SU559614A3 - Способ борьбы с водоросл ми и/или водными сорн ками - Google Patents
Способ борьбы с водоросл ми и/или водными сорн камиInfo
- Publication number
- SU559614A3 SU559614A3 SU2110614A SU2110614A SU559614A3 SU 559614 A3 SU559614 A3 SU 559614A3 SU 2110614 A SU2110614 A SU 2110614A SU 2110614 A SU2110614 A SU 2110614A SU 559614 A3 SU559614 A3 SU 559614A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- copper
- way
- water
- water weeds
- algae
- Prior art date
Links
- 241000195493 Cryptophyta Species 0.000 title description 3
- 241001113556 Elodea Species 0.000 title description 3
- 239000010949 copper Substances 0.000 description 14
- 229910052802 copper Inorganic materials 0.000 description 13
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 6
- -1 salt compounds Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000005749 Copper compound Substances 0.000 description 3
- 150000001880 copper compounds Chemical class 0.000 description 3
- 229910000365 copper sulfate Inorganic materials 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- CYKLGTUKGYURDP-UHFFFAOYSA-L copper;hydrogen sulfate;hydroxide Chemical compound O.[Cu+2].[O-]S([O-])(=O)=O CYKLGTUKGYURDP-UHFFFAOYSA-L 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000272184 Falconiformes Species 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 230000002353 algacidal effect Effects 0.000 description 1
- 239000003619 algicide Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 101150034227 xyl1 gene Proteins 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44349374A | 1974-02-19 | 1974-02-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU559614A3 true SU559614A3 (ru) | 1977-05-25 |
Family
ID=23761000
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2110614A SU559614A3 (ru) | 1974-02-19 | 1975-02-18 | Способ борьбы с водоросл ми и/или водными сорн ками |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS50117921A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7500983A (cg-RX-API-DMAC7.html) |
| CH (1) | CH604509A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2506431A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2260950B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1491137A (cg-RX-API-DMAC7.html) |
| HU (2) | HU176873B (cg-RX-API-DMAC7.html) |
| IN (1) | IN144623B (cg-RX-API-DMAC7.html) |
| IT (1) | IT1054605B (cg-RX-API-DMAC7.html) |
| KE (1) | KE3119A (cg-RX-API-DMAC7.html) |
| MX (1) | MX3820E (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ176684A (cg-RX-API-DMAC7.html) |
| SU (1) | SU559614A3 (cg-RX-API-DMAC7.html) |
| TR (1) | TR19082A (cg-RX-API-DMAC7.html) |
| YU (1) | YU38475A (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA751041B (cg-RX-API-DMAC7.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4098602A (en) * | 1976-06-28 | 1978-07-04 | Applied Biochemists, Inc. | Algaecidal composition |
| US4324578A (en) * | 1977-09-15 | 1982-04-13 | Applied Biochemists, Inc. | Method of preparing a copper complex for use as an algaecide |
| SE459164B (sv) * | 1981-05-08 | 1989-06-12 | Kenogard Ab | Traeskyddsmedel baserade paa konserverande metaller och organiska kvaeveinnehaallande foereningar samt anvaendning av medlet |
| US5426121A (en) * | 1994-10-04 | 1995-06-20 | Akzo Nobel N.V. | Wood preservation formulation comprising complex of a copper cation and alkoxylated diamine |
| ATE302551T1 (de) * | 2002-03-08 | 2005-09-15 | Bms Micro Nutrients N V | Pflanzenschutzmittelformulierung enthaltend ein kupfer-polyamin chelat |
-
1975
- 1975-02-07 CH CH154675A patent/CH604509A5/xx not_active IP Right Cessation
