SU496735A3 - Способ получени производных оксадиазолона - Google Patents
Способ получени производных оксадиазолонаInfo
- Publication number
- SU496735A3 SU496735A3 SU1890140A SU1890140A SU496735A3 SU 496735 A3 SU496735 A3 SU 496735A3 SU 1890140 A SU1890140 A SU 1890140A SU 1890140 A SU1890140 A SU 1890140A SU 496735 A3 SU496735 A3 SU 496735A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- alkyl
- oxadiazolone
- preparing
- dichloro
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 7
- ZVTQYRVARPYRRE-UHFFFAOYSA-N oxadiazol-4-one Chemical class O=C1CON=N1 ZVTQYRVARPYRRE-UHFFFAOYSA-N 0.000 title description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 22
- 125000000217 alkyl group Chemical group 0.000 description 16
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- 239000000243 solution Substances 0.000 description 9
- 125000004849 alkoxymethyl group Chemical group 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- -1 Butyl- Chemical group 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000003963 dichloro group Chemical group Cl* 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 2
- 229910000103 lithium hydride Inorganic materials 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241001103870 Adia Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000065675 Cyclops Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000856099 Zodia Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 239000011707 mineral Chemical class 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 238000002496 oximetry Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000013547 stew Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
- C07D271/113—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C243/24—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids
- C07C243/26—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C243/28—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to hydrogen atoms or to acyclic carbon atoms to hydrogen atoms or to carbon atoms of a saturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Paints Or Removers (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7132587A FR2162692A5 (enExample) | 1971-09-09 | 1971-09-09 | |
| FR7224327A FR2205068A6 (en) | 1972-07-05 | 1972-07-05 | 3-(substd phenyl)-oxadiazol-2-ones - with herbicidal activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU496735A3 true SU496735A3 (ru) | 1975-12-25 |
Family
ID=26216605
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1890140A SU496735A3 (ru) | 1971-09-09 | 1973-03-13 | Способ получени производных оксадиазолона |
Country Status (20)
| Country | Link |
|---|---|
| JP (2) | JPS5248987B2 (enExample) |
| AR (1) | AR194500A1 (enExample) |
| AT (3) | AT329917B (enExample) |
| AU (1) | AU463690B2 (enExample) |
| BE (1) | BE788612A (enExample) |
| CA (1) | CA986122A (enExample) |
| CH (3) | CH561014A5 (enExample) |
| DE (1) | DE2244237A1 (enExample) |
| DK (1) | DK131676C (enExample) |
| EG (1) | EG10717A (enExample) |
| ES (4) | ES406548A1 (enExample) |
| GB (1) | GB1364137A (enExample) |
| HU (1) | HU165428B (enExample) |
| IL (1) | IL40321A (enExample) |
| IT (1) | IT967312B (enExample) |
| NL (1) | NL7211949A (enExample) |
| OA (1) | OA04166A (enExample) |
| RO (1) | RO62265A (enExample) |
| SE (1) | SE376234B (enExample) |
| SU (1) | SU496735A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2222378B1 (enExample) * | 1973-03-22 | 1976-11-05 | Rhone Poulenc Ind | |
| JPS5218302A (en) * | 1975-08-01 | 1977-02-10 | Fuji Photo Film Co Ltd | Magnetic sheet recording/playing method |
| JPS5228697A (en) * | 1975-08-29 | 1977-03-03 | Hitachi Maxell Ltd | Production method of magnetic powder |
| JPS60171887A (ja) * | 1984-02-15 | 1985-09-05 | Matsushita Electric Ind Co Ltd | 固体カラ−撮像装置 |
| JPS6224896U (enExample) * | 1985-07-30 | 1987-02-16 | ||
| JPS6356078U (enExample) * | 1986-09-30 | 1988-04-14 | ||
| EP0354622A1 (en) * | 1988-08-11 | 1990-02-14 | Shell Internationale Researchmaatschappij B.V. | Oxadiazolone herbicides |
| JP3135741B2 (ja) * | 1993-05-07 | 2001-02-19 | 富士写真フイルム株式会社 | 研磨体 |
| DE19822316A1 (de) * | 1998-05-19 | 1999-11-25 | Clariant Gmbh | Verfahren zur Herstellung von Arylhydrazinen |
| EP3835285A1 (en) * | 2016-03-15 | 2021-06-16 | Shionogi & Co., Ltd | Method for producing phenoxyethanol derivative |
-
0
- BE BE788612D patent/BE788612A/xx unknown
-
1972
- 1972-08-29 RO RO72055A patent/RO62265A/ro unknown
- 1972-09-01 OA OA54680A patent/OA04166A/xx unknown
- 1972-09-01 NL NL7211949A patent/NL7211949A/xx not_active Application Discontinuation
- 1972-09-06 GB GB4133072A patent/GB1364137A/en not_active Expired
- 1972-09-06 AU AU46372/72A patent/AU463690B2/en not_active Expired
