SU440834A1 - - Google Patents
Info
- Publication number
- SU440834A1 SU440834A1 SU1638901A SU1638901A SU440834A1 SU 440834 A1 SU440834 A1 SU 440834A1 SU 1638901 A SU1638901 A SU 1638901A SU 1638901 A SU1638901 A SU 1638901A SU 440834 A1 SU440834 A1 SU 440834A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- amino
- added
- aza
- preparation
- Prior art date
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- -1 phenyl amino-3-aza-2-benzoquinone Chemical compound 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 11
- 239000011592 zinc chloride Substances 0.000 description 9
- 235000005074 zinc chloride Nutrition 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 6
- QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 238000003918 potentiometric titration Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- QXHDYMUPPXAMPQ-UHFFFAOYSA-N 2-(4-aminophenyl)ethanol Chemical compound NC1=CC=C(CCO)C=C1 QXHDYMUPPXAMPQ-UHFFFAOYSA-N 0.000 description 1
- PSTUGXWVTKXNGK-UHFFFAOYSA-N 2-anilino-n-ethylacetamide Chemical compound CCNC(=O)CNC1=CC=CC=C1 PSTUGXWVTKXNGK-UHFFFAOYSA-N 0.000 description 1
- HGUYBLVGLMAUFF-UHFFFAOYSA-N 2-methoxybenzene-1,4-diamine Chemical compound COC1=CC(N)=CC=C1N HGUYBLVGLMAUFF-UHFFFAOYSA-N 0.000 description 1
- WEEOFHJAGVFCFD-UHFFFAOYSA-N 2-n-chlorobenzene-1,2-diamine Chemical compound NC1=CC=CC=C1NCl WEEOFHJAGVFCFD-UHFFFAOYSA-N 0.000 description 1
- GJIUUSKMFGFFPH-UHFFFAOYSA-N 5,6-diiminopyridin-2-amine Chemical compound NC1=NC(=N)C=CC1=N GJIUUSKMFGFFPH-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- MZXAUVPBYZEAFH-UHFFFAOYSA-N ClOCl.CN(C1=CC=C(N)C=C1)C Chemical compound ClOCl.CN(C1=CC=C(N)C=C1)C MZXAUVPBYZEAFH-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004945 acylaminoalkyl group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- YFVLGCAEAIRPKX-UHFFFAOYSA-N n-[2-(3-aminophenyl)ethyl]acetamide Chemical compound CC(=O)NCCC1=CC=CC(N)=C1 YFVLGCAEAIRPKX-UHFFFAOYSA-N 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU60702 | 1970-04-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU440834A1 true SU440834A1 (enExample) | 1974-08-25 |
| SU440834A3 SU440834A3 (enExample) | 1974-08-25 |
Family
ID=19726324
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1638901A SU440834A3 (enExample) | 1970-04-10 | 1971-04-09 |
Country Status (15)
| Country | Link |
|---|---|
| AT (1) | AT316017B (enExample) |
| BE (1) | BE765548A (enExample) |
| BR (1) | BR7102076D0 (enExample) |
| CA (1) | CA976961A (enExample) |
| CH (1) | CH536112A (enExample) |
| DE (1) | DE2117363A1 (enExample) |
| DK (1) | DK131543C (enExample) |
| ES (1) | ES390037A1 (enExample) |
| FR (1) | FR2089423A5 (enExample) |
| GB (1) | GB1295789A (enExample) |
| IT (1) | IT1036041B (enExample) |
| LU (1) | LU60702A1 (enExample) |
| NL (1) | NL7104666A (enExample) |
| SE (1) | SE378252B (enExample) |
| SU (1) | SU440834A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4031722A1 (de) * | 1990-10-06 | 1992-04-09 | Basf Ag | Pyridonfarbstoffe und ein verfahren zu ihrer thermischen uebertragung |
| FR2845387B1 (fr) * | 2002-10-04 | 2005-01-21 | Oreal | Nouveaux colorants directs noirs trinoyaux heteroaromatiques |
-
1970
- 1970-04-10 LU LU60702D patent/LU60702A1/xx unknown
-
1971
- 1971-04-07 DK DK171171A patent/DK131543C/da active
- 1971-04-07 ES ES390037A patent/ES390037A1/es not_active Expired
- 1971-04-07 SE SE7104567A patent/SE378252B/xx unknown
- 1971-04-07 BR BR2076/71A patent/BR7102076D0/pt unknown
- 1971-04-07 NL NL7104666A patent/NL7104666A/xx unknown
- 1971-04-08 CA CA110,055A patent/CA976961A/en not_active Expired
- 1971-04-08 CH CH512671A patent/CH536112A/fr not_active IP Right Cessation
- 1971-04-08 FR FR7112556A patent/FR2089423A5/fr not_active Expired
- 1971-04-08 DE DE19712117363 patent/DE2117363A1/de active Pending
- 1971-04-09 BE BE765548A patent/BE765548A/xx unknown
- 1971-04-09 IT IT68199/71A patent/IT1036041B/it active
- 1971-04-09 SU SU1638901A patent/SU440834A3/ru active
- 1971-04-09 AT AT304571A patent/AT316017B/de not_active IP Right Cessation
- 1971-04-19 GB GB1295789D patent/GB1295789A/en not_active Expired
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU648103A3 (ru) | Способ получени тетразол - (1,5-а) хинолинов или их солей | |
| ES8507112A1 (es) | Un procedimiento para la prpeparacion de compuestos de 1,4-dihidropiridina. | |
| US2042023A (en) | Quaternary heterocyclic urea compounds and manufacture thereof | |
| SU440834A1 (enExample) | ||
| CH614448A5 (en) | Process for the preparation of novel tertiary amines and their acid addition salts, and compounds thus prepared | |
| SU517587A1 (ru) | Способ получени производных 2оксфенилмочевины | |
| US2606902A (en) | Ethyleneimino derivatives of phosphoric acid and method of preparing the same | |
| SE439482B (sv) | Sett att framstella p-hydroxifenylglycin | |
| GB1451477A (en) | Phenylamidinourea derivatives processes for their preparation and compositions incorporating them | |
| SU604497A3 (ru) | Способ получени тетрамизола или его солей | |
| JPS5949221B2 (ja) | 3−アシルアミノ−4−ホモイソツイスタンの製造法 | |
| US2409291A (en) | Chemotherapeutic sulfanilamide derivatives | |
| DE3363740D1 (en) | 3-pyridyl-5-alkoxy-(or phenoxy- or aralkyloxy-)pyrazole derivatives, process for their preparation, and their therapeutical use | |
| GB1490289A (en) | Intermediates and production thereof for use in the preparation of 6-(2-phenyl-2-(guanylureidoacetamido)acetamido)penicillanic acid | |
| SU399120A1 (ru) | Способ получения индоанилинов | |
| Bader et al. | 534. New 5-aminoglyoxalines as potential adrenergic agents | |
| JP3218071B2 (ja) | 新規糖アミノ酸化合物及びその製造法並びにそれを含有する界面活性剤組成物 | |
| US2281014A (en) | Aminoarylsulphonamidopyrazolones | |
| US2017976A (en) | Complex compound of alkali- and alkaline earth-metal halides | |
| GB1444678A (en) | Pyrazoles and process for their preparation | |
| US2798075A (en) | Heterocyclic quaternary salts | |
| US2381873A (en) | 6-amino nicotinamide derivatives | |
| US2744138A (en) | Di-guanidino-phenol ethers | |
| US3090785A (en) | New process for preparing acylated | |
| US2864821A (en) | N-(pyrazinoyl)-glycine |