SU512704A3 - Способ получени замещенных в 5-ом положении 5,10-дигидро-11 н-дибензо (в,е) (1,4)диазепин-11-онов - Google Patents
Способ получени замещенных в 5-ом положении 5,10-дигидро-11 н-дибензо (в,е) (1,4)диазепин-11-оновInfo
- Publication number
- SU512704A3 SU512704A3 SU1357008A SU1357008A SU512704A3 SU 512704 A3 SU512704 A3 SU 512704A3 SU 1357008 A SU1357008 A SU 1357008A SU 1357008 A SU1357008 A SU 1357008A SU 512704 A3 SU512704 A3 SU 512704A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dibenzo
- diazepin
- dihydro
- calculated
- acetyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 59
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 33
- 238000000354 decomposition reaction Methods 0.000 claims description 28
- -1 4-methoxypiperidino Chemical group 0.000 claims description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- 238000001953 recrystallisation Methods 0.000 claims description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 238000010992 reflux Methods 0.000 claims description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 239000000155 melt Substances 0.000 claims description 12
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 10
- 239000000706 filtrate Substances 0.000 claims description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 7
- 238000002844 melting Methods 0.000 claims description 6
- 230000008018 melting Effects 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 239000002026 chloroform extract Substances 0.000 claims description 5
- 235000019439 ethyl acetate Nutrition 0.000 claims description 5
- 238000001704 evaporation Methods 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- ONOBXDPYDHTSBQ-UHFFFAOYSA-N 2,3,4,7-tetrahydro-1h-diazepine Chemical compound C1CC=CCNN1 ONOBXDPYDHTSBQ-UHFFFAOYSA-N 0.000 claims description 4
- NNWUEBIEOFQMSS-UHFFFAOYSA-N 2-Methylpiperidine Chemical compound CC1CCCCN1 NNWUEBIEOFQMSS-UHFFFAOYSA-N 0.000 claims description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 230000008020 evaporation Effects 0.000 claims description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 4
- 235000011152 sodium sulphate Nutrition 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000001530 fumaric acid Substances 0.000 claims description 2
- 239000002244 precipitate Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- 239000012047 saturated solution Substances 0.000 claims description 2
- 239000000741 silica gel Substances 0.000 claims description 2
- 229910002027 silica gel Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 5
- QBBKKFZGCDJDQK-UHFFFAOYSA-N 2-ethylpiperidine Chemical compound CCC1CCCCN1 QBBKKFZGCDJDQK-UHFFFAOYSA-N 0.000 claims 4
- 125000000217 alkyl group Chemical group 0.000 claims 4
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 239000000284 extract Substances 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 238000010438 heat treatment Methods 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- SDGKUVSVPIIUCF-UHFFFAOYSA-N 2,6-dimethylpiperidine Chemical compound CC1CCCC(C)N1 SDGKUVSVPIIUCF-UHFFFAOYSA-N 0.000 claims 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims 1
- ZEYSHALLPAKUHG-UHFFFAOYSA-N 4-methoxypiperidine Chemical compound COC1CCNCC1 ZEYSHALLPAKUHG-UHFFFAOYSA-N 0.000 claims 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 230000003113 alkalizing effect Effects 0.000 claims 1
