US3692835A - Pharmacologically active amino-ethyl oximes - Google Patents
Pharmacologically active amino-ethyl oximes Download PDFInfo
- Publication number
- US3692835A US3692835A US715571A US3692835DA US3692835A US 3692835 A US3692835 A US 3692835A US 715571 A US715571 A US 715571A US 3692835D A US3692835D A US 3692835DA US 3692835 A US3692835 A US 3692835A
- Authority
- US
- United States
- Prior art keywords
- group
- mls
- ethyl
- ether
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 amino-ethyl oximes Chemical class 0.000 title abstract description 18
- 150000001875 compounds Chemical class 0.000 claims abstract description 47
- 239000002253 acid Substances 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- 150000007513 acids Chemical class 0.000 claims abstract description 13
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 13
- 125000000217 alkyl group Chemical group 0.000 abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 9
- 239000001257 hydrogen Substances 0.000 abstract description 9
- 125000005843 halogen group Chemical group 0.000 abstract description 6
- 150000003840 hydrochlorides Chemical class 0.000 abstract description 6
- 125000001424 substituent group Chemical group 0.000 abstract description 6
- 230000001430 anti-depressive effect Effects 0.000 abstract description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 abstract description 4
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 4
- 125000005605 benzo group Chemical group 0.000 abstract description 4
- 125000004663 dialkyl amino group Chemical group 0.000 abstract description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 3
- 125000004429 atom Chemical group 0.000 abstract description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 abstract description 3
- 150000002923 oximes Chemical class 0.000 abstract description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 abstract description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 78
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- 239000000243 solution Substances 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 23
- 239000000203 mixture Substances 0.000 description 16
- 239000002904 solvent Substances 0.000 description 15
- 239000000126 substance Substances 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- 239000003921 oil Substances 0.000 description 13
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- 239000000284 extract Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 8
- 230000001476 alcoholic effect Effects 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 230000001624 sedative effect Effects 0.000 description 5
- GNKZMNRKLCTJAY-UHFFFAOYSA-N 4'-Methylacetophenone Chemical compound CC(=O)C1=CC=C(C)C=C1 GNKZMNRKLCTJAY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 230000002082 anti-convulsion Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 229960004132 diethyl ether Drugs 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000000932 sedative agent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- MKJIEFSOBYUXJB-HOCLYGCPSA-N (3S,11bS)-9,10-dimethoxy-3-isobutyl-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one Chemical compound C1CN2C[C@H](CC(C)C)C(=O)C[C@H]2C2=C1C=C(OC)C(OC)=C2 MKJIEFSOBYUXJB-HOCLYGCPSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WJAXXWSZNSFVNG-UHFFFAOYSA-N 2-bromoethanamine;hydron;bromide Chemical compound [Br-].[NH3+]CCBr WJAXXWSZNSFVNG-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229960005333 tetrabenazine Drugs 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 206010015995 Eyelid ptosis Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 102000004316 Oxidoreductases Human genes 0.000 description 2
