SU160176A1 - - Google Patents
Info
- Publication number
- SU160176A1 SU160176A1 SU787677A SU787677A SU160176A1 SU 160176 A1 SU160176 A1 SU 160176A1 SU 787677 A SU787677 A SU 787677A SU 787677 A SU787677 A SU 787677A SU 160176 A1 SU160176 A1 SU 160176A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phthalic anhydride
- distillation
- column
- product
- processor
- Prior art date
Links
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 21
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 21
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- -1 alkali metal phthalates Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000001309 chloro group Chemical class Cl* 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- HQWKKEIVHQXCPI-UHFFFAOYSA-L disodium;phthalate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C([O-])=O HQWKKEIVHQXCPI-UHFFFAOYSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU160176A1 true SU160176A1 (enrdf_load_stackoverflow) |
Family
ID=
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5145971A (en) * | 1991-10-25 | 1992-09-08 | Occidental Chemical Corporation | Process for the preparation of oxydiphthalic acid and purified oxydiphthalic anhydride from crude oxydiphthalic anhydride |
| RU2694224C1 (ru) * | 2018-11-02 | 2019-07-10 | Ооо "Фамэк" | Способ дистилляции фталевого ангидрида-сырца |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5145971A (en) * | 1991-10-25 | 1992-09-08 | Occidental Chemical Corporation | Process for the preparation of oxydiphthalic acid and purified oxydiphthalic anhydride from crude oxydiphthalic anhydride |
| RU2694224C1 (ru) * | 2018-11-02 | 2019-07-10 | Ооо "Фамэк" | Способ дистилляции фталевого ангидрида-сырца |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0764627B1 (en) | Process for producing highly pure terephthalic acid | |
| KR100214397B1 (ko) | 테레프탈산의 생산방법 | |
| RU2326105C2 (ru) | Способ удаления железосодержащих загрязняющих веществ из жидких потоков в процессе производства и/или очистки ароматических кислот | |
| GB1593117A (en) | Process for the recovery of catalyst and solvent from the mother lquor of a process for the synthesis of therephthalic acid | |
| US6150553A (en) | Method for recovering methyl acetate and residual acetic acid in the production acid of pure terephthalic acid | |
| US4568427A (en) | Continuous isolation of phthalic anhydride and maleic anhydride from reaction gases | |
| CZ288198B6 (en) | Purification process of acrylic acid obtained by catalytic oxidation of propylene | |
| US4032563A (en) | Process for the recovery of high purity diesters of terephthalic or isophthalic acids | |
| EP0102642A1 (en) | Process for purifying methacrylic acid | |
| RU2671210C2 (ru) | Получение ароматической дикарбоновой кислоты | |
| US2134531A (en) | Purification of maleic anhydride | |
| EP0494527B1 (en) | Process for purification of carboxylic acids | |
| EP1104396B1 (en) | Method for recovering methyl acetate and residual acetic acid in the production of pure terephthalic acid | |
| SU160176A1 (enrdf_load_stackoverflow) | ||
| KR20150139820A (ko) | 방향족 산의 제조에서의 공비 증류에 의한 아세트산의 탈수 | |
| US3965126A (en) | Recovering maleic anhydride from the effluent from the production of phthalic anhydride | |
| KR20130090897A (ko) | 필터 공급 슬러리중 물의 백분율을 제어함으로써 테레프탈산 퍼지 여과 속도를 개선하는 방법 | |
| KR101946657B1 (ko) | 필터 공급 슬러리중 물의 백분율을 제어함으로써 테레프탈산 퍼지 여과 속도를 개선하는 방법 | |
| KR101943116B1 (ko) | 필터 공급 슬러리중 물의 백분율을 제어함으로써 테레프탈산 퍼지 여과 속도를 개선하는 방법 | |
| US3993671A (en) | Method for the continuous dehydration of maleic acid | |
| US4098838A (en) | Process for obtaining sulfur free pure naphthalene from bituminous coal tar and thionaphthene as a by-product | |
| KR20020022815A (ko) | 규격에 따른 프탈산 무수물의 제조 방법 | |
| JPS60152438A (ja) | メタクリル酸の精製方法 | |
| US3455963A (en) | Process for the extraction of citraconic acid | |
| US4017520A (en) | Production of maleic anhydride by azeotropic dehydration of maleic acid solutions derived from benzene oxidation processes |