 0.000 description 2
- 150000008054 sulfonate salts Chemical class 0.000 description 2
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 2
- 150000003555 thioacetals Chemical class 0.000 description 2
- RLUJQBLWUQZMDG-UHFFFAOYSA-N toluene;hydrochloride Chemical compound Cl.CC1=CC=CC=C1 RLUJQBLWUQZMDG-UHFFFAOYSA-N 0.000 description 2
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 2
- HSMVPDGQOIQYSR-KGENOOAVSA-N triflumizole Chemical compound C1=CN=CN1C(/COCCC)=N/C1=CC=C(Cl)C=C1C(F)(F)F HSMVPDGQOIQYSR-KGENOOAVSA-N 0.000 description 2
- ITHPEWAHFNDNIO-UHFFFAOYSA-N triphosphane Chemical compound PPP ITHPEWAHFNDNIO-UHFFFAOYSA-N 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- 239000001211 (E)-4-phenylbut-3-en-2-one Substances 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- OVISMSJCKCDOPU-UHFFFAOYSA-N 1,6-dichlorohexane Chemical compound ClCCCCCCCl OVISMSJCKCDOPU-UHFFFAOYSA-N 0.000 description 1
- NTINAJCDYRYMML-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-phenylethane-1,2-dione Chemical compound C1=CC(OC)=CC=C1C(=O)C(=O)C1=CC=CC=C1 NTINAJCDYRYMML-UHFFFAOYSA-N 0.000 description 1
- OKDWFIMHZAXBAG-UHFFFAOYSA-N 1-amino-2-ethylpropane-1,3-diol Chemical compound CCC(CO)C(N)O OKDWFIMHZAXBAG-UHFFFAOYSA-N 0.000 description 1
- BLIQUJLAJXRXSG-UHFFFAOYSA-N 1-benzyl-3-(trifluoromethyl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1C(C(=O)O)(C(F)(F)F)CCN1CC1=CC=CC=C1 BLIQUJLAJXRXSG-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 1
- ZZRGDSMZKOGYPC-UHFFFAOYSA-N 1-phenyl-2-propylbenzene Chemical group CCCC1=CC=CC=C1C1=CC=CC=C1 ZZRGDSMZKOGYPC-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- FCAJYRVEBULFKS-UHFFFAOYSA-N 2-(oxolan-2-yl)ethanol Chemical compound OCCC1CCCO1 FCAJYRVEBULFKS-UHFFFAOYSA-N 0.000 description 1
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical class CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- BCZZAISAAQRMLY-UHFFFAOYSA-N 2-fluoro-1-[3-(trifluoromethyl)phenyl]ethanone Chemical compound FCC(=O)C1=CC=CC(C(F)(F)F)=C1 BCZZAISAAQRMLY-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000003504 2-oxazolinyl group Chemical group O1C(=NCC1)* 0.000 description 1
- VKLSLWCRDBMTKB-UHFFFAOYSA-N 3-hexadecoxy-3-oxopropanoic acid Chemical compound CCCCCCCCCCCCCCCCOC(=O)CC(O)=O VKLSLWCRDBMTKB-UHFFFAOYSA-N 0.000 description 1
- GISCXYLVNFIAEL-UHFFFAOYSA-N 4-(chloromethyl)-1-phenylmethoxy-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(CCl)=CC=C1OCC1=CC=CC=C1 GISCXYLVNFIAEL-UHFFFAOYSA-N 0.000 description 1
- ZDRVLAOYDGQLFI-UHFFFAOYSA-N 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;hydrochloride Chemical compound Cl.C1=CC(O)=CC=C1NC1=NC(C=2C=CC(Cl)=CC=2)=CS1 ZDRVLAOYDGQLFI-UHFFFAOYSA-N 0.000 description 1
- WZBPZYCJUADXRS-UHFFFAOYSA-N 4-fluoro-3-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(F)C(C(F)(F)F)=C1 WZBPZYCJUADXRS-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- XJTCXIYCDUIGGL-UHFFFAOYSA-N 5-bromo-2-heptoxybenzonitrile Chemical compound CCCCCCCOC1=CC=C(Br)C=C1C#N XJTCXIYCDUIGGL-UHFFFAOYSA-N 0.000 description 1
- GBXPJDWSZDRLCZ-UHFFFAOYSA-N 5-ethyl-2,2-dimethyl-1,3-dioxane Chemical compound CCC1COC(C)(C)OC1 GBXPJDWSZDRLCZ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 208000009137 Behcet syndrome Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- XMWRBQBLMFGWIX-UHFFFAOYSA-N C60 fullerene Chemical compound C12=C3C(C4=C56)=C7C8=C5C5=C9C%10=C6C6=C4C1=C1C4=C6C6=C%10C%10=C9C9=C%11C5=C8C5=C8C7=C3C3=C7C2=C1C1=C2C4=C6C4=C%10C6=C9C9=C%11C5=C5C8=C3C3=C7C1=C1C2=C4C6=C2C9=C5C3=C12 XMWRBQBLMFGWIX-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- NZVQNABHNPTIMQ-UHFFFAOYSA-N FC(F)(F)C1=CC(O)=CC=C1OCC1=CC=CC=C1 Chemical compound FC(F)(F)C1=CC(O)=CC=C1OCC1=CC=CC=C1 NZVQNABHNPTIMQ-UHFFFAOYSA-N 0.000 description 1
- 206010019851 Hepatotoxicity Diseases 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 238000005654 Michaelis-Arbuzov synthesis reaction Methods 0.000 description 1
- 206010029155 Nephropathy toxic Diseases 0.000 description 1
- 206010029350 Neurotoxicity Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- 102100025749 Sphingosine 1-phosphate receptor 2 Human genes 0.000 description 1
- 101710155462 Sphingosine 1-phosphate receptor 2 Proteins 0.000 description 1
- 206010044221 Toxic encephalopathy Diseases 0.000 description 1
- SKXFUBHZYBNOPT-UHFFFAOYSA-K [Al](Br)(Br)Br.[Li] Chemical compound [Al](Br)(Br)Br.[Li] SKXFUBHZYBNOPT-UHFFFAOYSA-K 0.000 description 1
- WREOTYWODABZMH-DTZQCDIJSA-N [[(2r,3s,4r,5r)-3,4-dihydroxy-5-[2-oxo-4-(2-phenylethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N(C=C\1)C(=O)NC/1=N\OCCC1=CC=CC=C1 WREOTYWODABZMH-DTZQCDIJSA-N 0.000 description 1
- QQIRAVWVGBTHMJ-UHFFFAOYSA-N [dimethyl-(trimethylsilylamino)silyl]methane;lithium Chemical compound [Li].C[Si](C)(C)N[Si](C)(C)C QQIRAVWVGBTHMJ-UHFFFAOYSA-N 0.000 description 1
- MVAHBFHDGWKPSY-UHFFFAOYSA-N [propan-2-yl(2,3,3-trimethylbutan-2-yl)amino]phosphonous acid Chemical compound CC(C)N(C(C)(C)C(C)(C)C)P(O)O MVAHBFHDGWKPSY-UHFFFAOYSA-N 0.000 description 1
- YPNPLCUQNNKQBJ-UHFFFAOYSA-N acetamide;propanedioic acid Chemical compound CC(N)=O.OC(=O)CC(O)=O YPNPLCUQNNKQBJ-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- 230000001548 androgenic effect Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- QNFLUQDLGGWVNX-UHFFFAOYSA-N benzyl 4-fluoro-3-(trifluoromethyl)benzoate Chemical compound C1=C(C(F)(F)F)C(F)=CC=C1C(=O)OCC1=CC=CC=C1 QNFLUQDLGGWVNX-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- XDGYHAAUHYNDMA-UHFFFAOYSA-N benzyl hypochlorite Chemical compound ClOCC1=CC=CC=C1 XDGYHAAUHYNDMA-UHFFFAOYSA-N 0.000 description 1
- 229930008407 benzylideneacetone Natural products 0.000 description 1
- HAZUEVQCTTXTNL-NAXLJUODSA-N beta-D-GlcA-(1->3)-beta-D-Gal-(1->3)-beta-D-Gal-(1->4)-beta-D-Xyl-OBn Chemical compound OC[C@H]1O[C@@H](O[C@@H]2CO[C@@H](OCc3ccccc3)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)[C@H]2O)[C@H]1O HAZUEVQCTTXTNL-NAXLJUODSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- BTFBEYFQMPGYLB-UHFFFAOYSA-N butane-1,4-diol;hydrochloride Chemical compound Cl.OCCCCO BTFBEYFQMPGYLB-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- YAGCIXJCAUGCGI-UHFFFAOYSA-N butoxycarbonyl butyl carbonate Chemical compound CCCCOC(=O)OC(=O)OCCCC YAGCIXJCAUGCGI-UHFFFAOYSA-N 0.000 description 1
- 229940046731 calcineurin inhibitors Drugs 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 210000004087 cornea Anatomy 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- NSBNXCZCLRBQTA-UHFFFAOYSA-N dibenzyl bis(phenylmethoxy)phosphoryl phosphate Chemical compound C=1C=CC=CC=1COP(OP(=O)(OCC=1C=CC=CC=1)OCC=1C=CC=CC=1)(=O)OCC1=CC=CC=C1 NSBNXCZCLRBQTA-UHFFFAOYSA-N 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012025 fluorinating agent Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229910003472 fullerene Inorganic materials 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 230000007686 hepatotoxicity Effects 0.000 description 1
- 231100000304 hepatotoxicity Toxicity 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000004966 inorganic peroxy acids Chemical class 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- LZWQNOHZMQIFBX-UHFFFAOYSA-N lithium;2-methylpropan-2-olate Chemical compound [Li+].CC(C)(C)[O-] LZWQNOHZMQIFBX-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- XOPUORAQCYGJPT-UHFFFAOYSA-N methanesulfonic acid;hydrochloride Chemical compound Cl.CS(O)(=O)=O XOPUORAQCYGJPT-UHFFFAOYSA-N 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- UJQMLHKSZKBMMO-UHFFFAOYSA-N n,n-diethylethanamine;pyridine Chemical compound C1=CC=NC=C1.CCN(CC)CC UJQMLHKSZKBMMO-UHFFFAOYSA-N 0.000 description 1
- YGFLCNPXEPDANQ-UHFFFAOYSA-N n-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(C(C)C)P(OC(C)(C)C)OC(C)(C)C YGFLCNPXEPDANQ-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 230000007694 nephrotoxicity Effects 0.000 description 1
- 231100000417 nephrotoxicity Toxicity 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 230000007135 neurotoxicity Effects 0.000 description 1
- 231100000228 neurotoxicity Toxicity 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- GZNFMVYOVWHRGV-UHFFFAOYSA-N phenylmethanesulfonyl chloride hydrochloride Chemical compound Cl.ClS(=O)(=O)CC1=CC=CC=C1 GZNFMVYOVWHRGV-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 1
- 230000000865 phosphorylative effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- JQRYUMGHOUYJFW-UHFFFAOYSA-N pyridine;trihydrobromide Chemical compound [Br-].[Br-].[Br-].C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1 JQRYUMGHOUYJFW-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- HCWPIIXVSYCSAN-UHFFFAOYSA-N radium atom Chemical compound [Ra] HCWPIIXVSYCSAN-UHFFFAOYSA-N 0.000 description 1
- 229940075993 receptor modulator Drugs 0.000 description 1
- BDDWSAASCFBVBK-UHFFFAOYSA-N rhodium;triphenylphosphane Chemical compound [Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 BDDWSAASCFBVBK-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000014347 soups Nutrition 0.000 description 1
- 108010035597 sphingosine kinase Proteins 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 210000004988 splenocyte Anatomy 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000004808 supercritical fluid chromatography Methods 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000013076 target substance Substances 0.000 description 1
- FQFILJKFZCVHNH-UHFFFAOYSA-N tert-butyl n-[3-[(5-bromo-2-chloropyrimidin-4-yl)amino]propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCNC1=NC(Cl)=NC=C1Br FQFILJKFZCVHNH-UHFFFAOYSA-N 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 230000002992 thymic effect Effects 0.000 description 1
- 210000001541 thymus gland Anatomy 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- BWHOZHOGCMHOBV-BQYQJAHWSA-N trans-benzylideneacetone Chemical compound CC(=O)\C=C\C1=CC=CC=C1 BWHOZHOGCMHOBV-BQYQJAHWSA-N 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- KPUQGVXQKLUIES-UHFFFAOYSA-N trichloromethoxymethylbenzene Chemical compound ClC(Cl)(Cl)OCC1=CC=CC=C1 KPUQGVXQKLUIES-UHFFFAOYSA-N 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- 125000004385 trihaloalkyl group Chemical group 0.000 description 1
- GUTDVBHLNJEILW-UHFFFAOYSA-M triphenyl-[[4-phenylmethoxy-3-(trifluoromethyl)phenyl]methyl]phosphanium;chloride Chemical compound [Cl-].C=1C=C(OCC=2C=CC=CC=2)C(C(F)(F)F)=CC=1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 GUTDVBHLNJEILW-UHFFFAOYSA-M 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000002689 xenotransplantation Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/02—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/02—Nasal agents, e.g. decongestants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/16—Otologicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/64—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/72—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms
- C07C235/76—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton
- C07C235/78—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton the carbon skeleton containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/54—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and etherified hydroxy groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/16—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/32—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to an acyclic carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/08—Esters of oxyacids of phosphorus
- C07F9/09—Esters of phosphoric acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/08—Esters of oxyacids of phosphorus
- C07F9/09—Esters of phosphoric acids
- C07F9/091—Esters of phosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/08—Esters of oxyacids of phosphorus
- C07F9/141—Esters of phosphorous acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4056—Esters of arylalkanephosphonic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6527—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having nitrogen and oxygen atoms as the only ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6527—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having nitrogen and oxygen atoms as the only ring hetero atoms
- C07F9/653—Five-membered rings
Definitions
- the present invention relates to an amine compound and its use as a medicine.
- calciurin inhibitors such as cyclosporine N FK506 have been used to suppress rejection in patients who have received organ transplantation.
- certain calcineurin inhibitors such as cyclosporine
- can cause adverse side effects such as nephrotoxicity, hepatotoxicity, and neurotoxicity. Therefore, the development of safer and more effective drugs is being promoted in order to suppress rejection in transplant patients.
- Patent Documents 1 to 3 are useful as inhibitors of (acute or chronic) rejection in organ or bone marrow transplantation, and as therapeutic agents for various autoimmune diseases such as psoriasis and Behcet's disease and rheumatic diseases.
- 2 Aminopropane 1,3 dioli compound is disclosed.
- FTY720 2-amino-2- [2- (4 Okuchirufue - Le) Echiru] propane one 1, 3 Jioru hydrochloride
- FTY720-P sphingosine kinase
- FTY720-P 2 amino-2 phosphoryloxymethyl 4- (4-octylphenol) butanol
- FTY720—P is one of four types of S1P receptors among five types of sphingosine-1-phosphate (hereinafter also referred to as S1P) receptors (hereinafter also referred to as S1P1-5, respectively). Acts as an agent on the body (other than S1P2) (Non-patent Document 1).
- S1P1 in the S1P receptor is essential for the export of mature lymphocytes with thymic and secondary lymphoid tissue strength.
- FTY720—P acts as an S1P1 antigen to down-regulate S1P1 on lymphocytes.
- the migration of mature lymphocytes from the thymus and secondary lymphoid tissue is inhibited, and the immunosuppressive effect is exerted by isolating circulating mature lymphocytes in the blood within the secondary lymphoid tissue.
- Is suggested Non-patent document 2.
- the conventional 2-aminopropane 1,3 dioli compound is concerned about the occurrence of transient bradycardia as a side effect.
- 2-aminopropane 1,3 dioli compound is Numerous new compounds have been reported by modifying the compounds structurally.
- Patent Document 4 is an aminoamino derivative as a S1P receptor modulator with a phosphate group
- Patent Documents 5 and 6 are both S1P.
- Aminopropanol derivatives as receptor modulators are disclosed.
- trihaloalkyl groups such as trifluoromethyl groups are not disclosed as substituents on the benzene ring. In any case, the current level of satisfaction with pharmaceutical safety has not yet been reached.