- 108090000854 Oxidoreductases Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229940052303 ethers for general anesthesia Drugs 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- UYXAWHWODHRRMR-UHFFFAOYSA-N hexobarbital Chemical compound O=C1N(C)C(=O)NC(=O)C1(C)C1=CCCCC1 UYXAWHWODHRRMR-UHFFFAOYSA-N 0.000 description 2
- 229960002456 hexobarbital Drugs 0.000 description 2
- KDFBGNBTTMPNIG-UHFFFAOYSA-N hydron;2-(1h-indol-3-yl)ethanamine;chloride Chemical compound Cl.C1=CC=C2C(CCN)=CNC2=C1 KDFBGNBTTMPNIG-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 201000003004 ptosis Diseases 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 2
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- HGVWMTAIIYNQSI-UHFFFAOYSA-N 1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone Chemical compound O1CCOC2=CC(C(=O)C)=CC=C21 HGVWMTAIIYNQSI-UHFFFAOYSA-N 0.000 description 1
- OGRXDZGVASXMGD-UHFFFAOYSA-N 1-(4-methylphenyl)hexan-1-one Chemical compound CCCCCC(=O)C1=CC=C(C)C=C1 OGRXDZGVASXMGD-UHFFFAOYSA-N 0.000 description 1
- JECUZQLBQKNEMW-UHFFFAOYSA-N 1-(4-methylsulfanylphenyl)ethanone Chemical compound CSC1=CC=C(C(C)=O)C=C1 JECUZQLBQKNEMW-UHFFFAOYSA-N 0.000 description 1
- ISQPKHKHCAXWCD-UHFFFAOYSA-N 2-amino-1-phenylhexan-1-one Chemical compound CCCCC(N)C(=O)C1=CC=CC=C1 ISQPKHKHCAXWCD-UHFFFAOYSA-N 0.000 description 1
- BSMGLVDZZMBWQB-UHFFFAOYSA-N 2-methyl-1-phenylpropan-1-one Chemical compound CC(C)C(=O)C1=CC=CC=C1 BSMGLVDZZMBWQB-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- PATYHUUYADUHQS-UHFFFAOYSA-N 4-methylpropiophenone Chemical compound CCC(=O)C1=CC=C(C)C=C1 PATYHUUYADUHQS-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 235000019890 Amylum Nutrition 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 244000151018 Maranta arundinacea Species 0.000 description 1
- 235000010804 Maranta arundinacea Nutrition 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000010513 Stupor Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 235000012419 Thalia geniculata Nutrition 0.000 description 1
- 244000290333 Vanilla fragrans Species 0.000 description 1
- 235000009499 Vanilla fragrans Nutrition 0.000 description 1
- 235000012036 Vanilla tahitensis Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000002716 ataractic effect Effects 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 230000002920 convulsive effect Effects 0.000 description 1
- 230000003001 depressive effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001037 epileptic effect Effects 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical class C(=O)(OCC)* 0.000 description 1
- MGPDSKXOTDLPJE-UHFFFAOYSA-N ethyl aziridine-1-carboxylate Chemical compound CCOC(=O)N1CC1 MGPDSKXOTDLPJE-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000004515 gallic acid Nutrition 0.000 description 1
- 229940074391 gallic acid Drugs 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- VYXVPOVYYRXJCS-UHFFFAOYSA-N hydroxylamine;dihydrochloride Chemical compound Cl.Cl.ON VYXVPOVYYRXJCS-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YBSXDWIAUZOFFV-UHFFFAOYSA-N n-[(2,6-dichlorophenyl)methylidene]hydroxylamine Chemical compound ON=CC1=C(Cl)C=CC=C1Cl YBSXDWIAUZOFFV-UHFFFAOYSA-N 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003368 psychostimulant agent Substances 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/16—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/18—Ethylenedioxybenzenes, not substituted on the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/06—Six-membered rings
- C07D327/08—[b,e]-condensed with two six-membered carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/18—Fluorenes; Hydrogenated fluorenes
Definitions
