SU428605A3 - Способ получения оксазолов - Google Patents
Способ получения оксазоловInfo
- Publication number
- SU428605A3 SU428605A3 SU1319401A SU1319401A SU428605A3 SU 428605 A3 SU428605 A3 SU 428605A3 SU 1319401 A SU1319401 A SU 1319401A SU 1319401 A SU1319401 A SU 1319401A SU 428605 A3 SU428605 A3 SU 428605A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carried out
- oxazoles
- acetate
- yield
- carbon atoms
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 20
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 title description 2
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 11
- 150000002916 oxazoles Chemical class 0.000 claims description 9
- 150000001408 amides Chemical class 0.000 claims description 7
- DOBUSJIVSSJEDA-UHFFFAOYSA-L 1,3-dioxa-2$l^{6}-thia-4-mercuracyclobutane 2,2-dioxide Chemical compound [Hg+2].[O-]S([O-])(=O)=O DOBUSJIVSSJEDA-UHFFFAOYSA-L 0.000 claims description 6
- 229910000370 mercury sulfate Inorganic materials 0.000 claims description 6
- 238000006116 polymerization reaction Methods 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000003112 inhibitor Substances 0.000 claims description 4
- 229920000137 polyphosphoric acid Polymers 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 150000000475 acetylene derivatives Chemical class 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- RIZZXCJMFIGMON-UHFFFAOYSA-N prop-2-ynyl acetate Chemical compound CC(=O)OCC#C RIZZXCJMFIGMON-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- ZRLDBDZSLLGDOX-UHFFFAOYSA-N Trimethyloxazole Chemical compound CC1=NC(C)=C(C)O1 ZRLDBDZSLLGDOX-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- -1 monosubstituted oxazoles Chemical class 0.000 description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical class [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical class [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000002211 ultraviolet spectrum Methods 0.000 description 2
- NSAUQTCATRWAJC-UHFFFAOYSA-N 2,5-dimethyloxazole Chemical compound CC1=CN=C(C)O1 NSAUQTCATRWAJC-UHFFFAOYSA-N 0.000 description 1
- MLMGJTAJUDSUKA-UHFFFAOYSA-N 2-ethenyl-1h-imidazole Chemical class C=CC1=NC=CN1 MLMGJTAJUDSUKA-UHFFFAOYSA-N 0.000 description 1
- KVPZSRWPDYRSRG-UHFFFAOYSA-N 3,4,4-trimethyl-1,3-oxazolidin-2-one Chemical compound CN1C(=O)OCC1(C)C KVPZSRWPDYRSRG-UHFFFAOYSA-N 0.000 description 1
- AKUSZFPCJFNRSZ-UHFFFAOYSA-N 3,4-dimethyl-1,2-oxazole Chemical compound CC1=CON=C1C AKUSZFPCJFNRSZ-UHFFFAOYSA-N 0.000 description 1
- JRJGKUTZNBZHNK-UHFFFAOYSA-N 3-phenylpropyl acetate Chemical compound CC(=O)OCCCC1=CC=CC=C1 JRJGKUTZNBZHNK-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- MJBPUQUGJNAPAZ-UHFFFAOYSA-N Butine Natural products O1C2=CC(O)=CC=C2C(=O)CC1C1=CC=C(O)C(O)=C1 MJBPUQUGJNAPAZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical class [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- QCUOBSQYDGUHHT-UHFFFAOYSA-L cadmium sulfate Chemical compound [Cd+2].[O-]S([O-])(=O)=O QCUOBSQYDGUHHT-UHFFFAOYSA-L 0.000 description 1
- 229910000331 cadmium sulfate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229950001902 dimevamide Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229940047889 isobutyramide Drugs 0.000 description 1
- SANOUVWGPVYVAV-UHFFFAOYSA-N isovaleramide Chemical compound CC(C)CC(N)=O SANOUVWGPVYVAV-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002730 mercury Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007978 oxazole derivatives Chemical class 0.000 description 1
- IPWFJLQDVFKJDU-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O IPWFJLQDVFKJDU-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- XIPFMBOWZXULIA-UHFFFAOYSA-N pivalamide Chemical compound CC(C)(C)C(N)=O XIPFMBOWZXULIA-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR145789A FR1569792A (enExample) | 1968-03-28 | 1968-03-28 | |
