SU668606A3 - Способ получени пенициллинов или их солей - Google Patents
Способ получени пенициллинов или их солейInfo
- Publication number
- SU668606A3 SU668606A3 SU742026174A SU2026174A SU668606A3 SU 668606 A3 SU668606 A3 SU 668606A3 SU 742026174 A SU742026174 A SU 742026174A SU 2026174 A SU2026174 A SU 2026174A SU 668606 A3 SU668606 A3 SU 668606A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- phenyl
- yield
- prepared
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 100
- 150000003839 salts Chemical class 0.000 title claims description 17
- -1 1,4-cyclohexadienyl Chemical group 0.000 claims description 42
- 239000002253 acid Substances 0.000 claims description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 229930182555 Penicillin Natural products 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 230000010933 acylation Effects 0.000 claims description 5
- 238000005917 acylation reaction Methods 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 150000002960 penicillins Chemical class 0.000 claims description 3
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 claims description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 2
- 238000006136 alcoholysis reaction Methods 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 2
- 102100035475 Blood vessel epicardial substance Human genes 0.000 claims 1
- 101001094636 Homo sapiens Blood vessel epicardial substance Proteins 0.000 claims 1
- 101000608194 Homo sapiens Pyrin domain-containing protein 1 Proteins 0.000 claims 1
- 101000595404 Homo sapiens Ribonucleases P/MRP protein subunit POP1 Proteins 0.000 claims 1
- 150000008065 acid anhydrides Chemical class 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 238000004458 analytical method Methods 0.000 description 38
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 35
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 20
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 13
- 229960000723 ampicillin Drugs 0.000 description 13
- 239000011734 sodium Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 9
- 229960003022 amoxicillin Drugs 0.000 description 9
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- 125000003368 amide group Chemical group 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 150000004684 trihydrates Chemical class 0.000 description 6
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 5
- 229940049954 penicillin Drugs 0.000 description 5
- 229910000077 silane Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 229960004452 methionine Drugs 0.000 description 3
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 3
- 229940049953 phenylacetate Drugs 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- JSJWCHRYRHKBBW-UHFFFAOYSA-N N-carbamoyl-beta-alanine Chemical compound NC(=O)NCCC(O)=O JSJWCHRYRHKBBW-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- LXDLMOSEPGRTDA-GSVOUGTGSA-N (2r)-5-amino-2-(carbamoylamino)-5-oxopentanoic acid Chemical compound NC(=O)CC[C@H](C(O)=O)NC(N)=O LXDLMOSEPGRTDA-GSVOUGTGSA-N 0.000 description 1
- KBDLTYNZHQRMQC-UHFFFAOYSA-N 2-(4-methoxyphenyl)propanoic acid Chemical compound COC1=CC=C(C(C)C(O)=O)C=C1 KBDLTYNZHQRMQC-UHFFFAOYSA-N 0.000 description 1
- LUSWEUMSEVLFEQ-UHFFFAOYSA-N 2-(carbamoylamino)propanoic acid Chemical compound OC(=O)C(C)NC(N)=O LUSWEUMSEVLFEQ-UHFFFAOYSA-N 0.000 description 1
- JKMWMFKENFGKDJ-UHFFFAOYSA-N 2-(propan-2-ylcarbamoylamino)propanoic acid Chemical compound CC(C)NC(=O)NC(C)C(O)=O JKMWMFKENFGKDJ-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- GGZZISOUXJHYOY-UHFFFAOYSA-N 8-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical class C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1O GGZZISOUXJHYOY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical class C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- FFEARJCKVFRZRR-UHFFFAOYSA-N L-Methionine Natural products CSCCC(N)C(O)=O FFEARJCKVFRZRR-UHFFFAOYSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- 229930195722 L-methionine Natural products 0.000 description 1
