SU340178A1 - - Google Patents
Info
- Publication number
- SU340178A1 SU340178A1 SU1225422A SU1225422A SU340178A1 SU 340178 A1 SU340178 A1 SU 340178A1 SU 1225422 A SU1225422 A SU 1225422A SU 1225422 A SU1225422 A SU 1225422A SU 340178 A1 SU340178 A1 SU 340178A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- group
- polymer
- group containing
- substituted
- butyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 12
- 229920000642 polymer Polymers 0.000 claims description 12
- 229920001577 copolymer Polymers 0.000 claims description 10
- 239000003381 stabilizer Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical class [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 claims description 5
- 150000001336 alkenes Chemical class 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 229920001519 homopolymer Polymers 0.000 claims description 3
- 125000005429 oxyalkyl group Chemical group 0.000 claims description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims description 2
- LVCDXCQFSONNDO-UHFFFAOYSA-N n-benzylhydroxylamine Chemical class ONCC1=CC=CC=C1 LVCDXCQFSONNDO-UHFFFAOYSA-N 0.000 claims description 2
- 230000006641 stabilisation Effects 0.000 claims description 2
- 238000011105 stabilization Methods 0.000 claims description 2
- -1 polyethylene Polymers 0.000 description 8
- 238000001125 extrusion Methods 0.000 description 7
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000004743 Polypropylene Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 3
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 description 1
- YHCGGLXPGFJNCO-UHFFFAOYSA-N 2-(2H-benzotriazol-4-yl)phenol Chemical class OC1=CC=CC=C1C1=CC=CC2=C1N=NN2 YHCGGLXPGFJNCO-UHFFFAOYSA-N 0.000 description 1
- STEZVUQNTYIOEQ-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methylsulfanylmethyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CSCC=2C(=CC=C(C)C=2)O)=C1 STEZVUQNTYIOEQ-UHFFFAOYSA-N 0.000 description 1
- MKFXLOAJVWVPGD-UHFFFAOYSA-N 2-[N-hydroxy-C-(2-hydroxyphenyl)carbonimidoyl]phenol Chemical class C=1C=CC=C(O)C=1C(=NO)C1=CC=CC=C1O MKFXLOAJVWVPGD-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- PWWSSIYVTQUJQQ-UHFFFAOYSA-N distearyl thiodipropionate Chemical class CCCCCCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCCCCCC PWWSSIYVTQUJQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU340178A1 true SU340178A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3850143T2 (de) | Antioxydante aromatische Fluorophosphite. | |
| DE2606358C2 (de) | Verwendung von Stabilisatorsystemen aus Triarylphosphiten und Phenolen | |
| JP5315238B2 (ja) | 安定剤としての液体ホスフィットブレンド | |
| EP0002821B1 (de) | Cyclische Phosphite und mit deren Hilfe stabilisiertes organisches Material | |
| DE2759879C2 (de) | Stabilisierte Polypropylen-Formmassen | |
| DE69704864T2 (de) | Stabilisatorzusammensetzungen | |
| US4650894A (en) | Tris-organophosphite compositions having improved hydrolytic stability | |
| DE69214718T2 (de) | 4,4'-Biphenylendiphosphonit Verbindungen und ihre Verwendung | |
| DD291772A5 (de) | Stabilisatorkompositionen und deren verwendung sowie verfahren zur herstellung von phosphoniten | |
| EP0000352B1 (de) | Aromatische cyclische Phosphonigsäure-diester und mit diesen Verbindungen stabilisiertes organisches Material | |
| US4739000A (en) | Antioxidant aromatic tetraphosphites | |
| US4724247A (en) | Antioxidant aromatic diphosphites | |
| EP0032681A2 (en) | Hindered bis-phenol phenyl phosphites and synthetic resin compositions having enhanced stability to heat and light | |
| US3412052A (en) | Novel flame retardant plastic compositions | |
| EP0374761B1 (de) | Verfahren zur Herstellung von phosphororganischen Derivaten des 2,4-Di-t-butylphenols, der 4,4'-Dihalogenmagnesium-Verbindungen des Biphenyls und die Verwendung der phosphororganischen Derivate zur Stabilisierung von Kunststoffen, insbesondere in Polyolefinformmassen | |
| SU340178A1 (enExample) | ||
| DE112004000970T5 (de) | Polymerzusammensetzungen, die Stabilisatorverbindungen umfassen, welche Tricyclodecylmethylgruppen besitzen | |
| US3560434A (en) | Enhancement of resistance of olefin polymers to copper-catalyzed oxidative degradation | |
| US3784650A (en) | 3,5-dialkyl-4-hydroxybenzyl mercapto (acetic acid ester)containing phosphites | |
| DE69508370T2 (de) | Phosphonig-, phosphinig- oder phosphonsäure Derivate als Stabilisatoren für organische Materialen | |
| EP0033395A2 (en) | 2,6-Di-tertiary butyl phenyl phosphites and synthetic resin compositions containing these phosphites | |
| DE69116996T2 (de) | Organische Phosphite als Stabilisatoren und sie enthaltende Polymer-Zusammensetzung | |
| DE69012929T2 (de) | Phosphitverbindung und deren anwendung. | |
| EP0553059B1 (de) | Neue Cycloalkyliden-bisphenol-phosphite | |
| DE1768750C3 (de) | Äther von 2,4,6, Tn s (di tert butyl hydroxy benzyl) phenolen |