- XRAVYESZTUBEBU-UHFFFAOYSA-N cyclohexane;propan-2-ol Chemical compound CC(C)O.C1CCCCC1 XRAVYESZTUBEBU-UHFFFAOYSA-N 0.000 claims 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000002950 monocyclic group Chemical group 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- 150000003335 secondary amines Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 12
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- GRVNOUKHAZXMJK-UHFFFAOYSA-N 1-[(2-methylphenyl)methyl]piperazine Chemical compound CC1=CC=CC=C1CN1CCNCC1 GRVNOUKHAZXMJK-UHFFFAOYSA-N 0.000 description 2
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- RVNSAAIWCWTCTJ-ZPQYLTHOSA-N (2s,3s,4r)-2-(1,2-dihydroxyethyl)pyrrolidine-3,4-diol Chemical compound OCC(O)[C@@H]1NC[C@@H](O)[C@H]1O RVNSAAIWCWTCTJ-ZPQYLTHOSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- POXWDTQUDZUOGP-UHFFFAOYSA-N 1h-1,4-diazepine Chemical compound N1C=CC=NC=C1 POXWDTQUDZUOGP-UHFFFAOYSA-N 0.000 description 1
- KDDPNNXAZURUGP-UHFFFAOYSA-N 2-[2-(3,4-dichlorophenyl)-3-[2-(piperidin-3-ylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile Chemical compound ClC=1C=C(C=CC=1Cl)C=1N(C(=CN=1)CC#N)C1=NC(=NC=C1)NC1CNCCC1 KDDPNNXAZURUGP-UHFFFAOYSA-N 0.000 description 1
- JEGMWWXJUXDNJN-UHFFFAOYSA-N 3-methylpiperidine Chemical compound CC1CCCNC1 JEGMWWXJUXDNJN-UHFFFAOYSA-N 0.000 description 1
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- FKCBLVCOSCZFHV-UHFFFAOYSA-N acetonitrile;ethanol Chemical compound CCO.CC#N FKCBLVCOSCZFHV-UHFFFAOYSA-N 0.000 description 1
- XTKDAFGWCDAMPY-UHFFFAOYSA-N azaperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCN(C=2N=CC=CC=2)CC1 XTKDAFGWCDAMPY-UHFFFAOYSA-N 0.000 description 1
- GCGYREODZIZPLJ-UHFFFAOYSA-N azepan-1-ium;chloride Chemical compound Cl.C1CCCNCC1 GCGYREODZIZPLJ-UHFFFAOYSA-N 0.000 description 1
- CIPKKELWTGKUJB-UHFFFAOYSA-N azepane Chemical compound N1CCCCCC1.N1CCCCCC1 CIPKKELWTGKUJB-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- CVLAEJNQNKXNNN-UHFFFAOYSA-N diazepin-4-one Chemical compound O=C1C=CC=NN=C1 CVLAEJNQNKXNNN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- JXYZHMPRERWTPM-UHFFFAOYSA-N hydron;morpholine;chloride Chemical compound Cl.C1COCCN1 JXYZHMPRERWTPM-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/38—[b, e]- or [b, f]-condensed with six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyrane Compounds (AREA)
- Multiple-Way Valves (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681795176 DE1795176C3 (de) | 1968-08-20 | 1968-08-20 | hT-substituierte 5-Aminoacetyl-5,10-dihydro-l lH-dibenzo eckige Klammer auf b,e eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu diazepin-11one und Verfahren zu ihrer Herstellung |
| DE19691931487 DE1931487C3 (de) | 1969-06-20 | 1969-06-20 | In 5-Stellung substituierte 5,10-Dihydro-11H-dibenzo eckige Klammer auf b,e eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu diazepin-11 -one und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU512704A3 true SU512704A3 (ru) | 1976-04-30 |
Family
ID=25756103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1357008A SU512704A3 (ru) | 1968-08-20 | 1969-08-12 | Способ получени замещенных в 5-ом положении 5,10-дигидро-11 н-дибензо (в,е) (1,4)диазепин-11-онов |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3634408A (enExample) |
| AT (1) | AT292709B (enExample) |
