US3326273A - Exothermic hot top - Google Patents
Exothermic hot top Download PDFInfo
- Publication number
- US3326273A US3326273A US517132A US51713265A US3326273A US 3326273 A US3326273 A US 3326273A US 517132 A US517132 A US 517132A US 51713265 A US51713265 A US 51713265A US 3326273 A US3326273 A US 3326273A
- Authority
- US
- United States
- Prior art keywords
- aluminum
- dust
- ballmill
- metal
- dross
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 claims description 30
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 27
- 239000002657 fibrous material Substances 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 239000002245 particle Substances 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 239000000428 dust Substances 0.000 description 27
- 229910052751 metal Inorganic materials 0.000 description 20
- 239000002184 metal Substances 0.000 description 20
- 229910052782 aluminium Inorganic materials 0.000 description 17
- 238000005266 casting Methods 0.000 description 14
- 239000002002 slurry Substances 0.000 description 13
- 239000000463 material Substances 0.000 description 11
- 238000000034 method Methods 0.000 description 11
- 239000007787 solid Substances 0.000 description 10
- 239000011230 binding agent Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 230000008901 benefit Effects 0.000 description 6
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011819 refractory material Substances 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 3
- 238000000498 ball milling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000005058 metal casting Methods 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 229920001568 phenolic resin Polymers 0.000 description 3
- 239000011775 sodium fluoride Substances 0.000 description 3
- 235000013024 sodium fluoride Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 238000003809 water extraction Methods 0.000 description 3
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910001610 cryolite Inorganic materials 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- -1 halide salts Chemical class 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 238000005029 sieve analysis Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 201000010001 Silicosis Diseases 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910001959 inorganic nitrate Inorganic materials 0.000 description 1
- 229910052909 inorganic silicate Inorganic materials 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011490 mineral wool Substances 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910021652 non-ferrous alloy Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011044 quartzite Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229940032158 sodium silicate Drugs 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019794 sodium silicate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000007666 vacuum forming Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D7/00—Casting ingots, e.g. from ferrous metals
- B22D7/06—Ingot moulds or their manufacture
- B22D7/10—Hot tops therefor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22C—FOUNDRY MOULDING
- B22C3/00—Selection of compositions for coating the surfaces of moulds, cores, or patterns
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D7/00—Casting ingots, e.g. from ferrous metals
- B22D7/06—Ingot moulds or their manufacture
- B22D7/10—Hot tops therefor
- B22D7/104—Hot tops therefor from exothermic material only
-
- C—CHEMISTRY; METALLURGY
- C21—METALLURGY OF IRON
- C21C—PROCESSING OF PIG-IRON, e.g. REFINING, MANUFACTURE OF WROUGHT-IRON OR STEEL; TREATMENT IN MOLTEN STATE OF FERROUS ALLOYS
- C21C7/00—Treating molten ferrous alloys, e.g. steel, not covered by groups C21C1/00 - C21C5/00
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US517132A US3326273A (en) | 1965-12-28 | 1965-12-28 | Exothermic hot top |
| FR69134A FR1494838A (fr) | 1965-12-28 | 1966-07-12 | Perfectionnements apportés aux moules de fonderie |
| GB44722/66A GB1117977A (en) | 1965-12-28 | 1966-10-06 | Mould linings |
| BE691923D BE691923A (xx) | 1965-12-28 | 1966-12-28 | |
| JP41085257A JPS4948618B1 (xx) | 1965-12-28 | 1966-12-28 | |
| GB03587/67A GB1218568A (en) | 1965-12-28 | 1967-03-22 | Mould linings |
| US707471A US3567667A (en) | 1965-12-28 | 1968-02-23 | Mould linings composition comprising ball mill dust and calcium silicate,aluminum silicate or calcium alumino silicate fibrous refractory material |
| BE712197D BE712197A (xx) | 1965-12-28 | 1968-03-14 | |
| NL6803645A NL6803645A (xx) | 1965-12-28 | 1968-03-14 | |
