SE462971B - Foerfarande foer framstaellning av 5-alkyl-2-pyrazinkarbonsyra - Google Patents
Foerfarande foer framstaellning av 5-alkyl-2-pyrazinkarbonsyraInfo
- Publication number
- SE462971B SE462971B SE8203273A SE8203273A SE462971B SE 462971 B SE462971 B SE 462971B SE 8203273 A SE8203273 A SE 8203273A SE 8203273 A SE8203273 A SE 8203273A SE 462971 B SE462971 B SE 462971B
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- preparation
- pyrazine
- procedures
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 title 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- OTVZGAXESBAAQQ-UHFFFAOYSA-N pyrazine-2,3-dicarbonitrile Chemical compound N#CC1=NC=CN=C1C#N OTVZGAXESBAAQQ-UHFFFAOYSA-N 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- DPZSNGJNFHWQDC-ARJAWSKDSA-N (z)-2,3-diaminobut-2-enedinitrile Chemical compound N#CC(/N)=C(/N)C#N DPZSNGJNFHWQDC-ARJAWSKDSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- RHYUBLSWHDYKAO-UHFFFAOYSA-N 5-methylpyrazine-2,3-dicarbonitrile Chemical compound CC1=CN=C(C#N)C(C#N)=N1 RHYUBLSWHDYKAO-UHFFFAOYSA-N 0.000 description 2
- RBYJWCRKFLGNDB-UHFFFAOYSA-N 5-methylpyrazine-2-carboxylic acid Chemical compound CC1=CN=C(C(O)=O)C=N1 RBYJWCRKFLGNDB-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- -1 pyruvic acid aldehyde Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- BTYKRSQVJNDFFF-UHFFFAOYSA-N 5-methyl-4-oxidopyrazin-4-ium-2-carboxamide Chemical compound CC1=CN=C(C(N)=O)C=[N+]1[O-] BTYKRSQVJNDFFF-UHFFFAOYSA-N 0.000 description 1
- OYBQCUZBVHFPBU-UHFFFAOYSA-N 5-methylpyrazine-2-carboxamide Chemical compound CC1=CN=C(C(N)=O)C=N1 OYBQCUZBVHFPBU-UHFFFAOYSA-N 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-N PYRUVIC-ACID Natural products CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000000055 hyoplipidemic effect Effects 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8116263 | 1981-05-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8203273L SE8203273L (sv) | 1982-11-29 |
| SE462971B true SE462971B (sv) | 1990-09-24 |
Family
ID=10522093
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8203273A SE462971B (sv) | 1981-05-28 | 1982-05-26 | Foerfarande foer framstaellning av 5-alkyl-2-pyrazinkarbonsyra |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS57200368A (enExample) |
| AT (1) | AT387217B (enExample) |
| AU (1) | AU8412682A (enExample) |
| BE (1) | BE893317A (enExample) |
| CA (1) | CA1237724A (enExample) |
| CH (1) | CH649763A5 (enExample) |
| CS (1) | CS226741B2 (enExample) |
| DE (1) | DE3219407A1 (enExample) |
| DK (1) | DK155325C (enExample) |
| FI (1) | FI73669C (enExample) |
| FR (1) | FR2506768B1 (enExample) |
| GR (1) | GR76417B (enExample) |
| HU (1) | HU187716B (enExample) |
| IE (1) | IE52992B1 (enExample) |
| IL (1) | IL65864A (enExample) |
| IT (1) | IT1210478B (enExample) |
| NL (1) | NL8202105A (enExample) |
| SE (1) | SE462971B (enExample) |
| YU (1) | YU42766B (enExample) |
| ZA (1) | ZA823660B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1201417B (it) * | 1985-05-17 | 1989-02-02 | Montedison Spa | Procedimento per la preparazione di 2-carbossipirazine 4 ossido |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1361967A (en) * | 1972-04-28 | 1974-07-30 | Erba Carlo Spa | Pyrazine 4-oxide derivatives and process for their preparation |
| JPS565742B2 (enExample) * | 1973-09-29 | 1981-02-06 | ||
| JPS5134175A (en) * | 1974-09-18 | 1976-03-23 | Sagami Chem Res | Pirajinjudotai no seizohoho |
| JPS52153980A (en) * | 1976-06-17 | 1977-12-21 | Nippon Soda Co Ltd | Synthesis of 2,3-dicyanopyrazine |
| JPS5488281A (en) * | 1977-12-20 | 1979-07-13 | Nitsupou Kagaku Kk | Manufacture of pyrazine monocarboxylic acid |
| JPS5488280A (en) * | 1977-12-20 | 1979-07-13 | Nitsupou Kagaku Kk | Manufacture of dicyanopyradines |
-
1982
- 1982-05-21 NL NL8202105A patent/NL8202105A/nl active Search and Examination
- 1982-05-24 AT AT0203682A patent/AT387217B/de not_active IP Right Cessation
- 1982-05-24 FI FI821832A patent/FI73669C/fi not_active IP Right Cessation
- 1982-05-24 IL IL65864A patent/IL65864A/xx not_active IP Right Cessation
- 1982-05-24 DE DE19823219407 patent/DE3219407A1/de active Granted
- 1982-05-25 CA CA000403636A patent/CA1237724A/en not_active Expired
- 1982-05-25 AU AU84126/82A patent/AU8412682A/en not_active Abandoned
- 1982-05-25 FR FR8209038A patent/FR2506768B1/fr not_active Expired
