SE462050B - Koncentrerat mjukgoeringsmedel foer tyg samt saett foer framstaellning av detsamma - Google Patents
Koncentrerat mjukgoeringsmedel foer tyg samt saett foer framstaellning av detsammaInfo
- Publication number
- SE462050B SE462050B SE8303507A SE8303507A SE462050B SE 462050 B SE462050 B SE 462050B SE 8303507 A SE8303507 A SE 8303507A SE 8303507 A SE8303507 A SE 8303507A SE 462050 B SE462050 B SE 462050B
- Authority
- SE
- Sweden
- Prior art keywords
- plasticizer
- weight
- cation
- electrolyte
- carbon atoms
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 13
- 239000004744 fabric Substances 0.000 title claims description 5
- 239000004014 plasticizer Substances 0.000 claims description 30
- 239000003795 chemical substances by application Substances 0.000 claims description 25
- 150000001768 cations Chemical class 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 20
- 239000003792 electrolyte Substances 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 239000002736 nonionic surfactant Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 7
- 238000003756 stirring Methods 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 5
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical group [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 claims description 5
- 239000004664 distearyldimethylammonium chloride (DHTDMAC) Substances 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 239000004094 surface-active agent Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 239000002979 fabric softener Substances 0.000 claims description 4
- 229920000847 nonoxynol Polymers 0.000 claims description 3
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical group CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims description 2
- 230000003381 solubilizing effect Effects 0.000 claims 3
- 125000002091 cationic group Chemical group 0.000 description 8
- 238000009472 formulation Methods 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 3
- ZCPCLAPUXMZUCD-UHFFFAOYSA-M dihexadecyl(dimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCC ZCPCLAPUXMZUCD-UHFFFAOYSA-M 0.000 description 3
- -1 for example Chemical class 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- 229920003169 water-soluble polymer Polymers 0.000 description 3
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000013011 aqueous formulation Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- XIXADJRWDQXREU-UHFFFAOYSA-M lithium acetate Chemical compound [Li+].CC([O-])=O XIXADJRWDQXREU-UHFFFAOYSA-M 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- FFJMLWSZNCJCSZ-UHFFFAOYSA-N n-methylmethanamine;hydrobromide Chemical compound Br.CNC FFJMLWSZNCJCSZ-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920004893 Triton X-165 Polymers 0.000 description 1
- UDQHRHRQXMGUHM-UHFFFAOYSA-L [Cl-].[Br-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC.CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC Chemical compound [Cl-].[Br-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC.CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC UDQHRHRQXMGUHM-UHFFFAOYSA-L 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 239000013556 antirust agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229960002713 calcium chloride Drugs 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- LLSDKQJKOVVTOJ-UHFFFAOYSA-L calcium chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Ca+2] LLSDKQJKOVVTOJ-UHFFFAOYSA-L 0.000 description 1
- 229940052299 calcium chloride dihydrate Drugs 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 239000004665 cationic fabric softener Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- AQUCOCCZWYJKFZ-UHFFFAOYSA-M diethyl(dioctadecyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](CC)(CC)CCCCCCCCCCCCCCCCCC AQUCOCCZWYJKFZ-UHFFFAOYSA-M 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- OGQYPPBGSLZBEG-UHFFFAOYSA-N dimethyl(dioctadecyl)azanium Chemical compound CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC OGQYPPBGSLZBEG-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000006181 electrochemical material Substances 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/001—Softening compositions