| ES351881A ES351881A2 (es) | 1965-12-28 | 1968-03-22 | Perfeccionamientos en la preparacion de composiciones para revestir la superficie interior de utiles para fundicion. |
| FR144965A FR94641E (fr) | 1965-12-28 | 1968-03-22 | Perfectionnements apportés aux moules de fonderie. |
| JP43018305A JPS5248932B1 (xx) | 1965-12-28 | 1968-03-22 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US517132A US3326273A (en) | 1965-12-28 | 1965-12-28 | Exothermic hot top |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3326273A true US3326273A (en) | 1967-06-20 |
Family
ID=24058495
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US517132A Expired - Lifetime US3326273A (en) | 1965-12-28 | 1965-12-28 | Exothermic hot top |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3326273A (xx) |
| JP (1) | JPS4948618B1 (xx) |
| BE (1) | BE691923A (xx) |
| FR (1) | FR1494838A (xx) |
| GB (1) | GB1117977A (xx) |
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3385717A (en) * | 1966-01-19 | 1968-05-28 | Armsted Ind Inc | Mold wash composition |
| US3622536A (en) * | 1968-10-17 | 1971-11-23 | Foseco Int | Exothermic hot tops |
| US3876420A (en) * | 1969-08-20 | 1975-04-08 | Foseco Trading Ag | Thermal insulation molten metal |
| US3878142A (en) * | 1971-12-03 | 1975-04-15 | Tidd Chemisch Tech Produkte G | Compositions for lining casting moulds and related articles and method of making such articles |
| US4031046A (en) * | 1974-04-02 | 1977-06-21 | Firma Tido Chemisch-Technische Produkte Gmbh | Exothermic lining for metallurgical purposes and method of making the same |
| US4119468A (en) * | 1970-11-12 | 1978-10-10 | Air Products And Chemicals, Inc. | Particulate metallurgical hot topping compositions and method of use |
| JPS5651539A (en) * | 1974-10-29 | 1981-05-09 | Shoichi Sasaki | Slag making lump material for metal refining |
| US4274869A (en) * | 1979-04-19 | 1981-06-23 | Foseco International Limited | Desulphurization of metals |
| US4440575A (en) * | 1979-06-11 | 1984-04-03 | Daussan Jean | Granular insulation product and process for its preparation |
| USRE31589E (en) * | 1969-08-20 | 1984-05-22 | Foseco Trading A.G. | Thermal insulation molten metal |
| US4659056A (en) * | 1983-09-19 | 1987-04-21 | Societe Nationale Industrielle Et Aerospatiale | Electrically heated light-weight concrete mold |
| US6972059B1 (en) * | 1999-06-01 | 2005-12-06 | As Lungen Gmbh & Co. Kg | Exothermic feeder |
| WO2006091105A1 (en) * | 2005-02-03 | 2006-08-31 | Elkem As | Refractory compositions |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4041199A (en) | 1974-01-02 | 1977-08-09 | Foseco International Limited | Refractory heat-insulating materials |
| JPS5278924U (xx) * | 1975-12-11 | 1977-06-13 | ||
| SE434352B (sv) * | 1976-11-04 | 1984-07-23 | Foseco Int | Forfarande och anordning for forvermning av samverkande delar av ett munstycke och en stopparstang i ett for smelt metall avsett kerl |
| GB9308363D0 (en) * | 1993-04-22 | 1993-06-09 | Foseco Int | Refractory compositions for use in the casting of metals |
| DE10149876B4 (de) * | 2001-10-10 | 2013-01-10 | Georg Fischer Gmbh & Co.Kg | Exotherm reagierende Werkstoffzusammensetzungen für Speiserheizmassen |
| RU2454294C1 (ru) * | 2010-12-13 | 2012-06-27 | Государственное образовательное учреждение высшего профессионального образования "Московский государственный университет путей сообщения" (МИИТ) | Комплексная экзотермическая смесь |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2390500A (en) * | 1942-07-30 | 1945-12-11 | Ferro Eng Co | Low volume sinkhead |
| US2500097A (en) * | 1947-10-14 | 1950-03-07 | Peter J Soffel | Exothermic composition for controlling the fluidity of castings |
| US2891293A (en) * | 1956-01-20 | 1959-06-23 | Foundry Services Ltd | Method of initiating an exothermic reaction in a mold by chemical means |
| US3039158A (en) * | 1960-09-22 | 1962-06-19 | Oglebay Norton Co | Highly thermally efficient hot top and preformed protective refractory and exothermic unit therefor |
| US3171173A (en) * | 1962-05-04 | 1965-03-02 | Frank J Ingala | Composite slab for hot tops |
| US3212749A (en) * | 1964-03-24 | 1965-10-19 | Bate Micheal Donald La | Consumable hot top with inserts of exothermic material |
-
1965
- 1965-12-28 US US517132A patent/US3326273A/en not_active Expired - Lifetime
-
1966
- 1966-07-12 FR FR69134A patent/FR1494838A/fr not_active Expired
- 1966-10-06 GB GB44722/66A patent/GB1117977A/en not_active Expired
- 1966-12-28 JP JP41085257A patent/JPS4948618B1/ja active Pending
- 1966-12-28 BE BE691923D patent/BE691923A/xx not_active IP Right Cessation
