SU505371A3 - Способ получени бутилкаучука - Google Patents
Способ получени бутилкаучукаInfo
- Publication number
- SU505371A3 SU505371A3 SU1892342A SU1892342A SU505371A3 SU 505371 A3 SU505371 A3 SU 505371A3 SU 1892342 A SU1892342 A SU 1892342A SU 1892342 A SU1892342 A SU 1892342A SU 505371 A3 SU505371 A3 SU 505371A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- cocatalyst
- range
- isoprene
- catalyst
- group
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 229920005549 butyl rubber Polymers 0.000 title claims description 5
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 24
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 229940050176 methyl chloride Drugs 0.000 claims description 5
- -1 aromatic anhydrides Chemical class 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052797 bismuth Inorganic materials 0.000 claims description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 238000007334 copolymerization reaction Methods 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 239000001257 hydrogen Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- 150000002828 nitro derivatives Chemical class 0.000 claims description 2
- 150000002894 organic compounds Chemical group 0.000 claims description 2
- 150000004053 quinones Chemical class 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000002902 organometallic compounds Chemical group 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000004073 vulcanization Methods 0.000 description 5
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229910010165 TiCu Inorganic materials 0.000 description 3
- ANSXAPJVJOKRDJ-UHFFFAOYSA-N furo[3,4-f][2]benzofuran-1,3,5,7-tetrone Chemical compound C1=C2C(=O)OC(=O)C2=CC2=C1C(=O)OC2=O ANSXAPJVJOKRDJ-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 2
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- IZUKQUVSCNEFMJ-UHFFFAOYSA-N 1,2-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1[N+]([O-])=O IZUKQUVSCNEFMJ-UHFFFAOYSA-N 0.000 description 1
- KETQAJRQOHHATG-UHFFFAOYSA-N 1,2-naphthoquinone Chemical compound C1=CC=C2C(=O)C(=O)C=CC2=C1 KETQAJRQOHHATG-UHFFFAOYSA-N 0.000 description 1
- 229940105324 1,2-naphthoquinone Drugs 0.000 description 1
- WDCYWAQPCXBPJA-UHFFFAOYSA-N 1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1 WDCYWAQPCXBPJA-UHFFFAOYSA-N 0.000 description 1
- FYFDQJRXFWGIBS-UHFFFAOYSA-N 1,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1 FYFDQJRXFWGIBS-UHFFFAOYSA-N 0.000 description 1
- KSFNQTZBTVALRV-UHFFFAOYSA-N 2,3,5-trichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=CC(=O)C(Cl)=C(Cl)C1=O KSFNQTZBTVALRV-UHFFFAOYSA-N 0.000 description 1
- USAYMJGCALIGIG-UHFFFAOYSA-N 2,3-dichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=C(Cl)C(=O)C=CC1=O USAYMJGCALIGIG-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 1
- LNXVNZRYYHFMEY-UHFFFAOYSA-N 2,5-dichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=CC(=O)C(Cl)=CC1=O LNXVNZRYYHFMEY-UHFFFAOYSA-N 0.000 description 1
- IGIPYJUEWJRUGN-UHFFFAOYSA-N 2,6-dinitrocyclohexa-2,5-diene-1,4-dione Chemical compound [O-][N+](=O)C1=CC(=O)C=C([N+]([O-])=O)C1=O IGIPYJUEWJRUGN-UHFFFAOYSA-N 0.000 description 1
- DQTKCIVHDDGAFK-UHFFFAOYSA-N 2-(5,6-dihydro-4H-cyclopenta[d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dithiol Chemical compound S1C(S)=C(S)SC1=C1SC(CCC2)=C2S1 DQTKCIVHDDGAFK-UHFFFAOYSA-N 0.000 description 1
- XZLVODVCKMHHRJ-UHFFFAOYSA-N 5-methyl-1,3,5-trinitrocyclohexa-1,3-diene Chemical compound [O-][N+](=O)C1(C)CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 XZLVODVCKMHHRJ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 229910008433 SnCU Inorganic materials 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NYTOUQBROMCLBJ-UHFFFAOYSA-N Tetranitromethane Chemical compound [O-][N+](=O)C([N+]([O-])=O)([N+]([O-])=O)[N+]([O-])=O NYTOUQBROMCLBJ-UHFFFAOYSA-N 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000027756 respiratory electron transport chain Effects 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/06—Metallic compounds other than hydrides and other than metallo-organic compounds; Boron halide or aluminium halide complexes with organic compounds containing oxygen
