SU206572A1 - - Google Patents
Info
- Publication number
- SU206572A1 SU206572A1 SU936989A SU936989A SU206572A1 SU 206572 A1 SU206572 A1 SU 206572A1 SU 936989 A SU936989 A SU 936989A SU 936989 A SU936989 A SU 936989A SU 206572 A1 SU206572 A1 SU 206572A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- bromine
- acid
- solution
- filtrate
- filtration
- Prior art date
Links
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 239000000706 filtrate Substances 0.000 claims description 5
- 238000001914 filtration Methods 0.000 claims description 5
- 239000000047 product Substances 0.000 claims description 3
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 2
- 150000004056 anthraquinones Chemical class 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 4
- QZZSAWGVHXXMID-UHFFFAOYSA-N 1-amino-4-bromo-9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=CC=C2C(=O)C3=C(Br)C=C(S(O)(=O)=O)C(N)=C3C(=O)C2=C1 QZZSAWGVHXXMID-UHFFFAOYSA-N 0.000 description 3
- PZSHANOBYYVNEX-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-sulfonic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(S(O)(=O)=O)=C2N PZSHANOBYYVNEX-UHFFFAOYSA-N 0.000 description 3
- INPPNPYTEFTFQG-UHFFFAOYSA-N 2-amino-1-bromoanthracene-9,10-dione Chemical class C1=CC=C2C(=O)C3=C(Br)C(N)=CC=C3C(=O)C2=C1 INPPNPYTEFTFQG-UHFFFAOYSA-N 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FNXLCIKXHOPCKH-UHFFFAOYSA-N bromamine Chemical class BrN FNXLCIKXHOPCKH-UHFFFAOYSA-N 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU206572A1 true SU206572A1 (cs) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2287521C2 (ru) | Очистка 2-нитро-4-метилсульфонилбензойной кислоты | |
| SU206572A1 (cs) | ||
| US2745872A (en) | Isophthalic acid and terephthalic acid separation | |
| US4061646A (en) | Process for purification of crude 2-mercaptobenzothiazole | |
| US5116997A (en) | Purification of indigo | |
| SU1004328A1 (ru) | Способ получени мононатриевой соли 4-хлорфталевой кислоты | |
| SU1129204A1 (ru) | Способ получени сернокислотной пасты 1,5-диокси-2,6-дисульфоантрахинона | |
| US4246180A (en) | Process for separating off 1-amino-4-bromoanthraquinone-2-sulphonic acid | |
| US4145349A (en) | Process for the production of saccharine | |
| US3888885A (en) | Process for the preparation of 4-chloro-naphthalic acid anhydride | |
| JP2931393B2 (ja) | 2−アミノベンゼン−1,4−ジスルホン酸の製法 | |
| JP3020433B2 (ja) | 黄色建染染料の製造方法 | |
| US3849452A (en) | Process for producing alpha-anthraquinone-sulfonates with low mercury content | |
| SU345180A1 (ru) | Способ очистки лейкопарафуксина | |
| SU361176A1 (ru) | Способ получепия бистиофосфиновых кислот или их кислородных аналогов | |
| SU341824A1 (ru) | Способ получения активного медьсодержащего моноазокрасителя | |
| US4181805A (en) | Process for the preparation of pure sodium hydroxide addition compounds of cis-isomers of naphthoylene-bis-benzimidazoles | |
| SU355150A1 (cs) | ||
| SU654596A1 (ru) | Способ выделени антрацена из антраценовой фракции | |
| SU1081161A1 (ru) | Способ выделени натриевой соли м-нитробензолсульфокислоты | |
| JPH0512344B2 (cs) | ||
| US5068437A (en) | Process for producing 2-(p-chlorophenoxy) aniline | |
| SU266977A1 (ru) | Способ очистки лейкопарафуксина | |
| JPH0455184B2 (cs) | ||
| SU793377A3 (ru) | Способ получени терефталевой кислоты |