SE460358B - Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedel - Google Patents
Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedelInfo
- Publication number
- SE460358B SE460358B SE8601632A SE8601632A SE460358B SE 460358 B SE460358 B SE 460358B SE 8601632 A SE8601632 A SE 8601632A SE 8601632 A SE8601632 A SE 8601632A SE 460358 B SE460358 B SE 460358B
- Authority
- SE
- Sweden
- Prior art keywords
- phosphorus
- organic
- water
- ore
- fertilizer
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 23
- 239000003337 fertilizer Substances 0.000 title claims description 16
- 239000003795 chemical substances by application Substances 0.000 title 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 56
- 229910052698 phosphorus Inorganic materials 0.000 claims description 51
- 239000011574 phosphorus Substances 0.000 claims description 51
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 239000002699 waste material Substances 0.000 claims description 11
- 239000011575 calcium Substances 0.000 claims description 5
- 210000003608 fece Anatomy 0.000 claims description 5
- 239000010871 livestock manure Substances 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 239000001913 cellulose Substances 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 239000002245 particle Substances 0.000 claims description 4
- 239000003415 peat Substances 0.000 claims description 4
- 239000000835 fiber Substances 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000002689 soil Substances 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims 10
- 239000000376 reactant Substances 0.000 claims 7
- 239000002253 acid Substances 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 239000001506 calcium phosphate Substances 0.000 description 6
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 229910001868 water Inorganic materials 0.000 description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 5
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002426 superphosphate Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 description 3
- 239000001175 calcium sulphate Substances 0.000 description 3
- 235000011132 calcium sulphate Nutrition 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000005265 energy consumption Methods 0.000 description 3
- 230000007613 environmental effect Effects 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 229910000150 monocalcium phosphate Inorganic materials 0.000 description 3
- 235000019691 monocalcium phosphate Nutrition 0.000 description 3
- GBNXLQPMFAUCOI-UHFFFAOYSA-H tetracalcium;oxygen(2-);diphosphate Chemical compound [O-2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GBNXLQPMFAUCOI-UHFFFAOYSA-H 0.000 description 3
- 231100000331 toxic Toxicity 0.000 description 3
- 230000002588 toxic effect Effects 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 239000010440 gypsum Substances 0.000 description 2
- 229910052602 gypsum Inorganic materials 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- 239000010815 organic waste Substances 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- ZRIUUUJAJJNDSS-UHFFFAOYSA-N ammonium phosphates Chemical class [NH4+].[NH4+].[NH4+].[O-]P([O-])([O-])=O ZRIUUUJAJJNDSS-UHFFFAOYSA-N 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 229910052586 apatite Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical compound [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 1
- 239000002367 phosphate rock Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- -1 phosphorus compound Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- YWYZEGXAUVWDED-UHFFFAOYSA-N triammonium citrate Chemical compound [NH4+].[NH4+].[NH4+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O YWYZEGXAUVWDED-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000010803 wood ash Substances 0.000 description 1
- 239000002916 wood waste Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B13/00—Fertilisers produced by pyrogenic processes from phosphatic materials
- C05B13/02—Fertilisers produced by pyrogenic processes from phosphatic materials from rock phosphates
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B17/00—Other phosphatic fertilisers, e.g. soft rock phosphates, bone meal
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S71/00—Chemistry: fertilizers
