SU192793A1 - - Google Patents
Info
- Publication number
- SU192793A1 SU192793A1 SU1064331A SU1064331A SU192793A1 SU 192793 A1 SU192793 A1 SU 192793A1 SU 1064331 A SU1064331 A SU 1064331A SU 1064331 A SU1064331 A SU 1064331A SU 192793 A1 SU192793 A1 SU 192793A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mixture
- acid
- solvent
- water
- ethanol
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- 238000000034 method Methods 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- KHARCSTZAGNHOT-UHFFFAOYSA-N naphthalene-2,3-dicarboxylic acid Chemical class C1=CC=C2C=C(C(O)=O)C(C(=O)O)=CC2=C1 KHARCSTZAGNHOT-UHFFFAOYSA-N 0.000 description 6
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU192793A1 true SU192793A1 (enrdf_load_stackoverflow) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100572158B1 (ko) | 말론산과 이들의 에스테르들 | |
| JPH0324068A (ja) | アスコルビン酸の製法 | |
| US2971010A (en) | Production of dicarboxylic acid anhydrides | |
| KR100552262B1 (ko) | 정제된 테레프탈산과 이소프탈산을 혼합 크실렌으로부터제조하는 방법 | |
| US2462251A (en) | Process for preparing ascorbic acids | |
| US3824286A (en) | Preparation of polyacetylalkylene diamines | |
| JPS6233223B2 (enrdf_load_stackoverflow) | ||
| SU192793A1 (enrdf_load_stackoverflow) | ||
| US4370487A (en) | Process for, respectively, the production and purification of dicarboxylic and polycarboxylic acid anhydrides | |
| US3391187A (en) | Purification of malic acid | |
| US3637832A (en) | Preparation of straight chain dicarboxylic acids | |
| US3832357A (en) | Process for preparation of 3-hydroxy-2-alkyl-4-pyrone | |
| US4097522A (en) | Synthesis of m-benzoyl-hydratropic acid | |
| US3359283A (en) | Recovery of dicarboxylic acid anhydrides from aqueous acid solution | |
| US4775448A (en) | Isolation process | |
| SU235029A1 (ru) | Способ получения 4-алкил(ариламино)-7- карбоксихинолинов | |
| CN112724012B (zh) | 一种精制长链二元酸的方法 | |
| US3657333A (en) | Process for the production of pure fumaric acid from aqueous solutions thereof | |
| US4017520A (en) | Production of maleic anhydride by azeotropic dehydration of maleic acid solutions derived from benzene oxidation processes | |
| SU539879A1 (ru) | Способ очистки сульфадимезина | |
| US2818411A (en) | Separation of gamma picoline | |
| RU1830383C (ru) | Способ получени гидроарсената щелочного металла | |
| SU160176A1 (enrdf_load_stackoverflow) | ||
| SU158273A1 (enrdf_load_stackoverflow) | ||
| SU422721A1 (ru) | Способ получения алкилантрахинонов |