- Patent Document 1 International Publication Pamphlet WO94Z08943
- Patent Document 2 International Publication Pamphlet WO96Z06068
- Patent Document 3 International Publication Pamphlet W098Z45429
- Patent Document 4 International Publication Pamphlet WO02Z076995
- Patent document 5 Internationally published non-fret WO2004Z096752
- Patent Document 6 International Publication Pamphlet WO2004Z110979
- Non-Patent Document 1 Science, 2002, 296, 346-349
- Non-Patent Document 2 Nature, 2004, 427, pp. 355-360
- An object of the present invention is to provide a novel amine compound that is excellent in immunosuppressive action, rejection inhibitory action and the like and has reduced side effects such as bradycardia.
- X is an oxygen atom or a sulfur atom
- Y is CH
- R is a C1-C4 alkyl or alkyl substituted with a halogen atom.
- R may be substituted with a hydroxyl group or substituted with a halogen atom
- R and R may be the same or different
- a hydrogen atom or alkyl having 1 to 4 carbon atoms, n represents 5 to 8; Or a pharmaceutically acceptable acid addition salt thereof, or a hydrate or solvate thereof.
- a possible acid addition salt, or a hydrate or solvate thereof is provided.
- halogen atom represents an alkyl having 1 to 4 carbon atoms.
- a top acceptable acid addition salt, or a hydrate or solvate thereof is provided.
- the compound represented by the general formula (I) is any of the following a to e !, any one of 1-4 !, any compound described in any one, or a pharmaceutically acceptable acid addition salt thereof, or water thereof. Japanese products or solvent products.
- the compound of the general formula (I) is the following f ⁇ ; j !, which is 1 to 4 !, the compound described in any one, or a pharmaceutically acceptable acid addition salt thereof, or a Hydrate or solvent.
- a pharmaceutical composition comprising any one of 1 to 13 compounds and a pharmaceutically acceptable carrier
- autoimmune disease is rheumatoid arthritis, multiple sclerosis, encephalomyelitis, systemic lupus erythematosus, lupus nephritis, nephrotic syndrome, psoriasis, type I diabetes Adult.
- composition according to 14 wherein the allergic disease is atopic dermatitis, allergic rhinitis or asthma.
- X is an oxygen atom or sulfur atom
- Y is CH
- R is a C1-C4 alkyl or alkyl substituted with a halogen atom.
- R may be substituted with a hydroxyl group or substituted with a halogen atom
- R and R may be the same or different
- a hydrogen atom or alkyl having 1 to 4 carbon atoms, n represents 5 to 8; Or a pharmaceutically acceptable acid addition salt or metal salt thereof, or a hydrate or solvate thereof.
- the halogen atom is a fluorine atom, a chlorine atom, a bromine atom or an iodine atom, and a fluorine atom can be mentioned as a preferred example.
- Alkyl having 1 to 4 carbon atoms means linear or branched alkyl having 1 to 4 carbon atoms, such as methyl, ethyl, n-propyl, isopropyl, n-butyl, isobutyl, Secondary butyl, tertiary butyl (hereinafter, “tertiary” may be referred to as t- or tert-), etc. are preferable, and preferred examples include methyl, ethyl, n-propyl, and isopropyl. More preferred examples include methyl and ethyl.
- R in the general formula (I) include a hydrogen atom.
- Preferred examples of X include an oxygen atom, and preferred examples of Y include CH 2 CH.
- n 6 or 7, and a more preferable example is 6.
- R include fluoromethyl, difluoromethyl, trifluoromethyl, 2,2,2-trifluoroethyl and cyano, and more preferable examples include trifluoromethyl and cyano. Trifluoromethyl is more preferred.
- R examples include methyl, ethyl, hydroxymethyl, hydroxyethyl, and fullerene.
- Examples include olomethinore, chloromethinole, funoleololochinole, difunoleoleochinole, trifunoleoleochinole, trichloroethyl, and more preferred examples include methyl, ethyl, hydroxymethyl, 2-hydroxyethyl. , 2-Fluoroethyl, methyl and hydroxymethyl can be mentioned as more preferred examples, and hydroxymethyl is most preferred.
- R and R include, for example, the same or different, hydrogen atom, methyl,
- More preferred examples include a hydrogen atom and methyl, with a hydrogen atom being most preferred.
- Pharmaceutically acceptable acid addition salts of the compounds of the present invention include inorganic acid salts, organic acid salts, alkali metal salts, alkaline earth metal salts and the like.
- the compounds of the present invention also include geometric isomers, photoactive forms, hydrates, and solvates thereof.
- preferred compounds are 2 amino-2- [2- (4 heptyloxy-3-trifluoromethylphenol) ethyl] propane 1,3 diol and its hydrochloride.
- Examples of the synthesis method of the compound of the present invention include the following methods.
- R a , R b , R e and R d are protecting groups, X a and X b are leaving groups, R is alkyl having 1 to 4 carbon atoms substituted with a halogen atom, and R is May be substituted with a hydroxyl group or halogenated
- R a in the formula is not a particularly limited as long as it protects a hydrogen atom or a carboxyl group.
- alkyl specifically, methyl, ethyl, etc.
- aralkyl benzyl, etc.
- R b in the formula is not particularly limited as long as it protects a phenolic hydroxyl group.
- alkyl specifically, methyl, heptyl, etc.
- R is not particularly limited as long as it protects the hydroxyl group.
- substituents specifically those having about 2 to 4 carbon atoms, specifically acetyl, etc.
- trialkylsilyl specifically trimethylsilyl, etc.
- benzyl or acetal compounds specifically, And methoxymethyl, tetrahydroviral, etc.
- the protecting group represented by R d should protect the amino group. If it does not specifically limit.
- acyl preferably having about 2 to 4 carbon atoms, specifically acetyl
- force rubamate groups specifically, t-butyloxycarbol, benzyloxycarbol, etc. It is done.
- the leaving group represented by X a is not particularly limited as long as it is eliminated during the substitution reaction with the alkoxide ion (R b —0_).
- a halogen atom specifically, a fluorine atom
- toluenesulfonyloxy and the like can be mentioned.
- the leaving group represented by Xb is not particularly limited as long as it is eliminated during the condensation of the intermediate ( ⁇ -4) and triphenylphosphine and does not inhibit the reaction during the next Wittig reaction! ,.
- halogen atoms specifically, iodine atom, bromine atom, chlorine atom, etc.
- methane sulfo-loxy, toluene sulfo-loxy and the like can be mentioned.
- an oxygen functional group having a protecting group Rb at the 4-position is introduced by condensation of a leaving group Xa at the 4-position and a benzoic acid derivative ( ⁇ -1) and an alcohol Rb -OH.
- This step can be carried out in the presence of a base in a polar solvent such as N, N dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- the base may be an inorganic base such as sodium hydride or potassium hydroxide, or an organic base such as 1,8 diazabisic [5.4.0] unde force-7. Examples of reaction conditions are about 10 minutes to 10 hours at about 100 ° C under ice-cooling.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction in which the carboxyl group of intermediate ( ⁇ -2) is reduced to obtain intermediate (II 3) having a hydroxyl group.
- the reagent used for the reduction is not particularly limited as long as it is usually used, but alkali metals such as sodium and alkaline earth metals, metal hydrides such as diisobutylaluminum hydride, lithium aluminum hydride and water. Examples thereof include metal hydrogen complex compounds such as sodium borohydride, boron compounds such as diborane, and catalytic hydrogenation using homogeneous or heterogeneous catalysts.
- an appropriate temperature and time are selected for the reducing reagent to be used.
- Specific examples include reduction in diborane, lithium aluminum hydride, lithium borohydride, and alcohol such as ethanol in an ether solvent such as tetrahydrofuran at 30 ° C to reflux for about 10 minutes to 12 hours.
- Examples thereof include reduction with sodium borohydride or calcium borohydride, which is carried out for 30 minutes to 24 hours under ice-cooling to reflux for 30 minutes to 24 hours in a mixed solvent of an alcoholic solvent or an alcoholic solvent and tetrahydrofuran.
- After the reaction stop the reaction, extract, wash, dry, remove the solvent, etc. by the usual method, and obtain the desired product by purifying by distillation, silica gel column chromatography, recrystallization, etc. if necessary. be able to.
- the third step is a reaction for converting the hydroxyl group of the intermediate ( ⁇ -3) into the leaving group Xb .
- the reagent is not particularly limited as long as it can convert an alcoholic hydroxyl group to xb .
- Reagents used when x b is a halogen atom include N-chlorosuccinimide, N-bromosuccinimide, tetrasalt carbon and their combination with reaction aids such as triphosphine, base, hydrochloric acid, hydrogen bromide Examples thereof include inorganic acids such as acids and hydroiodic acid, phosphorus tribromide, phosphorus pentabromide, phosphorus trichloride, phosphorus pentachloride, iodine, bromine, chlorine, halogenated alcohol, and the like.
- the reaction conditions include a halogen solvent such as methylene chloride and an organic solvent such as an ether solvent such as tetrahydrofuran and a temperature of ⁇ 30 ° C. to 130 ° C. for about 10 minutes to 6 hours.
- a two-layer reaction of an aqueous solution or an organic solvent such as toluene and water can be performed.
- X b sulfo - Reagents used when Ruokishi chloride methanesulfonic - chloride sulfo such as Le - - Le Ya chloride toluenesulfonyl combination of an organic base such as Le and Toriechiruamin or pyridine is used.
- the reaction conditions include a halogen-based solvent such as methylene chloride and an organic solvent such as tetrahydrofuran and an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- a halogen-based solvent such as methylene chloride
- an organic solvent such as tetrahydrofuran
- an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- the fourth step is a reaction in which an intermediate ( ⁇ -4) having a leaving group Xb is reacted with triphenylphosphine to obtain a phospho-um salt ( ⁇ -5).
- the reaction conditions include room temperature to reflux for about 30 minutes to 12 hours in an inert solvent such as jetyl ether, benzene, and toluene.
- the target product can be obtained by distilling off the solvent, cooling, adding a hardly soluble solvent such as diisopropyl ether or hexane, and collecting the precipitated solid by filtration.
- the fifth step is the Wittig reaction of phospho-um salt ( ⁇ -5) and separately synthesized aldehyde ( ⁇ -6) This is a reaction in which a phenolic intermediate ( ⁇ -7) is obtained by deprotecting the protecting group R b after reducing the olefin form obtained by the condensation, and then deprotecting the protecting group R b .
- the conditions for the Wittig reaction include those used in a normal Wittig reaction. For example, in an ether solvent such as tetrahydrofuran, a base such as potassium t-butoxide is used, and the temperature is about 30 minutes to 12 hours at 30 ° C. to reflux.
- the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the reagent used for the subsequent reduction of the double bond is not limited as long as it is a reagent used for the usual olefin reduction, but for example, a heterogeneous catalyst such as palladium carbon or Raney nickel, or a mouth complex (chlorotris (triphenyl)). -Lyphosphine) rhodium (I)) and the like, and catalytic hydrogenation using a homogeneous catalyst.
- the reaction conditions include alcohol solvents such as ethanol, ether solvents such as dioxane, or hydrocarbon solvents such as toluene, under hydrogen pressure of 1 to 20 atmospheres, under ice cooling to reflux, for 30 minutes to 1 week. Is mentioned.
- An acid such as acetic acid or a base such as triethylamine can be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a conventional method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the condition of deprotection of the protecting group R b performed subsequently is not particularly limited as long as it is used in the deprotection of R b, for example, R b force S tribromide in methylene chloride solvent if methyl
- R b force S tribromide in methylene chloride solvent if methyl
- a method using an acid such as hydrochloric acid or trifluoroacetic acid can be used.
- the phenolic hydroxyl group of the intermediate (II-7) is alkylated, followed by R e , R d , And when R has a hydroxyl group, the protective group R e (R e is as defined above) is protected.
- the reagent used for alkylation of the phenolic hydroxyl group in the intermediate ( ⁇ -7) include a combination of an alkylating agent such as heptyl halide and an inorganic base such as potassium carbonate or sodium hydride.
- the reaction conditions include a polar solvent such as N, N dimethylformamide and an ether type solvent such as tetrahydrofuran at ice-cooled to 80 ° C. for 30 minutes to 12 hours.
- the alkylation of the phenolic hydroxyl group of the intermediate ( ⁇ -7) is also a Mitsunobu reaction in which heptyl alcohol is condensed using a phosphine compound such as triphenylphosphine and an azocarboxylic acid derivative such as diisopropyl ester of azodicarboxylic acid. Can be used.
- the reaction conditions at this time include, for example, about 10 minutes to 6 hours at about 50 ° C. under ice cooling in an ether solvent such as tetrahydrofuran.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc.
- Subsequent deprotection is not particularly limited as long as it can be used for deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e and R e are combined to form a cyclic acetal, and R d is t-butyloxycarbon, it can be simultaneously deprotected with an acid.
- the acid at this time include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol and an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof at ice-cooled to 80 ° C for 10 minutes to 12 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- a compound represented by alkyl having 1 to 4 carbon atoms wherein R in the general formula (la) is a hydrogen atom, X is an oxygen atom, R is substituted with a ligand atom (I 1) is synthesized by the following scheme ( ⁇ ) from an intermediate ( ⁇ —2, when R a is H) included in scheme (II) or a known compound represented by general formula (III 2): It can also be synthesized using intermediate (III-1).
- R b represents a protecting group
- R f —OH represents an alcohol used in the solvolysis reaction
- R i represents an alkyl having 1 to 4 carbon atoms substituted with a halogen atom.
- R b in the formula has the same meaning as in the scheme ( ⁇ ).
- R f include methyl, ethyl, and benzyl.
- general reaction conditions of Arndt-Eistert reaction are used for the synthesis from compound ( ⁇ -2).
- the reduction of the ester thus obtained includes the reagents and conditions used in the second step of scheme (ii).
- the usual Wittig reaction conditions are used for the synthesis from compound ( ⁇ -2).
- an inorganic acid such as hydrochloric acid is used in a mixed solvent of water or an organic solvent such as tetrahydrofuran and water.
- R e, and R d is a protecting group, X a, X e is a leaving group, 1 ⁇ represents a triflate Ruo b methyl or Shiano, R has the same meaning as above.
- R e , R d , and X a are as defined above. It not particularly limited as long as it can elimination is active I spoon by the catalyst during the Kin'atama reaction as the leaving group represented by X e. Examples thereof include a halogen atom (preferably an iodine atom, a bromine atom, etc.), trifluoromethanesulfonyloxy and the like.
- the first step is a reaction to obtain intermediate (IV-2) by condensation of compound (IV-1) having leaving group Xa with heptyl alcohol.
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- a base an organic base such as sodium hydride or potassium hydroxide or an organic base such as 1,8-diazabicyclo [5.4.0] undecar 7-en can be used.
- Examples of the reaction conditions are about 10 minutes to 10 hours under ice-cooling to about 100 ° C.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a method known from intermediate (IV-2) and intermediate ( ⁇ -6) (for example, Tetrahedron 57th (2001) 6531-6538, Chemicanole and Pharmaceutical Canole Bulletin.
- intermediate (IV-3) synthesized by the 53rd (2005) 100-102
- the catalyst used is tetrakis (triphenylphosphine) palladium (0), tris Nylideneacetone) dipalladium (0), dichlorobis (acetonitrile) palladium ( ⁇ ) and the like.
- organic bases such as triethylamine, inorganic bases such as ammonia, copper compounds such as copper iodide and copper bromide, 2-dicyclohexylphosphino-1,2,4,6, monotriisopropyl Additives such as phosphine compounds such as biphenyl can also be added.
- the reaction conditions include an ether solvent such as tetrahydrofuran and dioxane, a polar solvent such as acetonitrile and dimethylformamide, or a hydrocarbon solvent such as benzene, and from ice-cooled to reflux for about 30 minutes to 24 hours.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the third step is a reaction in which intermediate (IV-5) is obtained by reducing the triple bond of intermediate (IV-4).
- the reagent to be used is not limited as long as it is a reagent used for normal reduction of unsaturated carbon bonds.
- a heterogeneous catalytic rhodium complex chlorotris (Trifer- And catalytic hydrogenation using a homogeneous catalyst such as ruphosphine) rhodium (I)
- reaction conditions in an alcohol solvent such as ethanol, an ether solvent such as dioxane, or a hydrocarbon solvent such as toluene, under a hydrogen pressure of 1 to 20 atm, under ice cooling to reflux for 30 minutes to 1 Week.
- An acid such as acetic acid or a base such as triethylamine can be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the fourth step is a reaction for obtaining the compound (1-2) of the present invention by deprotecting the intermediate (IV-5).
