SU212179A1 - - Google Patents
Info
- Publication number
 - SU212179A1 SU212179A1 SU1118291A SU1118291A SU212179A1 SU 212179 A1 SU212179 A1 SU 212179A1 SU 1118291 A SU1118291 A SU 1118291A SU 1118291 A SU1118291 A SU 1118291A SU 212179 A1 SU212179 A1 SU 212179A1
 - Authority
 - SU
 - USSR - Soviet Union
 - Prior art keywords
 - methyl
 - atom
 - aralkyl
 - oxygen
 - compounds
 - Prior art date
 
Links
- 150000001875 compounds Chemical class 0.000 description 9
 - 239000000203 mixture Substances 0.000 description 8
 - 125000003710 aryl alkyl group Chemical group 0.000 description 6
 - 150000002596 lactones Chemical group 0.000 description 6
 - 229910052760 oxygen Inorganic materials 0.000 description 6
 - 229910052717 sulfur Inorganic materials 0.000 description 6
 - 125000000217 alkyl group Chemical group 0.000 description 5
 - 239000001301 oxygen Substances 0.000 description 5
 - 239000012141 concentrate Substances 0.000 description 4
 - 239000007788 liquid Substances 0.000 description 4
 - 238000002360 preparation method Methods 0.000 description 4
 - 241000238876 Acari Species 0.000 description 3
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
 - MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
 - 241000238631 Hexapoda Species 0.000 description 3
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
 - NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
 - 238000009472 formulation Methods 0.000 description 3
 - 239000002917 insecticide Substances 0.000 description 3
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
 - 244000045947 parasite Species 0.000 description 3
 - 229910052698 phosphorus Inorganic materials 0.000 description 3
 - 239000011593 sulfur Substances 0.000 description 3
 - 125000004434 sulfur atom Chemical group 0.000 description 3
 - 241000255925 Diptera Species 0.000 description 2
 - 125000003277 amino group Chemical group 0.000 description 2
 - 125000004103 aminoalkyl group Chemical group 0.000 description 2
 - 125000003118 aryl group Chemical group 0.000 description 2
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
 - 125000000753 cycloalkyl group Chemical group 0.000 description 2
 - 239000006185 dispersion Substances 0.000 description 2
 - 125000004185 ester group Chemical group 0.000 description 2
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
 - 125000000262 haloalkenyl group Chemical group 0.000 description 2
 - 125000000623 heterocyclic group Chemical group 0.000 description 2
 - 229910052739 hydrogen Inorganic materials 0.000 description 2
 - 239000001257 hydrogen Substances 0.000 description 2
 - 238000000034 method Methods 0.000 description 2
 - 229910052757 nitrogen Inorganic materials 0.000 description 2
 - 125000004433 nitrogen atom Chemical group N* 0.000 description 2
 - 239000003960 organic solvent Substances 0.000 description 2
 - 239000000575 pesticide Substances 0.000 description 2
 - 125000004437 phosphorous atom Chemical group 0.000 description 2
 - 239000002689 soil Substances 0.000 description 2
 - 239000007787 solid Substances 0.000 description 2
 - 239000000126 substance Substances 0.000 description 2
 - 239000004094 surface-active agent Substances 0.000 description 2
 - IYLGZMTXKJYONK-ACLXAEORSA-N (12s,15r)-15-hydroxy-11,16-dioxo-15,20-dihydrosenecionan-12-yl acetate Chemical group O1C(=O)[C@](CC)(O)C[C@@H](C)[C@](C)(OC(C)=O)C(=O)OCC2=CCN3[C@H]2[C@H]1CC3 IYLGZMTXKJYONK-ACLXAEORSA-N 0.000 description 1
 - 241001124076 Aphididae Species 0.000 description 1
 - 240000007124 Brassica oleracea Species 0.000 description 1
 - 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
 - 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
 - 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
 - 229920000742 Cotton Polymers 0.000 description 1
 - 241000256113 Culicidae Species 0.000 description 1
 - 241000254171 Curculionidae Species 0.000 description 1
 - 241000196324 Embryophyta Species 0.000 description 1
 - 241000219146 Gossypium Species 0.000 description 1
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