| FR174830A FR96117E (fr) | 1968-03-28 | 1968-11-22 | Synthese d'oxazoles. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU428605A3 true SU428605A3 (ru) | 1974-05-15 |
Family
ID=26181912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1319401A SU428605A3 (ru) | 1968-03-28 | 1969-03-27 | Способ получения оксазолов |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS4643776B1 (enExample) |
| BE (1) | BE730554A (enExample) |
| CH (1) | CH507275A (enExample) |
| DE (1) | DE1915232A1 (enExample) |
| FR (1) | FR96117E (enExample) |
| GB (1) | GB1268825A (enExample) |
| LU (1) | LU58313A1 (enExample) |
| NL (1) | NL6904051A (enExample) |
| SU (1) | SU428605A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2152367C2 (de) * | 1971-10-21 | 1985-01-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von 4- Methyl-oxazolen |
| GB2156344A (en) * | 1984-03-26 | 1985-10-09 | Dow Chemical Co | Liquid phase preparation of optionally 2-substituted-2-oxazolines by cyclodehydration |
| TW311136B (enExample) * | 1990-11-30 | 1997-07-21 | Otsuka Pharma Co Ltd |
-
1968
- 1968-11-22 FR FR174830A patent/FR96117E/fr not_active Expired
-
1969
- 1969-03-15 NL NL6904051A patent/NL6904051A/xx unknown
- 1969-03-24 CH CH440069A patent/CH507275A/fr not_active IP Right Cessation
- 1969-03-26 DE DE19691915232 patent/DE1915232A1/de not_active Withdrawn
- 1969-03-26 LU LU58313D patent/LU58313A1/xx unknown
- 1969-03-27 BE BE730554D patent/BE730554A/xx unknown
- 1969-03-27 SU SU1319401A patent/SU428605A3/ru active
- 1969-03-27 GB GB1619369A patent/GB1268825A/en not_active Expired
- 1969-03-28 JP JP2319069A patent/JPS4643776B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4643776B1 (enExample) | 1971-12-25 |
| CH507275A (fr) | 1971-05-15 |
| NL6904051A (enExample) | 1969-09-30 |
| GB1268825A (en) | 1972-03-29 |
| LU58313A1 (enExample) | 1969-10-27 |
| FR96117E (fr) | 1972-05-19 |
| BE730554A (enExample) | 1969-09-29 |
| DE1915232A1 (de) | 1969-10-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2760977A (en) | N-alkylol unsaturated amides | |
| Mich et al. | The generation of benzyne-A warning | |
| SU428605A3 (ru) | Способ получения оксазолов | |
| SU622410A3 (ru) | Способ получени карбонилзамещенных иминометилфосфонатов | |
| US3056802A (en) | Alpha-halo lactones | |
| US3277175A (en) | Preparation of p-nitrodiphenylamines | |
| US3969466A (en) | Preparation of hydrazodicarbonamide | |
| US3132141A (en) | Aluminum containing complexes of hexamethylene tetramine | |
| Galat | A Synthesis of α, β-Unsaturated Amides | |
| US3466308A (en) | Preparation of organic acids | |
| SU1131871A1 (ru) | Способ получени амидов адамантанкарбоновых кислот | |
| SU390091A1 (ru) | Способ получения 1-аренсульфонил-4- -арилдекагидрохиноксалинов | |
| US2417999A (en) | Preparation of n, n'-methylene bis hydantoins | |
| US3635999A (en) | Synthesis of oxazoles | |
| SU679578A1 (ru) | Способ получени 6-алкокси-2,2,4триметил-1,2-дигидрохинолинов | |
| Carroll et al. | Benzylation and Benzoylation of Methyl Phenacyl Sulfone | |
| SU438639A1 (ru) | Способ получени -хлорпропионовой кислоты | |
| US2770653A (en) | Diaralkylalkylenediamine preparation | |
| SU542391A1 (ru) | Гидразид 2-(5-нитро-2-тиенил)-цинхониновой кислоты в качестве промежуточного продукта в синтезе арилгидразидов, обладающих мутагенным действием, и способ его полечени | |
| US3331851A (en) | Preparation of oxazolines by cyclodehydrohalogenating n-(beta-haloethyl)-amides | |
| SU566519A3 (ru) | Способ получени винилциклогексана | |
| SU451701A1 (ru) | Способ получени -сульфоланил3-формамида | |
| JPH049790B2 (enExample) | ||
| SU77730A1 (ru) | Способ получени хлорированных производных фенилсилантрихлорида | |
| Shimoharada et al. | Synthetic approach to a new heterocycle, isoindolo [2, 1-c] thiazole |