- RR d and R have a hydroxyl group
- protecting group R e R e is
- the deprotection of the same meaning as described above is not particularly limited as long as it can be used for the deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e and R e combine to form a cyclic acetal, and R d is t-butyloxycarbol
- the cyclic acetal is deprotected with a catalytic amount of acid, followed by stronger acid conditions R d can be deprotected.
- the conditions used are alcoholic solvents such as methanol, or mixed solutions of alcoholic solvents and other organic solvents, using catalytic amounts of hydrochloric acid and toluenesulfonic acid, with ice cooling to 80 ° C for 30 minutes to 12 minutes. About time. Meanwhile the conditions for the deprotection of deprotection Ru is subsequently conducted R d of Asetaru, with inorganic acids or Torifuruoro acetic such as more equivalents of hydrochloric acid, ether solvents such as alcoholic solvents Ya tetrahydrofuran and ethanol, In water or a mixed solvent thereof, for about 10 minutes to 12 hours at -80 ° C under ice-cooling. After the reaction, the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- R a , R e , R d are protecting groups, X b , X d are leaving groups, R is a C 1-4 alkyl substituted with a halogen atom, and R is as described above. Synonymous.
- R a , R e , R d , and X b in the formula are as defined above.
- the leaving group represented by Xd is not particularly limited as long as it is eliminated during the substitution reaction with heptylthioion (CH S_).
- halogen atoms specifically fluorine atoms, etc.
- toluene sulfonyloxy and the like can be mentioned.
- a leaving group Xd at position 4 a benzoic acid derivative (V-1) and heptylthiol
- V-1 a benzoic acid derivative
- heptylthiol a reaction in which heptylthio is introduced at the 4-position by the condensation of to obtain an intermediate (V-2).
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- the base may be an inorganic base such as potassium carbonate or sodium hydroxide, or an organic base such as triethylamine or 1,8-diazabicyclo [5.4.0] unde force-7-ene.
- reaction conditions include about ⁇ 30 to 80 ° C. and about 10 minutes to 10 hours. After the reaction, extraction, washing, drying, solvent removal, etc. are carried out by ordinary methods, and the desired product can be obtained by purification by distillation, silica gel force chromatography, recrystallization, etc. as necessary.
- the second step is a reaction in which the carboxyl group of intermediate (V-2) is reduced to obtain an intermediate (V-3) having a hydroxyl group.
- the reagent used for the reduction is not particularly limited as long as it is usually used, but alkali metals such as sodium and alkaline earth metals, metal hydrides such as diisobutylaluminum hydride, lithium aluminum hydride and water. Examples thereof include metal hydrogen complex compounds such as sodium borohydride, boron compounds such as diborane, and catalytic hydrogenation using homogeneous or heterogeneous catalysts.
- an appropriate temperature and time are selected for the reducing reagent to be used.
- the third step is a reaction for converting the hydroxyl group of the intermediate (V-3) into the leaving group Xb .
- the reagent is not particularly limited as long as it can convert an alcoholic hydroxyl group to xb .
- Reagents used when x b is a halogen atom include N-chlorosuccinimide, N-bromosuccinimide, tetrasalt carbon and their combination with reaction aids such as triphosphine, base, hydrochloric acid, hydrogen bromide Acids, inorganic acids such as hydroiodic acid, phosphorus tribromide, pentabromide Examples thereof include phosphorus, phosphorus trichloride, phosphorus pentachloride, iodine, bromine, chlorine, and halogen ether.
- the reaction conditions include a halogen solvent such as methylene chloride and an organic solvent such as an ether solvent such as tetrahydrofuran and a temperature of ⁇ 30 ° C. to 130 ° C. for about 10 minutes to 6 hours.
- a two-layer reaction of an aqueous solution or an organic solvent such as toluene and water can be performed.
- X b sulfo - Reagents used when Ruokishi chloride methanesulfonic - chloride sulfo such as Le - - Le Ya chloride toluenesulfonyl combination of an organic base such as Le and Toriechiruamin or pyridine is used.
- the reaction conditions include a halogen-based solvent such as methylene chloride and an organic solvent such as tetrahydrofuran and an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- a halogen-based solvent such as methylene chloride
- an organic solvent such as tetrahydrofuran
- an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- the fourth step is a reaction in which an intermediate (V-4) having a leaving group Xb is reacted with triphenylphosphine to obtain a phospho-um salt (V-5).
- the reaction conditions include room temperature to reflux for about 30 minutes to 6 hours in an inert solvent such as jetyl ether, benzene, and toluene.
- the target product can be obtained by distilling off the solvent, cooling, adding a hardly soluble solvent such as diisopropyl ether or hexane, and collecting the precipitated solid by filtration. .
- a phospho-um salt (V-5) and a separately synthesized aldehyde ( ⁇ -6) are condensed by a Wittig reaction, and the resulting olefin is reduced to an intermediate ( This is a reaction to obtain V-6).
- the conditions for the Wittig reaction include those used in a normal Wittig reaction. For example, in an ether solvent such as tetrahydrofuran, a base such as potassium t-butoxide is used, and the reaction can be performed at ⁇ 30 ° C. to reflux for 30 minutes to 12 hours. After the reaction, the target substance can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc.
- the reagent used for the subsequent reduction of the double bond is not limited as long as it is a reagent used for the usual olefin reduction.
- a heterogeneous catalyst such as palladium on carbon or a rhodium complex (chlorotris (triphenyl) Catalytic hydrogenation using a homogeneous catalyst such as phosphine) rhodium (I) and the like.
- the reaction conditions are an alcoholic solvent such as ethanol, an ether solvent such as dioxane, or a hydrocarbon solvent such as toluene, under a hydrogen pressure of 1 to 20 atm, under ice cooling to reflux for 30 minutes to 1 week.
- An acid such as acetic acid or a base such as triethylamine can also be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a usual method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the sixth step is to protect the intermediate (V-6) when R e , R d and R have a hydroxyl group.
- the deprotection of intermediate (V-6) is not particularly limited as long as it is used for deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise. .
- R e and R e combine to form a cyclic acetal, which is R d carboxy-carboxyl, it can be simultaneously deprotected with an acid.
- the acid at this time include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol or an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof at ice-cooled to 80 ° C for about 10 minutes to 12 hours.
- an alcoholic solvent such as ethanol or an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof at ice-cooled to 80 ° C for about 10 minutes to 12 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel force chromatography, recrystallization, etc. as necessary.
- R e and R d are protecting groups, X e is an active hydroxyl group, 1 ⁇ is a C 1-4 alkyl or cyano substituted with a halogen atom, and R is as defined above. Is synonymous with)
- R e and R d have the same meanings as described above.
- the first step is a reaction to obtain an intermediate (VI-1) in which an active hydroxyl group is introduced into the phenolic hydroxyl group of the intermediate ( ⁇ -7) in scheme (IV).
- This step can be carried out in the presence of a base in a halogen-based solvent such as methylene chloride or chloroform, or an ether-based solvent such as tetrahydrofuran.
- a halogen-based solvent such as methylene chloride or chloroform
- an ether-based solvent such as tetrahydrofuran.
- activated sulfonic acid derivatives such as trifluoromethanesulfonic acid anhydride, 1 (trifluoromethanesulfol) imidazole, and toluene chloride are used.
- This reaction can also be carried out by using a sulfonic acid and a condensing agent in combination.
- a sulfonic acid and a condensing agent in combination.
- an organic base such as triethylamine, pyridine, or lutidine can be used.
- the reaction conditions include about 50 to 50 ° C. and about 5 minutes to 3 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction for obtaining intermediate (VI-2) by condensation of intermediate (VI-1) and heptylthiol.
- This step can be performed in an ether solvent such as dioxane or a hydrocarbon solvent such as toluene in the presence of a palladium catalyst.
- the palladium catalyst include palladium acetate ( ⁇ ) and tris (dibenzylideneacetone) dipalladium (0).
- a phosphine compound or a base can be added as a reaction aid.
- phosphine compounds include triphenylphosphine, 4,5-bis (diphenylphosphino) -1,9-dimethylxanthene, and the like.
- examples of the base include inorganic bases such as cesium carbonate and organic bases such as N, N diisopropylethylamine.
- examples of the reaction conditions include room temperature to reflux and 30 minutes to 24 hours. After the reaction, the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- the third step protects the intermediate (VI-2) when R e , R d and R have a hydroxyl group
- the deprotection of intermediate (VI 2) is not particularly limited as long as it is used for deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e is a protective group which can be deprotected by an acid such as methoxymethyl R d force 3 ⁇ 4 Petit Ruo propoxycarbonyl - if it is Le, Ru can simultaneously deprotected by acid.
- Examples of the acid at this time include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol and an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof at ice-cooled to 80 ° C. for 10 minutes to 12 hours. After the reaction, extraction, washing, drying, solvent removal, etc. are carried out by ordinary methods, and the desired product can be obtained by purification by silica gel column chromatography, recrystallization, etc. as necessary. .
- R d represents a protecting group
- R represents a C 1-4 alkyl or cyano substituted with a halogen atom
- R is as defined above.
- R d in the formula has the same meaning as described above.
- the protecting group represented by in the formula is not particularly limited as long as it protects the phosphate group.
- alkyl preferably having about 1 to 6 carbon atoms, specifically t-butyl, etc.
- benzyl phenol and the like can be mentioned.
- the first step is to synthesize the protected amino group (VII-2) by protecting the amino group of the compound of the present invention where R is a hydrogen atom (VII-1).
- This step can be performed using a normal amino group protection reaction.
- this step can be carried out in an alcohol such as methanol, or in a two-layer system or a mixture of water and an organic solvent such as ethyl acetate or black mouth form.
- Examples of the reagent to be used include acid chlorides such as sodium acetyl chloride and benzyloxychloride chloride, and acid anhydrides such as anhydrous acetic acid di-butyl dicarbonate.
- an organic base such as triethylamine or an inorganic base such as sodium bicarbonate can be added as a reaction accelerator.
- the reaction conditions are from about 30 minutes to 24 hours at 50 ° C under ice cooling.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the protected amino group (VII-2) is reacted with a phosphoric acid reagent (for example, phosphoric chloride, phosphoramidide and an oxidizing agent, tetrabenzoyl pyrophosphate, etc.) to phosphorylate.
- a phosphoric acid reagent for example, phosphoric chloride, phosphoramidide and an oxidizing agent, tetrabenzoyl pyrophosphate, etc.
- the body (VII-3) is synthesized.
- this step is performed under non-aqueous conditions, preferably in an organic solvent such as toluene, dichloromethane, or a mixed solvent thereof (for example, silver oxide, Tetra-n-hexylammonium iodide, etc.).
- the reaction conditions may include about 5 to 24 hours at 50 ° C under ice cooling.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- this reaction can also be synthesized by reacting ordinary phosphorylating reagents (phosphoric chloride and base, phosphoramidite and oxidizing agent, etc.) according to known methods.
- the third step is to prepare the compound (1-5) of the present invention with the phosphate (VII-3) strength.
- This step can be performed using a normal deprotection reaction. Specifically, hydrogenolysis, acid such as hydrochloric acid or trifluoroacetic acid, and Lewis acid such as trimethylsilyl bromide can be used.
- hydrogenolysis is used in this reaction, this step is exemplified in a hydrogen atmosphere using a catalyst such as palladium carbon in an alcoholic solvent such as methanol.
- the reaction conditions include room temperature to 60 ° C. and about 1 to 24 hours.
- the reaction solution is filtered, concentrated, etc. by a usual method, and the desired product can be obtained by purifying it by silica gel column chromatography, recrystallization, etc. as necessary.
- the reaction conditions when an acid is used in this reaction include an alcoholic solvent such as ethanol or water with them. In the mixed solvent, from room temperature to 100 ° C., about 30 minutes to 12 hours can be mentioned.
- R in the general formula (I) is a hydrogen atom
- X is an oxygen atom
- Y is CH C
- R substituted with a halogen atom, alkyl having 1 to 4 carbon atoms or sheared R and R
- R a is a hydrogen atom or protecting group
- R b and RR d are protecting groups
- XX b is a leaving group
- R is a carbon atom having 1 to 4 carbon atoms substituted with a halogen atom.
- R represents alkyl or cyan
- R a in the formula is not a particularly limited as long as it protects a hydrogen atom or a carboxyl group. Examples thereof include the same substituents as alkyl (specifically, methyl, ethyl, etc.), aralkyl (benzyl, etc.) and Rb .
- R b in the formula is not particularly limited as long as it protects the phenolic hydroxyl group. For example, alkyl (specifically, methyl, ethyl, etc.), aralkyl (benzyl, etc.) and the like can be mentioned.
- R b as Compound (I- la) is a partial structure of - (CH) when CH (where. N has the same meaning as described above) was used, the child deprotected R b
- R e in the formula is not particularly limited as long as it protects a hydroxyl group.
- R e specifically having about 2 to 4 carbon atoms, specifically acetyl, etc.
- a trialkylsilyl specifically trimethylsilyl, etc.
- a benzyl or acetal compound specifically, Methoxymethyl, tetrahydrobiranyl, etc.
- R d in the formula is not particularly limited as long as it protects the amino group.
- acyl preferably having about 2 to 4 carbon atoms, specifically acetyl, etc.
- force rubamate specifically, t-butyloxycarbo-benzyloxycarbonyl, etc.
- the leaving group represented by X a is not particularly limited as long as it departs during a substitution reaction by alkoxide ion (R b -0 ").
- c androgenic atom specifically a fluorine atom
- the leaving group represented by and toluene sulfonyl O carboxymethyl like X b is the intermediate (VIII - 4) and bird whistle -. leaves upon condensation with Ruhosufuin, as it does not inhibit the reaction in the next Wittig reaction
- a halogen atom specifically, an iodine atom, a bromine atom, a chlorine atom, etc.
- methanesulfoloxy, toluenesulfoloxy and the like can be mentioned.
- the first step is an oxygen functional group having the protecting group R b at the 4-position by condensation of 4-position leaving group X a Notsu was benzoic acid derivative (pi-1) and alcohol (VIII -1)
- This reaction introduces intermediate (VIII 2).
- This step can be performed in the presence of a base in a polar solvent such as N, N dimethylformamide or dimethyl sulfoxide, or an ether solvent such as tetrahydrofuran.
- a base an inorganic base such as sodium hydride or potassium hydroxide or an organic base such as 1,8 diazabicyclo [5.4.0] unde force-7 can be used.
- Examples of the reaction conditions are 10 minutes to 10 hours at about 100 ° C under ice-cooling. After the reaction, extraction, washing, drying, solvent removal, etc. are carried out by ordinary methods, and the desired product can be obtained by purification by distillation, silica gel column chromatography, recrystallization, etc. as necessary. .
- the second step is a reaction in which the carboxyl group of intermediate (VIII-2) is reduced to obtain intermediate (VIII-3) having a hydroxyl group.
- Reagents used for the reduction are not particularly limited as long as they are usually used, but alkali metals such as sodium and alkaline earth metals, metal hydrides such as diisobutylaluminum hydride, lithium aluminum hydride and hydrogenated metals. Examples thereof include metal hydrogen complex compounds such as sodium boron, boron compounds such as diborane, and catalytic hydrogenation using homogeneous or heterogeneous catalysts.
- an appropriate temperature and time are selected for the reducing reagent to be used.
- Specific examples include diborane and water in an ether solvent such as tetrahydrofuran at 30 ° C to reflux for about 10 minutes to 12 hours. Reduced with lithium aluminum bromide or lithium borohydride, mixed with alcohol solvent such as ethanol or mixed solvent of alcohol solvent and ether solvent such as tetrahydrofuran for 30 minutes to 24 hours under ice-cooling to reflux. Reduction with sodium borohydride or calcium borohydride. After the reaction, the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a conventional method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary. it can.
- the third step is a reaction for converting the hydroxyl group of intermediate (VIII-3) into the leaving group Xb .
- the reagent is not particularly limited as long as it can convert an alcoholic hydroxyl group to xb .
- Reagents used when Xb is a halogen atom include N-chlorosuccinimide, N-bromosuccinimide, tetrasalt-carbon and combinations of these with reaction aids such as triphenylphosphine and base, hydrochloric acid, hydrobromic acid Inorganic acids such as hydroiodic acid, phosphorus tribromide, phosphorus pentabromide, phosphorus trichloride, phosphorus pentachloride, iodine, bromine, chlorine, halogenated alcohol and the like.
