SU505371A3 - Способ получени бутилкаучука - Google Patents
Способ получени бутилкаучукаInfo
- Publication number
- SU505371A3 SU505371A3 SU1892342A SU1892342A SU505371A3 SU 505371 A3 SU505371 A3 SU 505371A3 SU 1892342 A SU1892342 A SU 1892342A SU 1892342 A SU1892342 A SU 1892342A SU 505371 A3 SU505371 A3 SU 505371A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- cocatalyst
- range
- isoprene
- catalyst
- group
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 229920005549 butyl rubber Polymers 0.000 title claims description 5
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 24
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 229940050176 methyl chloride Drugs 0.000 claims description 5
- -1 aromatic anhydrides Chemical class 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052797 bismuth Inorganic materials 0.000 claims description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 238000007334 copolymerization reaction Methods 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 239000001257 hydrogen Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- 150000002828 nitro derivatives Chemical class 0.000 claims description 2
- 150000002894 organic compounds Chemical group 0.000 claims description 2
- 150000004053 quinones Chemical class 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000002902 organometallic compounds Chemical group 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000004073 vulcanization Methods 0.000 description 5
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229910010165 TiCu Inorganic materials 0.000 description 3
- ANSXAPJVJOKRDJ-UHFFFAOYSA-N furo[3,4-f][2]benzofuran-1,3,5,7-tetrone Chemical compound C1=C2C(=O)OC(=O)C2=CC2=C1C(=O)OC2=O ANSXAPJVJOKRDJ-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 2
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- IZUKQUVSCNEFMJ-UHFFFAOYSA-N 1,2-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1[N+]([O-])=O IZUKQUVSCNEFMJ-UHFFFAOYSA-N 0.000 description 1
- KETQAJRQOHHATG-UHFFFAOYSA-N 1,2-naphthoquinone Chemical compound C1=CC=C2C(=O)C(=O)C=CC2=C1 KETQAJRQOHHATG-UHFFFAOYSA-N 0.000 description 1
- 229940105324 1,2-naphthoquinone Drugs 0.000 description 1
- WDCYWAQPCXBPJA-UHFFFAOYSA-N 1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1 WDCYWAQPCXBPJA-UHFFFAOYSA-N 0.000 description 1
- FYFDQJRXFWGIBS-UHFFFAOYSA-N 1,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1 FYFDQJRXFWGIBS-UHFFFAOYSA-N 0.000 description 1
- KSFNQTZBTVALRV-UHFFFAOYSA-N 2,3,5-trichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=CC(=O)C(Cl)=C(Cl)C1=O KSFNQTZBTVALRV-UHFFFAOYSA-N 0.000 description 1
- USAYMJGCALIGIG-UHFFFAOYSA-N 2,3-dichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=C(Cl)C(=O)C=CC1=O USAYMJGCALIGIG-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 1
- LNXVNZRYYHFMEY-UHFFFAOYSA-N 2,5-dichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=CC(=O)C(Cl)=CC1=O LNXVNZRYYHFMEY-UHFFFAOYSA-N 0.000 description 1
- IGIPYJUEWJRUGN-UHFFFAOYSA-N 2,6-dinitrocyclohexa-2,5-diene-1,4-dione Chemical compound [O-][N+](=O)C1=CC(=O)C=C([N+]([O-])=O)C1=O IGIPYJUEWJRUGN-UHFFFAOYSA-N 0.000 description 1
- DQTKCIVHDDGAFK-UHFFFAOYSA-N 2-(5,6-dihydro-4H-cyclopenta[d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dithiol Chemical compound S1C(S)=C(S)SC1=C1SC(CCC2)=C2S1 DQTKCIVHDDGAFK-UHFFFAOYSA-N 0.000 description 1
- XZLVODVCKMHHRJ-UHFFFAOYSA-N 5-methyl-1,3,5-trinitrocyclohexa-1,3-diene Chemical compound [O-][N+](=O)C1(C)CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 XZLVODVCKMHHRJ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 229910008433 SnCU Inorganic materials 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NYTOUQBROMCLBJ-UHFFFAOYSA-N Tetranitromethane Chemical compound [O-][N+](=O)C([N+]([O-])=O)([N+]([O-])=O)[N+]([O-])=O NYTOUQBROMCLBJ-UHFFFAOYSA-N 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000027756 respiratory electron transport chain Effects 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/06—Metallic compounds other than hydrides and other than metallo-organic compounds; Boron halide or aluminium halide complexes with organic compounds containing oxygen
- C08F4/12—Metallic compounds other than hydrides and other than metallo-organic compounds; Boron halide or aluminium halide complexes with organic compounds containing oxygen of boron, aluminium, gallium, indium, thallium or rare earths
