SU373920A1 - - Google Patents
Info
- Publication number
- SU373920A1 SU373920A1 SU10576A SU10576A SU373920A1 SU 373920 A1 SU373920 A1 SU 373920A1 SU 10576 A SU10576 A SU 10576A SU 10576 A SU10576 A SU 10576A SU 373920 A1 SU373920 A1 SU 373920A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- compounds
- alkyl
- plant
- results
- grown
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 14
- 241000196324 Embryophyta Species 0.000 description 9
- 241000209094 Oryza Species 0.000 description 5
- 230000000855 fungicidal effect Effects 0.000 description 5
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 239000002917 insecticide Substances 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 2
- 241000231139 Pyricularia Species 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000005359 phenoxyalkyl group Chemical group 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 241000238876 Acari Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- 241000488583 Panonychus ulmi Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- -1 halide compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU373920A1 true SU373920A1 (enrdf_load_stackoverflow) | |
| SU7944A1 SU7944A1 (ru) | 1929-02-28 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI63567C (fi) | Substituerad furan-2-karbonsyra-anilid med fungicidisk verkan och dess anvaendning | |
| US3499086A (en) | Methods and compositions for controlling fungal and bacterial infestation of plants utilizing organic tetravalent tin compounds | |
| HU182903B (en) | Process for preparing n-alkyl-anilide derivatives and fungicide compositions containing such compounds as active substances | |
| US3336186A (en) | Method of combating insects and acarids with certain phenyl-carbamate derivatives | |
| SU373920A1 (enrdf_load_stackoverflow) | ||
| US4076807A (en) | Phosphite-based fungicide compositions | |
| EP0153284B1 (en) | Aminoalkanephosphonic acids and derivatives thereof as fungicidal agents | |
| SE464029B (sv) | N-alkyl (en)-n-(o,o-disubstituerad-tiofosforyl)-n',n'-disubstituerade glycinamider och saett foer deras framstaellning samt akaricid, insekticid och fungicid, innehaallande dessa foereningar som aktiv bestaandsdel | |
| CZ274395A3 (en) | N-arylthiohydrazone derivatives as insecticidal and acaricidal preparations | |
| SU567390A3 (ru) | Способ борьбы с грибными болезн ми растений | |
| SU1111673A3 (ru) | Способ борьбы с сорн ками | |
| US4889944A (en) | Novel N-alkyl or N-alkenyl-N-(O,O-disubstituted-thio-phosphoryl)-N',N'-disubstituted glycin amides, process for the preparation thereof and acaricide, insecticide and fungicide containing these compounds as active ingredient | |
| US3542853A (en) | Aminomethyleneiminophenyl carbamates | |
| SU367575A1 (ru) | СССРОпубликовано 23.1.197,3. Бюллетень N° 8 Дата опубликовани описани 26.VI. 1973УДК 632.951(088.8) | |
| US4126678A (en) | Phosphite-based fungicide compositions | |
| SU482033A3 (ru) | Инсектицид,акарицид и фунгицид | |
| US4059609A (en) | S-naphthyl N-alkylthiolcarbamates | |
| JPS5912085B2 (ja) | 植物菌類性病害抑制方法 | |
| JPH054361B2 (enrdf_load_stackoverflow) | ||
| US4046883A (en) | Fungicidal compositions based on polyimides of phosphorus and method of treating plants therewith | |
| SU247148A1 (ru) | Инсектофунгицидный состав | |
| JPS5839121B2 (ja) | ガイチユウボウジヨホウホウ | |
| AT245861B (de) | Schädlingsbekämpfungsmittel mit insektizider und akarizider Wirkung | |
| SU356830A1 (ru) | Фунгицидная композиция | |
| SU288723A1 (enrdf_load_stackoverflow) |