- the reaction conditions include a halogen solvent such as methylene chloride and an organic solvent such as an ether solvent such as tetrahydrofuran and a temperature of ⁇ 30 ° C. to 130 ° C. for about 10 minutes to 6 hours.
- a two-layer reaction of an aqueous solution or an organic solvent such as toluene and water can be performed.
- X b sulfo - Reagents used when Ruokishi chloride methanesulfonic - chloride sulfo such as Le - - Le Ya chloride toluenesulfonyl combination of an organic base such as Le and Toriechiruamin or pyridine is used.
- the reaction conditions include a halogen-based solvent such as methylene chloride and an organic solvent such as tetrahydrofuran and an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- a halogen-based solvent such as methylene chloride
- an organic solvent such as tetrahydrofuran
- an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- the fourth step is a reaction in which an intermediate (VIII-4) having a leaving group Xb is reacted with triphenylphosphine to obtain a phospho-um salt (VIII-5).
- the reaction conditions include room temperature to reflux for about 30 minutes to 12 hours in an inert solvent such as jetyl ether, benzene, and toluene.
- the desired product can be obtained by distilling off the solvent, cooling, adding a hardly soluble solvent such as diisopropyl ether or hexane as necessary, and collecting the precipitated solid by filtration.
- phospho-um salt (VIII-5) and aldehyde ( ⁇ -6) separately synthesized are condensed by Wittig reaction, and the resulting olefin is reduced, followed by deprotection of protecting group Rb.
- a phenolic intermediate (VIII-6) is obtained.
- conditions for the Wittig reaction include those used in a normal Wittig reaction. For example, in an ether solvent such as tetrahydrofuran, a base such as potassium t-butoxide is used, and 30 ° C to reflux for about 30 minutes to 12 hours. After the reaction, the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc.
- the reagent used for the subsequent reduction of the double bond is not limited as long as it is a reagent used for the usual olefin reduction, but for example, a heterogeneous catalyst such as palladium on carbon or a rhodium complex (chlorotris). And catalytic hydrogenation using a homogeneous catalyst such as (triphenylphosphine) rhodium (I).
- the reaction conditions include alcohol solvents such as ethanol, ether solvents such as dioxane, or hydrocarbon solvents such as toluene, under hydrogen pressure of 1 to 20 atmospheres, under ice cooling to reflux, for 30 minutes to 1 week. Is mentioned.
- An acid such as acetic acid or a base such as triethylamine can be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a conventional method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the condition of deprotection of the protecting group R b performed subsequently is not particularly limited as long as it is used in the deprotection of R b, for example, R b force S tribromide in methylene chloride solvent if methyl
- R b force S tribromide in methylene chloride solvent if methyl
- a method using an acid such as hydrochloric acid or trifluoroacetic acid can be used.
- R b when a protecting group which can be deprotected by catalytic hydrogenation ⁇ Ka ⁇ such R b flatly Njiru substituted base Njiru or base Nji Ruo carboxymethyl, the deprotection of R b is, reduction of the double bond mentioned above Can be done at the same time.
- the invention compound as a R b is a partial structure of (I la) - in the case of using the (CH) CH (. N is as defined above), deprotection of R b
- the reagent used for alkylation of the phenolic hydroxyl group of intermediate (VIII 6) include a combination of an alkylating agent such as heptyl halide and an inorganic base such as potassium carbonate or sodium hydride.
- the reaction conditions include a polar solvent such as N, N dimethylformamide and an ether solvent such as tetrahydrofuran, and ice-cooled to 80 ° C. for 30 minutes to 12 hours.
- a phosphine compound such as triphenylphosphine and an azocarboxylic acid derivative such as diisopropyl ester of azodicarboxylic acid are used to condense heptyl alcohol.
- a reaction can also be used. The reaction conditions at this time include about 10 minutes to 6 hours at 50 ° C. under ice-cooling in an ether solvent such as tetrahydrofuran.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- Subsequent deprotection is not particularly limited as long as it can be used for deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e and R e are combined to form a cyclic acetal and the R d force is butyloxy carbo-yl, it can be simultaneously deprotected with an acid.
- the acid at this time include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol, an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof under ice-cooling at about 80 ° C. for about 10 minutes to 12 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- R in the general formula (I) is a hydrogen atom
- X is an oxygen atom
- Y is CH C
- R substituted with a halogen atom, alkyl having 1 to 4 carbon atoms or sheared R and R
- R b has the same meaning as in Scheme (VIII).
- R f include methyl, ethyl, and benzyl.
- general reaction conditions of Arndt-Eistert reaction are used for the synthesis of compound (VIII-2).
- the reduction of the ester group thus obtained includes the reagents and conditions used in the second step of scheme (VIII).
- the usual Wittig reaction conditions are used for the synthesis from compound (IX-2).
- an inorganic acid such as hydrochloric acid is used in a mixed solvent of water or an organic solvent such as tetrahydrofuran and water.
- Subsequent reductions include metal hydride complexes such as aluminum lithium hydride and sodium borohydride, heterogeneous catalysts such as palladium carbon and Raney nickel, or rhodium complexes (chlorotris (triphenylphosphine).
- metal hydride complexes such as aluminum lithium hydride and sodium borohydride
- heterogeneous catalysts such as palladium carbon and Raney nickel
- rhodium complexes chlorotris (triphenylphosphine).
- R in the general formula (I) is a hydrogen atom
- R is an alkyl having 1 to 4 carbon atoms substituted with a halogen atom
- R is ⁇ -fluoroalkyl
- the compound represented by 2 3 4 hydrogen atom (I lc) is also synthesized by the following scheme.
- m is an integer of 1 to 4
- X is an oxygen atom or sulfur atom
- H and R each represent an alkyl or cyan having 1 to 4 carbon atoms substituted with a halogen atom, and n is as defined above.
- the first step is a compound in which R in general formula (I) is a hydrogen atom and R is ⁇ -hydroxyalkyl.
- the reaction can be carried out using orthoacetate ester as a reagent in a polar solvent such as acetonitrile or N, N-dimethylformamide, a halogen-based solvent such as methylene chloride, or a hydrocarbon solvent such as toluene.
- a polar solvent such as acetonitrile or N, N-dimethylformamide
- a halogen-based solvent such as methylene chloride
- a hydrocarbon solvent such as toluene.
- a base such as N, N-diisopropylethylamine or an acid such as p-toluenesulfonic acid can be prepared.
- the reaction conditions include room temperature to reflux and 30 minutes to 12 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, and the like by usual methods, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- the fluorinated substance (X-2) is synthesized by fluorinating the hydroxyl group of the compound (X-1).
- the fluorine-containing agent include cetylaminosulfur trifluoride (DAST) and 2,2-difunoleoro 1,3-dimethinoreidoimidazolidine (DFI).
- DAST cetylaminosulfur trifluoride
- DFI 2,2-difunoleoro 1,3-dimethinoreidoimidazolidine
- the reaction can be carried out in a halogen solvent such as methylene chloride or a hydrocarbon solvent such as hexane.
- the reaction conditions include -78 ° C to room temperature for 30 minutes to 12 hours.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc.
- This step can also be performed by a method in which a fluoride ion is allowed to act after converting the hydroxyl group of compound (X-1) to the corresponding sulfonate salt.
- a fluoride ion is allowed to act after converting the hydroxyl group of compound (X-1) to the corresponding sulfonate salt.
- a fluoride ion is allowed to act after converting the hydroxyl group of compound (X-1) to the corresponding sulfonate salt.
- a fluoride ion is allowed to act after converting the hydroxyl group of compound (X-1) to the corresponding sulfonate salt.
- TB tetrabutylammonium fluoride
- the reaction is carried out in an ether solvent such as tetrahydrofuran at room temperature to 80 ° C for about 1 to 24 hours.
- a dehydrating agent such as molecular sieves can be added to this reaction.
- the target product can be obtained
- the compound (Ilc) of the present invention is prepared by deprotecting the compound (X-2).
- This step can be performed using a normal deprotection reaction. Specifically, it can be carried out using an acid such as hydrochloric acid or trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol or a mixed solvent thereof with water at room temperature to 100 ° C for about 30 minutes to 12 hours.
- the reaction solution can be filtered, concentrated, etc. by ordinary methods, and the desired product can be obtained by purifying it by silica gel column chromatography, recrystallization, etc., if necessary.
- R is a hydrogen atom
- X is an oxygen atom
- Y is CH 2 CH
- R represents trifluoromethyl or thiolated R e
- R d represents a protecting group
- X a and X e represent a leaving group
- R and n are as defined above.
- R e , R d and X a have the same meaning as described above. It not particularly limited as long as it can desorbed activated by the catalyst during the Kin'atama reaction as the leaving group represented by X e.
- a halogen atom preferably an iodine atom, a bromine atom, etc.
- trifluoromethanesulfuroxy and the like can be mentioned.
- the first step is a reaction to obtain intermediate (XI-3) by condensation of compound (XI-1) having leaving group Xa and alcohol (XI-2).
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- a base an organic base such as sodium hydride or potassium hydroxide or an organic base such as 1,8-diazabicyclo [5.4.0] undecar 7-en can be used.
- Examples of the reaction conditions are about 10 minutes to 10 hours under ice-cooling to about 100 ° C.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction in which intermediate (XI-3) and intermediate (IV-3) are condensed by a fungus head reaction to obtain intermediate (XI-4) containing a triple bond.
- the catalyst used include palladium compounds such as tetrakis (triphenylphosphine) palladium (0), tris (dibenzylideneacetone) dipalladium (0), and dichlorobis (acetonitrile) palladium ( ⁇ ).
- organic bases such as triethylamine, inorganic bases such as ammonia, copper compounds such as copper iodide and copper bromide, 2-dicyclohexylphosphino-2, 4, 4, 6, 6-trii Additives such as phosphine compounds such as propyl biphenyl can also be added.
- the reaction conditions include an ether solvent such as tetrahydrofuran and dioxane, a polar solvent such as acetonitrile and dimethylformamide, or a hydrocarbon solvent such as benzene, and ice cooling to reflux for about 30 minutes to 24 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the third step is a reaction in which intermediate (XI-5) is obtained by reducing the triple bond of intermediate (XI-4).
- the reagent to be used is not limited as long as it is a reagent used for normal reduction of unsaturated carbon bonds.
- heterogeneous catalytic rhodium complexes chlorotris (triphenyl-triphenyl And catalytic hydrogenation using a homogeneous catalyst such as ruphosphine) rhodium (I)).
- Reaction For example, in an alcohol solvent such as ethanol, an ether solvent such as dioxane, or a hydrocarbon solvent such as toluene, under a hydrogen pressure of 1 to 20 atmospheres, under ice cooling to reflux, 30 minutes to 1 week may be required. Can be mentioned.
- An acid such as acetic acid or a base such as triethylamine can be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the fourth step is a reaction for obtaining the compound (I-2a) of the present invention by deprotecting the intermediate (XI-5).
- R e , R d and R have a hydroxyl group, the protecting group R e (R e )
- the deprotection is not particularly limited as long as it is used for the deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e and R e are combined to form a cyclic acetal, and the R d force ⁇ -butyloxycarboro group, the cyclic acetal is deprotected with a catalytic amount of acid, and then the stronger acidity.
- R d can be deprotected by using conditions.
- the conditions used for the deprotection of the acetal at this time include a catalytic amount of hydrochloric acid or toluenesulfonic acid in an alcoholic solvent such as methanol or a mixed solution of an alcoholic solvent and another organic solvent. Examples include 30 minutes to 12 hours at ° C.
- the conditions for the deprotection of R d performed Deprotection of Asetaru, with inorganic acids or Torifuruoro acetic such as more equivalents of hydrochloric acid, ether solvents such as alcoholic solvents Ya tetrahydrofuran such as ethanol, water Or in a mixed solvent thereof at ice-cooled to 80 ° C for about 10 minutes to 12 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- R in formula (I) is a hydrogen atom, X is a sulfur atom, Y is CH 2 CH, R is a halogen atom
- R and R are each a hydrogen atom (I
- R a R e R d X b and X d in the formula are as defined above.
- the leaving group represented by Xd should be eliminated during the substitution reaction with alkylthioion (CH (CH) S_).
- halogen atom specifically, a fluorine atom
- toluene sulfo-loxy and the like can be mentioned.
- alkylthio is introduced into the 4-position by condensation of a benzoic acid derivative (V— 1) with a leaving group X d at the 4-position and a thiol (XII-1) to form an intermediate (XII— This is a reaction to obtain 2).
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- the base may be an inorganic base such as potassium carbonate or sodium hydroxide, or an organic base such as triethylamine or 1,8-diazabicyclo [5.4.0] unde force-7-ene. .
- reaction conditions include -30 to 80 ° C for about 10 minutes to 10 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction in which the carboxyl group of intermediate (XII-2) is reduced to obtain an intermediate (XII-3) having a hydroxyl group.
- Reagents used for the reduction are not particularly limited as long as they are usually used, but alkali metals such as sodium and alkaline earth metals, metal hydrides such as diisobutylaluminum hydride, lithium aluminum hydride, Examples thereof include metal hydrogen complex compounds such as sodium borohydride, boron compounds such as diborane, and catalytic hydrogenation using a homogeneous or heterogeneous catalyst.
- an appropriate temperature and time are selected for the reducing reagent to be used.
- Specific examples include reduction in diborane, lithium aluminum hydride, lithium borohydride, and alcohol such as ethanol in an ether solvent such as tetrahydrofuran at 30 ° C to reflux for about 10 minutes to 12 hours.
- Examples thereof include reduction with sodium borohydride or calcium borohydride, which is carried out in a mixed solvent of a system solvent or an alcohol solvent and an ether solvent such as tetrahydrofuran under ice cooling to reflux for about 30 minutes to 24 hours.
- the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a conventional method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary. it can.
- the third step is a reaction for converting the hydroxyl group of the intermediate ( ⁇ -3) into the leaving group Xb .
- the reagent is not particularly limited as long as it can convert an alcoholic hydroxyl group to xb .
- Reagents used when Xb is a halogen atom include N-chlorosuccinimide, N-bromosuccinimide, tetrasalt-carbon and combinations of these with reaction aids such as triphenylphosphine and base, hydrochloric acid, hydrobromic acid Inorganic acids such as hydroiodic acid, phosphorus tribromide, phosphorus pentabromide, phosphorus trichloride, phosphorus pentachloride, iodine, bromine, chlorine, halogenated alcohol and the like.
- the reaction conditions include a halogen solvent such as methylene chloride and an organic solvent such as an ether solvent such as tetrahydrofuran and a temperature of ⁇ 30 ° C. to 130 ° C. for about 10 minutes to 6 hours.
- a two-layer reaction of an aqueous solution or an organic solvent such as toluene and water can be performed.
- X b sulfo - Reagents used when Ruokishi chloride methanesulfonic - chloride sulfo such as Le - - Le Ya chloride toluenesulfonyl combination of an organic base such as Le and Toriechiruamin or pyridine is used.
- the reaction conditions include a halogen-based solvent such as methylene chloride and an organic solvent such as tetrahydrofuran and an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- a halogen-based solvent such as methylene chloride
- an organic solvent such as tetrahydrofuran
- an organic solvent such as tetrahydrofuran at ⁇ 30 ° C. to 50 ° C. for about 5 minutes to 3 hours.
- the fourth step is an intermediate having a leaving group X b (XII- 4) is reacted with triphenyl phosphine phospho - is a reaction to obtain a ⁇ unsalted (XII-5).
- Reaction conditions include jetyl ether In an inert solvent such as benzene and toluene, room temperature to reflux may be about 30 minutes to 6 hours. After the reaction, if necessary, the target product can be obtained by distilling off the solvent, cooling, adding a hardly soluble solvent such as diisopropyl ether or hexane, and collecting the precipitated solid by filtration.
- the fifth step is the condensation of the phospho-um salt (XII-5) with a separately synthesized aldehyde ( ⁇ -6) by the Wittig reaction, followed by reduction of the obtained olefin body to obtain an intermediate.
- This is a reaction to obtain (XII 6).
- the conditions for the Wittig reaction include those used in a normal Wittig reaction. For example, in an ether-based solvent such as tetrahydrofuran, a base such as potassium t-butoxide is used, and the temperature is from -30 ° C to reflux for about 30 minutes to 12 hours. After the reaction, stop the reaction, extract, wash, dry, remove the solvent, etc.
