SE444763B - Tandkremskomposition - Google Patents
TandkremskompositionInfo
- Publication number
- SE444763B SE444763B SE7902993A SE7902993A SE444763B SE 444763 B SE444763 B SE 444763B SE 7902993 A SE7902993 A SE 7902993A SE 7902993 A SE7902993 A SE 7902993A SE 444763 B SE444763 B SE 444763B
- Authority
- SE
- Sweden
- Prior art keywords
- weight
- sodium
- alkyl
- toothpaste
- calcium carbonate
- Prior art date
Links
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 27
- 239000000463 material Substances 0.000 claims description 25
- -1 alkyl sulphate Chemical compound 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 21
- 239000000606 toothpaste Substances 0.000 claims description 18
- 239000011734 sodium Substances 0.000 claims description 17
- 229910052708 sodium Inorganic materials 0.000 claims description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 15
- 229940034610 toothpaste Drugs 0.000 claims description 15
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 13
- 229910019142 PO4 Inorganic materials 0.000 claims description 9
- 239000000654 additive Substances 0.000 claims description 9
- 230000000996 additive effect Effects 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000010452 phosphate Substances 0.000 claims description 9
- 238000005498 polishing Methods 0.000 claims description 8
- 150000005690 diesters Chemical class 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical group [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 claims description 5
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 5
- 235000019818 tetrasodium diphosphate Nutrition 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical group 0.000 claims description 4
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims description 4
- 235000011180 diphosphates Nutrition 0.000 claims description 4
- 125000000129 anionic group Chemical group 0.000 claims description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 1
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 12
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 10
- 239000000551 dentifrice Substances 0.000 description 9
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000008051 alkyl sulfates Chemical class 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 235000011187 glycerol Nutrition 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 4
- 230000032683 aging Effects 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 4
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000001506 calcium phosphate Substances 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 239000003349 gelling agent Substances 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- 239000004141 Sodium laurylsulphate Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 239000000679 carrageenan Substances 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 229940113118 carrageenan Drugs 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229940091249 fluoride supplement Drugs 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- ZMRUPTIKESYGQW-UHFFFAOYSA-N propranolol hydrochloride Chemical compound [H+].[Cl-].C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 ZMRUPTIKESYGQW-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-N sodium;dodecyl sulfate;hydron Chemical compound [H+].[Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-N 0.000 description 2
- YUOWTJMRMWQJDA-UHFFFAOYSA-J tin(iv) fluoride Chemical compound [F-].[F-].[F-].[F-].[Sn+4] YUOWTJMRMWQJDA-UHFFFAOYSA-J 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 2
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 2
- JLPAMKUIIFHLBH-UHFFFAOYSA-N 1,2-dihydroxypropane-1-sulfonic acid Chemical compound CC(O)C(O)S(O)(=O)=O JLPAMKUIIFHLBH-UHFFFAOYSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 229910021593 Copper(I) fluoride Inorganic materials 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000005696 Diammonium phosphate Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HFIGWKOFZLNOQK-UHFFFAOYSA-K [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] Chemical class [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] HFIGWKOFZLNOQK-UHFFFAOYSA-K 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- OYLGJCQECKOTOL-UHFFFAOYSA-L barium fluoride Chemical compound [F-].[F-].[Ba+2] OYLGJCQECKOTOL-UHFFFAOYSA-L 0.000 description 1
- 229910001632 barium fluoride Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical class C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- BMRUOURRLCCWHB-UHFFFAOYSA-M copper(i) fluoride Chemical compound [Cu]F BMRUOURRLCCWHB-UHFFFAOYSA-M 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- DGTVXEHQMSJRPE-UHFFFAOYSA-M difluorophosphinate Chemical compound [O-]P(F)(F)=O DGTVXEHQMSJRPE-UHFFFAOYSA-M 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- MHJAJDCZWVHCPF-UHFFFAOYSA-L dimagnesium phosphate Chemical compound [Mg+2].OP([O-])([O-])=O MHJAJDCZWVHCPF-UHFFFAOYSA-L 0.000 description 1
- 229910000395 dimagnesium phosphate Inorganic materials 0.000 description 1
- 235000019791 dimagnesium phosphate Nutrition 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 229910001385 heavy metal Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910001506 inorganic fluoride Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229910000400 magnesium phosphate tribasic Inorganic materials 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 125000000963 oxybis(methylene) group Chemical group [H]C([H])(*)OC([H])([H])* 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- AQMNWCRSESPIJM-UHFFFAOYSA-M sodium metaphosphate Chemical compound [Na+].[O-]P(=O)=O AQMNWCRSESPIJM-UHFFFAOYSA-M 0.000 description 1