- the temperature of the reaction mixture may vary between rather wide limits. As a rule, however, it will be between 0 and 50 C.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
NL676704810A NL150105B (nl) | 1967-04-05 | 1967-04-05 | Verbindingen met antidepressieve werking. |
NL676717001A NL151361B (nl) | 1967-12-14 | 1967-12-14 | Verbindingen met centrale werking. |
Publications (1)
Publication Number | Publication Date |
---|---|
US3692835A true US3692835A (en) | 1972-09-19 |
Family
ID=26644178
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US715571A Expired - Lifetime US3692835A (en) | 1967-04-05 | 1968-03-25 | Pharmacologically active amino-ethyl oximes |
US06/814,019 Expired - Fee Related US5008452A (en) | 1967-04-05 | 1989-12-20 | Aminoethyl oximes |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US06/814,019 Expired - Fee Related US5008452A (en) | 1967-04-05 | 1989-12-20 | Aminoethyl oximes |
Country Status (16)
Cited By (25)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3903164A (en) * | 1972-03-24 | 1975-09-02 | Kabi Ab | Pharmacodynamically active amino alkyloxim ethers |
US4038317A (en) * | 1975-02-12 | 1977-07-26 | Seperic | O-aminoalkyl oximes |
US4060631A (en) * | 1975-03-20 | 1977-11-29 | U.S. Philips Corporation | Aminoethyl oxime ethers having anti-depressive activity |
US4062969A (en) * | 1976-06-25 | 1977-12-13 | Union Carbide Corporation | Dioxane oxime compounds and pesticidal dioxane carbamoyloxime derivatives |
US4077999A (en) * | 1976-01-27 | 1978-03-07 | Egyt Gyogyszervegyeszeti Gyar | Novel oxime ethers |
US4081551A (en) * | 1975-03-20 | 1978-03-28 | U.S. Philips Corporation | Oxime ethers having anti-depressive activity |
US4081552A (en) * | 1975-03-20 | 1978-03-28 | U.S. Philips Corporation | Oxime ethers having anti-depressive activity |
US4085225A (en) * | 1975-03-20 | 1978-04-18 | U.S. Philips Corporation | Oxime ethers having anti-depressive activity |
US4086361A (en) * | 1975-03-20 | 1978-04-25 | U.S. Philips Corporation | Aminoethyl oximes having anti-depressive activity |
FR2387945A1 (fr) * | 1977-03-02 | 1978-11-17 | Ciba Geigy Ag | Agents favorisant la croissance des plantes et phytoprotecteurs a base d'oximethers et d'oximesters |
US4192893A (en) * | 1975-03-20 | 1980-03-11 | U.S. Philips Corporation | Anti-depressive compounds |
US4242348A (en) * | 1970-06-11 | 1980-12-30 | Duphar International Research B.V. | Novel basic substituted-alkylidenamino-oxylalkyl-carboxylic-acid esters |
US4328227A (en) * | 1976-12-24 | 1982-05-04 | Hoechst Aktiengesellschaft | Novel O-propyloximes |
US4342763A (en) * | 1979-02-13 | 1982-08-03 | Provesan S.A. | P-Chloroacetophenone oxime compounds and pharmaceutical compositions |
US4358450A (en) * | 1976-12-24 | 1982-11-09 | Hoechst Aktiengesellschaft | O-Alkylated oximes and pharmaceutical composition thereof |
US4388106A (en) * | 1978-08-31 | 1983-06-14 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4488899A (en) * | 1978-08-31 | 1984-12-18 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4488898A (en) * | 1978-08-31 | 1984-12-18 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4488900A (en) * | 1978-08-31 | 1984-12-18 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4548756A (en) * | 1977-03-02 | 1985-10-22 | Ciba Geigy Corporation | Oxime ethers |
US4581060A (en) * | 1977-03-02 | 1986-04-08 | Ciba-Geigy Corporation | Compositions, which promote plant growth and protect plants, based on oxime ethers and oxime esters |
US4709095A (en) * | 1984-08-06 | 1987-11-24 | Yoshitomi Pharmaceutical Industries, Ltd. | Ortho-aminomethylphenol compounds |
US4845287A (en) * | 1986-01-16 | 1989-07-04 | Bayer Aktiengesellschaft | Hydroxybenzaldoxime O-ethers |
