SK285040B6 - Netoxická a nekorózna zážihová zlož - Google Patents
Netoxická a nekorózna zážihová zlož Download PDFInfo
- Publication number
- SK285040B6 SK285040B6 SK1367-2000A SK13672000A SK285040B6 SK 285040 B6 SK285040 B6 SK 285040B6 SK 13672000 A SK13672000 A SK 13672000A SK 285040 B6 SK285040 B6 SK 285040B6
- Authority
- SK
- Slovakia
- Prior art keywords
- group
- tetrazene
- weight
- composition according
- nitrocellulose
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 44
- 231100000252 nontoxic Toxicity 0.000 title claims abstract description 4
- 230000003000 nontoxic effect Effects 0.000 title claims abstract description 4
- 150000004655 tetrazenes Chemical class 0.000 claims abstract description 42
- 229910052796 boron Inorganic materials 0.000 claims abstract description 15
- 239000002360 explosive Substances 0.000 claims abstract description 15
- 239000007800 oxidant agent Substances 0.000 claims abstract description 11
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims abstract description 9
- -1 nitro amines Chemical class 0.000 claims abstract description 8
- 150000003839 salts Chemical class 0.000 claims abstract description 7
- 239000000446 fuel Substances 0.000 claims abstract description 6
- 230000001590 oxidative effect Effects 0.000 claims abstract description 6
- 229910044991 metal oxide Inorganic materials 0.000 claims abstract description 5
- 150000004706 metal oxides Chemical class 0.000 claims abstract description 5
- 239000003795 chemical substances by application Substances 0.000 claims abstract 3
- 150000002978 peroxides Chemical class 0.000 claims abstract 3
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 claims description 28
- 239000000020 Nitrocellulose Substances 0.000 claims description 22
- 229920001220 nitrocellulos Polymers 0.000 claims description 22
- 239000011230 binding agent Substances 0.000 claims description 13
- 239000010949 copper Substances 0.000 claims description 12
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 claims description 8
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052802 copper Inorganic materials 0.000 claims description 7
- AGUIVNYEYSCPNI-UHFFFAOYSA-N N-methyl-N-picrylnitramine Chemical group [O-][N+](=O)N(C)C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O AGUIVNYEYSCPNI-UHFFFAOYSA-N 0.000 claims description 6
- 239000011135 tin Substances 0.000 claims description 6
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 5
- 229910052797 bismuth Inorganic materials 0.000 claims description 5
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000005337 ground glass Substances 0.000 claims description 4
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical class N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 235000010333 potassium nitrate Nutrition 0.000 claims description 4
- 239000004323 potassium nitrate Substances 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical class [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 claims description 3
- 230000009972 noncorrosive effect Effects 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 239000000028 HMX Substances 0.000 claims description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 2
- 150000004972 metal peroxides Chemical class 0.000 claims description 2
- UZGLIIJVICEWHF-UHFFFAOYSA-N octogen Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)CN([N+]([O-])=O)C1 UZGLIIJVICEWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 2
- 150000002926 oxygen Chemical class 0.000 claims 2
- 241000220479 Acacia Species 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 229910000476 molybdenum oxide Inorganic materials 0.000 claims 1
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical class [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 claims 1
- 229910001887 tin oxide Inorganic materials 0.000 claims 1
- 229910001935 vanadium oxide Inorganic materials 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- 239000002253 acid Substances 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 230000004913 activation Effects 0.000 abstract 1
- 230000008878 coupling Effects 0.000 abstract 1
- 238000010168 coupling process Methods 0.000 abstract 1
- 238000005859 coupling reaction Methods 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 239000011521 glass Substances 0.000 description 34
- 235000010489 acacia gum Nutrition 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 9
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- IUKSYUOJRHDWRR-UHFFFAOYSA-N 2-diazonio-4,6-dinitrophenolate Chemical compound [O-]C1=C([N+]#N)C=C([N+]([O-])=O)C=C1[N+]([O-])=O IUKSYUOJRHDWRR-UHFFFAOYSA-N 0.000 description 4
- 244000215068 Acacia senegal Species 0.000 description 4
- 229920000084 Gum arabic Polymers 0.000 description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 4
