SU701535A3 - Способ получени производных 1,2,4-триазола или их солей - Google Patents
Способ получени производных 1,2,4-триазола или их солейInfo
- Publication number
- SU701535A3 SU701535A3 SU752194709A SU2194709A SU701535A3 SU 701535 A3 SU701535 A3 SU 701535A3 SU 752194709 A SU752194709 A SU 752194709A SU 2194709 A SU2194709 A SU 2194709A SU 701535 A3 SU701535 A3 SU 701535A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- salts
- preparing
- triazole derivatives
- triazole
- dichlorobenzylidene
- Prior art date
Links
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- -1 2,6-dichlorobenzylidene Chemical group 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- WIDBCGPXDBQVAW-UHFFFAOYSA-N 2-amino-1-[(2,6-dichlorophenyl)methylidene]-3-(dimethylamino)guanidine Chemical compound CN(C)N=C(NN)N=CC1=C(Cl)C=CC=C1Cl WIDBCGPXDBQVAW-UHFFFAOYSA-N 0.000 description 1
- CSPZTLTUXBDWPV-UHFFFAOYSA-N 3-n-[(2,6-dichlorophenyl)methylideneamino]-4-n,4-n-dimethyl-1,2,4-triazole-3,4-diamine Chemical compound CN(C)N1C=NN=C1NN=CC1=C(Cl)C=CC=C1Cl CSPZTLTUXBDWPV-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
- C07C281/16—Compounds containing any of the groups, e.g. aminoguanidine
- C07C281/18—Compounds containing any of the groups, e.g. aminoguanidine the other nitrogen atom being further doubly-bound to a carbon atom, e.g. guanylhydrazones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO744468A NO143904C (no) | 1974-12-11 | 1974-12-11 | Analogifremgangsmaate til fremstilling av terapeutisk virksomme substituerte triazoler |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU701535A3 true SU701535A3 (ru) | 1979-11-30 |
Family
ID=19881989
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752194709A SU701535A3 (ru) | 1974-12-11 | 1975-12-09 | Способ получени производных 1,2,4-триазола или их солей |
| SU772444404A SU651697A3 (ru) | 1974-12-11 | 1977-01-20 | Способ получени 3-(2,6-дихлорбензилиденгидразино)-4-метиламино-1,2,4-триазола или его соли |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU772444404A SU651697A3 (ru) | 1974-12-11 | 1977-01-20 | Способ получени 3-(2,6-дихлорбензилиденгидразино)-4-метиламино-1,2,4-триазола или его соли |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4022905A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5182276A (cg-RX-API-DMAC7.html) |
| AT (1) | AT345823B (cg-RX-API-DMAC7.html) |
| AU (1) | AU497897B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE836520A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1054615A (cg-RX-API-DMAC7.html) |
| CH (1) | CH603602A5 (cg-RX-API-DMAC7.html) |
| CS (2) | CS194732B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD126302A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2553520A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2293926A2 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1535937A (cg-RX-API-DMAC7.html) |
| HU (1) | HU170760B (cg-RX-API-DMAC7.html) |
| IE (1) | IE42878B1 (cg-RX-API-DMAC7.html) |
| LU (1) | LU73990A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7514472A (cg-RX-API-DMAC7.html) |
| NO (1) | NO143904C (cg-RX-API-DMAC7.html) |
| SU (2) | SU701535A3 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA757364B (cg-RX-API-DMAC7.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT376423B (de) * | 1978-04-26 | 1984-11-26 | Glaxo Group Ltd | Verfahren zur herstellung von neuen 1,2,4triazolderivaten |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3528969A (en) * | 1967-11-30 | 1970-09-15 | Sandoz Ag | Benzylidene hydrazones |
| US3516995A (en) * | 1969-02-27 | 1970-06-23 | Sandoz Ag | Benzalhydrazones |
| IT1054107B (it) * | 1970-12-15 | 1981-11-10 | Isf Spa | Nuove 3,idrazinopiridazine 6,sostituite ad attivita antiiperten siva e loro preparazione |
| US3850915A (en) * | 1971-09-03 | 1974-11-26 | American Home Prod | 2,6-dichlorobenzaldehyde hydrazones |
| SE401833B (sv) * | 1973-06-14 | 1978-05-29 | Astra Laekemedel Ab | Forfarande for framstellnig av vissa angivna 1,2,4-friazolderivat |
-
1974
- 1974-12-11 NO NO744468A patent/NO143904C/no unknown
-
1975