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2390500A (en) * | 1942-07-30 | 1945-12-11 | Ferro Eng Co | Low volume sinkhead |
| US2500097A (en) * | 1947-10-14 | 1950-03-07 | Peter J Soffel | Exothermic composition for controlling the fluidity of castings |
| US2891293A (en) * | 1956-01-20 | 1959-06-23 | Foundry Services Ltd | Method of initiating an exothermic reaction in a mold by chemical means |
| US3039158A (en) * | 1960-09-22 | 1962-06-19 | Oglebay Norton Co | Highly thermally efficient hot top and preformed protective refractory and exothermic unit therefor |
| US3171173A (en) * | 1962-05-04 | 1965-03-02 | Frank J Ingala | Composite slab for hot tops |
| US3212749A (en) * | 1964-03-24 | 1965-10-19 | Bate Micheal Donald La | Consumable hot top with inserts of exothermic material |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3385717A (en) * | 1966-01-19 | 1968-05-28 | Armsted Ind Inc | Mold wash composition |
| US3622536A (en) * | 1968-10-17 | 1971-11-23 | Foseco Int | Exothermic hot tops |
| USRE31589E (en) * | 1969-08-20 | 1984-05-22 | Foseco Trading A.G. | Thermal insulation molten metal |
| US3876420A (en) * | 1969-08-20 | 1975-04-08 | Foseco Trading Ag | Thermal insulation molten metal |
| US4119468A (en) * | 1970-11-12 | 1978-10-10 | Air Products And Chemicals, Inc. | Particulate metallurgical hot topping compositions and method of use |
| US3878142A (en) * | 1971-12-03 | 1975-04-15 | Tidd Chemisch Tech Produkte G | Compositions for lining casting moulds and related articles and method of making such articles |
| US4031046A (en) * | 1974-04-02 | 1977-06-21 | Firma Tido Chemisch-Technische Produkte Gmbh | Exothermic lining for metallurgical purposes and method of making the same |
| JPS5651539A (en) * | 1974-10-29 | 1981-05-09 | Shoichi Sasaki | Slag making lump material for metal refining |
| JPS5638659B2 (xx) * | 1974-10-29 | 1981-09-08 | ||
| US4274869A (en) * | 1979-04-19 | 1981-06-23 | Foseco International Limited | Desulphurization of metals |
| US4440575A (en) * | 1979-06-11 | 1984-04-03 | Daussan Jean | Granular insulation product and process for its preparation |
| US4659056A (en) * | 1983-09-19 | 1987-04-21 | Societe Nationale Industrielle Et Aerospatiale | Electrically heated light-weight concrete mold |
| US6972059B1 (en) * | 1999-06-01 | 2005-12-06 | As Lungen Gmbh & Co. Kg | Exothermic feeder |
| WO2006091105A1 (en) * | 2005-02-03 | 2006-08-31 | Elkem As | Refractory compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1117977A (en) | 1968-06-26 |
| FR1494838A (fr) | 1967-09-15 |
| BE691923A (xx) | 1967-06-28 |
| JPS4948618B1 (xx) | 1974-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3326273A (en) | Exothermic hot top | |
| EP0244133B1 (en) | Exothermic compositions | |
| EP0993889B1 (en) | Foundry exothermic assembly | |
| US2912729A (en) | Refractory molds | |
| US3347721A (en) | Dry exothermic composition containing fibrous material having oxidizer salt absorbedtherein | |
| US3567667A (en) | Mould linings composition comprising ball mill dust and calcium silicate,aluminum silicate or calcium alumino silicate fibrous refractory material | |
| US5169542A (en) | Filters for light metals | |
| US3934637A (en) | Casting of molten metals | |
| US2654670A (en) | Flux for treating aluminum and aluminum alloys | |
| US3162558A (en) | Moldable exothermic composition | |
| US3203057A (en) | Process for making cores and molds, articles made thereby and binder compositions therefor | |
| US3810506A (en) | Molding for use in steel ingot making by bottom pouring and method of making steel ingot | |
| CA1103884A (en) | Refractory exothermic heat insulating articles | |
| US4869468A (en) | Alumina and MgO preheatable insulating refractory liners and methods of using | |
| US4696455A (en) | Zircon and MgO preheatable insulating refractory liners and methods of use thereof | |
| US3622536A (en) | Exothermic hot tops | |
| US3876420A (en) | Thermal insulation molten metal | |
| EP0030940A1 (en) | PRODUCTION OF METALLIC CASTS. | |
| US3144690A (en) | Exothermically reacting shaped products for use in foundry practice | |
| US4167418A (en) | Protective coating for metal ingot molds and cores | |
| US3344838A (en) | Method for producing an exothermic lining for ingot and foundry molds and hot tops | |
| US2169385A (en) | Manufacture of foundry molds | |
| US4040469A (en) | Casting of molten metals | |
| US3706682A (en) | Hot tops and mixture of materials therefor | |
| US20080178767A1 (en) | Dry-Spray Products For Protecting Centrifugal Casting Molds of Cast Iron Pipes in Association With a Wet-Spray Product |