- Y10S71/903—Soil conditioner
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
- Soil Conditioners And Soil-Stabilizing Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI851525A FI73192C (fi) | 1985-04-17 | 1985-04-17 | Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedel. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8601632D0 SE8601632D0 (sv) | 1986-04-11 |
| SE8601632L SE8601632L (sv) | 1986-10-18 |
| SE460358B true SE460358B (sv) | 1989-10-02 |
Family
ID=8520681
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8601632A SE460358B (sv) | 1985-04-17 | 1986-04-11 | Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedel |
| SE8604317A SE459174B (sv) | 1985-04-17 | 1986-10-13 | Foerfarande foer att producera kombinerad fosforgoedsel och jordkonditionerare |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8604317A SE459174B (sv) | 1985-04-17 | 1986-10-13 | Foerfarande foer att producera kombinerad fosforgoedsel och jordkonditionerare |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4710219A (cs) |
| AT (1) | AT388371B (cs) |
| CH (1) | CH672310A5 (cs) |
| DE (2) | DE3612929A1 (cs) |
| FI (1) | FI73192C (cs) |
| FR (2) | FR2580629B1 (cs) |
| GB (2) | GB2173782B (cs) |
| NO (1) | NO165289C (cs) |
| SE (2) | SE460358B (cs) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI73192C (fi) * | 1985-04-17 | 1987-09-10 | Arvo Wahlberg | Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedel. |
| FI84470C (fi) * | 1989-06-05 | 1991-12-10 | Rauma Wood International Oy | Vaextregleringsfoerfarande. |
| DE4029079A1 (de) * | 1990-09-13 | 1992-03-19 | Duro Galvanit Chemie Eva M Dil | Verfahren zur entsorgung von hygiene-zellstoff-abfaellen |
| US5162600A (en) * | 1990-12-28 | 1992-11-10 | Rheox, Inc. | Method of treating lead contaminated soil |
| DE29608680U1 (de) * | 1996-05-14 | 1997-01-09 | Neumann, Richard, 84061 Ergoldsbach | Bodenbelebungsmaterial |
| US6174472B1 (en) | 1998-09-03 | 2001-01-16 | Ernest W. Johnson | Process for forming soil enhancing pellets |
| US6334990B1 (en) | 1999-10-21 | 2002-01-01 | Airborne Industrial Minerals Inc. | Formulation of potassium sulfate, sodium carbonate and sodium bicarbonate from potash brine |
| US6375824B1 (en) | 2001-01-16 | 2002-04-23 | Airborne Industrial Minerals Inc. | Process for producing potassium hydroxide and potassium sulfate from sodium sulfate |
| CN1509261A (zh) * | 2001-05-17 | 2004-06-30 | 杰富意钢铁株式会社 | 磷肥用原料及其制造方法 |
| US6824584B2 (en) | 2001-07-03 | 2004-11-30 | Donald C. Young | Ammonium phosphate/phosphite fertilizer compound |
| US6857998B1 (en) | 2002-05-10 | 2005-02-22 | Free Flow Technologies, Inc. | Compositions and methods for treatment of solid waste |
| US20090314046A1 (en) * | 2008-06-19 | 2009-12-24 | Michael Rieth | Production of a high phosphorus fertilizer product |
| US20140144196A1 (en) * | 2011-07-06 | 2014-05-29 | Hector Luis Correa Delgado | Organic water retention mix for use on soil |
| FI127608B (fi) * | 2016-05-13 | 2018-10-15 | Ecolan Oy | Lannoite ja menetelmä sen valmistamiseksi ja lannoitetuotteen käyttö |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE740335C (de) * | 1938-11-10 | 1943-10-18 | Adolf Syberg | Verfahren zur Herstellung eines Duengemittels |
| DE850456C (de) * | 1948-11-16 | 1952-09-25 | Richard Schubert | Verfahren zur Herstellung von wasserloesliche Phosphorsaeure enthaltenden Humusduengemitteln |
| GB822637A (en) * | 1956-12-27 | 1959-10-28 | John David Larson | Process of rendering phosphate rock assimilable by plant life |
| US3239329A (en) * | 1963-07-29 | 1966-03-08 | Canadian Forest Prod | Processes for the production of phosphate products |
| DE1592583A1 (de) * | 1964-12-11 | 1971-05-27 | Chemie Appbau Mainz Schmahl & | Verfahren zur Herstellung granulierter Duengemittel |
| DE1592587A1 (de) * | 1965-05-28 | 1970-07-30 | Albert Ag Chem Werke | Verfahren zur Herstellung granulierter Duengemittel |
| JPS606318B2 (ja) * | 1979-12-13 | 1985-02-16 | 日本重化学工業株式会社 | 混合りん酸肥料 |
| FI67837C (fi) * | 1984-03-28 | 1986-02-18 | Arvo Wahlberg | Foerfarande foer framstaellning av goedselmedel av traeaska oc barrtraedsbark eller annat traeavfall |
| FI73192C (fi) * | 1985-04-17 | 1987-09-10 | Arvo Wahlberg | Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedel. |
-
1985