US5008452A (en) * | 1967-04-05 | 1991-04-16 | Duphar International Research B.V. | Aminoethyl oximes |
WO2018096376A1 (en) | 2016-11-24 | 2018-05-31 | Mta Támogatott Kutatócsoportok Irodája | Compositions for organ preservation |
Families Citing this family (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB1600969A (en) * | 1977-01-07 | 1981-10-21 | Acf Chemiefarma Nv | Heterocyclic compounds |
AU532700B2 (en) * | 1979-04-02 | 1983-10-13 | Sumitomo Chemical Company, Limited | Diphenylalkanoether |
FR2518090A1 (fr) * | 1981-12-11 | 1983-06-17 | Univablot | Ethers d'oximes a-b insatures, leur procede de preparation et leur utilisation comme medicament |
US5665756A (en) * | 1994-08-03 | 1997-09-09 | Hoechst Marion Roussel, Inc. | Aminoalkyloximes useful in the treatment of depression and obsessive compulsive disorders |
Citations (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US1733462A (en) * | 1926-09-23 | 1929-10-29 | Winthrop Chem Co Inc | New basic oxime ethers of cyclic compounds |
US3270055A (en) * | 1963-09-11 | 1966-08-30 | Engelhard Hermann | 5-aminoalkoxy ethers of 5-hydroxyimino-10, 11-dihydro-5h-dibenzo (a, d) cyclohepta (1, 4) dienes |
US3441608A (en) * | 1964-11-26 | 1969-04-29 | Bayer Ag | 5beta - n - methylamino - ethoxyimino - 5h - dibenzo - (a,d) - 10,11 - dihydrocycloheptene and non-toxic pharmaceutically acceptable salts thereof and their production |
Family Cites Families (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
NL6503019A (enrdf_load_html_response) * | 1965-03-10 | 1966-09-12 | ||
US4235931A (en) * | 1967-04-05 | 1980-11-25 | Duphar International Research B.V. | Compounds having pharmacological properties |
US3692835A (en) * | 1967-04-05 | 1972-09-19 | Jan Van Dijk | Pharmacologically active amino-ethyl oximes |
NL150105B (nl) * | 1967-04-05 | 1976-07-15 | Philips Nv | Verbindingen met antidepressieve werking. |
US4192818A (en) * | 1967-04-05 | 1980-03-11 | Duphar International Research B.V. | Compounds having pharmacological properties |
NL7503312A (nl) * | 1975-03-20 | 1976-09-22 | Philips Nv | Verbindingen met antidepressieve werking. |
-
1968
- 1968-03-25 US US715571A patent/US3692835A/en not_active Expired - Lifetime
- 1968-03-29 FR FR1583796D patent/FR1583796A/fr not_active Expired
- 1968-03-30 DE DE1768100A patent/DE1768100C2/de not_active Expired
- 1968-04-02 AT AT141370A patent/AT289761B/de not_active IP Right Cessation
- 1968-04-02 DK DK144068AA patent/DK120384B/da unknown
- 1968-04-02 AT AT141270A patent/AT289760B/de not_active IP Right Cessation
- 1968-04-02 AT AT319868A patent/AT289758B/de not_active IP Right Cessation
- 1968-04-02 CH CH484268A patent/CH534669A/de not_active IP Right Cessation
- 1968-04-02 CH CH1493570A patent/CH535209A/de not_active IP Right Cessation
- 1968-04-02 NO NO681268A patent/NO125974B/no unknown
- 1968-04-02 IL IL29740A patent/IL29740A/en unknown
- 1968-04-02 GB GB05735/68A patent/GB1205665A/en not_active Expired
- 1968-04-02 SE SE04388/68A patent/SE352078B/xx unknown
- 1968-04-02 AT AT141170A patent/AT289759B/de not_active IP Right Cessation
- 1968-04-02 CA CA016,478A patent/CA959063A/en not_active Expired
- 1968-04-02 IE IE381/68A patent/IE33428B1/xx unknown
- 1968-04-03 YU YU765/68A patent/YU33857B/xx unknown
- 1968-04-03 BE BE713172D patent/BE713172A/xx not_active IP Right Cessation
- 1968-04-04 FI FI680931A patent/FI49957C/fi active
- 1968-06-28 FR FR157096A patent/FR7901M/fr not_active Expired
-
1969
- 1969-04-03 ES ES352329A patent/ES352329A1/es not_active Expired
- 1969-05-14 ES ES367237A patent/ES367237A1/es not_active Expired
-
1973
- 1973-03-28 YU YU845/73A patent/YU33858B/xx unknown
- 1973-03-28 YU YU847/73A patent/YU33859B/xx unknown
-
1989