- 229930186657 Lat Natural products 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- PYUSHNKNPOHWEZ-UHFFFAOYSA-N N-Formyl-DL-methionine Chemical compound CSCCC(C(O)=O)NC=O PYUSHNKNPOHWEZ-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical class CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000008753 Papaver somniferum Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 101100091149 Rattus norvegicus Rnf39 gene Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N anhydrous guanidine Natural products NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001354 dialkyl silanes Chemical class 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- 125000004990 dihydroxyalkyl group Chemical group 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- MHYCRLGKOZWVEF-UHFFFAOYSA-N ethyl acetate;hydrate Chemical compound O.CCOC(C)=O MHYCRLGKOZWVEF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- MHIGBKBJSQVXNH-IWVLMIASSA-N methacycline Chemical compound C=C([C@H]1[C@@H]2O)C3=CC=CC(O)=C3C(=O)C1=C(O)[C@@]1(O)[C@@H]2[C@H](N(C)C)C(O)=C(C(N)=O)C1=O MHIGBKBJSQVXNH-IWVLMIASSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PYUSHNKNPOHWEZ-RXMQYKEDSA-N n-formyl-l-methionine Chemical compound CSCC[C@H](C(O)=O)NC=O PYUSHNKNPOHWEZ-RXMQYKEDSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229950010879 phenamine Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- IFGCUJZIWBUILZ-UHFFFAOYSA-N sodium 2-[[2-[[hydroxy-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphosphoryl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid Chemical compound [Na+].C=1NC2=CC=CC=C2C=1CC(C(O)=O)NC(=O)C(CC(C)C)NP(O)(=O)OC1OC(C)C(O)C(O)C1O IFGCUJZIWBUILZ-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 229960004799 tryptophan Drugs 0.000 description 1
- 229960004441 tyrosine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oncology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB21203/73A GB1479267A (en) | 1973-05-04 | 1973-05-04 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU668606A3 true SU668606A3 (ru) | 1979-06-15 |
Family
ID=10158924
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU742026174A SU668606A3 (ru) | 1973-05-04 | 1974-04-30 | Способ получени пенициллинов или их солей |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3923788A (enExample) |
| JP (1) | JPS5756479B2 (enExample) |
| AR (1) | AR201768A1 (enExample) |
| AT (1) | AT330957B (enExample) |
| BE (1) | BE814559A (enExample) |
| BR (1) | BR7403455D0 (enExample) |
| CH (1) | CH603663A5 (enExample) |
| CS (1) | CS197231B2 (enExample) |
| DD (1) | DD111579A5 (enExample) |
| DE (1) | DE2421030A1 (enExample) |
| ES (1) | ES425945A1 (enExample) |
| FI (1) | FI58778C (enExample) |
| FR (1) | FR2227858B1 (enExample) |
| GB (1) | GB1479267A (enExample) |
| HU (1) | HU169830B (enExample) |
| IE (1) | IE40013B1 (enExample) |
| IL (2) | IL44728A (enExample) |
| MW (1) | MW1874A1 (enExample) |
| NL (1) | NL7406024A (enExample) |
| PH (1) | PH12910A (enExample) |
| RO (1) | RO67060A (enExample) |
| SE (1) | SE7703567L (enExample) |
| SU (1) | SU668606A3 (enExample) |
| YU (1) | YU122174A (enExample) |
| ZA (1) | ZA742788B (enExample) |
| ZM (1) | ZM7274A1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1503918A (en) * | 1974-06-18 | 1978-03-15 | Beecham Group Ltd | Penicillins |
| ES448679A1 (es) * | 1975-07-31 | 1977-11-16 | Kim Young Sul | Un procedimiento para la produccion de lisinato de metampi- cilina. |
| US4053609A (en) * | 1975-09-12 | 1977-10-11 | Tanabe Seiyaku Co., Ltd. | Penicillins and processes for preparing the same |
| TR201922977A2 (tr) * | 2019-12-31 | 2021-07-26 | T C Erciyes Ueniversitesi | Penisilin türevleri ve bunların sentezlenmesi için yöntem |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR6705A (enExample) * | 1958-02-06 | |||
| US3340252A (en) * | 1964-04-07 | 1967-09-05 | American Home Prod | Amino-acylamino-acylamino-penicillanic acids |
| GB1180745A (en) * | 1966-10-04 | 1970-02-11 | Beecham Group Ltd | Penicillins |
| US3483188A (en) * | 1968-06-13 | 1969-12-09 | Bristol Myers Co | 6-(alpha - 3 - allophanamidophenylacetamido) and 6 - (alpha - 3 - allophanamidothienylacetamido)-penicillanic acids |
-
1973
- 1973-05-04 IL IL44728A patent/IL44728A/en unknown
- 1973-05-04 GB GB21203/73A patent/GB1479267A/en not_active Expired
-
1974
- 1974-04-24 FI FI1265/74A patent/FI58778C/fi active
- 1974-04-26 BR BR3455/74A patent/BR7403455D0/pt unknown
- 1974-04-29 IL IL44728A patent/IL44728A0/xx unknown
- 1974-04-29 IE IE901/74A patent/IE40013B1/xx unknown
- 1974-04-30 SU SU742026174A patent/SU668606A3/ru active