- 1985-04-17 FI FI851525A patent/FI73192C/fi not_active IP Right Cessation
-
1986
- 1986-04-11 SE SE8601632A patent/SE460358B/sv not_active IP Right Cessation
- 1986-04-14 NO NO861431A patent/NO165289C/no unknown
- 1986-04-14 GB GB08609055A patent/GB2173782B/en not_active Expired
- 1986-04-16 FR FR868605452A patent/FR2580629B1/fr not_active Expired - Fee Related
- 1986-04-17 DE DE19863612929 patent/DE3612929A1/de not_active Ceased
- 1986-04-17 US US06/853,354 patent/US4710219A/en not_active Expired - Fee Related
- 1986-10-13 SE SE8604317A patent/SE459174B/sv not_active IP Right Cessation
- 1986-10-15 GB GB8624691A patent/GB2196328B/en not_active Expired
- 1986-10-16 AT AT0275886A patent/AT388371B/de not_active IP Right Cessation
- 1986-10-16 FR FR868614372A patent/FR2605311B1/fr not_active Expired - Fee Related
- 1986-10-16 CH CH4136/86A patent/CH672310A5/de not_active IP Right Cessation
- 1986-10-16 DE DE19863635195 patent/DE3635195A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| GB2196328A (en) | 1988-04-27 |
| CH672310A5 (cs) | 1989-11-15 |
| AT388371B (de) | 1989-06-12 |
| FR2580629A1 (fr) | 1986-10-24 |
| FI73192B (fi) | 1987-05-29 |
| FI851525L (fi) | 1986-10-18 |
| ATA275886A (de) | 1988-11-15 |
| SE8601632D0 (sv) | 1986-04-11 |
| FR2580629B1 (fr) | 1990-06-22 |
| SE8604317D0 (sv) | 1986-10-13 |
| SE8604317L (sv) | 1988-04-14 |
| DE3612929A1 (de) | 1987-01-15 |
| US4710219A (en) | 1987-12-01 |
| FI73192C (fi) | 1987-09-10 |
| NO165289B (no) | 1990-10-15 |
| SE459174B (sv) | 1989-06-12 |
| NO165289C (no) | 1991-01-23 |
| GB2196328B (en) | 1991-07-10 |
| FR2605311A1 (fr) | 1988-04-22 |
| FI851525A0 (fi) | 1985-04-17 |
| DE3635195A1 (de) | 1988-04-28 |
| FR2605311B1 (fr) | 1990-06-22 |
| SE8601632L (sv) | 1986-10-18 |
| NO861431L (no) | 1986-10-20 |
| GB2173782B (en) | 1989-01-11 |
| GB8609055D0 (en) | 1986-05-21 |
| GB2173782A (en) | 1986-10-22 |
| GB8624691D0 (en) | 1986-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE460358B (sv) | Foerfarande foer framstaellning av kombinerat fosforgoedselmedel och jordfoerbaettringsmedel | |
| US2504545A (en) | Granulated fertilizer | |
| Garbouchev | The manufacture and agronomic efficiency of a partially acidulated phosphate rock fertilizer | |
| US2504544A (en) | Process of manufacturing phosphoric acid | |
| US4804401A (en) | Method of producing a phosphorus fertilizer soil conditioner | |
| CA1210953A (en) | Rock phosphate/sulphur fertilizer composition | |
| US4239523A (en) | Method for manufacturing phosphatic fertilizers having a high concentration, particularly calcium metaphosphate Ca(PO3)2 | |
| US2889217A (en) | Process for producing defluorinated phosphate material | |
| Houston et al. | Compound Fertilizers from Rock Phosphate, Nitric Acid and Phosphoric Acids, and Ammonia | |
| US4177052A (en) | Process for preparing dicalcium phosphate containing fertilizer | |
| Nielsson et al. | Nitric phosphates, manufacture from phosphate rock, nitric acid ammonia, and potassium or other soluble sulfates | |
| US2555634A (en) | Production of phosphate materials | |
| US2898207A (en) | Acidulation of phosphate | |
| US3006754A (en) | Production of superphosphate fertilizers | |
| Nielsson et al. | Nitric Phosphates from Phosphate Rock, Nitric Acid, Ammonia, and Carbon Dioxide | |
| ATE36110T1 (de) | Verfahren zur herstellung von futterphosphaten. | |
| CA1182977A (en) | Method of defluorinating phosphates | |
| CA1287745C (en) | Production method of combined phosphorus fertilizer and soil conditioner | |
| FI73659B (fi) | Framstaellningsfoerfarande foer kombinerat fosforgoedslingsmedel och jordfoerbaettringsmedel. | |
| SU1564152A1 (ru) | Способ получени сложных удобрений | |
| CA1287746C (en) | Production method of combined phosphorus fertilizer and soil conditioner | |
| SU1472465A1 (ru) | Способ получени гранулированного неслеживающегос известкового удобрени | |
| US2086565A (en) | Making calcium phosphate fertilizer | |
| US3178278A (en) | Process for producing a multilayer high analysis, granular, non-hygroscopic phosphate fertilizer and the product thereof | |
| US3672828A (en) | Quick cure process for making superphosphates of low fluorine content |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8601632-6 Effective date: 19931110 Format of ref document f/p: F |