- the reagent used for the subsequent reduction of the double bond is not limited as long as it is a reagent used for the usual olefin reduction.
- a heterogeneous catalyst such as palladium carbon or Raney nickel or a rhodium complex (chlorotris ( Trihydrogen-phosphine) rhodium (I) and the like, and catalytic hydrogenation using a homogeneous catalyst.
- the reaction conditions include an alcoholic solvent such as ethanol, an ether solvent such as dioxane, or a hydrocarbon solvent such as toluene, under a hydrogen pressure of 1 to 20 atm, under ice cooling to reflux for 30 minutes to 1 week. Can be mentioned.
- An acid such as acetic acid or a base such as triethylamine can also be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a usual method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the sixth step protects the intermediate (XII-6) when R e , R d and R have a hydroxyl group.
- the deprotection of intermediate (XII-6) is not particularly limited as long as it is used for deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e and R e are combined to form a cyclic acetal and the R d force is ⁇ -butoxycarboxyl, it can be simultaneously deprotected by an acid.
- the acid at this time examples thereof include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol, an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof at ice-cooled to 80 ° C. for 10 minutes to 12 hours.
- an alcoholic solvent such as ethanol
- an ether solvent such as tetrahydrofuran
- water or a mixed solvent thereof at ice-cooled to 80 ° C. for 10 minutes to 12 hours.
- R in general formula (I) is a hydrogen atom, X is a sulfur atom, R is substituted with a halogen atom.
- R is an alkyl having 1 to 4 carbon atoms substituted with a halogen atom or a sheared R e
- R d is a protecting group
- X e is a hydroxyl-activating group
- R and n are as described above
- R e and R d have the same meanings as described above.
- the activation group for a hydroxyl group represented by X e, triflumizole Ruo Russia methanesulfonyl - Le Ya toluenesulfonyl - sulfo such as Le - Le can be mentioned.
- the first step is a reaction for obtaining an intermediate (XIII-1) in which an active hydroxyl group is introduced into the phenolic hydroxyl group of the intermediate (VIII-6) in scheme (VIII).
- This step can be carried out in the presence of a base in a halogen-based solvent such as methylene chloride or chloroform and an ether-based solvent such as tetrahydrofuran.
- Reagents used in this reaction include trifluoromethanesulfonic anhydride, 1 (trifluoromethanesulfol) imidazole, toluene chloride and V, and activated sulfonic acid derivatives.
- This reaction can also be performed by using a sulfonic acid and a condensing agent in combination.
- a sulfonic acid and a condensing agent in combination.
- organic bases such as triethylamine pyridine and lutidine can be used.
- reaction conditions 50 ⁇ An example is about 5 minutes to 3 hours at about 50 ° C.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction for obtaining intermediate ( ⁇ -2) by condensation of intermediate ( ⁇ -1) and thiol (XII-1).
- This step can be performed in the presence of a palladium catalyst in an ether solvent such as dioxane or a hydrocarbon solvent such as toluene.
- a palladium catalyst include palladium acetate ( ⁇ ) and tris (dibenzylideneacetone) dipalladium (0).
- phosphinic compounds and bases can be added to the reaction as reaction aids.
- the phosphine compound include triphenylphosphine and 4,5-bis (diphenylphosphino) 9,9-dimethylxanthene.
- examples of the base include inorganic bases such as cesium carbonate and organic bases such as N, N diisopropylethylamine.
- examples of the reaction conditions include room temperature to reflux and 30 minutes to 24 hours. After the reaction, the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the third step protects the intermediate (XIII-2) when R e , R d and R have a hydroxyl group
- the protecting group R e (R e is as defined above) is deprotected to give the compound (I-4a) of the present invention.
- the deprotection of intermediate (XIII 2) is not particularly limited as long as it is used for deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e is deprotected possible coercive Mamorumoto by acids such as methoxymethyl R d force 3 ⁇ 4- Petit Ruo propoxycarbonyl - if it is Le, cut with simultaneous deprotection by acid.
- the acid at this time include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol, an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof, for about 10 minutes to 12 hours at ⁇ 80 ° C. under ice cooling.
- an alcoholic solvent such as ethanol
- an ether solvent such as tetrahydrofuran
- water or a mixed solvent thereof
- extraction, washing, drying, solvent removal, etc. are carried out by ordinary methods, and the desired product can be obtained by purification by silica gel column chromatography, recrystallization, etc. as necessary. .
- R in the general formula (I) is a hydrogen atom
- Y is CH 2 CH 3
- R is an alkyl having 1 to 4 carbon atoms substituted with a halogen atom
- X is an oxygen atom or sulfur atom
- X f is a leaving group
- R is Hydroxymeth
- N is as defined above.
- the leaving group represented by X f, alkoxide or Chiorua - not particularly limited as long as it desorbs when on by substitution reaction.
- a halogen atom specifically, a fluorine atom
- toluenesulfonyloxy and the like can be mentioned.
- R 8 is not particularly limited as long as it protects a phenol group or a thiol group.
- R g include alkyl (such as methyl), aralkyl (such as benzyl), and a protecting group that forms acetal (such as methoxymethyl ethoxyethyl) when X is an oxygen atom.
- alkyl such as methyl
- aralkyl such as 4-methoxybenzil
- a protective group that forms thioacetal such as methoxymethyl-phenylthiomethyl, acetamidomethyl
- the first step is a reaction in which an intermediate (XIV-3) is obtained from the condensation of acetofenone (XIV-1) with a leaving group Xf at the 4-position and alcohol or thiol (XIV-2). is there.
- This step can be carried out in the presence of a base in a polar solvent such as N, N dimethylformamide or dimethyl sulfoxide, or in an ether solvent such as tetrahydrofuran.
- a base an inorganic base such as sodium hydride or potassium hydroxide, or an organic base such as 1,8 diazabicyclo [5.4.0] undecar 7-en can be used.
- Examples of the reaction conditions are about 10 minutes to 10 hours under ice-cooling to about 100 ° C.
- the target product can be obtained by drying, removing the solvent, etc., and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction in which the acetyl group of intermediate (XIV-3) is brominated to obtain a naphthyl bromide (XIV-4).
- This step can be performed in a halogen type solvent such as black mouth form, an ether type solvent such as dioxane, an alcohol type solvent such as methanol, or a solvent such as acetic acid.
- the bromination reagent include bromine, pyridinium mutobide amide, and phenyltrimethyl methane mutobromide.
- the reaction conditions are about 30 minutes to 10 hours at about 60 ° C. under ice cooling.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the third step is a reaction in which intermediate (XIV-5) is condensed with jetyl acetamide malonate to obtain intermediate (XIV-5).
- This step can be carried out in the presence of a base in a polar solvent such as N, N dimethylformamide or dimethylsulfoxide, or an ether solvent such as tetrahydrofuran.
- a base an inorganic base such as sodium hydride, potassium hydroxide, potassium t-butoxy and the like can be used.
- Examples of the reaction conditions are about 10 minutes to 5 hours at about 50 ° C. under ice cooling.
- the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary. .
- the fourth step is a reaction in which the carbo group of intermediate (XIV-5) is reduced to methylene to obtain intermediate (XIV-6).
- the reducing agent a combination of trialkylsilane and trifluoroacetic acid or a combination of trialkylsilane and tetrasalt-titanium can be used, and the reaction is performed in a halogen-based solvent such as 1,2-dichloroethane or without solvent. be able to. Examples of the reaction conditions are 1 to 48 hours under ice-cooling to reflux.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- X is an oxygen atom or a sulfur atom
- R is halo
- Alkyl having 1 to 4 carbon atoms, R and R are either one or both alkyl having 1 to 4 carbon atoms , Y is CH CH or C
- the compound (1-6a) of the present invention is synthesized by alkylating the amino group of the compound (XV-1) having a primary amino group among the compounds of the present invention.
- a reductive amination reaction can be carried out using an alkylation reaction of amines using a non-alkylene alkyl and a base. R or R carbon number when reductive amination is used
- Aldehyde and compound (XV-1) having the same number of carbon atoms as in 4 are mixed with an alcoholic solvent such as methanol or a halogenated solvent such as dichloroethane, sodium borohydride, sodium cyanoborohydride, hydrogenated trihydride.
- the target product can be obtained by reacting with a reducing agent such as sodium cetoxyborohydride.
- the reduction can also be carried out using hydrogen and a catalyst such as Raney nickel or platinum oxide.
- This reaction can also be performed sequentially with the generation of a Schiff base and the reduction reaction.
- an acid such as acetic acid can be added as a reaction accelerator. Examples of the reaction conditions are about 30 minutes to 10 hours at about 50 ° C.
- R in the general formula (I) is a hydrogen atom
- R a C1-C4 alkyl substituted with a hydrogen atom
- R is a hydrogen atom
- the represented compound (I 7a) is synthesized by the following scheme (XVI).
- X is an oxygen atom or sulfur atom
- 1 ⁇ is an alkyl having 1 to 4 carbon atoms substituted with a halogen atom, or R is optionally substituted with a hydroxyl group or a halogen atom.
- R e and R d are protecting groups, is a protecting group or — (CH 2) CH, X a and X b are leaving groups, and X s contains phosphorus Indicates a leaving group, and n is the same as described above.
- R e in the formula is not particularly limited as long as it protects a hydroxyl group.
- substituents that form asil preferably having about 2 to 4 carbon atoms, specifically acetyl), trialkylsilyl (specifically trimethylsilyl, etc.), benzyl or acetal compounds (specifically Methoxymethyl, tetrahydrobiral, etc.).
- R has a hydroxyl group
- protection as is R e and specific examples thereof include those similar to R e
- R d protection group represented by R d in the formula is not particularly limited as long as it protects the amino group.
- acyl preferably having about 2 to 4 carbon atoms, specifically acetyl
- force rubamate specifically, tert-oxycarboxyl, benzyloxycarbol, etc.
- a protecting group is not particularly limited as long as it protects a phenol group or a thiol group.
- alkyl such as methyl
- examples include kills (such as 4-methoxybenzyl) and protecting groups that form acetals (such as methoxymethyl ethoxytetyl).
- examples include alkyl (such as methyl), aralkyl (such as 4-methoxybenzyl), and protecting groups that form thioacetal (such as methoxymethyl N-phenylthiomethyl and acetamidomethyl).
- the leaving group represented by X a is not particularly limited as long as it is eliminated during the substitution reaction with alkoxide ion (R g — 0_) or thiolate (— S_).
- a halogen atom specifically a fluorine atom, etc.
- toluenesulfonyloxy and the like can be mentioned.
- the leaving group represented by X b is particularly selected as long as it is eliminated during the reaction between the intermediate (XVI-5) and the phosphorus compound and does not inhibit the reaction during the subsequent reaction with the aldehyde ( ⁇ -6). It is not limited.
- halogen atoms specifically, iodine atom, bromine atom, chlorine atom, etc.
- methanesulfonyloxy, toluenesulfonyloxy and the like can be mentioned.
- Examples of the leaving group containing phosphorus represented by X g include P (CH) and P (O) (OR h ) (R h is carbon number 1
- the first step is a reaction to obtain an intermediate (XVI-3) by condensing benzoic acid (XVI-1) and alcohol or thiol (XVI-2) with a leaving group Xa at the 4-position. is there.
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- bases include inorganic bases such as sodium hydride, potassium hydroxide and potassium carbonate, alkoxides such as potassium t-butoxide, and organic bases such as 1,8-diazabicyclo [5.4.0] undecar 7-en. Can be used.
- reaction conditions are about 30 minutes to 24 hours at about 80 ° C. under ice cooling.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the second step is a reaction in which the carboxyl group of intermediate (XVI-3) is reduced to obtain an intermediate (XVI-4) having a hydroxyl group.
- Reagents used for the reduction are not particularly limited as long as they are usually used, but alkali metals such as sodium and alkaline earth metals, metal hydrides such as diisobutylaluminum hydride, lithium aluminum hydride and hydrogenated metals.
- Metal hydrogen complex compounds such as sodium bis (2-methoxyethoxy) aluminum, boron compounds such as diborane, catalytic hydrogenation using homogeneous or heterogeneous catalysts, etc. Can be mentioned.
- a temperature and time appropriate for the reducing reagent to be used are selected.
- diborane which is carried out at a temperature of from 30 ° C to reflux for about 10 minutes to 12 hours in an ether solvent such as tetrahydrofuran, reduction with lithium aluminum hydride, in an inert solvent such as toluene under ice-cooling to Examples thereof include reduction with sodium bis (2-methoxyethoxy) aluminum hydride performed at 50 ° C. for about 30 minutes to 24 hours.
- ether solvent such as tetrahydrofuran
- lithium aluminum hydride in an inert solvent such as toluene under ice-cooling
- Examples thereof include reduction with sodium bis (2-methoxyethoxy) aluminum hydride performed at 50 ° C. for about 30 minutes to 24 hours.
- After the reaction stop the reaction, extract, wash, dry, remove the solvent, etc. by the usual method, and obtain the desired product by purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary. This comes out.
- the third step is a reaction in which the hydroxyl group of intermediate (XVI-4) is converted to leaving group Xb .
- the reagent is not particularly limited as long as it can convert an alcoholic hydroxyl group to Xb .
- Reagents used when Xb is a halogen atom include N-chlorosuccinimide, N-bromosuccinimide, tetrasalt-carbon and combinations of these with reaction aids such as triphenylphosphine and base, hydrochloric acid, hydrobromic acid Inorganic acids such as hydroiodic acid, phosphorus tribromide, phosphorus pentabromide, phosphorus trichloride, phosphorus pentachloride, iodine, bromine, chlorine, thiol halide, (X roenamine, etc.
- Reaction conditions In an organic solvent such as a halogen-based solvent such as methylene chloride or an ether-based solvent such as tetrahydrofuran, about 10 minutes to 6 hours at -30 ° C and 130 ° C. or even reaction in an organic solvent and a two-layer system of water such as toluene perform X b sulfo -.
- Ruokishi chloride methanesulfonate as a reagent to be used when the - Le Ya chloride toluenesulfonyl - chloride scan such Le A combination of ruphorol and triethylamine is used in combination with an organic base such as pyridine, etc.
- the reaction conditions are as follows: a halogenated solvent such as salt and methylene; Examples include 5 minutes to 3 hours at 50 ° C. After the reaction, the reaction is stopped, extracted, washed, dried, solvent removed, etc. by ordinary methods, and distilled, silica gel column chromatography as necessary.
- the target product can be obtained by purification by chromatography, recrystallization and the like.
- the fourth step is an intermediate having a leaving group X b (XVI- 5) and intermediate phosphorous compound is reacted with a phosphorus including leaving group X s (XVI- 6) in the obtained reaction is there. If X s is P (CH),
- Intermediate (XVI-6) is obtained by reacting intermediate (XVI-5) with triphenylphosphine. Can be obtained.
- the reaction conditions include room temperature to reflux for about 30 minutes to 12 hours in an inert solvent such as jetyl ether, benzene, and toluene. After the reaction, if necessary, the target product can be obtained by distilling off the solvent, cooling, adding a hardly soluble solvent such as diisopropyl ether or hexane, and collecting the precipitated solid by filtration.
- X s is P (O) (OR h ) (R h is as defined above)
- intermediate (XVI-6) is intermediate (XVI)
- -It can be obtained by Arbuzov reaction between 5) and triethyl phosphite.
- the reaction conditions include no solvent or in an inert solvent such as xylene for 30 minutes to 12 hours at 100 ° C to 170 ° C.
- the desired product can be obtained by distilling off excess triethyl phosphite.
- the fifth step is a reaction in which an intermediate (XVI-6) containing phosphorus and an aldehyde ( ⁇ -6) synthesized separately are condensed to obtain an olefin (XVI-7). If X s is P (CH), normal Wit
- the conditions for the tig reaction are used.
- a base such as sodium hydride or potassium t-butoxide may be used, and the reaction may be performed at 30 ° C. to reflux for about 30 minutes to 12 hours.
- the Z form can be obtained preferentially by conducting the reaction in an aprotic polar solvent under conditions that do not contain a salt, or the E form can be obtained preferentially by Schlosser's improved method.
- the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary. .
- the usual Horner-Wadsworth-Emmons reaction conditions are used.
