SU191714A1 - - Google Patents
Info
- Publication number
- SU191714A1 SU191714A1 SU917385A SU917385A SU191714A1 SU 191714 A1 SU191714 A1 SU 191714A1 SU 917385 A SU917385 A SU 917385A SU 917385 A SU917385 A SU 917385A SU 191714 A1 SU191714 A1 SU 191714A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dye
- triazine
- dyes
- solution
- trichloromethyl
- Prior art date
Links
- 239000000975 dye Substances 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 5
- -1 sulfo, nitro, methoxy, methyl Chemical group 0.000 description 5
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 4
- JTDVTKHIUJFIGA-UHFFFAOYSA-N 2,4-dichloro-6-(trichloromethyl)-1,3,5-triazine Chemical compound ClC1=NC(Cl)=NC(C(Cl)(Cl)Cl)=N1 JTDVTKHIUJFIGA-UHFFFAOYSA-N 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000987 azo dye Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000002594 sorbent Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU191714A1 true SU191714A1 (pm) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3647778A (en) | Reactive disazo dyestuffs containing triazines | |
| US3883523A (en) | Triazine derivatives of triphenodioxazines | |
| KR850001475B1 (ko) | 셀룰로스 섬유용 아조 염료의 제조방법 | |
| JP3137725B2 (ja) | 反応性アゾ染料 | |
| EP0042108B1 (en) | Reactive dyes, their use and cellulose fibers dyed therewith | |
| SU191714A1 (pm) | ||
| US5968208A (en) | Negative dyes and coloration process using them | |
| EP0042204A2 (en) | Reactive dyestuffs | |
| US5059681A (en) | Bis-azotriazinyl reactive dyes having an n-alkyl-phenylenediamine link | |
| US5872228A (en) | Process for the preparation of reactive azo dyes | |
| EP0001629B1 (de) | Wasserlösliche, faserreaktive grüne Phthalocyanin-Azofarbstoffe, ihre Herstellung und ihre Verwendung | |
| GB2103232A (en) | Arylazo-aminonaphtholsulfonic acid | |
| CS222246B2 (en) | Method of preparation of the reactive dye | |
| US4988802A (en) | Reactive dyes with three reactive groups | |
| KR890002825B1 (ko) | 수용성 디스아조 화합물의 제조방법 | |
| SU350263A1 (ru) | Способ получения активных красителей | |
| KR100517525B1 (ko) | 반응성 디아민-결합된 아조 염료 | |
| US5223607A (en) | Reactive azo dyes with at lest two reactive halotriazine groups | |
| JPH02228368A (ja) | 反応性染料 | |
| EP0276686B1 (en) | Anthraquinone compound and dyeing or printing method using the same | |
| SU373954A1 (ru) | Способ получения активных красителей | |
| US4372892A (en) | Process for the preparation of 1-aminobenzene-5-β-sulfatoethylsulfone-2,4-disulfonic acid, the 5-vinylsulfone compound and the alkali salts thereof | |
| US3102886A (en) | New water soluble dyestuffs of the pyrene-quinone and pyrene-quinone-carbazole series capable of being chemically fixed on fibers | |
| US3651055A (en) | Anthraquinonyl-triazine dyestuffs | |
| SU332636A1 (ru) | Способ получения активных красителей |