- 239000000205 acacia gum Substances 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910015902 Bi 2 O 3 Inorganic materials 0.000 description 3
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 3
- 229910006404 SnO 2 Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 229910052726 zirconium Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- WETZJIOEDGMBMA-UHFFFAOYSA-L lead styphnate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([O-])=C1[N+]([O-])=O WETZJIOEDGMBMA-UHFFFAOYSA-L 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- DHEQXMRUPNDRPG-UHFFFAOYSA-N strontium nitrate Chemical compound [Sr+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O DHEQXMRUPNDRPG-UHFFFAOYSA-N 0.000 description 2
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical compound [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 229910052582 BN Inorganic materials 0.000 description 1
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- 239000000006 Nitroglycerin Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- CZBAOTHTKHKSRS-UHFFFAOYSA-O [N+](=O)([O-])[O-].[NH4+].[Cu] Chemical compound [N+](=O)([O-])[O-].[NH4+].[Cu] CZBAOTHTKHKSRS-UHFFFAOYSA-O 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- CZPONYHBMZVWTM-UHFFFAOYSA-N azane;nitric acid Chemical compound N.N.O[N+]([O-])=O CZPONYHBMZVWTM-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 150000001622 bismuth compounds Chemical class 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 229910000435 bromine oxide Inorganic materials 0.000 description 1
- 229910021346 calcium silicide Inorganic materials 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 230000003749 cleanliness Effects 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- PPNKDDZCLDMRHS-UHFFFAOYSA-N dinitrooxybismuthanyl nitrate Chemical class [Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PPNKDDZCLDMRHS-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 229960005191 ferric oxide Drugs 0.000 description 1
- 239000003546 flue gas Substances 0.000 description 1
- 229960003711 glyceryl trinitrate Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- DLINORNFHVEIFE-UHFFFAOYSA-N hydrogen peroxide;zinc Chemical compound [Zn].OO DLINORNFHVEIFE-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- FMSOWMGJJIHFTQ-UHFFFAOYSA-N oxidobromine(.) Chemical compound Br[O] FMSOWMGJJIHFTQ-UHFFFAOYSA-N 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- YQMWDQQWGKVOSQ-UHFFFAOYSA-N trinitrooxystannyl nitrate Chemical compound [Sn+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O YQMWDQQWGKVOSQ-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 239000003232 water-soluble binding agent Substances 0.000 description 1
- 229940105296 zinc peroxide Drugs 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06C—DETONATING OR PRIMING DEVICES; FUSES; CHEMICAL LIGHTERS; PYROPHORIC COMPOSITIONS
- C06C7/00—Non-electric detonators; Blasting caps; Primers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Glass Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Fire-Extinguishing Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CZ19993305A CZ288858B6 (cs) | 1999-09-17 | 1999-09-17 | Netoxická a nekorozivní zážehová slož |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK13672000A3 SK13672000A3 (sk) | 2001-04-09 |
| SK285040B6 true SK285040B6 (sk) | 2006-05-04 |
Family
ID=5466514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK1367-2000A SK285040B6 (sk) | 1999-09-17 | 2000-09-13 | Netoxická a nekorózna zážihová zlož |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US6964287B1 (cs) |
| EP (1) | EP1216215B1 (cs) |
| AT (1) | ATE267784T1 (cs) |
| AU (1) | AU6978600A (cs) |
| CA (1) | CA2382688A1 (cs) |
| CZ (1) | CZ288858B6 (cs) |
| DE (1) | DE60011109T2 (cs) |
| HK (1) | HK1049144A1 (cs) |
| PT (1) | PT1216215E (cs) |
| SK (1) | SK285040B6 (cs) |
| TR (1) | TR200200668T2 (cs) |
| WO (1) | WO2001021558A1 (cs) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10221044A1 (de) * | 2001-05-10 | 2002-11-14 | Dynamit Nobel Ag | Anzündmittel |
| US6878221B1 (en) * | 2003-01-30 | 2005-04-12 | Olin Corporation | Lead-free nontoxic explosive mix |
| WO2004069771A1 (en) * | 2003-02-05 | 2004-08-19 | Metlite Alloys Gauteng (Pty) Ltd. | Explosive composition |
| US8784583B2 (en) * | 2004-01-23 | 2014-07-22 | Ra Brands, L.L.C. | Priming mixtures for small arms |
| US20060219341A1 (en) | 2005-03-30 | 2006-10-05 | Johnston Harold E | Heavy metal free, environmentally green percussion primer and ordnance and systems incorporating same |
| FR2897864B1 (fr) * | 2006-02-24 | 2008-04-11 | Cheddite France Sa | Composition d'amorcage et applications |
| US8641842B2 (en) | 2011-08-31 | 2014-02-04 | Alliant Techsystems Inc. | Propellant compositions including stabilized red phosphorus, a method of forming same, and an ordnance element including the same |