- a hydrocarbon solvent such as benzene or an ether solvent such as tetrahydrofuran
- a base such as sodium hydride, potassium tert-butoxide, or lithium hexamethyldisilazane is used, and the reaction is performed at 20 ° C to reflux for about 30 minutes to 12 hours.
- Olefins can preferentially obtain E bodies.
- the target product can be obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary. .
- the conditions used are deprotection of normal protecting groups
- the protecting group is not particularly limited as long as it is used in the above, and all protecting groups can be deprotected at once or stepwise.
- R e is a protecting group for forming an acetal and R d force 3 ⁇ 4-propylcarboxyl
- the acid at this time include inorganic acids such as hydrochloric acid and trifluoroacetic acid.
- the reaction conditions include an alcoholic solvent such as ethanol or an ether solvent such as tetrahydrofuran, water, or a mixed solvent thereof at ice-cooled to 80 ° C for about 10 minutes to 12 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel force chromatography, recrystallization, etc. as necessary.
- R e and R d When represents a protecting group, prior to the deprotection of the protecting groups R e and R d , the deprotection of and the resulting phenol or thiol alkylation can be carried out.
- the conditions used for deprotection are not particularly limited as long as they are used for the usual deprotection of protecting groups.
- R g is 4-methoxybenzyl, 2,3-dichloro-1,5,6-disyano-
- examples of the acid-oxidation reaction with 1,4 benzoquinone (DDQ) and the like include a reaction in which a nickel compound is used as a catalyst.
- examples of the reagent used for the alkyl group of the phenolic hydroxyl group or thiol group of the obtained compound include a combination of an alkylating agent such as alkyl halide and an inorganic base such as potassium carbonate or sodium hydride.
- the reaction conditions include a polar solvent such as N, N dimethylformamide and an ether solvent such as tetrahydrofuran and ice-cooled to 80 ° C. for about 10 minutes to 12 hours.
- a polar solvent such as N, N dimethylformamide
- an ether solvent such as tetrahydrofuran and ice-cooled to 80 ° C. for about 10 minutes to 12 hours.
- Mitsunobu reaction can also be used for alkyl groups of phenolic hydroxyl groups.
- R e and R d are protecting groups, R is a protecting group or one (CH 3) 2 CH, X a and X e are leaving groups g 2 n 3
- N is as defined above.
- R e , R d , X a and X e in the formula are as defined above.
- the first step is a reaction for obtaining an intermediate (XVII-3) by condensing the starting material (XVII-1) with an alcohol or thiol (XVII-2).
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- a base an inorganic base such as sodium hydride, potassium hydroxide or potassium carbonate, an alkoxide such as potassium t-butoxide, or an organic base such as 1,8-diazabicyclo [5.4.0] undecar 7-en is used. Can be done.
- reaction conditions are under ice-cooling to about 80 ° C for about 30 minutes to about 24 hours.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the leaving group X a of the compound (XVII- 1) uses as starting material the ones phenolic hydroxyl group or Chio Lumpur, in which case, the first step, Hue Nord hydroxyl group or thiol Is alkylated.
- the reagent used for this alkylation includes a combination of an alkylating agent such as halogenoalkyl and an inorganic base such as potassium carbonate or sodium hydride.
- an alkylating agent such as halogenoalkyl
- an inorganic base such as potassium carbonate or sodium hydride.
- polar solvents such as N, N-dimethylformamide and ether solvents such as tetrahydrofuran are used at ice-cooling to 80 ° C. Examples include about 10 minutes to 12 hours. Mitsunobu reaction can also be used for the alkyl group of a phenolic hydroxyl group.
- the second step is a reaction in which the formyl group of intermediate (XVII-3) is fluorinated to obtain intermediate (XVII-4) having difluoromethyl.
- This step can be performed in a halogen-based solvent such as methylene chloride using a fluorine-containing agent such as cetylaminosulfur trifluoride (DAST) or xenon difluoride.
- a fluorine-containing agent such as cetylaminosulfur trifluoride (DAST) or xenon difluoride.
- this fluorination reaction can be carried out by using an oxidizing agent such as N-odosuccinimide in the presence of a fluoride ion such as tetrabutylammonium fluoride instead of using a single fluorinating agent.
- reaction conditions are about 1 to 24 hours at about 50 ° C under ice-cooling.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- the third step is a reaction in which intermediate (XVII-4) and intermediate (IV-3) are condensed by a bacterial head reaction to obtain an intermediate (XVII-5) containing a triple bond.
- the catalyst to be used include palladium compounds such as tetrakis (triphenylphosphine) palladium (0), tris (dibenzylideneacetone) dipalladium (0), dichlorobis (acetonitrile) palladium ( ⁇ ) and the like.
- organic bases such as triethylamine, inorganic bases such as ammonia, copper compounds such as copper iodide and copper bromide, 2-dicyclohexylphosphino2, 2, 4, 6,
- Additives such as phosphine compounds such as triisopropyl biphenyl
- the reaction conditions include an ether solvent such as tetrahydrofuran and dioxane, a polar solvent such as acetonitrile and dimethylformamide, or a hydrocarbon solvent such as benzene, and from ice-cooled to reflux for about 30 minutes to 24 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the fourth step is a reaction in which intermediate (XVII-6) is obtained by reducing the triple bond of intermediate (XVII-5).
- the reagent used when Y is CH 2 CH 3 is a normal unsaturated carbon bond.
- heterogeneous catalyst rhodium complexes chlorotris (triphenylphosphine) rhodium (I) etc.
- Catalytic hydrogen using homogeneous catalyst There is a soup bowl.
- the reaction conditions are an alcohol solvent such as ethanol, an ether solvent such as dioxane, or a hydrocarbon solvent such as toluene, under a hydrogen pressure of 1 to 20 atm, under ice cooling to reflux for 30 minutes to 1 week. Is mentioned.
- an acid such as acetic acid or a base such as triethylamine can be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- the desired product can be obtained by filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- the fifth step is a reaction for obtaining the compound (I-8a) of the present invention by deprotecting the intermediate (XVII-6).
- R e , R d and R have a hydroxyl group, a protecting group R e (R e )
- the deprotection is not particularly limited as long as it is used for the deprotection of ordinary protecting groups, and all protecting groups can be deprotected at once or stepwise.
- R e and R e combine to form a cyclic acetal, and the R d force ⁇ -butyloxy carbocycle, the cyclic acetal is deprotected with a catalytic amount of acid, and then a stronger acidic condition is applied. By using it, R d can be deprotected.
- the conditions used for the deprotection of the acetal at this time include a catalytic amount of hydrochloric acid or toluenesulfonic acid in an alcoholic solvent such as methanol or a mixed solution of an alcoholic solvent and another organic solvent.
- the temperature may be about 30 minutes to 12 hours at 80 ° C.
- the conditions for deprotection of R d performed Deprotection of Asetaru, such as using an inorganic acid or Torifuruoro acetic acid such as hydrochloric acid in equivalent amount or more, ether solvents such as alcoholic solvents Ya tetrahydrofuran ethanol In water or a mixed solvent thereof, for about 10 minutes to 12 hours at -80 ° C under ice-cooling.
- ether solvents such as alcoholic solvents Ya tetrahydrofuran ethanol In water or a mixed solvent thereof, for about 10 minutes to 12 hours at -80 ° C under ice-cooling.
- extraction, washing, drying, solvent removal, etc. are performed by usual methods, and purification is performed by silica gel column chromatography, recrystallization, etc. as necessary. You can get things.
- R e and R d When represents a protecting group, prior to the deprotection of the protecting groups R e and R d , deprotection of the resulting group or the resulting alkyl group of phenol or thiol can be carried out.
- the conditions used for deprotection are not particularly limited as long as they are used for the usual deprotection of protecting groups.
- R g is 4-methoxybenzyl, 2,3 dichloro-1,5,6 dicyanano
- Examples of the reagent used for the alkyl group of the phenolic hydroxyl group or thiol group of the obtained compound include a combination of an alkylating agent such as halogen alkyl and an inorganic base such as potassium carbonate or sodium hydride. It is done.
- the reaction conditions include a polar solvent such as N, N dimethylformamide and an ether solvent such as tetrahydrofuran under ice-cooling at about 80 ° C. for about 10 minutes to 12 hours. Mitsunobu reaction can also be used for alkylation of phenolic hydroxyl groups.
- Rukiru, R e , R d and are a protecting group, X a and a sesame leaving group, and ⁇ is as defined above.
- R e , R d , X a and X e in the formula are the same as described above.
- the protecting group represented by Ri in the formula is not particularly limited as long as it protects a hydroxyl group.
- trialkyl silyl specifically t-butyldimethylsilyl etc.
- the first step is a reaction for obtaining an intermediate (XVIII-3) by condensing the starting material (XVIII-1) with an alcohol or thiol (XVIII-2).
- This step can be carried out in the presence of a base in a polar solvent such as N, N-dimethylformamide or dimethyl sulfoxide or an ether solvent such as tetrahydrofuran.
- a base an inorganic base such as sodium hydride, potassium hydroxide or potassium carbonate, an alkoxide such as potassium t-butoxide, or an organic base such as 1,8-diazabicyclo [5.4.0] undecar 7-en is used. Can be done.
- reaction conditions are under ice-cooling to about 80 ° C for about 30 minutes to about 24 hours.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- the leaving group X a of the compound (XVIII- 1) is used as a raw material ones phenolic hydroxyl group or Chio Lumpur, in which case, the first step, Hue Nord hydroxyl group or thiol Is alkylated.
- the reagent used for this alkylation includes a combination of an alkylating agent such as halogenoalkyl and an inorganic base such as potassium carbonate or sodium hydride.
- the reaction conditions include a polar solvent such as N, N-dimethylformamide and an ether solvent such as tetrahydrofuran under ice cooling to 80 ° C. for about 10 minutes to 12 hours.
- Mitsunobu reaction can also be used for the alkyl group of a phenolic hydroxyl group.
- the second step is a reaction in which the formyl group of intermediate (XVIII-3) is reduced to hydroxymethyl and then a protective group is introduced.
- Reagents used for reducing formyl groups are usually used! /, But are not particularly limited as long as they are used, but metal hydrides such as diisobutylaluminum hydride, lithium aluminum hydride, sodium borohydride, etc. Metal hydrogen complex compounds, catalytic hydrogenation using homogeneous or heterogeneous catalysts, and the like.
- a temperature and time appropriate for the reducing reagent to be used are selected.
- ether solvent such as tetrahydrofuran—reduction with lithium aluminum hydride or lithium borohydride performed at 30 ° C. to room temperature for about 10 minutes to 3 hours, alcohol solvent such as ethanol or alcohol solvent and tetrahydrofuran, etc.
- Reduction with sodium borohydride or calcium borohydride performed in a mixed solvent of the above ether-based solvent for about 10 minutes to 3 hours under ice-cooling to room temperature.
- stop the reaction extract, wash, dry, remove the solvent, etc. by the usual method, and purify by distillation, silica gel column chromatography, recrystallization, etc. as necessary.
- a usual protecting group introduction reaction is used for the introduction of the protecting group.
- a silylating agent such as t-butyldimethylchlorosilane is used as a reagent, and a base such as imidazole or triethylamine can be used as a reaction accelerator.
- the target product is obtained by stopping the reaction, extracting, washing, drying, removing the solvent, etc. by a conventional method, and purifying by distillation, silica gel column chromatography, recrystallization, etc. as necessary. Can do.
- the third step is a reaction in which intermediate (XVIII-4) and intermediate (IV-3) are condensed by a bacterial head reaction to obtain an intermediate (XVIII-5) containing a triple bond.
- the catalyst to be used include palladium compounds such as tetrakis (triphenylphosphine) palladium (0), tris (dibenzylideneacetone) dipalladium (0), dichlorobis (acetonitrile) palladium ( ⁇ ) and the like.
- organic bases such as triethylamine, inorganic bases such as ammonia, copper compounds such as copper iodide and copper bromide, 2-dicyclohexylphosphino2, 2, 4, 6, 6, —
- Additives such as phosphine compounds such as triisopropyl biphenyl can also be added.
- the reaction conditions include an ether solvent such as tetrahydrofuran and dioxane, a polar solvent such as acetonitrile and dimethylformamide, or a hydrocarbon solvent such as benzene, and from ice cooling to reflux for about 30 minutes to 24 hours.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a conventional method, and purifying by silica gel column chromatography, recrystallization, etc. as necessary.
- the fourth step is a reaction in which the triple bond of intermediate (XVIII-5) is reduced to obtain intermediate (XVIII-6).
- the reagent used when Y is CH 2 CH is a normal unsaturated carbon bond
- reaction conditions are an alcohol solvent such as ethanol, an ether solvent such as dioxane, or a hydrocarbon solvent such as toluene, under a hydrogen pressure of 1 to 20 atm, under ice cooling to reflux for 30 minutes to 1 week. Is mentioned.
- an acid such as acetic acid or a base such as triethylamine can be added to the reaction solution depending on the reaction rate and the stability of the compound.
- the desired product can be obtained by filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- the desired product can be obtained by filtration, extraction, washing, drying, solvent removal, etc. by a conventional method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- the fifth step is to synthesize the fluoride compound (XVIII-7) by deprotecting Ri of the compound (XVIII-6) and fluorinating the hydroxyl group of the resulting compound.
- the deprotection of the protecting group can be performed using a normal deprotection reaction.
- a fluorine compound such as tetraptyl ammonium fluoride can be used.
- Conditions for this reaction include an ice-cooled solution to reflux for about 30 minutes to 24 hours in an ether solvent such as tetrahydrofuran.
- the target product can be obtained by performing extraction, washing, drying, solvent removal, etc.
- the reaction can be carried out in a halogen solvent such as methylene chloride or a hydrocarbon solvent such as hexane.
- a halogen solvent such as methylene chloride or a hydrocarbon solvent such as hexane.
- the reaction conditions include ⁇ 78 ° C. to room temperature for 30 minutes to 12 hours. After the reaction, perform extraction, washing, drying, solvent removal, etc. by the usual method.
- the desired product can be obtained by purification by silica gel column chromatography, recrystallization or the like.
- This step can also be performed by a method in which a fluoride ion is allowed to act after converting a hydroxyl group to a corresponding sulfonate salt.
- a fluoride ion is allowed to act after converting a hydroxyl group to a corresponding sulfonate salt.
- a fluoride ion is allowed to act after converting a hydroxyl group to a corresponding sulfonate salt.
- TBAF tetrabutylammonium fluoride
- the reaction is carried out in an ether solvent such as tetrahydrofuran at room temperature to 80 ° C for about 1 to 24 hours.
- a dehydrating agent such as molecular sieves can be added.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purifying by silica gel column chromatography, recrystallization or the like, if necessary.
- Ri is trialkylsilyl
- fluorination can be performed without deprotecting Ri.
- the sixth step is a reaction for obtaining the compound (I-9a) of the present invention by deprotecting the intermediate (XVIII-7).
- R e has the same meaning as described above
- All protecting groups can be deprotected at once or stepwise. For example, when R e and R e combine to form a cyclic acetal, and the R d force ⁇ -butyloxy carbocycle, the cyclic acetal is deprotected with a catalytic amount of acid, and then a stronger acidic condition is applied. By using it, R d can be deprotected.
- the conditions used for the deprotection of the acetal at this time include a catalytic amount of hydrochloric acid or toluenesulfonic acid in an alcoholic solvent such as methanol or a mixed solution of an alcoholic solvent and another organic solvent.
- the temperature may be about 30 minutes to 12 hours at 80 ° C.
- the conditions for the deprotection of R d performed Deprotection of Asetaru, using an inorganic acid or Torifuruoro acetic acid such as hydrochloric acid in equivalent amount or more, ether solvents such as alcoholic solvents Ya tetrahydrofuran and ethanol, In water or a mixed solvent thereof, for about 10 minutes to 5 hours at ice-cooled to room temperature.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- a target object to be precipitated can be filtered by adding a low-solubility solvent such as diisopropyl ether to the reaction solution.
- the compound (I 10a) represented by the child is synthesized by the following scheme (XIX).
- R d and R j each represents a protecting group, and n is as defined above.
- R d in the formula has the same meaning as described above.
- Compound (XIX-2) contains a hydroxyl group in R
- the hydroxyl group may be protected with a protecting group R e (R e is as defined above).
- R e is as defined above.
- the protecting group R e is R
- the amino group and hydroxyl group can be protected by forming [0153].