- 1982-05-25 CS CS823842A patent/CS226741B2/cs unknown
- 1982-05-25 GR GR68246A patent/GR76417B/el unknown
- 1982-05-26 IE IE1261/82A patent/IE52992B1/en not_active IP Right Cessation
- 1982-05-26 SE SE8203273A patent/SE462971B/sv not_active IP Right Cessation
- 1982-05-26 ZA ZA823660A patent/ZA823660B/xx unknown
- 1982-05-26 JP JP57088153A patent/JPS57200368A/ja active Granted
- 1982-05-27 HU HU821712A patent/HU187716B/hu unknown
- 1982-05-27 YU YU1131/82A patent/YU42766B/xx unknown
- 1982-05-27 DK DK239482A patent/DK155325C/da not_active IP Right Cessation
- 1982-05-27 IT IT8221517A patent/IT1210478B/it active Protection Beyond IP Right Term
- 1982-05-27 CH CH3285/82A patent/CH649763A5/de not_active IP Right Cessation
- 1982-05-27 BE BE0/208187A patent/BE893317A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| YU113182A (en) | 1985-03-20 |
| FR2506768B1 (fr) | 1985-06-21 |
| FI821832A0 (fi) | 1982-05-24 |
| BE893317A (fr) | 1982-11-29 |
| CS226741B2 (en) | 1984-04-16 |
| DK155325C (da) | 1989-09-18 |
| AU8412682A (en) | 1982-12-02 |
| FR2506768A1 (fr) | 1982-12-03 |
| CH649763A5 (de) | 1985-06-14 |
| DK239482A (da) | 1982-11-29 |
| IE821261L (en) | 1982-11-28 |
| JPH0456034B2 (enExample) | 1992-09-07 |
| HU187716B (en) | 1986-02-28 |
| NL8202105A (nl) | 1982-12-16 |
| FI73669B (fi) | 1987-07-31 |
| DE3219407A1 (de) | 1983-01-05 |
| DE3219407C2 (enExample) | 1990-09-06 |
| IT1210478B (it) | 1989-09-14 |
| IL65864A0 (en) | 1982-08-31 |
| ATA203682A (de) | 1988-05-15 |
| IE52992B1 (en) | 1988-04-27 |
| CA1237724A (en) | 1988-06-07 |
| ZA823660B (en) | 1983-03-30 |
| AT387217B (de) | 1988-12-27 |
| IL65864A (en) | 1985-08-30 |
| JPS57200368A (en) | 1982-12-08 |
| IT8221517A0 (it) | 1982-05-27 |
| DK155325B (da) | 1989-03-28 |
| GR76417B (enExample) | 1984-08-10 |
| SE8203273L (sv) | 1982-11-29 |
| FI73669C (fi) | 1987-11-09 |
| YU42766B (en) | 1988-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5708175A (en) | Process for producing 4-trifluoromethylnicotinic acid | |
| US4152326A (en) | Cyclic sulphonyloxyimides | |
| US5349103A (en) | Preparation of aromatic nitriles | |
| US3922307A (en) | Process for preparing cyclohexanediones-(1,3) | |
| US4673761A (en) | Process for preparing anti-inflammatory cycloalkylidenemethylphenylacetic acid derivatives | |
| SU784766A3 (ru) | Способ получени бенз-ацил-бензимидазол(2)-производных | |
| FI73223B (fi) | Ny 20-isocyano-3-metoxipregna- 3,5,17(20)-trien, foerfarande foer framstaellning daerav samt foerfarande foer framstaellning av 17- -hydroxipregn-4-en-3,20-dion. | |
| SE462971B (sv) | Foerfarande foer framstaellning av 5-alkyl-2-pyrazinkarbonsyra | |
| BE897952A (fr) | Procede de production d'imidazoles et intermediaires utilises a cet effet | |
| SE451724B (sv) | Forfarande for framstellning av natriumcefuroxim | |
| EP0099960A1 (de) | Verfahren zur Herstellung von Niederalkylestern von N-L-alpha-Aspartyl-L-phenylalanin und neue Zwischenprodukte zu deren Herstellung | |
| US4692545A (en) | Method for preparation of mercaptobenzoates | |
| US4182880A (en) | 1,8-Naphthyridine compounds and process for preparing the same | |
| US4709044A (en) | Biotin intermediates | |
| FI69628B (fi) | Nytt foerfarande foer framstaellning av apovinkaminsyraestrar | |
| US4556718A (en) | 4,5-Dialkoxy-1,3-dioxolane-2-carboxylic acids, their derivatives, preparation process and application | |
| US2881210A (en) | Process of preparing p-aminomethylphenylacetic acid | |
| US2489881A (en) | Oxazoiiones and rbrocess for | |
| US2140480A (en) | 3-keto-d-pentonic acid lactone and process for the manufacture of same | |
| US2432961A (en) | Substituted thieno uracils and methods of preparing same | |
| US4289897A (en) | Method for production of acylhydrazones of formyl-acetic acid ester | |
| US3598844A (en) | Azidocinnamic aldehydes | |
| US5332824A (en) | Process for the preparation of 2-amino-5-methyl-pyridine | |
| EP0018732B1 (en) | An alpha-methyl-4(2'-thienyl-carbonyl)phenyl acetic acid derivative, process for its preparation and its pharmaceutical use | |
| FI64136C (fi) | Foerfarande foer framstaellning av d-2-(6-metoxi-2-naftyl)-propionsyra |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8203273-1 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8203273-1 Format of ref document f/p: F |