| US20130333815A1 (en) | 2012-06-13 | 2013-12-19 | Alliant Techsystems Inc. | Non-lethal payloads and methods of producing same |
| US8192568B2 (en) | 2007-02-09 | 2012-06-05 | Alliant Techsystems Inc. | Non-toxic percussion primers and methods of preparing the same |
| US8202377B2 (en) | 2007-02-09 | 2012-06-19 | Alliant Techsystems Inc. | Non-toxic percussion primers and methods of preparing the same |
| WO2010052269A1 (de) * | 2008-11-07 | 2010-05-14 | Ruag Ammotec Gmbh | Anzündsätze mit verbesserter anzündleistung |
| US8206522B2 (en) | 2010-03-31 | 2012-06-26 | Alliant Techsystems Inc. | Non-toxic, heavy-metal free sensitized explosive percussion primers and methods of preparing the same |
| BR112012026892A2 (pt) * | 2010-04-22 | 2016-07-19 | Pacific Scient Energetic Materials Co | alternativa para tetrazeno |
| RU2542297C2 (ru) * | 2012-10-01 | 2015-02-20 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования Самарский государственный технический университет | Ударный капсюльный состав |
| CN115594555A (zh) * | 2022-09-23 | 2023-01-13 | 西安庆华民用爆破器材股份有限公司（Cn） | 一种环保型耐高温点火剂 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3611939A (en) * | 1962-11-29 | 1971-10-12 | Hans Stadler | Primer |
| DE1243067B (de) * | 1965-11-13 | 1967-06-22 | Karlsruhe Augsburg Iweka | Perkussionszuendsatz fuer Niederdruck-Zuendung |
| NL6915133A (cs) * | 1968-10-26 | 1970-04-28 | ||
| US4429632A (en) * | 1981-04-27 | 1984-02-07 | E. I. Du Pont De Nemours & Co. | Delay detonator |
| US4497251A (en) * | 1983-02-25 | 1985-02-05 | E. I. Du Pont De Nemours And Company | Liquid-disabled blasting cap |
| US5216199A (en) | 1991-07-08 | 1993-06-01 | Blount, Inc. | Lead-free primed rimfire cartridge |
| US5167736A (en) | 1991-11-04 | 1992-12-01 | Olin Corporation | Nontoxic priming mix |
| US5567252A (en) | 1992-01-09 | 1996-10-22 | Olin Corporation | Nontoxic priming mix |
| CH685940A5 (de) | 1993-11-09 | 1995-11-15 | Eidgenoess Munitionsfab Thun | Perkussionszundsatz fur Handfeuerwaffen, Verfahren zu seiner Herstellung sowie dessen Verwendung. |
| US5547528A (en) * | 1995-05-26 | 1996-08-20 | Federal-Hoffman, Inc. | Non-toxic primer |
| US20010001970A1 (en) * | 1995-10-28 | 2001-05-31 | Rainer Hagel | Lead- and barium-free propellant charges |
| DE19540278A1 (de) * | 1995-10-28 | 1997-04-30 | Dynamit Nobel Ag | Blei- und Barium-freie Anzündsätze |
| US6224099B1 (en) * | 1997-07-22 | 2001-05-01 | Cordant Technologies Inc. | Supplemental-restraint-system gas generating device with water-soluble polymeric binder |
-
1999
- 1999-09-17 CZ CZ19993305A patent/CZ288858B6/cs not_active IP Right Cessation
-
2000
- 2000-09-11 AT AT00958100T patent/ATE267784T1/de not_active IP Right Cessation
- 2000-09-11 PT PT00958100T patent/PT1216215E/pt unknown
- 2000-09-11 CA CA002382688A patent/CA2382688A1/en not_active Abandoned
- 2000-09-11 US US10/088,155 patent/US6964287B1/en not_active Expired - Lifetime
- 2000-09-11 AU AU69786/00A patent/AU6978600A/en not_active Abandoned
- 2000-09-11 EP EP00958100A patent/EP1216215B1/en not_active Expired - Lifetime
- 2000-09-11 HK HK02109299.7A patent/HK1049144A1/zh unknown
- 2000-09-11 TR TR2002/00668T patent/TR200200668T2/xx unknown
- 2000-09-11 WO PCT/CZ2000/000067 patent/WO2001021558A1/en active IP Right Grant
- 2000-09-11 DE DE60011109T patent/DE60011109T2/de not_active Expired - Lifetime
- 2000-09-13 SK SK1367-2000A patent/SK285040B6/sk not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SK13672000A3 (sk) | 2001-04-09 |
| AU6978600A (en) | 2001-04-24 |
| DE60011109D1 (de) | 2004-07-01 |
| WO2001021558A1 (en) | 2001-03-29 |
| ATE267784T1 (de) | 2004-06-15 |
| CZ9903305A3 (en) | 2001-06-13 |
| PT1216215E (pt) | 2004-09-30 |
| EP1216215A1 (en) | 2002-06-26 |
| EP1216215B1 (en) | 2004-05-26 |
| DE60011109T2 (de) | 2005-01-20 |
| CZ288858B6 (cs) | 2001-09-12 |
| TR200200668T2 (tr) | 2002-06-21 |
| US6964287B1 (en) | 2005-11-15 |
| HK1049144A1 (zh) | 2003-05-02 |
| CA2382688A1 (en) | 2001-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2556595C (en) | Priming mixtures for small arms | |
| CA2942312C (en) | Non-toxic percussion primers and methods of preparing the same | |
| EP2167447B1 (en) | Non-toxic percussion primers | |
| US8460486B1 (en) | Percussion primer composition and systems incorporating same | |
| SK285040B6 (sk) | Netoxická a nekorózna zážihová zlož | |
| AU7218001A (en) | Non-toxic primer mix | |
| US5466315A (en) | Non-toxic primer for center-fire cartridges | |
| EP2602238B1 (en) | Non-toxic percussion primers and methods of preparing the same | |
| US9409830B1 (en) | Non-toxic primer mix | |
| US2060522A (en) | Nitrosoguanidine as a priming ingredient | |
| CA2668123C (en) | Non-toxic percussion primers and methods of preparing the same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK4A | Patent expired |
Expiry date: 20200913 |