- 1974-04-30 YU YU01221/74A patent/YU122174A/xx unknown
- 1974-04-30 DE DE2421030A patent/DE2421030A1/de not_active Ceased
- 1974-05-02 AT AT364374A patent/AT330957B/de not_active IP Right Cessation
- 1974-05-02 FR FR7415192A patent/FR2227858B1/fr not_active Expired
- 1974-05-02 ZA ZA00742788A patent/ZA742788B/xx unknown
- 1974-05-03 NL NL7406024A patent/NL7406024A/xx not_active Application Discontinuation
- 1974-05-03 CH CH605774A patent/CH603663A5/xx not_active IP Right Cessation
- 1974-05-03 CS CS743212A patent/CS197231B2/cs unknown
- 1974-05-03 MW MW18/74*UA patent/MW1874A1/xx unknown
- 1974-05-03 BE BE143931A patent/BE814559A/xx unknown
- 1974-05-03 PH PH15807A patent/PH12910A/en unknown
- 1974-05-03 ES ES425945A patent/ES425945A1/es not_active Expired
- 1974-05-03 RO RO7478669A patent/RO67060A/ro unknown
- 1974-05-03 US US466814A patent/US3923788A/en not_active Expired - Lifetime
- 1974-05-03 HU HUBE1197A patent/HU169830B/hu unknown
- 1974-05-03 ZM ZM72/74A patent/ZM7274A1/xx unknown
- 1974-05-04 JP JP49050193A patent/JPS5756479B2/ja not_active Expired
- 1974-05-06 DD DD178296A patent/DD111579A5/xx unknown
- 1974-05-06 AR AR253608A patent/AR201768A1/es active
-
1977
- 1977-03-28 SE SE7703567A patent/SE7703567L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL44728A0 (en) | 1974-06-30 |
| SE7703567L (sv) | 1977-03-28 |
| AR201768A1 (es) | 1975-04-15 |
| JPS5040589A (enExample) | 1975-04-14 |
| HU169830B (enExample) | 1977-02-28 |
| PH12910A (en) | 1979-10-04 |
| US3923788A (en) | 1975-12-02 |
| NL7406024A (enExample) | 1974-11-06 |
| ZA742788B (en) | 1975-05-28 |
| DE2421030A1 (de) | 1974-11-21 |
| AT330957B (de) | 1976-07-26 |
| GB1479267A (en) | 1977-07-13 |
| BE814559A (fr) | 1974-11-04 |
| JPS5756479B2 (enExample) | 1982-11-30 |
| BR7403455D0 (pt) | 1974-12-31 |
| FI58778B (fi) | 1980-12-31 |
| IL44728A (en) | 1977-08-31 |
| RO67060A (ro) | 1982-10-26 |
| AU6853474A (en) | 1975-11-06 |
| FR2227858B1 (enExample) | 1977-11-04 |
| FR2227858A1 (enExample) | 1974-11-29 |
| IE40013B1 (en) | 1979-02-28 |
| ES425945A1 (es) | 1976-12-16 |
| ATA364374A (de) | 1975-10-15 |
| ZM7274A1 (en) | 1976-11-22 |
| YU122174A (en) | 1982-05-31 |
| CS197231B2 (en) | 1980-04-30 |
| MW1874A1 (en) | 1975-05-13 |
| DD111579A5 (enExample) | 1975-02-20 |
| FI58778C (fi) | 1981-04-10 |
| IE40013L (en) | 1974-11-04 |
| CH603663A5 (enExample) | 1978-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU668606A3 (ru) | Способ получени пенициллинов или их солей | |
| JPS6139313B2 (enExample) | ||
| IE43123B1 (en) | Tetrazolethiomethyl cephalosporin compounds | |
| CA1069886A (en) | Removal of carboxy-protecting groups | |
| FR2511375A1 (fr) | Nouveaux derives de la cephalosporine, leur preparation et les medicaments qui les contiennent | |
| US4171303A (en) | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives | |
| US4304717A (en) | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives | |
| JP2003521476A (ja) | チオール誘導体、メタロ−β−ラクタマーゼ阻害剤 | |
| US4182863A (en) | 7-Amino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid | |
| US4113943A (en) | 7β-[(2-Amino-1,2-dioxoethyl)amino]acyl cephalosporins | |
| US4026886A (en) | 7-Acyl-7-arylthiocephalosporins | |
| JPH0645628B2 (ja) | β−ラクタム化合物及びその塩、その製造方法及び薬剤 | |
| US4029669A (en) | 6-Benzalimino-6-arylthio penicillanic acids and derivatives thereof | |
| US3994877A (en) | 6-[α-AMINO-ω-(3,4-METHYLENEDIOXYPHENYL)ACYLAMIDO]PENICILLANIC ACID DERIVATIVES | |
| US4178444A (en) | Hydrazono derivatives of cephalosporins | |
| FR2551441A1 (fr) | Derives de aminomethyl-2-penem, leur procede de preparation et les preparations pharmaceutiques | |
| US3994954A (en) | Process for preparing substituted glycines | |
| US3987032A (en) | Penicillins | |
| US3935189A (en) | Penicillins | |
| US3780088A (en) | Alpha-ureidocyclohexadienylalkylene carboxylic acids | |
| US3668198A (en) | {60 -ureido-2,4,6-cycloheptatrienylmethylpenicillins | |
| US3720665A (en) | Acyloxymethyl esters of alpha-preidocyclo-hexadienylalkylene-penicillins | |
| HU183061B (en) | Process for preparing penam-3-carboxylic acid derivatives with antibacterial activity and pharmaceutical compositions containing such compounds | |
| GB1309375A (en) | Phosphono substituted acylpenicillins | |
| NZ203065A (en) | Penicillin derivatives and pharmaceutical compositions;intermediates |