- C11D3/0015—Softening compositions liquid
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/38—Cationic compounds
- C11D1/62—Quaternary ammonium compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/835—Mixtures of non-ionic with cationic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US39041182A | 1982-06-22 | 1982-06-22 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8303507D0 SE8303507D0 (sv) | 1983-06-20 |
| SE8303507L SE8303507L (sv) | 1983-12-23 |
| SE462050B true SE462050B (sv) | 1990-04-30 |
Family
ID=23542374
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8303507A SE462050B (sv) | 1982-06-22 | 1983-06-20 | Koncentrerat mjukgoeringsmedel foer tyg samt saett foer framstaellning av detsamma |
Country Status (18)
| Country | Link |
|---|---|
| AU (1) | AU558320B2 (pm) |
| BE (1) | BE893887A (pm) |
| BR (1) | BR8303280A (pm) |
| CA (1) | CA1208854A (pm) |
| CH (1) | CH655332A5 (pm) |
| DE (1) | DE3225687A1 (pm) |
| DK (1) | DK165336C (pm) |
| ES (2) | ES8501434A1 (pm) |
| FR (1) | FR2528864B1 (pm) |
| GB (1) | GB2122662B (pm) |
| GR (1) | GR77513B (pm) |
| IT (1) | IT1172269B (pm) |
| MX (1) | MX158906A (pm) |
| NL (1) | NL8302227A (pm) |
| NO (1) | NO163629C (pm) |
| NZ (1) | NZ204517A (pm) |
| SE (1) | SE462050B (pm) |
| ZA (1) | ZA834209B (pm) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4497716A (en) * | 1982-12-23 | 1985-02-05 | Lever Brothers Company | Fabric softening composition |
| NZ207932A (en) * | 1983-05-11 | 1986-03-14 | Colgate Palmolive Co | Fabric softener compositions containing quaternary ammonium compounds |
| GB8410320D0 (en) * | 1984-04-19 | 1984-05-31 | Unilever Plc | Aqueous fabric softening composition |
| GB8410322D0 (en) * | 1984-04-19 | 1984-05-31 | Unilever Plc | Aqueous concentrated fabric softening composition |
| GB8719083D0 (en) * | 1987-08-12 | 1987-09-16 | Albright & Wilson | Fabric conditioners |
| EP0309052B1 (en) * | 1987-09-23 | 1992-11-25 | The Procter & Gamble Company | Stable biodegradable fabric softening compositions containing linear alkoxylated alcohols |
| GB8818593D0 (en) * | 1988-08-04 | 1988-09-07 | Albright & Wilson | Fabric conditioners |
| US5066414A (en) * | 1989-03-06 | 1991-11-19 | The Procter & Gamble Co. | Stable biodegradable fabric softening compositions containing linear alkoxylated alcohols |
| EP2159276A1 (en) | 2008-08-30 | 2010-03-03 | Clariant (Brazil) S.A. | Solid or gel surfactant composition |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660286A (en) * | 1969-01-03 | 1972-05-02 | Lever Brothers Ltd | Liquid wash cycle softener |
| US3920565A (en) * | 1973-02-23 | 1975-11-18 | Procter & Gamble | Fabric softener composition and method |
| US3974076A (en) * | 1974-01-11 | 1976-08-10 | The Procter & Gamble Company | Fabric softener |
| LU71307A1 (pm) * | 1974-11-18 | 1976-09-06 | ||
| JPS52134030A (en) * | 1976-04-30 | 1977-11-09 | Kao Corp | Softening composition for fabrics and hairs |
| US4119545A (en) * | 1977-03-28 | 1978-10-10 | Colgate Palmolive Company | Concentrated fabric softening composition |
| DE3025369A1 (de) * | 1980-07-04 | 1982-01-28 | Hoechst Ag, 6000 Frankfurt | Waeschweichspuelmittelkonzentrat |
| BE888535A (fr) * | 1981-04-23 | 1981-08-17 | Lesieur Cotelle | Compositions adoucissantes liquides pour textiles, |
-
1982
- 1982-06-15 ZA ZA834209A patent/ZA834209B/xx unknown
- 1982-07-09 DE DE19823225687 patent/DE3225687A1/de active Granted
- 1982-07-15 FR FR8212357A patent/FR2528864B1/fr not_active Expired
- 1982-07-20 BE BE0/208632A patent/BE893887A/fr unknown
-
1983
- 1983-06-09 NZ NZ204517A patent/NZ204517A/en unknown
- 1983-06-15 GR GR71691A patent/GR77513B/el unknown
