SU663261A3 - Способ борьбы с нежелательными растени ми - Google Patents
Способ борьбы с нежелательными растени миInfo
- Publication number
- SU663261A3 SU663261A3 SU742039333A SU2039333A SU663261A3 SU 663261 A3 SU663261 A3 SU 663261A3 SU 742039333 A SU742039333 A SU 742039333A SU 2039333 A SU2039333 A SU 2039333A SU 663261 A3 SU663261 A3 SU 663261A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- undesirable plants
- fighting
- fighting undesirable
- plants
- herbicides
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 5
- 239000013543 active substance Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- -1 chalk Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732333477 DE2333477A1 (de) | 1973-06-30 | 1973-06-30 | Schwefligsaeureester aliphatischer glykolsaeureamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU663261A3 true SU663261A3 (ru) | 1979-05-15 |
Family
ID=5885652
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU742039333A SU663261A3 (ru) | 1973-06-30 | 1974-06-27 | Способ борьбы с нежелательными растени ми |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3935190A (enExample) |
| JP (1) | JPS5036633A (enExample) |
| AR (1) | AR214163A1 (enExample) |
| AT (1) | AT335790B (enExample) |
| BE (1) | BE817010A (enExample) |
| BG (1) | BG21582A3 (enExample) |
| BR (1) | BR7405344D0 (enExample) |
| CA (1) | CA1027948A (enExample) |
| CH (1) | CH584507A5 (enExample) |
| CS (1) | CS183743B2 (enExample) |
| DD (1) | DD112207A1 (enExample) |
| DE (1) | DE2333477A1 (enExample) |
| DK (1) | DK348774A (enExample) |
| FR (1) | FR2235124B1 (enExample) |
| GB (1) | GB1465113A (enExample) |
| HU (1) | HU167996B (enExample) |
| IL (1) | IL45059A (enExample) |
| IT (1) | IT1047138B (enExample) |
| NL (1) | NL7408544A (enExample) |
| PL (1) | PL88543B1 (enExample) |
| SE (1) | SE7407831L (enExample) |
| SU (1) | SU663261A3 (enExample) |
| YU (1) | YU170974A (enExample) |
| ZA (1) | ZA744041B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2457688A1 (de) * | 1974-12-06 | 1976-06-10 | Basf Ag | Carbaminsaeurethiolester |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3775458A (en) * | 1967-11-01 | 1973-11-27 | Uniroyal Inc | Substituted phenylethyl sulfites |
| US3798254A (en) * | 1971-09-20 | 1974-03-19 | Monsanto Co | Substituted s-dichloromethyl organothiosulfonates and their manufacture |
-
1973
- 1973-06-30 DE DE19732333477 patent/DE2333477A1/de active Pending
-
1974
- 1974-06-13 BG BG026957A patent/BG21582A3/xx unknown
- 1974-06-13 SE SE7407831A patent/SE7407831L/xx unknown
- 1974-06-18 IL IL45059A patent/IL45059A/en unknown
- 1974-06-18 JP JP49068799A patent/JPS5036633A/ja active Pending
- 1974-06-18 YU YU01709/74A patent/YU170974A/xx unknown
- 1974-06-20 US US05/481,216 patent/US3935190A/en not_active Expired - Lifetime
- 1974-06-24 ZA ZA00744041A patent/ZA744041B/xx unknown
- 1974-06-25 AR AR254385A patent/AR214163A1/es active
- 1974-06-25 NL NL7408544A patent/NL7408544A/xx not_active Application Discontinuation
- 1974-06-26 CA CA203,504A patent/CA1027948A/en not_active Expired
- 1974-06-26 IT IT51751/74A patent/IT1047138B/it active