 - XIYZMOFCMDIBKI-UHFFFAOYSA-N Isolin Natural products CCC1C(OC(=O)C)C(C)C(C)(O)C(=O)OCC2=CCN3CCC(OC1=O)C23 XIYZMOFCMDIBKI-UHFFFAOYSA-N 0.000 description 1
 - 241000258916 Leptinotarsa decemlineata Species 0.000 description 1
 - 241000124008 Mammalia Species 0.000 description 1
 - 241001325166 Phacelia congesta Species 0.000 description 1
 - OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
 - 241000607479 Yersinia pestis Species 0.000 description 1
 - 230000000895 acaricidal effect Effects 0.000 description 1
 - 239000000642 acaricide Substances 0.000 description 1
 - 239000013543 active substance Substances 0.000 description 1
 - 239000000443 aerosol Substances 0.000 description 1
 - 125000003342 alkenyl group Chemical group 0.000 description 1
 - 125000003545 alkoxy group Chemical group 0.000 description 1
 - -1 alkylmercaptoalkyl Chemical group 0.000 description 1
 - 238000007796 conventional method Methods 0.000 description 1
 - 230000006378 damage Effects 0.000 description 1
 - 239000003085 diluting agent Substances 0.000 description 1
 - 239000002270 dispersing agent Substances 0.000 description 1
 - 238000010410 dusting Methods 0.000 description 1
 - 230000000694 effects Effects 0.000 description 1
 - 239000000839 emulsion Substances 0.000 description 1
 - 229910052602 gypsum Inorganic materials 0.000 description 1
 - 239000010440 gypsum Substances 0.000 description 1
 - 125000005343 heterocyclic alkyl group Chemical group 0.000 description 1
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
 - NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
 - 231100001231 less toxic Toxicity 0.000 description 1
 - 125000004430 oxygen atom Chemical group O* 0.000 description 1
 - 239000011574 phosphorus Substances 0.000 description 1
 - 239000002904 solvent Substances 0.000 description 1
 - 238000005507 spraying Methods 0.000 description 1
 - 230000009885 systemic effect Effects 0.000 description 1
 - 231100000331 toxic Toxicity 0.000 description 1
 - 230000002588 toxic effect Effects 0.000 description 1
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
 - 238000009736 wetting Methods 0.000 description 1
 - 239000000080 wetting agent Substances 0.000 description 1
 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| SU212179A1 true SU212179A1 (forum.php) | 
Family
ID=
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| GB1163711A (en) | Substituted Benzimidazoles and Biocidally-Active Compositions | |
| CS227693B2 (en) | Insecticide and method of its preparation | |
| AU2016290577B2 (en) | Compositions and methods for the control of arthropods | |
| JPS5942646B2 (ja) | 忌避剤 | |
| SU212179A1 (forum.php) | ||
| SU586820A3 (ru) | Способ борьбы с насекомыми и клещами и пестицидна композици дл его осуществлени | |
| HU184676B (en) | Pesticide preparation containing organic phosphorus compound and pyretroide derivative | |
| US3105000A (en) | Organo-tin and organo-sulphur parasiticides | |
| US2403495A (en) | Insecticide | |
| JPS5821602B2 (ja) | 殺虫剤組成物 | |
| SU578829A3 (ru) | Способ борьбы с насекомыми и клещами | |
| JPS6210202B2 (forum.php) | ||
| JPS60109508A (ja) | 除草剤組成物 | |
| JPH0558811A (ja) | 殺虫組成物 | |
| US3261743A (en) | Controlling nematodes with organic phosphonothioites and phosphonothioates | |
| US3318764A (en) | Method for controlling nematodes with phosphorous compounds | |
| IL40476A (en) | O,s-dialkyl-o-phenyl thiophosphoric acid esters,their manufacture and their use in pest control | |
| KR810000387B1 (ko) | O,s-디알킬 o-설포닐옥시페닐 포스포로 디티올산염의 제조방법 | |
| SU578830A3 (ru) | Способ борьбы с насекомыми, клещами и нематодами | |
| US4216213A (en) | Acaricidal and insecticidal compositions | |
| US4024252A (en) | 2-(5-Ethyl-6-bromothiazolo[3,2-b]-5-triazolyl)thiophosphonate esters, compositions and method of use | |
| DE1180736B (de) | Verfahren zur Herstellung von ungesaettigten Thiophosphorsaeureestern | |
| SU578935A1 (ru) | Синергист пиретринов | |
| SU383233A1 (forum.php) | ||
| US2388684A (en) | Insecticide |