SU208699A1 - - Google Patents
Info
- Publication number
- SU208699A1 SU208699A1 SU897413A SU897413A SU208699A1 SU 208699 A1 SU208699 A1 SU 208699A1 SU 897413 A SU897413 A SU 897413A SU 897413 A SU897413 A SU 897413A SU 208699 A1 SU208699 A1 SU 208699A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- crystals
- carbonization
- introduction
- polyacrylamide
- surfactants
- Prior art date
Links
- 239000013078 crystal Substances 0.000 description 11
- 238000000034 method Methods 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 238000003763 carbonization Methods 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 4
- 239000012267 brine Substances 0.000 description 3
- 229920002401 polyacrylamide Polymers 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU208699A1 true SU208699A1 (enExample) |
Family
ID=
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4478599A (en) * | 1982-05-25 | 1984-10-23 | Kerr-Mcgee Chemical Corporation | Method of continuously controlling crystal fines formation |
| RU2622126C2 (ru) * | 2011-12-21 | 2017-06-13 | Солвей Са | Способ приготовления частиц гидрокарбоната натрия |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4478599A (en) * | 1982-05-25 | 1984-10-23 | Kerr-Mcgee Chemical Corporation | Method of continuously controlling crystal fines formation |
| RU2622126C2 (ru) * | 2011-12-21 | 2017-06-13 | Солвей Са | Способ приготовления частиц гидрокарбоната натрия |
| US9695059B2 (en) | 2011-12-21 | 2017-07-04 | Solvay Sa | Process for preparing sodium bicarbonate particles |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU208699A1 (enExample) | ||
| US1815276A (en) | Process of manufacturing sugar | |
| US2007971A (en) | Process of making sugar products | |
| US2191365A (en) | Process for purifying sugar juices and solutions | |
| US4340612A (en) | Process for spinning fish proteins | |
| DE2808424A1 (de) | Verfahren zur gewinnung von kristallen von natriumcarbonatmonohydrat | |
| US2389119A (en) | Process for the production of dextrose | |
| NL8101908A (nl) | Werkwijze voor het extraheren van suiker uit suikerhoudende planteweefsels. | |
| DE846164C (de) | Verfahren zur Herstellung von Polyamiden | |
| DE50005610D1 (de) | Verfahren zur aufbereitung von salzsole und alkalihalogenide, erhalten aus einem verfahren zur aufbereitung von salzsole | |
| US2249920A (en) | Sugar refining | |
| JPS5852986B2 (ja) | ベタイン複塩の製造法 | |
| US1533033A (en) | Process for treating liquids | |
| SU467750A1 (ru) | Способ кристаллизации | |
| SU1227666A1 (ru) | Способ очистки клеровки желтого сахара | |
| RU1709732C (ru) | Способ получения диффузионного сока | |
| US2488974A (en) | Extraction of sugar from sugarcontaining liquids | |
| US2337853A (en) | Manufacture of dextrose | |
| RU2087461C1 (ru) | Способ получения винной кислоты из виннокислой извести | |
| DE99384C (enExample) | ||
| US1658998A (en) | Process of making grape sugar | |
| US2072639A (en) | Bleaching sugar | |
| US3876466A (en) | Manufacture of sugar | |
| SU196730A1 (ru) | Способ получения кристаллического хлоратанатрия | |
| US1399533A (en) | Processes of systematically sulfurating the juices obtained during the manufacture of sugar |