- C08F4/14—Boron halides or aluminium halides; Complexes thereof with organic compounds containing oxygen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT21727/72A IT953490B (it) | 1972-03-11 | 1972-03-11 | Procedimento per la polimerizzazio ne e copolimerzzazione dell isobu tilene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU505371A3 true SU505371A3 (ru) | 1976-02-28 |
Family
ID=11186001
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1892342A SU505371A3 (ru) | 1972-03-11 | 1973-03-09 | Способ получени бутилкаучука |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3872069A (enExample) |
| JP (1) | JPS543507B2 (enExample) |
| AT (1) | AT327541B (enExample) |
| AU (1) | AU475815B2 (enExample) |
| BE (1) | BE796430A (enExample) |
| CA (1) | CA1020698A (enExample) |
| CH (1) | CH565823A5 (enExample) |
| CS (1) | CS183683B2 (enExample) |
| DD (1) | DD104798A5 (enExample) |
| DE (1) | DE2311796C3 (enExample) |
| ES (1) | ES412650A1 (enExample) |
| FR (1) | FR2175803B1 (enExample) |
| GB (1) | GB1400975A (enExample) |
| HU (1) | HU165739B (enExample) |
| IN (1) | IN140847B (enExample) |
| IT (1) | IT953490B (enExample) |
| LU (1) | LU67188A1 (enExample) |
| NL (1) | NL154228B (enExample) |
| PL (1) | PL92660B1 (enExample) |
| RO (1) | RO63435A (enExample) |
| SE (1) | SE7303371L (enExample) |
| SU (1) | SU505371A3 (enExample) |
| ZA (1) | ZA731362B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2459837C2 (ru) * | 2006-03-14 | 2012-08-27 | Ленксесс Инк. | Иономерный бутильный каучук, вулканизированное пероксидом изделие из него и изделие, включающее субстрат, связанный с названным каучуком |
| RU2497833C2 (ru) * | 2006-03-14 | 2013-11-10 | Ленксесс Инк. | Способ катионной полимеризации изоолефинового мономера с использованием цинк-галогенидного инициатора |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5032653A (en) * | 1988-06-28 | 1991-07-16 | Exxon Chemical Patents, Inc. | Direct synthesis by cationic polymerization of nitrogen-containing polymers |
| CA2413611C (en) * | 2002-12-05 | 2012-11-13 | Bayer Inc. | Process for production of high-isoprene butyl rubber |
| CN106146710B (zh) * | 2015-04-22 | 2018-12-28 | 中国石油化工股份有限公司 | 一种阳离子聚合方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2581154A (en) * | 1948-07-01 | 1952-01-01 | Standard Oil Dev Co | Tertiary-butyl halide promoters in friedel-crafts catalyzed olefin polymerizations |
| US2697694A (en) * | 1950-10-28 | 1954-12-21 | Standard Oil Co | Manufacture of high molecular weight polybutenes |
| US2931791A (en) * | 1955-05-23 | 1960-04-05 | Exxon Research Engineering Co | Polymerization of hydrocarbons with catalyst of bf3 and bci3 |
| US3193545A (en) * | 1958-12-03 | 1965-07-06 | Exxon Research Engineering Co | Catalyst and process for polymerizing alpha-olefins utilizing titanium halide derivatives |
| US3560458A (en) * | 1964-05-01 | 1971-02-02 | Exxon Research Engineering Co | Process for polymerization of cationically polymerizable monomers |
| FR1542101A (fr) * | 1967-10-06 | 1968-10-11 | Lubrizol Corp | Production de produits de polymérisation de l'isobutène et de mélanges d'isobutène et d'autres oléfines et di-oléfines |
| US3694377A (en) * | 1968-03-13 | 1972-09-26 | Exxon Research Engineering Co | Butyl rubber catalyst system |
-
1972
- 1972-03-11 IT IT21727/72A patent/IT953490B/it active
-
1973
- 1973-02-27 ZA ZA731362A patent/ZA731362B/xx unknown
- 1973-03-01 AU AU52758/73A patent/AU475815B2/en not_active Expired
- 1973-03-08 FR FR7308242A patent/FR2175803B1/fr not_active Expired
- 1973-03-08 BE BE1004864A patent/BE796430A/xx not_active IP Right Cessation
- 1973-03-08 HU HUSA2475A patent/HU165739B/hu unknown
- 1973-03-09 PL PL1973161162A patent/PL92660B1/pl unknown
- 1973-03-09 SE SE7303371A patent/SE7303371L/sv unknown
- 1973-03-09 GB GB1161173A patent/GB1400975A/en not_active Expired
- 1973-03-09 US US339940A patent/US3872069A/en not_active Expired - Lifetime
- 1973-03-09 AT AT209173A patent/AT327541B/de not_active IP Right Cessation
- 1973-03-09 CA CA165,939A patent/CA1020698A/en not_active Expired
- 1973-03-09 ES ES412650A patent/ES412650A1/es not_active Expired
- 1973-03-09 SU SU1892342A patent/SU505371A3/ru active