- 1989-12-20 US US06/814,019 patent/US5008452A/en not_active Expired - Fee Related
Patent Citations (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US1733462A (en) * | 1926-09-23 | 1929-10-29 | Winthrop Chem Co Inc | New basic oxime ethers of cyclic compounds |
US3270055A (en) * | 1963-09-11 | 1966-08-30 | Engelhard Hermann | 5-aminoalkoxy ethers of 5-hydroxyimino-10, 11-dihydro-5h-dibenzo (a, d) cyclohepta (1, 4) dienes |
US3441608A (en) * | 1964-11-26 | 1969-04-29 | Bayer Ag | 5beta - n - methylamino - ethoxyimino - 5h - dibenzo - (a,d) - 10,11 - dihydrocycloheptene and non-toxic pharmaceutically acceptable salts thereof and their production |
Non-Patent Citations (1)
Title |
---|
Chemical Abstracts, Vol. 61, 10545 10546(1964) * |
Cited By (32)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5008452A (en) * | 1967-04-05 | 1991-04-16 | Duphar International Research B.V. | Aminoethyl oximes |
US4242348A (en) * | 1970-06-11 | 1980-12-30 | Duphar International Research B.V. | Novel basic substituted-alkylidenamino-oxylalkyl-carboxylic-acid esters |
US4317835A (en) * | 1970-06-11 | 1982-03-02 | Duphar International Research B.V. | Novel basic substituted-alkylidenamino-oxyalkyl-carboxylic acid esters |
US3903164A (en) * | 1972-03-24 | 1975-09-02 | Kabi Ab | Pharmacodynamically active amino alkyloxim ethers |
US4038317A (en) * | 1975-02-12 | 1977-07-26 | Seperic | O-aminoalkyl oximes |
US4086361A (en) * | 1975-03-20 | 1978-04-25 | U.S. Philips Corporation | Aminoethyl oximes having anti-depressive activity |
US4081552A (en) * | 1975-03-20 | 1978-03-28 | U.S. Philips Corporation | Oxime ethers having anti-depressive activity |
US4085225A (en) * | 1975-03-20 | 1978-04-18 | U.S. Philips Corporation | Oxime ethers having anti-depressive activity |
US4192893A (en) * | 1975-03-20 | 1980-03-11 | U.S. Philips Corporation | Anti-depressive compounds |
US4081551A (en) * | 1975-03-20 | 1978-03-28 | U.S. Philips Corporation | Oxime ethers having anti-depressive activity |
US4060631A (en) * | 1975-03-20 | 1977-11-29 | U.S. Philips Corporation | Aminoethyl oxime ethers having anti-depressive activity |
US4077999A (en) * | 1976-01-27 | 1978-03-07 | Egyt Gyogyszervegyeszeti Gyar | Novel oxime ethers |
US4062969A (en) * | 1976-06-25 | 1977-12-13 | Union Carbide Corporation | Dioxane oxime compounds and pesticidal dioxane carbamoyloxime derivatives |
US4328227A (en) * | 1976-12-24 | 1982-05-04 | Hoechst Aktiengesellschaft | Novel O-propyloximes |
US4358450A (en) * | 1976-12-24 | 1982-11-09 | Hoechst Aktiengesellschaft | O-Alkylated oximes and pharmaceutical composition thereof |
US4548756A (en) * | 1977-03-02 | 1985-10-22 | Ciba Geigy Corporation | Oxime ethers |
FR2387945A1 (fr) * | 1977-03-02 | 1978-11-17 | Ciba Geigy Ag | Agents favorisant la croissance des plantes et phytoprotecteurs a base d'oximethers et d'oximesters |
US4581060A (en) * | 1977-03-02 | 1986-04-08 | Ciba-Geigy Corporation | Compositions, which promote plant growth and protect plants, based on oxime ethers and oxime esters |
US4388106A (en) * | 1978-08-31 | 1983-06-14 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4505742A (en) * | 1978-08-31 | 1985-03-19 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4450000A (en) * | 1978-08-31 | 1984-05-22 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4486224A (en) * | 1978-08-31 | 1984-12-04 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4488899A (en) * | 1978-08-31 | 1984-12-18 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4488898A (en) * | 1978-08-31 | 1984-12-18 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4488900A (en) * | 1978-08-31 | 1984-12-18 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4439228A (en) * | 1978-08-31 | 1984-03-27 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4439230A (en) * | 1978-08-31 | 1984-03-27 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4437879A (en) | 1978-08-31 | 1984-03-20 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