- 1983-06-17 DK DK281583A patent/DK165336C/da not_active IP Right Cessation
- 1983-06-17 IT IT48525/83A patent/IT1172269B/it active
- 1983-06-20 SE SE8303507A patent/SE462050B/sv not_active IP Right Cessation
- 1983-06-20 AU AU15961/83A patent/AU558320B2/en not_active Ceased
- 1983-06-21 GB GB08316857A patent/GB2122662B/en not_active Expired
- 1983-06-21 MX MX197751A patent/MX158906A/es unknown
- 1983-06-21 ES ES523460A patent/ES8501434A1/es not_active Expired
- 1983-06-21 BR BR8303280A patent/BR8303280A/pt unknown
- 1983-06-21 NO NO832245A patent/NO163629C/no unknown
- 1983-06-21 CA CA000430819A patent/CA1208854A/en not_active Expired
- 1983-06-22 NL NL8302227A patent/NL8302227A/nl not_active Application Discontinuation
- 1983-06-22 CH CH3420/83A patent/CH655332A5/de not_active IP Right Cessation
-
1984
- 1984-03-07 ES ES530347A patent/ES8505402A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1208854A (en) | 1986-08-05 |
| DK165336B (da) | 1992-11-09 |
| NO163629C (no) | 1990-06-27 |
| FR2528864B1 (fr) | 1987-05-07 |
| BR8303280A (pt) | 1984-02-07 |
| NO832245L (no) | 1983-12-23 |
| BE893887A (fr) | 1983-01-20 |
| DE3225687A1 (de) | 1983-12-22 |
| NO163629B (no) | 1990-03-19 |
| DE3225687C2 (pm) | 1991-11-21 |
| IT8348525A0 (it) | 1983-06-17 |
| NZ204517A (en) | 1986-09-10 |
| IT1172269B (it) | 1987-06-18 |
| SE8303507L (sv) | 1983-12-23 |
| FR2528864A1 (fr) | 1983-12-23 |
| ES523460A0 (es) | 1984-11-16 |
| ES530347A0 (es) | 1985-05-16 |
| CH655332A5 (de) | 1986-04-15 |
| SE8303507D0 (sv) | 1983-06-20 |
| GB2122662A (en) | 1984-01-18 |
| MX158906A (es) | 1989-03-29 |
| DK281583D0 (da) | 1983-06-17 |
| DK281583A (da) | 1983-12-23 |
| AU558320B2 (en) | 1987-01-29 |
| NL8302227A (nl) | 1984-01-16 |
| GB2122662B (en) | 1986-01-22 |
| GR77513B (pm) | 1984-09-24 |
| DK165336C (da) | 1993-03-29 |
| ES8505402A1 (es) | 1985-05-16 |
| ZA834209B (en) | 1985-01-30 |
| GB8316857D0 (en) | 1983-07-27 |
| ES8501434A1 (es) | 1984-11-16 |
| AU1596183A (en) | 1984-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1143512A (en) | Concentrated fabric softening composition | |
| EP0060003B1 (en) | Textile treatment compositions and preparation thereof | |
| JPH0236712B2 (pm) | ||
| JPH0370032B2 (pm) | ||
| US4157307A (en) | Liquid fabric softener | |
| US4844823A (en) | Fabric softener composition containing di-esterified long chain fatty acid quaternary ammonium salt | |
| US4326965A (en) | Liquid fabric-softening composition | |
| US4772403A (en) | Fabric softener composition | |
| JPH0329908B2 (pm) | ||
| US4851141A (en) | Concentrated stable nonaqueous fabric softener composition | |
| SE462050B (sv) | Koncentrerat mjukgoeringsmedel foer tyg samt saett foer framstaellning av detsamma | |
| EP1259673B1 (en) | Fabric conditioning compositions | |
| HUP0003822A2 (en) | Stable rinse cycle fabric softener composition with glycerol monostearate co-softener | |
| EP0276999A2 (en) | Fabric conditioning composition | |
| EP0394133B1 (en) | Fabric softener compostitions | |
| JPH0215664B2 (pm) | ||
| JPS5994680A (ja) | 織編物のコンデイシヨニング方法 | |
| CA1204563A (en) | Liquid fabric-softening composition | |
| HU210123B (en) | Fiber conditioning compositions containing aminosilicone and process for preparing the compositions | |
| EP0122140A2 (en) | Method for preparing fabric softening compositions | |
| EP0450706B1 (en) | Alkoxy-(2-ethyl)hexyl-aliphatic methyl quaternary ammonium compounds and their precursor amines | |
| HUP0302954A2 (hu) | Textilkondicionáló készítmények | |
| DE69423650T2 (de) | Viskositätsstabile konzentrierte weichspülerzusammensetzungen | |
| AU596086B2 (en) | Concentrated stable non-aqueous fabric softener composition | |
| US4661270A (en) | Concentrated fabric softening composition and methods for making same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8303507-1 Effective date: 19950110 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8303507-1 Format of ref document f/p: F |