SU316214A1 - - Google Patents
Info
- Publication number
- SU316214A1 SU316214A1 SU1279761A SU1279761A SU316214A1 SU 316214 A1 SU316214 A1 SU 316214A1 SU 1279761 A SU1279761 A SU 1279761A SU 1279761 A SU1279761 A SU 1279761A SU 316214 A1 SU316214 A1 SU 316214A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- compounds
- sprayed
- alkenyl
- alkyl
- hydrogen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 241000238876 Acari Species 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- -1 alkenyl hydrogen Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU316214A1 true SU316214A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU736856A3 (ru) | Способ борьбы с грибными заболевани ми растений | |
| SU1346043A3 (ru) | Способ получени производных 2-цианобензимидазола | |
| JPS638302A (ja) | 殺生剤用効力増強剤 | |
| HU176034B (en) | Insecticide, akaricide and nematocide compositions containing simmetric bis-carbamate derivatives, and process for producing the active agents | |
| US3400153A (en) | Nitroalkyl carbamoyloximes | |
| SU316214A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| US3113908A (en) | Destroying nematodes employing methyl isothiocyanate | |
| US3009855A (en) | Method and composition of destroying insects employing 1-naphthyl n-methyl carbamate | |
| US3466316A (en) | Alpha-cyano carbamoyloxime compounds | |
| PL95242B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| CN1083690C (zh) | 抗虫卵方法 | |
| DE2015527A1 (de) | Cyanalkylaldoximcarbamate und ihre Verwendung | |
| CH616654A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| CA1100981A (en) | N-aminothio derivatives of n-methyl carbamates | |
| US3930002A (en) | Carbamate pesticidal compositions | |
| US4122204A (en) | N-(4-tert-butylphenylthiosulfenyl)-N-alkyl aryl carbamate compounds | |
| FI59996B (fi) | Bensimidazol-1-karboximidsyraestrar anvaendbara i fungicider och insekticider | |
| CH506237A (de) | Gegebenenfalls substituiertes N,N'-Bis-(carbamoyloxy)-dithiooxalimidat enthaltendes Schädlingsbekämpfungsmittel | |
| US3965137A (en) | Thiocyano xanthates | |
| US4003897A (en) | Carbamate pesticidal compounds | |
| US3966953A (en) | 2-(Carbamoyloximino)-4-thiazolidinone compounds as insecticidal, miticidal or nematocidal agents | |
| CA1080617A (en) | Pesticides | |
| SU1111673A3 (ru) | Способ борьбы с сорн ками | |
| SU519109A3 (ru) | Фунгицидное средство | |
| DE2943019A1 (de) | Mikrobizides mittel |