| BE (1) | BE737747A (enExample) |
| BG (1) | BG16339A3 (enExample) |
| BR (1) | BR6911744D0 (enExample) |
| CH (1) | CH510685A (enExample) |
| CS (1) | CS163730B2 (enExample) |
| DK (1) | DK135043B (enExample) |
| ES (1) | ES370395A1 (enExample) |
| FI (1) | FI49509C (enExample) |
| FR (1) | FR2016008B1 (enExample) |
| GB (1) | GB1236112A (enExample) |
| IE (1) | IE33270B1 (enExample) |
| IL (1) | IL32854A (enExample) |
| NL (1) | NL143570B (enExample) |
| NO (1) | NO125386B (enExample) |
| PL (1) | PL69663B1 (enExample) |
| RO (1) | RO56187A (enExample) |
| SE (1) | SE367199B (enExample) |
| SU (1) | SU512704A3 (enExample) |
| YU (1) | YU34045B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI50242C (fi) * | 1969-07-18 | 1976-01-12 | Thomae Gmbh Dr K | Menetelmä valmistaa farmakologisesti aktiivisia uusia diallyyliaminoal kanoyylidibenso- tai pyridobenso-diatsepiineja ja niiden happoadditios uoloja. |
| DE2424811C3 (de) * | 1974-05-22 | 1981-08-20 | Dr. Karl Thomae Gmbh, 7950 Biberach | Pyrido-benzodiazepinone, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| IT1130973B (it) * | 1980-03-17 | 1986-06-18 | Microsules Argentina Sa De S C | Processo per la preparazione di derivati di 5,11-di-idro-6h-pirido(2,3-b) (1,4)-benzodiazepin-6-one,derivati finali ed intermedi di sintesi in tal modo ottenuti |
| DE3028001A1 (de) * | 1980-07-24 | 1982-02-18 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue, in 5-stellung substituierte 5,10-dihydro-11h-dibenzo (b,e)(1,4) diazepin-11-one, verfahren zu ihrer herstellung und diese verbindung enthaltende arzneimittel |
| DE3204158A1 (de) * | 1982-02-06 | 1983-08-11 | Dr. Karl Thomae Gmbh, 7950 Biberach | "substituierte dibenzodiazepinone, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel" |
| IT1212742B (it) * | 1983-05-17 | 1989-11-30 | Dompe Farmaceutici Spa | Derivati dibenzo [1,4]diazepinonici pirido [1,4] benzodiazepinonici,pirido [1,5] benzodiazepinonici e loro attivita' farmacologica |
| IT1212743B (it) * | 1983-05-17 | 1989-11-30 | Dompe Farmaceutici Spa | Sali quaternari di derivati di benzo[ 1,4 ]diazepinonici,pirido [1,4]benzodiazepinonici,prido [1,5]benzodiazepinonici e loro atti vita' farmacologica |
| DD236731B3 (de) * | 1983-10-19 | 1992-12-10 | Dresden Arzneimittel | Verfahren zur herstellung von neuen in 5-stellung substituierten 5,10-dihydro-11h-dibenzo|b,e¨|1,4¨diazepin-11-onen |
-
1969
- 1969-07-22 FI FI692162A patent/FI49509C/fi active
- 1969-07-24 RO RO60620A patent/RO56187A/ro unknown
- 1969-07-26 BG BG012747A patent/BG16339A3/bg unknown
- 1969-08-07 US US848356A patent/US3634408A/en not_active Expired - Lifetime
- 1969-08-11 ES ES370395A patent/ES370395A1/es not_active Expired
- 1969-08-12 SU SU1357008A patent/SU512704A3/ru active
- 1969-08-13 CH CH1231169A patent/CH510685A/de not_active IP Right Cessation
- 1969-08-13 IE IE1144/69A patent/IE33270B1/xx unknown
- 1969-08-15 YU YU2098/69A patent/YU34045B/xx unknown
- 1969-08-19 AT AT795969A patent/AT292709B/de not_active IP Right Cessation
- 1969-08-19 IL IL32854A patent/IL32854A/xx unknown
- 1969-08-19 PL PL1969135429A patent/PL69663B1/pl unknown
- 1969-08-19 DK DK443169AA patent/DK135043B/da not_active IP Right Cessation
- 1969-08-19 NO NO3363/69A patent/NO125386B/no unknown
- 1969-08-20 CS CS5774A patent/CS163730B2/cs unknown
- 1969-08-20 NL NL696912653A patent/NL143570B/xx unknown