- 1974-06-26 CS CS7400004515A patent/CS183743B2/cs unknown
- 1974-06-27 CH CH886774A patent/CH584507A5/xx not_active IP Right Cessation
- 1974-06-27 SU SU742039333A patent/SU663261A3/ru active
- 1974-06-28 DD DD179582A patent/DD112207A1/xx unknown
- 1974-06-28 DK DK348774A patent/DK348774A/da unknown
- 1974-06-28 BE BE146008A patent/BE817010A/xx unknown
- 1974-06-28 BR BR5344/74A patent/BR7405344D0/pt unknown
- 1974-06-28 FR FR7422694A patent/FR2235124B1/fr not_active Expired
- 1974-06-28 AT AT536974A patent/AT335790B/de not_active IP Right Cessation
- 1974-06-28 HU HUBA3099A patent/HU167996B/hu unknown
- 1974-06-28 PL PL1974172257A patent/PL88543B1/pl unknown
- 1974-06-28 GB GB2875574A patent/GB1465113A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1027948A (en) | 1978-03-14 |
| IL45059A (en) | 1977-03-31 |
| ZA744041B (en) | 1975-07-30 |
| BR7405344D0 (pt) | 1975-01-07 |
| BE817010A (fr) | 1974-12-30 |
| IT1047138B (it) | 1980-09-10 |
| FR2235124A1 (enExample) | 1975-01-24 |
| AR214163A1 (es) | 1979-05-15 |
| NL7408544A (nl) | 1975-01-02 |
| PL88543B1 (enExample) | 1976-09-30 |
| GB1465113A (en) | 1977-02-23 |
| DE2333477A1 (de) | 1975-01-23 |
| AT335790B (de) | 1977-03-25 |
| JPS5036633A (enExample) | 1975-04-05 |
| FR2235124B1 (enExample) | 1978-01-13 |
| CS183743B2 (en) | 1978-07-31 |
| AU7025474A (en) | 1976-01-08 |
| CH584507A5 (enExample) | 1977-02-15 |
| HU167996B (enExample) | 1976-02-28 |
| SE7407831L (enExample) | 1975-01-02 |
| US3935190A (en) | 1976-01-27 |
| IL45059A0 (en) | 1974-09-10 |
| DK348774A (enExample) | 1975-03-17 |
| YU170974A (en) | 1982-02-28 |
| DD112207A1 (enExample) | 1975-04-05 |
| ATA536974A (de) | 1976-07-15 |
| BG21582A3 (bg) | 1976-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3133810A (en) | Herbicidal compositions | |
| PL100036B1 (pl) | Srodek chwastobojczy | |
| SU526274A3 (ru) | Способ борьбы с сорной растительностью | |
| BG63239B1 (bg) | Синергитичен хербициден състав и метод за приложението му | |
| SU686593A3 (ru) | Способ борьбы с нежелательным ростом растений | |
| SU472487A3 (ru) | Фунгицидное средство | |
| SU663261A3 (ru) | Способ борьбы с нежелательными растени ми | |
| JPS6069001A (ja) | 殺線虫・殺虫組成物 | |
| SU579847A3 (ru) | Гербицидное средство | |
| SU577931A3 (ru) | Гербицидный состав | |
| US3719465A (en) | Composition and method for controlling undesirable plant growth | |
| US3312542A (en) | Enhancing growth rate of plants with polyalkoxylated derivatives of ricinoleic acid triglycerides | |
| SU577933A3 (ru) | Гербицидное средство | |
| SU587836A3 (ru) | Гербицидна композици | |
| US3925555A (en) | Method of controlling mites using chloromethanesulfonamide | |
| SU503483A3 (ru) | Гербицидна смесь | |
| US2217207A (en) | Fungicidal preparation | |
| US2415020A (en) | Insecticidal compositions | |
| SU589884A3 (ru) | Гербицидный состав | |
| KR100350329B1 (ko) | 선택된 제초제조성물 | |
| SU1149858A3 (ru) | Гербицидное средство | |
| RU2002109177A (ru) | Способ регулирования роста и развития зерновых культур | |
| US3346362A (en) | Method for controlling weeds | |
| SU860675A3 (ru) | Гербицидный состав | |
| SU805935A3 (ru) | Гербицидный состав |