- 1973-03-09 RO RO7300074122A patent/RO63435A/ro unknown
- 1973-03-09 LU LU67188A patent/LU67188A1/xx unknown
- 1973-03-09 DE DE2311796A patent/DE2311796C3/de not_active Expired
- 1973-03-11 CH CH348173A patent/CH565823A5/xx not_active IP Right Cessation
- 1973-03-12 NL NL737303458A patent/NL154228B/xx unknown
- 1973-03-12 DD DD169662A patent/DD104798A5/xx unknown
- 1973-03-12 CS CS7300001772A patent/CS183683B2/cs unknown
- 1973-03-12 JP JP2808873A patent/JPS543507B2/ja not_active Expired
- 1973-03-13 IN IN555/CAL/1973A patent/IN140847B/en unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2459837C2 (ru) * | 2006-03-14 | 2012-08-27 | Ленксесс Инк. | Иономерный бутильный каучук, вулканизированное пероксидом изделие из него и изделие, включающее субстрат, связанный с названным каучуком |
| RU2497833C2 (ru) * | 2006-03-14 | 2013-11-10 | Ленксесс Инк. | Способ катионной полимеризации изоолефинового мономера с использованием цинк-галогенидного инициатора |
| RU2497833C9 (ru) * | 2006-03-14 | 2014-07-20 | Ленксесс Инк. | Способ катионной полимеризации изоолефинового мономера с использованием цинк-галогенидного инициатора |
Also Published As
| Publication number | Publication date |
|---|---|
| AT327541B (de) | 1976-02-10 |
| NL7303458A (enExample) | 1973-09-13 |
| BE796430A (fr) | 1973-07-02 |
| DE2311796C3 (de) | 1978-08-10 |
| HU165739B (enExample) | 1974-10-28 |
| AU5275873A (en) | 1974-09-05 |
| ZA731362B (en) | 1973-11-28 |
| DE2311796B2 (de) | 1977-12-01 |
| AU475815B2 (en) | 1976-09-02 |
| FR2175803B1 (enExample) | 1976-09-10 |
| SE7303371L (enExample) | 1973-09-12 |
| CS183683B2 (en) | 1978-07-31 |
| JPS543507B2 (enExample) | 1979-02-23 |
| FR2175803A1 (enExample) | 1973-10-26 |
| IN140847B (enExample) | 1977-01-01 |
| IT953490B (it) | 1973-08-10 |
| LU67188A1 (enExample) | 1973-05-22 |
| GB1400975A (en) | 1975-07-16 |
| CH565823A5 (enExample) | 1975-08-29 |
| ES412650A1 (es) | 1976-01-01 |
| RO63435A (fr) | 1978-05-15 |
| JPS48102886A (enExample) | 1973-12-24 |
| DD104798A5 (enExample) | 1974-03-20 |
| DE2311796A1 (de) | 1973-09-20 |
| PL92660B1 (enExample) | 1977-04-30 |
| NL154228B (nl) | 1977-08-15 |
| ATA209173A (de) | 1975-04-15 |
| US3872069A (en) | 1975-03-18 |
| CA1020698A (en) | 1977-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0265053B1 (en) | Living polymerization of olefins to end-functionalized polymers | |
| US3114743A (en) | Method of preparing synthetic rubber | |
| US4753991A (en) | Polymers containing amino groups, and their preparation | |
| US3789036A (en) | Process for preparing saturated and unsaturated elastomeric copolymers of ethylene and/or higher alpha-olefins | |
| US3135716A (en) | Process for preparing terminally reactive polymers | |
| EP0076535B1 (en) | Process for polymerising conjugate diolefins, and means suitable for this purpose | |
| US2936302A (en) | Olefin polymerization with pretreated catalyst | |
| US4001195A (en) | Copolymerization of olefins | |
| US3272786A (en) | Polymerization process using chain-transfer agents | |
| SU505371A3 (ru) | Способ получени бутилкаучука | |
| JP3808758B2 (ja) | イソブチレン系重合体の製造方法 | |
| JP3388865B2 (ja) | オレフィン基を有するイソブチレン系重合体の製造法 | |
| US2440750A (en) | Polymerization catalysts and preparation thereof | |
| US4877846A (en) | Polyalcohol homopolymers | |
| EP0274913A2 (en) | Polyalcohol homopolymers | |
| US2956959A (en) | Polymerization of epoxy compounds | |
| US3317437A (en) | Process for the production of alfin catalysts | |
| US2621171A (en) | Process for polymerizing alpha-methyl styrene | |
| US3088940A (en) | Hompolymerization of acrylonitrile with catalyst compositions comprising organo tin hydride and metal halide complexes | |
| JPH06345821A (ja) | 不飽和基を有するイソブチレン系重合体の製造方法 | |
| US3074917A (en) | Reaction of polymer having terminally reactive acidic groups and an aziridinyl phosphine oxide or sulfide | |
| US3901862A (en) | Process for the preparation of ethylene-butadiene copolymers | |
| US3632849A (en) | Process for the preparation of trans-polypentenamers | |
| US3027359A (en) | Tertiary phosphine polymerization catalysts system | |
| US3329666A (en) | Process for polymerizing isoprene with a catalyst comprising lithium or an organolithium and a hydrate or carbonyl of a lithium derivative of a metal halide |