SU354662A1 - - Google Patents
Info
- Publication number
- SU354662A1 SU354662A1 SU1496216A SU1496216A SU354662A1 SU 354662 A1 SU354662 A1 SU 354662A1 SU 1496216 A SU1496216 A SU 1496216A SU 1496216 A SU1496216 A SU 1496216A SU 354662 A1 SU354662 A1 SU 354662A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- dyes
- parts
- diamine
- amino
- Prior art date
Links
- 239000002253 acid Substances 0.000 description 12
- 239000000975 dye Substances 0.000 description 11
- 238000000034 method Methods 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000004985 diamines Chemical class 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- -1 amine naphthalene series Chemical class 0.000 description 1
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical class C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU354662A1 true SU354662A1 (enrdf_load_stackoverflow) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3970946B2 (ja) | アゾ染料混合物、アゾ染料、それらの製法及びそれらの用途 | |
| KR910001687B1 (ko) | 트리펜디옥사진 비닐 설폰의 제조방법 | |
| US3966705A (en) | Disulfo naphthalene containing fiber-reactive tetrazo dyes | |
| EP0252508B1 (en) | Water soluble disazo colorant and dyeing method using the same | |
| JPS587672B2 (ja) | 繊維反応性アゾ染料の製法 | |
| JPH0231749B2 (enrdf_load_stackoverflow) | ||
| EP0253932B1 (en) | A water soluble direct black polyazo dyestuffs mixture | |
| US4973671A (en) | Doubled copper formazan reactive dyes containing a monofluorotriazine or monochlorotriazine group | |
| US4066389A (en) | Sulfophenylamino containing tetrareactive triazine disazo dyestuffs and dyestuff compositions thereof | |
| SU354662A1 (enrdf_load_stackoverflow) | ||
| US3950128A (en) | Disazo dyestuffs | |
| US5059681A (en) | Bis-azotriazinyl reactive dyes having an n-alkyl-phenylenediamine link | |
| US4228071A (en) | Triazine containing fiber-reactive disazo dyestuffs | |
| SU451253A3 (ru) | Способ получени трифендиоксазинового активного красител | |
| US3163635A (en) | Water-soluble azo dyestuffs | |
| US5554733A (en) | Reactive azo dyes containing phenylamino-chlorotriazinylamino and α,β-dibromoproproylamino or α-bromoacryloylamino fiber reactive groups | |
| US5459244A (en) | Polyfunctional azo reactive dyestuffs containing a morpholinyl-substituted fluorotriazine radical | |
| US4699628A (en) | Process for the preparation of a water soluble direct green polyazo dyestuffs mixture in situ and water soluble direct green polyazo dyestuffs mixture obtained thereby | |
| Szadowski et al. | Synthesis and properties of disazo dyes derived from water-soluble derivatives of benzidine and 4, 4'-diaminodiphenylurea | |
| IE41484B1 (en) | Water-soluble benzene azo pyrazolone reactive monoazo dyestuffs processes for their preparation and use | |
| US4431584A (en) | Triazinyl reactive dyes containing a 1-naphtol-4,8-disulfonic acid component | |
| US1888516A (en) | Azo-dyestuffs containing chromium and process of making same | |
| SU350263A1 (ru) | Способ получения активных красителей | |
| US4758659A (en) | Hexakisazo dyes | |
| US4113719A (en) | 1:2-Cobalt-complex azo dyestuffs having an acetoacetylamino diphenylamino coupler |