- 1969-08-20 GB GB41598/69A patent/GB1236112A/en not_active Expired
- 1969-08-20 FR FR6928589A patent/FR2016008B1/fr not_active Expired
- 1969-08-20 BE BE737747D patent/BE737747A/xx unknown
- 1969-08-20 SE SE11570/69A patent/SE367199B/xx unknown
- 1969-08-20 BR BR211744/69A patent/BR6911744D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL32854A (en) | 1972-10-29 |
| IL32854A0 (en) | 1969-11-12 |
| PL69663B1 (enExample) | 1973-08-31 |
| FR2016008A1 (enExample) | 1970-04-30 |
| NL6912653A (enExample) | 1970-02-24 |
| BR6911744D0 (pt) | 1973-01-18 |
| DK135043B (da) | 1977-02-28 |
| FR2016008B1 (enExample) | 1973-12-21 |
| CS163730B2 (enExample) | 1975-11-07 |
| FI49509C (fi) | 1975-07-10 |
| BE737747A (enExample) | 1970-02-20 |
| RO56187A (enExample) | 1975-06-15 |
| BG16339A3 (bg) | 1972-08-20 |
| US3634408A (en) | 1972-01-11 |
| NO125386B (enExample) | 1972-09-04 |
| IE33270B1 (en) | 1974-05-01 |
| YU209869A (en) | 1978-05-15 |
| DK135043C (enExample) | 1977-08-22 |
| AT292709B (de) | 1971-09-10 |
| SE367199B (enExample) | 1974-05-20 |
| ES370395A1 (es) | 1971-04-16 |
| IE33270L (en) | 1970-02-20 |
| FI49509B (enExample) | 1975-04-01 |
| GB1236112A (en) | 1971-06-23 |
| CH510685A (de) | 1971-07-31 |
| YU34045B (en) | 1978-10-31 |
| NL143570B (nl) | 1974-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2985657A (en) | 1-(aroylalkyl)-4-heterocyclylpiperazines | |
| US3682930A (en) | 4(1-alkyl-4-piperidylidine)-4h-benzo {84,5{9 {0 cyclohepta {8 1,2{14 6{9 | |
| NO122814B (enExample) | ||
| NO120935B (enExample) | ||
| NO162965B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive alfa-(2-okso-2,4,5,6,7,7a-heksahydrotieno-(3,2-c)-5-pyridyl)-fenyl-eddiksyre-derivater. | |
| PL94155B1 (enExample) | ||
| SU512704A3 (ru) | Способ получени замещенных в 5-ом положении 5,10-дигидро-11 н-дибензо (в,е) (1,4)диазепин-11-онов | |
| US2877224A (en) | 3-cyano substituted phenothiazines | |
| BIEL et al. | Central Stimulants. II. Cholinergic Blocking Agents1 | |
| DK143183B (da) | Analogifremgangsmaade til fremstilling af 1h-pyrazolo (3,4-b)pyridiner eller fysiologisk acceptable salte deraf | |
| US4672063A (en) | Antiallergic 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-one compounds | |
| US4213985A (en) | Novel 5,11-dihydro-6H-pyrido-[2,3-b][1,4]-benzodiazepine-6-ones | |
| US3000892A (en) | 1-aroylalkyl-4-aroylpiperazines | |
| GB1569039A (en) | Derivatives of 10,11-dihydrobenzo(4,5)-cyclohepta(1,2-b)-pyrazolo(4,3-e)-pyridine-5(1h)one | |
| SU638259A3 (ru) | Способ получени 2,3-замещенных 5,6-конденсированных 4-(2н)-аминоалкоксипиранонов или их солей | |
| US2694705A (en) | Nx c c ox a a | |
| US3309370A (en) | Bicycloalkyl piperazine derivatives and process | |
| US2979502A (en) | Phenthiazine derivatives | |
| Ueda et al. | The synthesis of 10-(4-methylpiperazino) dibenzo [b, f] thiepin and related compounds. Neurotropic and psychotropic agents | |
| US3445464A (en) | Phenothiazine derivatives | |
| US3282942A (en) | Substituted cycloalkanoindoles | |
| US3839341A (en) | Substituted 1,3,8-triazaspiro(4.5)decanes | |
| US2485662A (en) | Alpha-(aminoalkyl)-stilbenes | |
| US3251838A (en) | Optionally substituted 5-methyl-6-phenyltetrahydro-1, 3, 4-oxadiazines | |
| DK145576B (da) | Analogifremgangsmaade til fremstilling af 6-fluor-substituerede thioxanthener eller syreadditionssalte deraf |