US4342763A (en) * | 1979-02-13 | 1982-08-03 | Provesan S.A. | P-Chloroacetophenone oxime compounds and pharmaceutical compositions |
US4709095A (en) * | 1984-08-06 | 1987-11-24 | Yoshitomi Pharmaceutical Industries, Ltd. | Ortho-aminomethylphenol compounds |
US4845287A (en) * | 1986-01-16 | 1989-07-04 | Bayer Aktiengesellschaft | Hydroxybenzaldoxime O-ethers |
WO2018096376A1 (en) | 2016-11-24 | 2018-05-31 | Mta Támogatott Kutatócsoportok Irodája | Compositions for organ preservation |
Also Published As
Publication number | Publication date |
---|---|
US5008452A (en) | 1991-04-16 |
YU33859B (en) | 1978-06-30 |
IE33428L (en) | 1968-10-05 |
DE1768100A1 (de) | 1971-10-14 |
IL29740A0 (en) | 1968-06-20 |
FR1583796A (enrdf_load_html_response) | 1969-12-05 |
AT289761B (de) | 1971-05-10 |
FI49957B (enrdf_load_html_response) | 1975-07-31 |
FI49957C (fi) | 1975-11-10 |
GB1205665A (en) | 1970-09-16 |
DE1768100C2 (de) | 1986-02-06 |
CA959063A (en) | 1974-12-10 |
YU33858B (en) | 1978-06-30 |
YU84573A (en) | 1977-12-31 |
YU75668A (en) | 1977-12-31 |
AT289758B (de) | 1971-05-10 |
AT289760B (de) | 1971-05-10 |
IE33428B1 (en) | 1974-06-26 |
SE352078B (enrdf_load_html_response) | 1972-12-18 |
FR7901M (enrdf_load_html_response) | 1970-05-11 |
YU33857B (en) | 1978-06-30 |
NO125974B (enrdf_load_html_response) | 1972-12-04 |
YU84773A (en) | 1977-12-31 |
BE713172A (enrdf_load_html_response) | 1968-10-03 |
ES367237A1 (es) | 1971-06-16 |
AT289759B (de) | 1971-05-10 |
CH534669A (de) | 1973-03-15 |
IL29740A (en) | 1971-11-29 |
CH535209A (de) | 1973-03-31 |
DK120384B (da) | 1971-05-24 |
ES352329A1 (es) | 1969-12-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US3692835A (en) | Pharmacologically active amino-ethyl oximes | |
US4087535A (en) | 5-Methyl-isoxazole-4-carboxylic acid anilides | |
US2703324A (en) | Basic ethers of aralkyl phenols and salts thereof | |
US3532712A (en) | N'-cyclopropyl ethylenediamine derivatives | |
US3759979A (en) | Aromatic amino acids and esters thereof | |
US3937841A (en) | Treatment of depression | |
US3205136A (en) | Antidepressant phenyloxyalkylamines | |
CA1136624A (en) | 9-aminoalkylfluorenes | |
US2516098A (en) | Biphenyl compounds | |
US4235931A (en) | Compounds having pharmacological properties | |
US3992536A (en) | Pharmaceutical compositions containing a 1-phenyl-2,2,4,4-C1 -C2 alkyl-3-[4-phenyl of pyridyl)-piperazino]-cyclobutanol-(1) and method of use | |
US2441576A (en) | Amino methyl phenols | |
US3526671A (en) | Aminoalkylated oximes of dibenzo(a,d)cyclohepten-5-ones | |
AU733006B2 (en) | Phenylpropenone compounds and medicines containing the same | |
SU1549480A3 (ru) | Способ получени производных иминотиазолидина или их гидрохлоридов | |
US4209517A (en) | α-Ethylenic alcohols and ketones, their preparation, and their use as medicaments | |
US4086361A (en) | Aminoethyl oximes having anti-depressive activity | |
US3066141A (en) | Quinoline-type mustards and process for producing same | |
US4182760A (en) | Benzophenone anti-oximes, diazepin-N-oxides, and their use as pharmaceutical agents and as intermediates for pharmaceutical agents | |
EP0187509A2 (en) | 9-Aminoalkylfluorenes | |
US3334115A (en) | Basically substituted ureas and salts thereof | |
US3943173A (en) | 3-Alkylamino- alpha-aminomethyl-4-hydroxybenzyl alcohols | |
CH516532A (de) | Verfahren zur Herstellung neuer Oximäther | |
US4081552A (en) | Oxime ethers having anti-depressive activity | |
US3943149A (en) | Naphthyloxy acetic acids and related compounds |