- C08F4/12—Metallic compounds other than hydrides and other than metallo-organic compounds; Boron halide or aluminium halide complexes with organic compounds containing oxygen of boron, aluminium, gallium, indium, thallium or rare earths
- C08F4/14—Boron halides or aluminium halides; Complexes thereof with organic compounds containing oxygen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT21727/72A IT953490B (it) | 1972-03-11 | 1972-03-11 | Procedimento per la polimerizzazio ne e copolimerzzazione dell isobu tilene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU505371A3 true SU505371A3 (ru) | 1976-02-28 |
Family
ID=11186001
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1892342A SU505371A3 (ru) | 1972-03-11 | 1973-03-09 | Способ получени бутилкаучука |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3872069A (enExample) |
| JP (1) | JPS543507B2 (enExample) |
| AT (1) | AT327541B (enExample) |
| AU (1) | AU475815B2 (enExample) |
| BE (1) | BE796430A (enExample) |
| CA (1) | CA1020698A (enExample) |
| CH (1) | CH565823A5 (enExample) |
| CS (1) | CS183683B2 (enExample) |
| DD (1) | DD104798A5 (enExample) |
| DE (1) | DE2311796C3 (enExample) |
| ES (1) | ES412650A1 (enExample) |
| FR (1) | FR2175803B1 (enExample) |
| GB (1) | GB1400975A (enExample) |
| HU (1) | HU165739B (enExample) |
| IN (1) | IN140847B (enExample) |
| IT (1) | IT953490B (enExample) |
| LU (1) | LU67188A1 (enExample) |
| NL (1) | NL154228B (enExample) |
| PL (1) | PL92660B1 (enExample) |
| RO (1) | RO63435A (enExample) |
| SE (1) | SE7303371L (enExample) |
| SU (1) | SU505371A3 (enExample) |
| ZA (1) | ZA731362B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2459837C2 (ru) * | 2006-03-14 | 2012-08-27 | Ленксесс Инк. | Иономерный бутильный каучук, вулканизированное пероксидом изделие из него и изделие, включающее субстрат, связанный с названным каучуком |
| RU2497833C2 (ru) * | 2006-03-14 | 2013-11-10 | Ленксесс Инк. | Способ катионной полимеризации изоолефинового мономера с использованием цинк-галогенидного инициатора |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5032653A (en) * | 1988-06-28 | 1991-07-16 | Exxon Chemical Patents, Inc. | Direct synthesis by cationic polymerization of nitrogen-containing polymers |
| CA2413611C (en) * | 2002-12-05 | 2012-11-13 | Bayer Inc. | Process for production of high-isoprene butyl rubber |
| CN106146710B (zh) * | 2015-04-22 | 2018-12-28 | 中国石油化工股份有限公司 | 一种阳离子聚合方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2581154A (en) * | 1948-07-01 | 1952-01-01 | Standard Oil Dev Co | Tertiary-butyl halide promoters in friedel-crafts catalyzed olefin polymerizations |
| US2697694A (en) * | 1950-10-28 | 1954-12-21 | Standard Oil Co | Manufacture of high molecular weight polybutenes |
| US2931791A (en) * | 1955-05-23 | 1960-04-05 | Exxon Research Engineering Co | Polymerization of hydrocarbons with catalyst of bf3 and bci3 |
| US3193545A (en) * | 1958-12-03 | 1965-07-06 | Exxon Research Engineering Co | Catalyst and process for polymerizing alpha-olefins utilizing titanium halide derivatives |
| US3560458A (en) * | 1964-05-01 | 1971-02-02 | Exxon Research Engineering Co | Process for polymerization of cationically polymerizable monomers |
| FR1542101A (fr) * | 1967-10-06 | 1968-10-11 | Lubrizol Corp | Production de produits de polymérisation de l'isobutène et de mélanges d'isobutène et d'autres oléfines et di-oléfines |
| US3694377A (en) * | 1968-03-13 | 1972-09-26 | Exxon Research Engineering Co | Butyl rubber catalyst system |
-
1972
- 1972-03-11 IT IT21727/72A patent/IT953490B/it active
-
1973
- 1973-02-27 ZA ZA731362A patent/ZA731362B/xx unknown
- 1973-03-01 AU AU52758/73A patent/AU475815B2/en not_active Expired
- 1973-03-08 HU HUSA2475A patent/HU165739B/hu unknown
- 1973-03-08 BE BE1004864A patent/BE796430A/xx not_active IP Right Cessation
- 1973-03-08 FR FR7308242A patent/FR2175803B1/fr not_active Expired
- 1973-03-09 ES ES412650A patent/ES412650A1/es not_active Expired
- 1973-03-09 PL PL1973161162A patent/PL92660B1/pl unknown
- 1973-03-09 RO RO7300074122A patent/RO63435A/ro unknown
- 1973-03-09 CA CA165,939A patent/CA1020698A/en not_active Expired
- 1973-03-09 LU LU67188A patent/LU67188A1/xx unknown
- 1973-03-09 US US339940A patent/US3872069A/en not_active Expired - Lifetime
- 1973-03-09 GB GB1161173A patent/GB1400975A/en not_active Expired
