SU434646A3 - Способ получения простаноиновой кислоты или ее эфиров и солей - Google Patents
Способ получения простаноиновой кислоты или ее эфиров и солейInfo
- Publication number
- SU434646A3 SU434646A3 SU1647379A SU1647379A SU434646A3 SU 434646 A3 SU434646 A3 SU 434646A3 SU 1647379 A SU1647379 A SU 1647379A SU 1647379 A SU1647379 A SU 1647379A SU 434646 A3 SU434646 A3 SU 434646A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- salts
- ether
- prostaneoic
- obtaining
- Prior art date
Links
- 239000002253 acid Substances 0.000 title description 11
- 238000000034 method Methods 0.000 title description 7
- 150000003839 salts Chemical class 0.000 title description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003180 prostaglandins Chemical class 0.000 description 3
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- -1 alkyl halide ester Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- 241000406668 Loxodonta cyclotis Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- JHZPNBKZPAWCJD-UHFFFAOYSA-N ethyl 2-oxocyclopentane-1-carboxylate Chemical compound CCOC(=O)C1CCCC1=O JHZPNBKZPAWCJD-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 210000000582 semen Anatomy 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR707015910A FR2085654B1 (enExample) | 1970-04-30 | 1970-04-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU434646A3 true SU434646A3 (ru) | 1974-06-30 |
Family
ID=9054926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1647379A SU434646A3 (ru) | 1970-04-30 | 1971-04-29 | Способ получения простаноиновой кислоты или ее эфиров и солей |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3801623A (enExample) |
| JP (1) | JPS5523826B1 (enExample) |
| AT (1) | AT310959B (enExample) |
| BE (1) | BE766521A (enExample) |
| CA (1) | CA965088A (enExample) |
| CH (2) | CH540905A (enExample) |
| CS (1) | CS174158B2 (enExample) |
| DE (1) | DE2121429A1 (enExample) |
| DK (1) | DK138490B (enExample) |
| ES (1) | ES390720A1 (enExample) |
| FR (1) | FR2085654B1 (enExample) |
| GB (1) | GB1355993A (enExample) |
| IL (1) | IL36726A (enExample) |
| LU (1) | LU63087A1 (enExample) |
| NL (1) | NL7105989A (enExample) |
| PL (1) | PL81594B1 (enExample) |
| SE (2) | SE380260B (enExample) |
| SU (1) | SU434646A3 (enExample) |
| ZA (1) | ZA712778B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE29587E (en) * | 1970-04-30 | 1978-03-21 | Roussel Uclaf | Cyclopentanone derivatives |
| US3870710A (en) * | 1970-04-30 | 1975-03-11 | Roussel Uclaf | Cyclopentanone derivatives |
| US3920827A (en) * | 1971-06-24 | 1975-11-18 | Alza Corp | Pharmaceutical compositions containing therapeutic 5',6'-dihydro-2h-pyran-4'-yloxy prostaglandins |
| US4130721A (en) * | 1972-07-24 | 1978-12-19 | The Upjohn Company | 11-Deoxy PGE2 compounds |
| US4074045A (en) * | 1973-07-20 | 1978-02-14 | Hoffmann-La Roche Inc. | 2H-cyclopenta b!furan-2-ones and process for preparation |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1198071A (en) * | 1966-08-09 | 1970-07-08 | George Erich Just | Improvements in or relating to Prostaglandin Analogues and the Manufacture thereof |
-
1970
- 1970-04-30 FR FR707015910A patent/FR2085654B1/fr not_active Expired
-
1971
- 1971-04-26 IL IL36726A patent/IL36726A/xx unknown
- 1971-04-28 CH CH1206172A patent/CH540905A/fr not_active IP Right Cessation
- 1971-04-28 US US00138276A patent/US3801623A/en not_active Expired - Lifetime
- 1971-04-28 PL PL1971147805A patent/PL81594B1/pl unknown
- 1971-04-28 CH CH624871A patent/CH539596A/fr not_active IP Right Cessation