- the protecting group represented by R j in the formula is not particularly limited as long as it protects a phosphate group.
- alkyl preferably having about 1 to 6 carbon atoms, specifically t-butyl etc.
- benzyl fuller and the like can be mentioned.
- the first step is to synthesize the protected amino group (XIX-2) by protecting the amino group of the compound of the present invention wherein R is a hydrogen atom (XIX-1). .
- This step can be performed using a normal amino group protecting reaction.
- R d as a protecting group
- this process is a two-layer system or a mixture of alcohol and water or an organic solvent such as ethyl acetate or chloroform. Can be done in.
- the reagent to be used examples include acid chlorides such as sodium acetyl chloride and benzyloxycarbonyl chloride, and acid anhydrides such as anhydrous acetic acid di-butyl dicarbonate.
- an organic base such as triethylamine or an inorganic base such as sodium bicarbonate can be added as a reaction accelerator.
- the reaction conditions may include about 30 minutes to 24 hours at 50 ° C under ice-cooling.
- the desired product can be obtained by performing extraction, washing, drying, solvent removal, etc. by a usual method, and purification by silica gel column chromatography, recrystallization, etc. as necessary.
- an oxazoline represented by the general formula (XIX 2 ′) an amino group and a hydroxyl group contained in R are simultaneously protected.
- the reaction can be carried out using ortho-acetate as a reagent in a polar solvent such as acetonitrile or N, N dimethylformamide, a halogen-based solvent such as sodium chloride or a hydrocarbon solvent such as toluene. .
- a base such as N, N diisopropylethylamine or an acid such as p-toluenesulfonic acid can be added.
- the reaction conditions include room temperature to reflux and 30 minutes to 12 hours. After the reaction, extraction, washing, drying, solvent removal, etc. are carried out by ordinary methods, and purification is carried out by silica gel column chromatography, recrystallization, etc. as necessary to obtain the desired product.
- the second step is to react the amino group protector (XIX-2) with a phosphoric acid reagent (for example, phosphoric chloride, phosphoramidide and oxidizing agent, tetrabenzyl ester pyrophosphate, etc.) XIX-3) is synthesized.
- a phosphoric acid reagent for example, phosphoric chloride, phosphoramidide and oxidizing agent, tetrabenzyl ester pyrophosphate, etc.
- XIX-3 is synthesized.
- a phosphoric acid reagent for example, phosphoric chloride, phosphoramidide and oxidizing agent, tetrabenzyl ester pyrophosphate, etc.
- XIX-3 phosphoric acid reagent
- this step is performed under non-aqueous conditions, preferably in an organic solvent such as toluene, dichloromethane, or a mixed solvent thereof (for example, silver oxide, iodine).
- the desired product can be obtained by performing filtration, extraction, washing, drying, solvent removal, etc. by a conventional method and, if necessary, purification by silica gel column chromatography, recrystallization or the like.
- conventional phosphoric acid reagent phosphoric chloride and base, phosphoramidite and oxidizing agent, etc.
- a phosphoryl such as diptyldiisopropyl phosphoramidite in a halogen solvent such as dichloromethane, an ether solvent such as tetrahydrofuran, a polar solvent such as acetonitrile, or a mixed solvent thereof.
- a reaction accelerator such as 1H-tetrazole can be added to this reaction.
- Phosphorus oxidation following this phosphoric acid can be carried out using organic peroxy acids such as m-peroxybenzoic acid and t-butyl hydroperoxide and inorganic peracids such as hydrogen peroxide. Can be used.
- the reaction is carried out under ice-cooling at 50 ° C for about 3 minutes to 1 hour.
- the target product can be obtained by extraction, washing, drying, solvent removal, etc. by a conventional method, and purification by silica gel column chromatography, recrystallization, etc., if necessary.
- the third step is to prepare the compound (I 10a) of the present invention from the phosphorylated form (XIX-3).
- This step can be performed using a normal deprotection reaction. Specifically, hydrogenation decomposition, an acid such as hydrochloric acid or trifluoroacetic acid, or a Lewis acid such as trimethylsilyl bromide can be used.
- hydrogenolysis is used for this reaction, this step is exemplified in an alcoholic solvent such as methanol and using a catalyst such as palladium carbon in a hydrogen atmosphere.
- the reaction conditions include room temperature to 60 ° C. and about 1 to 24 hours.
- the reaction solution is filtered, concentrated, etc.
- the compound of the present invention can be converted into an acid addition salt by treating with an acid in an appropriate solvent (water, alcohol, ether, etc.) as necessary. Further, the obtained compound of the present invention can be made into a hydrate or a solvate by treating with water, a water-containing solvent or other solvent (for example, alcohol).
- the compound of the present invention treats or prevents autoimmune diseases (for example, rheumatoid arthritis, multiple sclerosis, encephalomyelitis, systemic lupus erythematosus, lupus nephritis, nephrotic syndrome, psoriasis, type I diabetes, etc.); Transplantation of mammalian organs or tissues (e.g., heart, kidney, liver, lung, bone marrow, cornea, spleen, small intestine, extremity, muscle, Resistance to nerves, fat pulp, duodenum, skin, splenocyte, etc., including xenotransplantation) or prevention or suppression of acute rejection or chronic rejection; graft versus host by bone marrow transplantation (GvH) Disease: Useful for the treatment or prevention of allergic diseases (eg, atopic dermatitis, allergic rhinitis, asthma, etc.).
- autoimmune diseases for example, rheumatoid arthritis, multiple
- prevention means that a disease, disorder or symptom develops! /, And the compound of the present invention or a pharmaceutical composition containing the same is administered to an individual. Means an act.
- Treatment means an act of administering the compound of the present invention or a pharmaceutical composition containing the same to an individual who has already developed a disease, disorder or symptom. Therefore, the act of administering to an individual who has already developed a disease, disease or symptom in order to prevent worsening of the symptom, seizure, or recurrence is an aspect of “treatment”.
- the compound of the present invention is used as a pharmaceutical
- the compound of the present invention is pharmaceutically acceptable carriers (such as excipients, binders, disintegrants, corrigents, flavoring agents, emulsifiers, diluents, solubilizers). It can be administered orally or parenterally in the form of a pharmaceutical composition or formulation (oral, injection, etc.) obtained by mixing.
- the pharmaceutical composition can be formulated according to a usual method.
- parenteral means subcutaneous injection, intravenous injection, intramuscular injection, intraperitoneal injection, infusion method or local administration (transdermal administration, ophthalmic administration, transpulmonary / bronchial administration, Nasal administration or rectal administration).
- the content of the compound of the present invention that can be combined with the carrier can be varied depending on the individual to be treated and the specific dosage form.
- the specific dose for a specific patient is the age, body It depends on various factors, including severity, general health, sex, diet, time of administration, method of administration, excretion rate and the extent of the specific disease being treated.
- the dose of the compound of the present invention depends on age, body weight, general health condition, sex, meal, administration time, administration method, excretion rate, and the degree of the medical condition being treated at that time of the patient. Or other factors.
- the compound of the present invention has no effect on heart rate and can be used safely. Its daily dose varies depending on the patient's condition and weight, the type of compound, the route of administration, etc. Is administered subcutaneously, intravenously, intramuscularly, transcutaneously, ophthalmically, pulmonary, bronchially, nasally or rectally, about 0.01-50 mgZ per day, orally Approximately 0.01-150 mg Z / day Z is administered.
- Tris (hydroxymethyl) aminomethane hydrochloride (2 g) is dissolved in N, N dimethylformamide (50 ml), 2, 2 dimethoxypropane (7.8 ml), p-toluenesulfonic acid monohydrate (229 mg) is added. It was prepared and stirred at room temperature for 15 hours. To the mixed solution were added triethylamine (9.5 ml), methanol (20 ml) and di-tert-butyl dicarbonate (4.17 g), and the mixture was stirred at room temperature for 12 hours.
- Reference Example Compound 2-5 (70.3 g) was dissolved in tetrahydrofuran (500 ml), t-butoxy potassium (13. Og) was added, and the mixture was stirred for 1 hour.
- a solution of the compound of Reference Example 1 (15. Og) in tetrahydrofuran (100 ml) was added dropwise to the mixed solution under ice cooling, and the mixture was stirred for 2 hours under ice cooling.
- Water was added to the reaction mixture, and the mixture was extracted with ethyl acetate, washed with water and saturated brine, and dried over anhydrous magnesium sulfate. The solvent was evaporated under reduced pressure.
- Acetic anhydride (1.03 ml) was added 8 times every 10 minutes with stirring to a mixture of compound 1-1 (3.00 g), black mouth form (300 ml) and saturated aqueous sodium hydrogen carbonate solution (300 ml). Finally, acetic anhydride was added, and the mixture was stirred for 1.5 hours. The organic layer was separated, washed with saturated brine, dried over anhydrous magnesium sulfate, and the solvent was distilled off under reduced pressure to obtain the desired product (2. 96 g). ) Was obtained as a white solid.
- Compound 3-3 (1.47 g) was fractionated by HPLC using CHIRALPAK (registered trademark) AD-H (hexane Z ethanol Z diisopropylamine) to give both enantiomers as colorless oils.
- the first peak with a short retention time was S form (0.55 g, compound 3-4-1), and the second peak with a long retention time was R form (0.65 g, compound 3-4-2).
- Reference Example Compound 3-1 (836 mg), synthesized by a known method (for example, tetrahedron No. 57 (2001), pages 6531-6538) (2,2 dimethyl-5 ethyl-1,3 dioxane 5 yl) Power rubamic acid t-butyl ester (482mg), 2 dicyclohexylphosphino-1,2,4,6, monotriisopropylbiphenyl (54mg), bis (acetonitrile) palladium ( ⁇ ) dichloride (10mg), cesium carbonate (919 mg) was stirred in a mixed solvent of acetonitrile (15 ml) and tetrahydrofuran (2 ml) at 70 ° C. for 4 hours.
- This oil was dissolved in ethyl acetate (6 ml), 10% palladium carbon (containing about 50% water, 0.080 g) was added, and the mixture was stirred at room temperature for 3 hours and a half in a hydrogen atmosphere. The solution was filtered, and the filtrate was concentrated to obtain the desired product (0.610 g) as a pale yellow powder.
- Gyl ester (459 mg) was added and stirred at room temperature. After 5 minutes, tetra-n-hexyl ammonium iodide (410 mg) was added, and the mixture was further stirred for 17 hours. The insoluble material was removed by filtration, the solvent was evaporated, and the residue was purified by silica gel chromatography and preparative HPLC to obtain the desired product (106 mg) as a colorless oil.
- Triethylsilane (116 ml) was added to a solution of compound 9-3 (31.5 g) in trifluoroacetic acid (230 ml), and the mixture was stirred at 70 ° C. for 13 hours.
- the reaction mixture was concentrated under reduced pressure, water was added, and the mixture was extracted with ethyl acetate.
- the organic layer was washed successively with aqueous sodium hydroxide solution and saturated brine, dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure.
- the obtained residue was purified by silica gel chromatography to give a mixture of the title compound and raw material as a yellow oil.
- Triethylsilane (116 ml) was added to a solution of this oily substance in trifluoroacetic acid (230 ml), and the mixture was stirred at 70 ° C. for 12 hours.
- the reaction mixture was concentrated under reduced pressure, water was added, and the mixture was extracted with ethyl acetate.
- the organic layer was washed successively with aqueous sodium hydroxide solution and saturated brine, dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure. Jetyl ether was added to the obtained residue, and the precipitated solid was collected by filtration and dried to obtain the desired product (7.9 lg) as a white powder.
- the mother liquor was concentrated under reduced pressure and purified by silica gel chromatography to obtain the desired product (4.29 g). The combined yield was 12.2g.
- N, N Diisopropylethylamine (0.340 ml) and trimethyl orthoacetate (0.121 ml) were added to a solution of N 8 N (270 mg) in N, N dimethylformamide (7 ml), and the mixture was heated to 120 ° C. And stirred for 5 and a half hours. Water was added to the reaction mixture, and the mixture was extracted with ethyl acetate, washed with water and saturated brine, dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure to give 280 mg of a brown oil.
- the organic layer was separated, washed with water and saturated brine, dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure to obtain the target compound (13. lg ) Was obtained as a light brown oil.
- Reference Example Compound 2-5 (21.8 g) was suspended in tetrahydrofuran (200 ml), and potassium t-butoxide (4.35 g) was added under ice cooling, followed by stirring for 1 hour. To the mixed solution was added a solution of compound 13-3 (4.80 g) in tetrahydrofuran (40 ml), and the mixture was stirred for 1 hour and a half under ice cooling and for 1 hour at room temperature. The reaction mixture was added to water and extracted with ethyl acetate. The organic layer was washed with saturated brine and dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure.
- the compound 15-2-2 (785 mg) was suspended in ethyl acetate (5 ml), and a 4 M solution of hydrogen chloride in ethyl acetate (2 ml) was added. Hexane (10 ml) was further added and allowed to stand for 1 hour, and the precipitated solid was collected by filtration to obtain the desired product (833 mg) as a white powder.
- Reference Example Compound 2-5 (26.3 g) was suspended in tetrahydrofuran (120 ml), and potassium t-butoxide (5.24 g) was added under ice cooling, followed by stirring for 50 minutes. To the mixed solution was added a solution of compound 19-3 (6.10 g) in tetrahydrofuran (80 ml), and the mixture was stirred for 2 hours under ice cooling and 4 hours at room temperature. The reaction solution was added to brine and extracted with ethyl acetate. The organic layer was washed with saturated brine and dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure.
- Reference Example compound 2-5 (10.9 g) was suspended in tetrahydrofuran (80 ml), ice-cooled low-temperature lithium t-butoxide (2.17 g) was added, and the mixture was stirred for 30 min. To this mixed solution was added a solution of compound 21-4 (3.50 g) in tetrahydrofuran (25 ml), and the mixture was stirred for 20 minutes under ice-cooling and further at room temperature for 5 hours. The reaction solution was added to brine and extracted with ethyl acetate. The organic layer was washed with saturated brine and dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure.
- Triethenoreamine (0.284 ml) and di-tert-butyl dicarbonate (220 mg) were added to a methanol (15 ml) solution of Compound 22-2 (290 mg) and stirred at room temperature for 18 hours. Further, di-t-butyl dicarbonate (220 mg) was added and stirred at room temperature for 5 hours.
- the reaction mixture was concentrated under reduced pressure, water was added, and the mixture was extracted with ethyl acetate. The organic layer was washed with saturated brine and dried over anhydrous magnesium sulfate, and the solvent was distilled off under reduced pressure to obtain 400 mg of a pale yellow oil.
- Acid t-butyl ester (280 mg) was obtained as a colorless oil.
- the [1, 1 bis (hydroxymethyl) 3- (4-octylthio 3-trifluoromethylphenol)] propyl strength rubamic acid t-butyl ester methylene chloride (15 ml) recovered above was added to a solution of N, N-diisopropylethylamine (0.129 ml) and methoxymethyl chloride (0.063 ml) were added, and the mixture was stirred under ice-cooling for 5 minutes and further at room temperature for 14 hours. Water was added to the reaction mixture, and the mixture was extracted with methylene chloride.
- the organic layer was washed with saturated brine and dried over anhydrous magnesium sulfate, and the solvent was evaporated under reduced pressure.
- the obtained residue was purified by silica gel chromatography to give the object product (210 mg) as a colorless oil.
