SU440834A1 - - Google Patents
Info
- Publication number
- SU440834A1 SU440834A1 SU1638901A SU1638901A SU440834A1 SU 440834 A1 SU440834 A1 SU 440834A1 SU 1638901 A SU1638901 A SU 1638901A SU 1638901 A SU1638901 A SU 1638901A SU 440834 A1 SU440834 A1 SU 440834A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- amino
- added
- aza
- preparation
- Prior art date
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- -1 phenyl amino-3-aza-2-benzoquinone Chemical compound 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 11
- 239000011592 zinc chloride Substances 0.000 description 9
- 235000005074 zinc chloride Nutrition 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 6
- QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 238000003918 potentiometric titration Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- QXHDYMUPPXAMPQ-UHFFFAOYSA-N 2-(4-aminophenyl)ethanol Chemical compound NC1=CC=C(CCO)C=C1 QXHDYMUPPXAMPQ-UHFFFAOYSA-N 0.000 description 1
- PSTUGXWVTKXNGK-UHFFFAOYSA-N 2-anilino-n-ethylacetamide Chemical compound CCNC(=O)CNC1=CC=CC=C1 PSTUGXWVTKXNGK-UHFFFAOYSA-N 0.000 description 1
- HGUYBLVGLMAUFF-UHFFFAOYSA-N 2-methoxybenzene-1,4-diamine Chemical compound COC1=CC(N)=CC=C1N HGUYBLVGLMAUFF-UHFFFAOYSA-N 0.000 description 1
- WEEOFHJAGVFCFD-UHFFFAOYSA-N 2-n-chlorobenzene-1,2-diamine Chemical compound NC1=CC=CC=C1NCl WEEOFHJAGVFCFD-UHFFFAOYSA-N 0.000 description 1
- GJIUUSKMFGFFPH-UHFFFAOYSA-N 5,6-diiminopyridin-2-amine Chemical compound NC1=NC(=N)C=CC1=N GJIUUSKMFGFFPH-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- MZXAUVPBYZEAFH-UHFFFAOYSA-N ClOCl.CN(C1=CC=C(N)C=C1)C Chemical compound ClOCl.CN(C1=CC=C(N)C=C1)C MZXAUVPBYZEAFH-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004945 acylaminoalkyl group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- YFVLGCAEAIRPKX-UHFFFAOYSA-N n-[2-(3-aminophenyl)ethyl]acetamide Chemical compound CC(=O)NCCC1=CC=CC(N)=C1 YFVLGCAEAIRPKX-UHFFFAOYSA-N 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU60702 | 1970-04-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU440834A1 true SU440834A1 (https=) | 1974-08-25 |
| SU440834A3 SU440834A3 (https=) | 1974-08-25 |
Family
ID=19726324
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1638901A SU440834A3 (https=) | 1970-04-10 | 1971-04-09 |
Country Status (15)
| Country | Link |
|---|---|
| AT (1) | AT316017B (https=) |
| BE (1) | BE765548A (https=) |
| BR (1) | BR7102076D0 (https=) |
| CA (1) | CA976961A (https=) |
| CH (1) | CH536112A (https=) |
| DE (1) | DE2117363A1 (https=) |
| DK (1) | DK131543C (https=) |
| ES (1) | ES390037A1 (https=) |
| FR (1) | FR2089423A5 (https=) |
| GB (1) | GB1295789A (https=) |
| IT (1) | IT1036041B (https=) |
| LU (1) | LU60702A1 (https=) |
| NL (1) | NL7104666A (https=) |
| SE (1) | SE378252B (https=) |
| SU (1) | SU440834A3 (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4031722A1 (de) * | 1990-10-06 | 1992-04-09 | Basf Ag | Pyridonfarbstoffe und ein verfahren zu ihrer thermischen uebertragung |
| FR2845387B1 (fr) * | 2002-10-04 | 2005-01-21 | Oreal | Nouveaux colorants directs noirs trinoyaux heteroaromatiques |
-
1970
- 1970-04-10 LU LU60702D patent/LU60702A1/xx unknown
-
1971
- 1971-04-07 NL NL7104666A patent/NL7104666A/xx unknown
- 1971-04-07 SE SE7104567A patent/SE378252B/xx unknown
- 1971-04-07 BR BR2076/71A patent/BR7102076D0/pt unknown
- 1971-04-07 ES ES390037A patent/ES390037A1/es not_active Expired
- 1971-04-07 DK DK171171A patent/DK131543C/da active
- 1971-04-08 DE DE19712117363 patent/DE2117363A1/de active Pending
- 1971-04-08 CA CA110,055A patent/CA976961A/en not_active Expired
- 1971-04-08 FR FR7112556A patent/FR2089423A5/fr not_active Expired
- 1971-04-08 CH CH512671A patent/CH536112A/fr not_active IP Right Cessation
- 1971-04-09 BE BE765548A patent/BE765548A/xx unknown
- 1971-04-09 SU SU1638901A patent/SU440834A3/ru active
- 1971-04-09 AT AT304571A patent/AT316017B/de not_active IP Right Cessation
- 1971-04-09 IT IT68199/71A patent/IT1036041B/it active
- 1971-04-19 GB GB1295789D patent/GB1295789A/en not_active Expired
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU648103A3 (ru) | Способ получени тетразол - (1,5-а) хинолинов или их солей | |
| US2042023A (en) | Quaternary heterocyclic urea compounds and manufacture thereof | |
| ES8507112A1 (es) | Un procedimiento para la prpeparacion de compuestos de 1,4-dihidropiridina. | |
| BROWN et al. | Structure and antimicrobial activity of the 3-aminorhodanines | |
| SU440834A1 (https=) | ||
| CH614448A5 (en) | Process for the preparation of novel tertiary amines and their acid addition salts, and compounds thus prepared | |
| GB1418287A (en) | 1-ethyl-trizoles process for their preparation and their use as fungicides | |
| SU517587A1 (ru) | Способ получени производных 2оксфенилмочевины | |
| SE439482B (sv) | Sett att framstella p-hydroxifenylglycin | |
| GB1451477A (en) | Phenylamidinourea derivatives processes for their preparation and compositions incorporating them | |
| SU604497A3 (ru) | Способ получени тетрамизола или его солей | |
| JPS5949221B2 (ja) | 3−アシルアミノ−4−ホモイソツイスタンの製造法 | |
| US2695293A (en) | N, n'-substituted diamine compounds and method of making the same | |
| US2524802A (en) | Hydroxybenzenesulfonamidopyridazines and preparation of same | |
| US2409291A (en) | Chemotherapeutic sulfanilamide derivatives | |
| DE3363740D1 (en) | 3-pyridyl-5-alkoxy-(or phenoxy- or aralkyloxy-)pyrazole derivatives, process for their preparation, and their therapeutical use | |
| GB1490289A (en) | Intermediates and production thereof for use in the preparation of 6-(2-phenyl-2-(guanylureidoacetamido)acetamido)penicillanic acid | |
| SU399120A1 (ru) | Способ получения индоанилинов | |
| US2281014A (en) | Aminoarylsulphonamidopyrazolones | |
| US2017976A (en) | Complex compound of alkali- and alkaline earth-metal halides | |
| GB1444678A (en) | Pyrazoles and process for their preparation | |
| US2798075A (en) | Heterocyclic quaternary salts | |
| US2381873A (en) | 6-amino nicotinamide derivatives | |
| US2744138A (en) | Di-guanidino-phenol ethers | |
| US3090785A (en) | New process for preparing acylated |