- 1972-09-06 JP JP47088783A patent/JPS5248987B2/ja not_active Expired
- 1972-09-06 CA CA151,070A patent/CA986122A/en not_active Expired
- 1972-09-07 IL IL40321A patent/IL40321A/xx unknown
- 1972-09-07 EG EG365/72A patent/EG10717A/xx active
- 1972-09-07 HU HURO678A patent/HU165428B/hu unknown
- 1972-09-08 CH CH805474A patent/CH561014A5/xx not_active IP Right Cessation
- 1972-09-08 AT AT930373*7A patent/AT329917B/de not_active IP Right Cessation
- 1972-09-08 AR AR243999A patent/AR194500A1/es active
- 1972-09-08 AT AT930273A patent/AT317888B/de active
- 1972-09-08 SE SE7211627A patent/SE376234B/xx unknown
- 1972-09-08 DK DK444972A patent/DK131676C/da active
- 1972-09-08 CH CH1325472A patent/CH555849A/fr not_active IP Right Cessation
- 1972-09-08 DE DE2244237A patent/DE2244237A1/de active Pending
- 1972-09-08 AT AT772872A patent/AT317887B/de not_active IP Right Cessation
- 1972-09-08 CH CH805374A patent/CH555355A/fr not_active IP Right Cessation
- 1972-09-09 ES ES406548A patent/ES406548A1/es not_active Expired
- 1972-09-09 IT IT29011/72A patent/IT967312B/it active
- 1972-09-09 ES ES406550A patent/ES406550A1/es not_active Expired
- 1972-09-09 ES ES406551A patent/ES406551A1/es not_active Expired
- 1972-09-09 ES ES406549A patent/ES406549A1/es not_active Expired
-
1973
- 1973-03-13 SU SU1890140A patent/SU496735A3/ru active
-
1975
- 1975-02-27 JP JP2349275A patent/JPS538699B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES406549A1 (es) | 1976-01-16 |
| DE2244237A1 (de) | 1973-03-15 |
| RO62265A (enExample) | 1977-09-15 |
| IL40321A0 (en) | 1972-11-28 |
| DK131676B (da) | 1975-08-18 |
| AT317888B (de) | 1974-09-25 |
| ES406548A1 (es) | 1976-01-16 |
| AT329917B (de) | 1976-06-10 |
| JPS50140447A (enExample) | 1975-11-11 |
| JPS5248987B2 (enExample) | 1977-12-14 |
| BE788612A (fr) | 1973-03-08 |
| AU4637272A (en) | 1974-03-14 |
| JPS538699B2 (enExample) | 1978-03-31 |
| OA04166A (fr) | 1979-12-15 |
| AR194500A1 (es) | 1973-07-23 |
| EG10717A (en) | 1976-05-31 |
| CH561014A5 (enExample) | 1975-04-30 |
| ES406550A1 (es) | 1975-09-01 |
| CA986122A (en) | 1976-03-23 |
| ATA930373A (de) | 1975-08-15 |
| SE376234B (enExample) | 1975-05-12 |
| JPS4839639A (enExample) | 1973-06-11 |
| GB1364137A (en) | 1974-08-21 |
| ES406551A1 (es) | 1976-01-16 |
| IL40321A (en) | 1975-03-13 |
| AU463690B2 (en) | 1975-07-31 |
| NL7211949A (enExample) | 1973-03-13 |
| DK131676C (da) | 1976-01-19 |
| HU165428B (enExample) | 1974-08-28 |
| CH555355A (fr) | 1974-10-31 |
| AT317887B (de) | 1974-09-25 |
| IT967312B (it) | 1974-02-28 |
| CH555849A (fr) | 1974-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU496735A3 (ru) | Способ получени производных оксадиазолона | |
| SU518135A3 (ru) | Способ получени производных хромана | |
| US2734904A (en) | Xcxnhxc-nh | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| US2872457A (en) | Process for the preparation of 4-hydroxycoumarin derivatives | |
| US3960856A (en) | Process for the preparation of 4-hydroxy-3-(5-methyl-3-isoxazolylcarbamoyl)-2-methyl-2H-1,2-benzothiazine 1,1-dioxide | |
| US2579420A (en) | Method for producing 6-halo-8-hydroxycinchoninic acids | |
| US4277607A (en) | Process for the preparation of 4-chloroquinolines | |
| Kurzer | 638. Cyanamides. Part II. The influence of substituents in the synthesis of arylsulphonylarylcyanamides | |
| Braunholtz et al. | 837. Cyclic keto-amines. Part II. The preparation and spectroscopic characteristics of substituted 1: 2: 3: 4-tetrahydro-4-oxoquinolines | |
| SU791239A3 (ru) | Способ получени производных 2,3-дигидробензо/в/тиофенона-2 или их солей | |
| SU383373A1 (ru) | Способ получени динатриевой соли дисульфида 3,3-дипропандисульфокислоты | |
| SU1313856A1 (ru) | Способ получени производных цис- или транс-диаминодибензоилдибензо-18-краун-6 | |
| SU591145A3 (ru) | Способ получени производных 2,4-диметил-3-карбоксианилидфурана или их солей | |
| US2727904A (en) | Therapeutically valuable aminosalicylic acid derivatives | |
| US2097860A (en) | Anthraquinone thiophene and senenophene carboxylic acid compounds | |
| US4061658A (en) | 2,5-Dipicrylfurans | |
| SU596169A3 (ru) | Способ получени производных 4н-бензо/4,5/-циклогепта/1,2-в/ тиофена или их солей | |
| Dikshit et al. | A new synthesis of thiophenes and thiapyrans: Part V. 6: 7-Benzothionaphthene and 9-chloronaphtho-(1′: 8′-bc)-thiapyran | |
| JPS59176234A (ja) | p‐ニトロフエニル3−ブロモ−2,2−ジエトキシ−プロピオネート | |
| SU457704A1 (ru) | Способ получени амида липоевой кислоты | |
| JPH0686422B2 (ja) | N‐置換ジカルボン酸イミド化合物の製造方法 | |
| US2513573A (en) | Nitro-(2-thenoyl)-o-benzoic acids | |
| US4180510A (en) | Method for preparing thienylacetic acids | |
| SU475364A1 (ru) | Способ получени производных арилсульфониламидов диалкилфосфорных кислот |