- 1973-03-09 SU SU1892342A patent/SU505371A3/ru active
- 1973-03-09 DE DE2311796A patent/DE2311796C3/de not_active Expired
- 1973-03-09 AT AT209173A patent/AT327541B/de not_active IP Right Cessation
- 1973-03-09 SE SE7303371A patent/SE7303371L/sv unknown
- 1973-03-11 CH CH348173A patent/CH565823A5/xx not_active IP Right Cessation
- 1973-03-12 NL NL737303458A patent/NL154228B/xx unknown
- 1973-03-12 CS CS7300001772A patent/CS183683B2/cs unknown
- 1973-03-12 JP JP2808873A patent/JPS543507B2/ja not_active Expired
- 1973-03-12 DD DD169662A patent/DD104798A5/xx unknown
- 1973-03-13 IN IN555/CAL/1973A patent/IN140847B/en unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2459837C2 (ru) * | 2006-03-14 | 2012-08-27 | Ленксесс Инк. | Иономерный бутильный каучук, вулканизированное пероксидом изделие из него и изделие, включающее субстрат, связанный с названным каучуком |
| RU2497833C2 (ru) * | 2006-03-14 | 2013-11-10 | Ленксесс Инк. | Способ катионной полимеризации изоолефинового мономера с использованием цинк-галогенидного инициатора |
| RU2497833C9 (ru) * | 2006-03-14 | 2014-07-20 | Ленксесс Инк. | Способ катионной полимеризации изоолефинового мономера с использованием цинк-галогенидного инициатора |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2311796A1 (de) | 1973-09-20 |
| AU5275873A (en) | 1974-09-05 |
| NL7303458A (enExample) | 1973-09-13 |
| JPS543507B2 (enExample) | 1979-02-23 |
| ES412650A1 (es) | 1976-01-01 |
| SE7303371L (enExample) | 1973-09-12 |
| AU475815B2 (en) | 1976-09-02 |
| DE2311796C3 (de) | 1978-08-10 |
| JPS48102886A (enExample) | 1973-12-24 |
| CA1020698A (en) | 1977-11-08 |
| LU67188A1 (enExample) | 1973-05-22 |
| ATA209173A (de) | 1975-04-15 |
| IN140847B (enExample) | 1977-01-01 |
| FR2175803A1 (enExample) | 1973-10-26 |
| NL154228B (nl) | 1977-08-15 |
| DE2311796B2 (de) | 1977-12-01 |
| FR2175803B1 (enExample) | 1976-09-10 |
| US3872069A (en) | 1975-03-18 |
| ZA731362B (en) | 1973-11-28 |
| DD104798A5 (enExample) | 1974-03-20 |
| GB1400975A (en) | 1975-07-16 |
| PL92660B1 (enExample) | 1977-04-30 |
| BE796430A (fr) | 1973-07-02 |
| IT953490B (it) | 1973-08-10 |
| CS183683B2 (en) | 1978-07-31 |
| RO63435A (fr) | 1978-05-15 |
| CH565823A5 (enExample) | 1975-08-29 |
| HU165739B (enExample) | 1974-10-28 |
| AT327541B (de) | 1976-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0265053B1 (en) | Living polymerization of olefins to end-functionalized polymers | |
| US3114743A (en) | Method of preparing synthetic rubber | |
| US4753991A (en) | Polymers containing amino groups, and their preparation | |
| US3789036A (en) | Process for preparing saturated and unsaturated elastomeric copolymers of ethylene and/or higher alpha-olefins | |
| US3135716A (en) | Process for preparing terminally reactive polymers | |
| US2936302A (en) | Olefin polymerization with pretreated catalyst | |
| US3272786A (en) | Polymerization process using chain-transfer agents | |
| SU505371A3 (ru) | Способ получени бутилкаучука | |
| JP3808758B2 (ja) | イソブチレン系重合体の製造方法 | |
| JP3388865B2 (ja) | オレフィン基を有するイソブチレン系重合体の製造法 | |
| US2440750A (en) | Polymerization catalysts and preparation thereof | |
| US4877846A (en) | Polyalcohol homopolymers | |
| JP3092875B2 (ja) | 末端にビニル基を有するイソブチレン系重合体およびその製造方法 | |
| EP0274913A2 (en) | Polyalcohol homopolymers | |
| US2956959A (en) | Polymerization of epoxy compounds | |
| US3317437A (en) | Process for the production of alfin catalysts | |
| US2621171A (en) | Process for polymerizing alpha-methyl styrene | |
| US3088940A (en) | Hompolymerization of acrylonitrile with catalyst compositions comprising organo tin hydride and metal halide complexes | |
| JPH06345821A (ja) | 不飽和基を有するイソブチレン系重合体の製造方法 | |
| US3074917A (en) | Reaction of polymer having terminally reactive acidic groups and an aziridinyl phosphine oxide or sulfide | |
| US3901862A (en) | Process for the preparation of ethylene-butadiene copolymers | |
| US3632849A (en) | Process for the preparation of trans-polypentenamers | |
| US3027359A (en) | Tertiary phosphine polymerization catalysts system | |
| US3329666A (en) | Process for polymerizing isoprene with a catalyst comprising lithium or an organolithium and a hydrate or carbonyl of a lithium derivative of a metal halide | |
| US2984656A (en) | Polymerization of vinyl alkyl ethers |