- the total amount of the target product was 500 mg.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Immunology (AREA)
- Pulmonology (AREA)
- Diabetes (AREA)
- Rheumatology (AREA)
- Dermatology (AREA)
- Physical Education & Sports Medicine (AREA)
- Biomedical Technology (AREA)
- Transplantation (AREA)
- Otolaryngology (AREA)
- Pain & Pain Management (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Urology & Nephrology (AREA)
- Emergency Medicine (AREA)
- Endocrinology (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
Description
Claims
Priority Applications (12)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CA002633372A CA2633372A1 (en) | 2005-12-14 | 2006-12-14 | Easily absorbed oral preparations of xanthine derivatives |
JP2007550231A JP4833998B2 (ja) | 2005-12-15 | 2006-12-15 | アミン化合物及びその医薬用途 |
US12/086,419 US8809304B2 (en) | 2005-12-15 | 2006-12-15 | Amine compound and use thereof for medical purposes |
CA2633374A CA2633374C (en) | 2005-12-15 | 2006-12-15 | Amine compound and use thereof for medical purposes |
PL06834759T PL1961734T3 (pl) | 2005-12-15 | 2006-12-15 | Związek aminowy i jego zastosowanie do celów medycznych |
DK06834759.0T DK1961734T3 (da) | 2005-12-15 | 2006-12-15 | Aminforbindelse og anvendelse deraf til medicinske formål |
EP06834759A EP1961734B1 (en) | 2005-12-15 | 2006-12-15 | Amine compound and use thereof for medical purposes |
BRPI0619894A BRPI0619894B8 (pt) | 2005-12-15 | 2006-12-15 | composto de amina e composição farmacêutica |
CN2006800472557A CN101346346B (zh) | 2005-12-15 | 2006-12-15 | 胺化合物及其医药用途 |
AU2006325931A AU2006325931B8 (en) | 2005-12-15 | 2006-12-15 | Amine compound and use thereof for medical purposes |
KR1020087016615A KR101346527B1 (ko) | 2005-12-15 | 2006-12-15 | 아민 화합물 및 그 의약 용도 |
US14/306,902 US20140296183A1 (en) | 2005-12-15 | 2014-06-17 | Amine compound and use thereof for medical purposes |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2005361363 | 2005-12-15 | ||
JP2005-361363 | 2005-12-15 |
Related Child Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US12/086,419 A-371-Of-International US8809304B2 (en) | 2005-12-15 | 2006-12-15 | Amine compound and use thereof for medical purposes |
US14/306,902 Division US20140296183A1 (en) | 2005-12-15 | 2014-06-17 | Amine compound and use thereof for medical purposes |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2007069712A1 true WO2007069712A1 (ja) | 2007-06-21 |
Family
ID=38163014
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/JP2006/325016 WO2007069712A1 (ja) | 2005-12-14 | 2006-12-15 | アミン化合物及びその医薬用途 |
Country Status (16)
Country | Link |
---|---|
US (2) | US8809304B2 (ja) |
EP (1) | EP1961734B1 (ja) |
JP (1) | JP4833998B2 (ja) |
KR (1) | KR101346527B1 (ja) |
CN (1) | CN101346346B (ja) |
AT (1) | ATE524432T1 (ja) |
AU (1) | AU2006325931B8 (ja) |
BR (1) | BRPI0619894B8 (ja) |
CA (1) | CA2633374C (ja) |
DK (1) | DK1961734T3 (ja) |
ES (1) | ES2369520T3 (ja) |
PL (1) | PL1961734T3 (ja) |
PT (1) | PT1961734E (ja) |
RU (1) | RU2433117C2 (ja) |
TW (1) | TWI451865B (ja) |
WO (1) | WO2007069712A1 (ja) |
Cited By (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2008153159A1 (ja) * | 2007-06-14 | 2008-12-18 | Mitsubishi Tanabe Pharma Corporation | アミン化合物及びその医薬用途 |
WO2009119858A1 (ja) * | 2008-03-27 | 2009-10-01 | 田辺三菱製薬株式会社 | ベンゼン化合物及びその医薬用途 |
US8277775B2 (en) | 2007-08-17 | 2012-10-02 | The Research Foundation Of The City University Of New York | Boron dipyrromethene difluoro (BODIPY) conjugates |
WO2013161816A1 (ja) | 2012-04-23 | 2013-10-31 | 田辺三菱製薬株式会社 | アミン化合物及びその医薬用途 |
WO2018021517A1 (ja) | 2016-07-29 | 2018-02-01 | 田辺三菱製薬株式会社 | 4-アルコキシ-3-トリフルオロメチルベンジルアルコールの製造方法 |
WO2021084068A1 (en) | 2019-10-31 | 2021-05-06 | Idorsia Pharmaceuticals Ltd | Combination of a cxcr7 antagonist with an s1p1 receptor modulator |
US11078221B2 (en) | 2017-09-29 | 2021-08-03 | University College Cardiff Consultants Ltd | Phosphorodiamidates and other phosphorus derivatives of fingolimod and related S1P receptor modulators |
WO2021157682A1 (ja) | 2020-02-06 | 2021-08-12 | 田辺三菱製薬株式会社 | 筋痛性脳脊髄炎/慢性疲労症候群治療剤 |
WO2021200975A1 (ja) | 2020-03-31 | 2021-10-07 | 田辺三菱製薬株式会社 | 医薬組成物 |
Families Citing this family (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP1986635A4 (en) * | 2006-02-21 | 2009-04-22 | Univ Ohio State Res Found | ANTI CANCER AGENTS |
ES2414205T3 (es) * | 2006-06-02 | 2013-07-18 | The Ohio State University Research Foundation | Agentes terapéuticos para el tratamiento de linfoma de células del manto |
WO2010097371A1 (en) * | 2009-02-24 | 2010-09-02 | Novartis Ag | Ceramide-analogous metabolites |
US8461362B2 (en) * | 2009-04-13 | 2013-06-11 | The Ohio State University Research Foundation | Protein phosphatase 2A-activating agents |
WO2010121111A1 (en) * | 2009-04-17 | 2010-10-21 | The Ohio State University Research Foundation | Antiadhesion agents |
US8309768B2 (en) | 2010-11-29 | 2012-11-13 | The Ohio State University Research Foundation | FTY720-derived anticancer agents |
CA3207440A1 (en) | 2021-02-08 | 2022-08-11 | Jimin Lee | Amiselimod for preventing, treating, or ameliorating ulcerative colitis |
Citations (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO1994008943A1 (en) * | 1992-10-21 | 1994-04-28 | Yoshitomi Pharmaceutical Industries, Ltd. | 2-amino-1,3-propanediol compound and immunosuppressant |
WO1996006068A1 (fr) * | 1994-08-22 | 1996-02-29 | Yoshitomi Pharmaceutical Industries, Ltd. | Compose benzenique et son utilisation medicale |
WO2004024673A1 (en) * | 2002-09-13 | 2004-03-25 | Novartis Ag | Amino-propanol derivatives |
WO2004110421A1 (en) * | 2003-06-06 | 2004-12-23 | Sanofi-Aventis Deutschland Gmbh | Use of 2-amino-1-3-propanediol derivatives for the manufacture of a medicament for the treatment of various types of pain |
WO2004110979A2 (en) * | 2003-06-12 | 2004-12-23 | Novartis Ag | Amino-propanol derivatives as sphingosine-1-phosphate receptor modulator |
WO2006011554A1 (ja) * | 2004-07-29 | 2006-02-02 | Sankyo Company, Limited | 免疫抑制剤としての医薬組成物 |
Family Cites Families (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5948820A (en) * | 1994-08-22 | 1999-09-07 | Yoshitomi Pharmaceutical Industries, Ltd. | Benzene compound and pharmaceutical use thereof |
GB9624038D0 (en) | 1996-11-19 | 1997-01-08 | Sandoz Ltd | Organic compounds |
GB9707307D0 (en) | 1997-04-10 | 1997-05-28 | Ciba Geigy Ag | Polypeptide markers |
DK1377593T3 (da) * | 2001-03-26 | 2006-04-10 | Novartis Ag | 2-Amino-propanolderivater |
NZ529044A (en) | 2001-06-08 | 2008-03-28 | Novartis Ag | Treatment or prophylaxis of insulin-producing cell graft rejection |
JP4603531B2 (ja) | 2003-04-30 | 2010-12-22 | ノバルティス アーゲー | スフィンゴシン−1−ホスフェートレセプターモジュレーターとしての、アミノプロパノール誘導体 |
-
2006
- 2006-12-15 WO PCT/JP2006/325016 patent/WO2007069712A1/ja active Application Filing
- 2006-12-15 EP EP06834759A patent/EP1961734B1/en active Active
- 2006-12-15 ES ES06834759T patent/ES2369520T3/es active Active
- 2006-12-15 AU AU2006325931A patent/AU2006325931B8/en active Active
- 2006-12-15 BR BRPI0619894A patent/BRPI0619894B8/pt active IP Right Grant
- 2006-12-15 KR KR1020087016615A patent/KR101346527B1/ko active IP Right Grant
- 2006-12-15 PL PL06834759T patent/PL1961734T3/pl unknown
- 2006-12-15 AT AT06834759T patent/ATE524432T1/de active
- 2006-12-15 TW TW095147069A patent/TWI451865B/zh not_active IP Right Cessation
- 2006-12-15 CN CN2006800472557A patent/CN101346346B/zh active Active
- 2006-12-15 CA CA2633374A patent/CA2633374C/en active Active
- 2006-12-15 RU RU2008128875/04A patent/RU2433117C2/ru active
- 2006-12-15 JP JP2007550231A patent/JP4833998B2/ja active Active
- 2006-12-15 DK DK06834759.0T patent/DK1961734T3/da active
- 2006-12-15 US US12/086,419 patent/US8809304B2/en active Active
- 2006-12-15 PT PT06834759T patent/PT1961734E/pt unknown
-
2014
- 2014-06-17 US US14/306,902 patent/US20140296183A1/en not_active Abandoned
Patent Citations (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO1994008943A1 (en) * | 1992-10-21 | 1994-04-28 | Yoshitomi Pharmaceutical Industries, Ltd. | 2-amino-1,3-propanediol compound and immunosuppressant |
WO1996006068A1 (fr) * | 1994-08-22 | 1996-02-29 | Yoshitomi Pharmaceutical Industries, Ltd. | Compose benzenique et son utilisation medicale |
WO2004024673A1 (en) * | 2002-09-13 | 2004-03-25 | Novartis Ag | Amino-propanol derivatives |
WO2004110421A1 (en) * | 2003-06-06 | 2004-12-23 | Sanofi-Aventis Deutschland Gmbh | Use of 2-amino-1-3-propanediol derivatives for the manufacture of a medicament for the treatment of various types of pain |
WO2004110979A2 (en) * | 2003-06-12 | 2004-12-23 | Novartis Ag | Amino-propanol derivatives as sphingosine-1-phosphate receptor modulator |
WO2006011554A1 (ja) * | 2004-07-29 | 2006-02-02 | Sankyo Company, Limited | 免疫抑制剤としての医薬組成物 |
Cited By (14)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2008153159A1 (ja) * | 2007-06-14 | 2008-12-18 | Mitsubishi Tanabe Pharma Corporation | アミン化合物及びその医薬用途 |
US8129361B2 (en) | 2007-06-14 | 2012-03-06 | Mitsubishi Tanabe Pharma Corporation | Amine compound and pharmaceutical use thereof |
RU2453532C2 (ru) * | 2007-06-14 | 2012-06-20 | Мицубиси Танабе Фарма Корпорейшн | Аминосоединение и его фармацевтическое применение |
US8277775B2 (en) | 2007-08-17 | 2012-10-02 | The Research Foundation Of The City University Of New York | Boron dipyrromethene difluoro (BODIPY) conjugates |
WO2009119858A1 (ja) * | 2008-03-27 | 2009-10-01 | 田辺三菱製薬株式会社 | ベンゼン化合物及びその医薬用途 |
WO2013161816A1 (ja) | 2012-04-23 | 2013-10-31 | 田辺三菱製薬株式会社 | アミン化合物及びその医薬用途 |
WO2018021517A1 (ja) | 2016-07-29 | 2018-02-01 | 田辺三菱製薬株式会社 | 4-アルコキシ-3-トリフルオロメチルベンジルアルコールの製造方法 |
US10752575B2 (en) | 2016-07-29 | 2020-08-25 | Mitsubishi Tanabe Pharma Corporation | 4-alkoxy-3-(trifluoromethyl)benzyl alcohol production method |
EP3819285A1 (en) | 2016-07-29 | 2021-05-12 | Mitsubishi Tanabe Pharma Corporation | 4-alkoxy-3-(trifluoromethyl)benzyl alcohol production method |
US11078221B2 (en) | 2017-09-29 | 2021-08-03 | University College Cardiff Consultants Ltd | Phosphorodiamidates and other phosphorus derivatives of fingolimod and related S1P receptor modulators |
WO2021084068A1 (en) | 2019-10-31 | 2021-05-06 | Idorsia Pharmaceuticals Ltd | Combination of a cxcr7 antagonist with an s1p1 receptor modulator |
WO2021157682A1 (ja) | 2020-02-06 | 2021-08-12 | 田辺三菱製薬株式会社 | 筋痛性脳脊髄炎/慢性疲労症候群治療剤 |
WO2021200975A1 (ja) | 2020-03-31 | 2021-10-07 | 田辺三菱製薬株式会社 | 医薬組成物 |
EP4129276A4 (en) * | 2020-03-31 | 2023-10-18 | Mitsubishi Tanabe Pharma Corporation | PHARMACEUTICAL COMPOSITION |
Also Published As
Publication number | Publication date |
---|---|
US20140296183A1 (en) | 2014-10-02 |
CN101346346B (zh) | 2012-08-22 |
KR20080080167A (ko) | 2008-09-02 |
BRPI0619894B1 (pt) | 2021-04-06 |
BRPI0619894B8 (pt) | 2021-05-25 |
EP1961734B1 (en) | 2011-09-14 |
ATE524432T1 (de) | 2011-09-15 |
PL1961734T3 (pl) | 2012-02-29 |
CN101346346A (zh) | 2009-01-14 |
JPWO2007069712A1 (ja) | 2009-05-28 |
TW200732284A (en) | 2007-09-01 |
RU2433117C2 (ru) | 2011-11-10 |
DK1961734T3 (da) | 2011-12-05 |
US8809304B2 (en) | 2014-08-19 |
JP4833998B2 (ja) | 2011-12-07 |
PT1961734E (pt) | 2011-10-06 |
CA2633374A1 (en) | 2007-06-21 |
AU2006325931A1 (en) | 2007-06-21 |
BRPI0619894A2 (pt) | 2011-10-25 |
TWI451865B (zh) | 2014-09-11 |
AU2006325931B2 (en) | 2012-09-06 |
EP1961734A4 (en) | 2009-03-25 |
AU2006325931B8 (en) | 2012-09-20 |
RU2008128875A (ru) | 2010-01-20 |
US20090137530A1 (en) | 2009-05-28 |
AU2006325931A8 (en) | 2012-09-20 |
KR101346527B1 (ko) | 2013-12-31 |
CA2633374C (en) | 2013-10-01 |
ES2369520T3 (es) | 2011-12-01 |
EP1961734A1 (en) | 2008-08-27 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
WO2007069712A1 (ja) | アミン化合物及びその医薬用途 | |
US7728020B2 (en) | Amino acid derivatives | |
JP4152884B2 (ja) | ジアリールエーテル誘導体とその付加塩及び免疫抑制剤 | |
TWI439263B (zh) | 胺化合物及其醫藥用途 | |
WO2005044780A1 (ja) | アミノカルボン酸誘導体とその付加塩及びs1p受容体調節剤 | |
WO2006129688A1 (ja) | 2-アミノブタノール化合物及びその医薬用途 | |
ES2491224T3 (es) | Compuesto de 2-aminobutanol y su uso para fines médicos | |
JP6194306B2 (ja) | アミン化合物及びその医薬用途 | |
JP2011136905A (ja) | ベンゼン化合物及びその医薬用途 | |
JP2022517993A (ja) | アナンダミド化合物 | |
TW202435893A (zh) | 甲狀腺激素類似物的前藥、其製備方法和使用方法 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
WWE | Wipo information: entry into national phase |
Ref document number: 200680047255.7 Country of ref document: CN |
|
121 | Ep: the epo has been informed by wipo that ep was designated in this application | ||
WWE | Wipo information: entry into national phase |
Ref document number: 2007550231 Country of ref document: JP |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2006325931 Country of ref document: AU |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2633374 Country of ref document: CA Ref document number: MX/a/2008/007816 Country of ref document: MX Ref document number: 12008501424 Country of ref document: PH Ref document number: 2006834759 Country of ref document: EP |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
ENP | Entry into the national phase |
Ref document number: 2006325931 Country of ref document: AU Date of ref document: 20061215 Kind code of ref document: A |
|
WWE | Wipo information: entry into national phase |
Ref document number: 1020087016615 Country of ref document: KR |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2008128875 Country of ref document: RU Ref document number: 3648/CHENP/2008 Country of ref document: IN |
|
WWE | Wipo information: entry into national phase |
Ref document number: 12086419 Country of ref document: US |
|
ENP | Entry into the national phase |
Ref document number: PI0619894 Country of ref document: BR Kind code of ref document: A2 Effective date: 20080616 |