- 1975-02-15 DE DE19752506431 patent/DE2506431A1/de not_active Withdrawn
- 1975-02-17 MX MX465675U patent/MX3820E/es unknown
- 1975-02-17 GB GB656775A patent/GB1491137A/en not_active Expired
- 1975-02-17 FR FR7504884A patent/FR2260950B1/fr not_active Expired
- 1975-02-17 NZ NZ17668475A patent/NZ176684A/xx unknown
- 1975-02-18 BR BR7500983A patent/BR7500983A/pt unknown
- 1975-02-18 HU HUSA003049 patent/HU176873B/hu unknown
- 1975-02-18 HU HU75SA00002750A patent/HU170893B/hu unknown
- 1975-02-18 JP JP50020812A patent/JPS50117921A/ja active Pending
- 1975-02-18 IT IT2037875A patent/IT1054605B/it active
- 1975-02-18 SU SU2110614A patent/SU559614A3/ru active
- 1975-02-18 TR TR1908275A patent/TR19082A/xx unknown
- 1975-02-18 YU YU38475A patent/YU38475A/xx unknown
- 1975-02-19 ZA ZA00751041A patent/ZA751041B/xx unknown
-
1976
- 1976-02-16 IN IN277/CAL/1976A patent/IN144623B/en unknown
-
1981
- 1981-02-26 KE KE311981A patent/KE3119A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7500983A (pt) | 1975-12-02 |
| IT1054605B (it) | 1981-11-30 |
| NZ176684A (en) | 1978-03-06 |
| HU176873B (en) | 1981-05-28 |
| FR2260950B1 (cg-RX-API-DMAC7.html) | 1979-01-05 |
| HU170893B (hu) | 1977-09-28 |
| MX3820E (es) | 1981-07-30 |
| GB1491137A (en) | 1977-11-09 |
| DE2506431A1 (de) | 1975-09-18 |
| FR2260950A1 (cg-RX-API-DMAC7.html) | 1975-09-12 |
| YU38475A (en) | 1982-02-28 |
| ZA751041B (en) | 1976-09-29 |
| KE3119A (en) | 1981-04-10 |
| AU7827375A (en) | 1976-08-19 |
| JPS50117921A (cg-RX-API-DMAC7.html) | 1975-09-16 |
| IN144623B (cg-RX-API-DMAC7.html) | 1978-05-20 |
| TR19082A (tr) | 1978-05-01 |
| CH604509A5 (cg-RX-API-DMAC7.html) | 1978-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU656462A3 (ru) | Инсектицидно-овицидное средство | |
| ES2254267T3 (es) | Composiciones impermeabilizantes/conservantes. | |
| US3844760A (en) | Composition for and method of treating water | |
| US4098602A (en) | Algaecidal composition | |
| ES2234251T3 (es) | Composiciones reguladoras del crecimiento de las plantas. | |
| SU559614A3 (ru) | Способ борьбы с водоросл ми и/или водными сорн ками | |
| RU2000127705A (ru) | Композиции регуляторов роста растений | |
| US4361435A (en) | Copper and amine based aquatic herbicides | |
| US4505734A (en) | Copper based algaecides and aquatic herbicides | |
| PL244948B1 (pl) | Ciecze jonowe z kationem alkilo-1,ω-bis(tributylo(karboksymetylo) amoniowym) oraz anionami L-proliny lub L-histydyny, sposób ich otrzymywania i zastosowanie jako środki do czyszczenia przemysłowego | |
| CA2008732A1 (en) | Biocidal compositions and treatments | |
| US3690857A (en) | Method of controlling aquatic weeds,and other undesired forms of aquatic life,without adversely affecting fish | |
| DK155657B (da) | Fremgangsmaade til behandling af vand, isaer akvarievand, samt kationbytter og beholder til anvendelse ved fremgangsmaaden | |
| US3807983A (en) | Quaternary ammonium aquatic herbicides | |
| JPH054978A (ja) | 新規包接化合物及びその製造法 | |
| US3948632A (en) | Control of algae, aquatic plants, and the like | |
| US2657178A (en) | Treatment of industrial waters | |
| SU1303013A3 (ru) | Способ борьбы с нежелательной растительностью | |
| CA1129878A (en) | Copper (ii) alkanolamine complexes useful as algacides and herbicides | |
| EP0217961A1 (en) | Miticide | |
| JPH0434987B2 (cg-RX-API-DMAC7.html) | ||
| EP0293152A2 (en) | Method of treating ecologically sensitive water systems | |
| Alcantar et al. | Ammonia removal in freshwater and saltwater systems | |
| CA1060672A (en) | Control of algae, aquatic plants, and the like | |
| KR790001603B1 (ko) | 살조류 조성물의 제조방법 |