- 1975-11-24 ZA ZA757364A patent/ZA757364B/xx unknown
- 1975-11-25 US US05/635,140 patent/US4022905A/en not_active Expired - Lifetime
- 1975-11-28 DE DE19752553520 patent/DE2553520A1/de not_active Withdrawn
- 1975-12-04 CA CA241038A patent/CA1054615A/en not_active Expired
- 1975-12-05 AU AU87317/75A patent/AU497897B2/en not_active Expired
- 1975-12-09 CS CS758362A patent/CS194732B2/cs unknown
- 1975-12-09 CS CS783687A patent/CS194750B2/cs unknown
- 1975-12-09 SU SU752194709A patent/SU701535A3/ru active
- 1975-12-10 HU HU75AA00000836A patent/HU170760B/hu unknown
- 1975-12-10 AT AT936475A patent/AT345823B/de not_active IP Right Cessation
- 1975-12-10 GB GB50664/75A patent/GB1535937A/en not_active Expired
- 1975-12-10 FR FR7537841A patent/FR2293926A2/fr active Granted
- 1975-12-10 DD DD190026A patent/DD126302A5/xx unknown
- 1975-12-10 IE IE2683/75A patent/IE42878B1/en unknown
- 1975-12-10 CH CH1606475A patent/CH603602A5/xx not_active IP Right Cessation
- 1975-12-11 BE BE162643A patent/BE836520A/xx unknown
- 1975-12-11 LU LU73990A patent/LU73990A1/xx unknown
- 1975-12-11 NL NL7514472A patent/NL7514472A/xx not_active Application Discontinuation
- 1975-12-11 JP JP50146948A patent/JPS5182276A/ja active Pending
-
1977
- 1977-01-20 SU SU772444404A patent/SU651697A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| NO143904B (no) | 1981-01-26 |
| AU497897B2 (en) | 1979-01-18 |
| AU8731775A (en) | 1977-06-09 |
| GB1535937A (en) | 1978-12-13 |
| JPS5182276A (cg-RX-API-DMAC7.html) | 1976-07-19 |
| DD126302A5 (de) | 1977-07-06 |
| CS194732B2 (en) | 1979-12-31 |
| ATA936475A (de) | 1978-02-15 |
| FR2293926A2 (fr) | 1976-07-09 |
| BE836520A (fr) | 1976-06-11 |
| SU651697A3 (ru) | 1979-03-05 |
| IE42878B1 (en) | 1980-11-05 |
| CA1054615A (en) | 1979-05-15 |
| DE2553520A1 (de) | 1976-06-16 |
| FR2293926B2 (cg-RX-API-DMAC7.html) | 1979-04-06 |
| CS194750B2 (en) | 1979-12-31 |
| US4022905A (en) | 1977-05-10 |
| NL7514472A (nl) | 1976-06-15 |
| HU170760B (hu) | 1977-09-28 |
| NO143904C (no) | 1981-05-06 |
| LU73990A1 (cg-RX-API-DMAC7.html) | 1976-11-11 |
| CH603602A5 (cg-RX-API-DMAC7.html) | 1978-08-31 |
| NO744468L (cg-RX-API-DMAC7.html) | 1976-06-14 |
| AT345823B (de) | 1978-10-10 |
| IE42878L (en) | 1976-06-11 |
| ZA757364B (en) | 1976-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU955857A3 (ru) | Способ получени меркаптоациламинокислот или их солей | |
| US3810906A (en) | N1-heteroacylated phenylhydrazines | |
| GB1563842A (en) | Phenyl-acetic acids and derivatives thereof | |
| SU701535A3 (ru) | Способ получени производных 1,2,4-триазола или их солей | |
| US3285928A (en) | Mercury derivatives of propyl-hydantoins | |
| Heymann et al. | Derivatives of p, p'-Diaminodiphenyl Sulfone1a | |
| US3365447A (en) | 2, 5-dihydro-4-hydroxy-2-oxothiophens | |
| SU492076A3 (ru) | Способ получени замещенных гуанидина | |
| US4076745A (en) | Process for calcium salts α-ketocarboxylic acids | |
| US2524802A (en) | Hydroxybenzenesulfonamidopyridazines and preparation of same | |
| US3974169A (en) | α-[2-(2-Pyridyl)ethylamino]phenylacetic acid dihydrochloride Hemihydrate | |
| Abshire et al. | Synthesis of α-alkyl-substituted amino acids and derivatives | |
| NO133230B (cg-RX-API-DMAC7.html) | ||
| SU1053755A3 (ru) | Способ получени производных эрголинов или их солей | |
| US2868804A (en) | Betaine ascorbate | |
| US3997547A (en) | Phenylimino-2H-quinolizines | |
| GB1580483A (en) | Sulphoalkyl-1,3,4-oxadiazolyl-2-thiols | |
| US3197477A (en) | Allylhydantoins | |
| US3755314A (en) | Novel 2-acryloyl benzimidazoles, their process of preparation and their therapeutic application | |
| US4188489A (en) | Process for the production of 3-substituted amino-5-pyrazolones | |
| GODAR et al. | Synthesis of Some Substituted Pyridines1 | |
| US3576800A (en) | 1-acyl-3-indolyl aliphatic acid derivatives and their method of preparation | |
| RENN et al. | Cyanoethylation of the 5-Aminotetrazoles1 | |
| US2524799A (en) | Hydroxybenzenesulfonamidoimidazoles and preparation of the same | |
| US2770653A (en) | Diaralkylalkylenediamine preparation |