- 1971-04-29 ZA ZA712778A patent/ZA712778B/xx unknown
- 1971-04-29 CA CA111,792A patent/CA965088A/en not_active Expired
- 1971-04-29 ES ES390720A patent/ES390720A1/es not_active Expired
- 1971-04-29 SE SE7105614A patent/SE380260B/xx unknown
- 1971-04-29 SE SE7405388A patent/SE388614B/xx unknown
- 1971-04-29 CS CS3119A patent/CS174158B2/cs unknown
- 1971-04-29 SU SU1647379A patent/SU434646A3/ru active
- 1971-04-30 BE BE766521A patent/BE766521A/xx unknown
- 1971-04-30 LU LU63087D patent/LU63087A1/xx unknown
- 1971-04-30 DE DE19712121429 patent/DE2121429A1/de not_active Ceased
- 1971-04-30 DK DK208971AA patent/DK138490B/da unknown
- 1971-04-30 JP JP2815371A patent/JPS5523826B1/ja active Pending
- 1971-04-30 GB GB12449/71*2A patent/GB1355993A/en not_active Expired
- 1971-04-30 AT AT376171A patent/AT310959B/de not_active IP Right Cessation
- 1971-05-03 NL NL7105989A patent/NL7105989A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5523826B1 (enExample) | 1980-06-25 |
| IL36726A0 (en) | 1971-06-23 |
| FR2085654A1 (enExample) | 1971-12-31 |
| PL81594B1 (enExample) | 1975-08-30 |
| ZA712778B (en) | 1972-06-28 |
| ES390720A1 (es) | 1974-01-01 |
| NL7105989A (enExample) | 1971-11-02 |
| DK138490B (da) | 1978-09-18 |
| BE766521A (fr) | 1971-11-03 |
| CA965088A (en) | 1975-03-25 |
| GB1355993A (en) | 1974-06-12 |
| AT310959B (de) | 1973-10-25 |
| FR2085654B1 (enExample) | 1973-06-08 |
| DE2121429A1 (enExample) | 1971-11-11 |
| DK138490C (enExample) | 1979-02-19 |
| IL36726A (en) | 1975-02-10 |
| CH540905A (fr) | 1973-10-15 |
| SE380260B (sv) | 1975-11-03 |
| CS174158B2 (enExample) | 1977-03-31 |
| SE388614B (sv) | 1976-10-11 |
| CH539596A (fr) | 1973-07-31 |
| LU63087A1 (enExample) | 1971-08-27 |
| US3801623A (en) | 1974-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU434646A3 (ru) | Способ получения простаноиновой кислоты или ее эфиров и солей | |
| US4119727A (en) | Novel 11-desoxy-prostaglandin F2 derivatives | |
| US3835179A (en) | Novel 15-substituted prostanoic acids and esters | |
| US4076732A (en) | Derivatives of α-(6-carboxyhexyl) furfuryl alcohol | |
| GB1342810A (en) | Process for the preparation of cyclic ketones | |
| US4282372A (en) | Process for producing cyclopentenolones | |
| SU847912A3 (ru) | Способ получени галоидацеталейэТилЕНОВыХ АльдЕгидОВ | |
| US3301859A (en) | Cinchoninic acids and use in process for quinolinols | |
| US3970692A (en) | Process for the preparation of prostaglandin F2.sub.α and the analogs thereof | |
| US4082707A (en) | 2-(4-isobutylphenyl)-propiohydroxamic acid and a procedure for its preparation | |
| US3989744A (en) | 11-Substitute d-11-desoxy-pge analogues | |
| DK146593B (da) | Analogifremgangsmaade til fremstilling af fluorprostaglandiner | |
| JPS5846049A (ja) | アミノカルボン酸誘導体およびその製造法 | |
| JP2612161B2 (ja) | ジベンゾチエピン誘導体の製造法 | |
| US4046787A (en) | Novel 15-substituted prostanoic acids and esters | |
| US2744137A (en) | Process for the manufacture of n-methyl-beta-cyclohexen-(1)-ylethylamine | |
| JPH0219831B2 (enExample) | ||
| US4208526A (en) | Process for the preparation of thiazolidin-4-one-acetic acid derivatives | |
| JPH0696564B2 (ja) | α−(ω−ヒドロキシアルキル)フルフリルアルコ−ル及びその製造法 | |
| SU1721051A1 (ru) | Способ получени 2-галоидпроизводных фурана | |
| US3932472A (en) | Novel 15-substituted prostanoic acids and esters | |
| JP2549997B2 (ja) | 新規ハロケタール化合物 | |
| SU1205756A3 (ru) | Способ получени 1,1-дихлор-4-метилпентадиенов | |
| US3200138A (en) | Mesyloxyacetic acid and acid chloride | |
| US3567744A (en) | Process for producing furoic acid derivatives |