- VZWGHDYJGOMEKT-UHFFFAOYSA-J sodium pyrophosphate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O VZWGHDYJGOMEKT-UHFFFAOYSA-J 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- AYGJDUHQRFKLBG-UHFFFAOYSA-M sodium;1,1-dioxo-1,2-benzothiazol-3-olate;dihydrate Chemical compound O.O.[Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 AYGJDUHQRFKLBG-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 229960002799 stannous fluoride Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- XLRPYZSEQKXZAA-OCAPTIKFSA-N tropane Chemical compound C1CC[C@H]2CC[C@@H]1N2C XLRPYZSEQKXZAA-OCAPTIKFSA-N 0.000 description 1
- 229930004006 tropane Natural products 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/55—Phosphorus compounds
- A61K8/556—Derivatives containing from 2 to 10 oxyalkylene groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/24—Phosphorous; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/46—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing sulfur
- A61K8/463—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing sulfur containing sulfuric acid derivatives, e.g. sodium lauryl sulfate
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB22475/78A GB1599689A (en) | 1978-05-25 | 1978-05-25 | Dental cream composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7902993L SE7902993L (sv) | 1979-11-26 |
| SE444763B true SE444763B (sv) | 1986-05-12 |
Family
ID=10179978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7902993A SE444763B (sv) | 1978-05-25 | 1979-04-04 | Tandkremskomposition |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS54157843A (enExample) |
| AR (1) | AR218540A1 (enExample) |
| AT (1) | AT363602B (enExample) |
| AU (1) | AU523563B2 (enExample) |
| BE (1) | BE876425A (enExample) |
| BR (1) | BR7903126A (enExample) |
| CA (1) | CA1118360A (enExample) |
| CH (1) | CH641955A5 (enExample) |
| DE (1) | DE2918132A1 (enExample) |
| DK (1) | DK157900B (enExample) |
| FR (1) | FR2426458B1 (enExample) |
| GB (1) | GB1599689A (enExample) |
| IE (1) | IE48240B1 (enExample) |
| IT (1) | IT1116852B (enExample) |
| MX (1) | MX153894A (enExample) |
| MY (2) | MY8300102A (enExample) |
| NL (1) | NL7903191A (enExample) |
| NO (1) | NO147859C (enExample) |
| NZ (1) | NZ190071A (enExample) |
| PH (1) | PH15533A (enExample) |
| PT (1) | PT69497A (enExample) |
| SE (1) | SE444763B (enExample) |
| ZA (1) | ZA791715B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3504178A1 (de) * | 1985-02-07 | 1986-08-14 | Blendax Werke Schneider Co | Zahnpasta |
| GB8719775D0 (en) * | 1987-08-21 | 1987-09-30 | Unilever Plc | Oral products |
| JP3025567B2 (ja) * | 1991-12-16 | 2000-03-27 | 花王株式会社 | 口腔用組成物 |
| US6149894A (en) * | 1999-05-14 | 2000-11-21 | Colgate Palmolive Company | Method for the manufacture of toothpaste |
| CA2690744A1 (en) * | 2007-06-12 | 2008-12-24 | Rhodia, Inc. | Mono-, di- and polyol alkoxylate phosphate esters in oral care formulations and methods for using same |
| JP7126811B2 (ja) * | 2017-07-25 | 2022-08-29 | 株式会社ジーシー | 歯面清掃用組成物 |
| JP7165772B2 (ja) * | 2021-03-22 | 2022-11-04 | 株式会社ジーシー | 歯面清掃用組成物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE516996A (enExample) * | 1952-02-19 | |||
| US2812284A (en) * | 1953-04-15 | 1957-11-05 | Procter & Gamble | Oral detergent composition and dentifrice comprising same |
| JPS4925337B1 (enExample) * | 1970-03-31 | 1974-06-29 | ||
| GB1475252A (en) * | 1975-01-15 | 1977-06-01 | Colgate Palmolive Co | Toothpaste composition |
| GB1475251A (en) * | 1975-01-15 | 1977-06-01 | Colgate Palmolive Co | Oral preparations |
-
1978
- 1978-05-25 GB GB22475/78A patent/GB1599689A/en not_active Expired
-
1979
- 1979-03-30 NZ NZ190071A patent/NZ190071A/xx unknown
- 1979-04-04 SE SE7902993A patent/SE444763B/sv not_active IP Right Cessation
- 1979-04-10 ZA ZA791715A patent/ZA791715B/xx unknown
- 1979-04-17 AU AU46111/79A patent/AU523563B2/en not_active Ceased
- 1979-04-17 PT PT69497A patent/PT69497A/pt unknown
- 1979-04-18 MX MX177358A patent/MX153894A/es unknown
- 1979-04-23 NL NL7903191A patent/NL7903191A/xx not_active Application Discontinuation
- 1979-05-01 DK DK178579A patent/DK157900B/da not_active Application Discontinuation
- 1979-05-05 DE DE19792918132 patent/DE2918132A1/de active Granted
- 1979-05-10 AT AT0347279A patent/AT363602B/de not_active IP Right Cessation
- 1979-05-10 IT IT48996/79A patent/IT1116852B/it active
- 1979-05-17 CH CH460779A patent/CH641955A5/de not_active IP Right Cessation
- 1979-05-17 AR AR276562A patent/AR218540A1/es active
- 1979-05-18 FR FR7912775A patent/FR2426458B1/fr not_active Expired
- 1979-05-18 JP JP6139679A patent/JPS54157843A/ja active Granted
- 1979-05-21 BE BE0/195299A patent/BE876425A/xx not_active IP Right Cessation
- 1979-05-21 BR BR7903126A patent/BR7903126A/pt unknown
- 1979-05-23 NO NO791702A patent/NO147859C/no unknown
- 1979-05-24 PH PH22561A patent/PH15533A/en unknown
- 1979-05-24 CA CA000328249A patent/CA1118360A/en not_active Expired
- 1979-08-08 IE IE1009/79A patent/IE48240B1/en unknown
-
1983
- 1983-12-30 MY MY102/83A patent/MY8300102A/xx unknown
- 1983-12-30 MY MY101/83A patent/MY8300101A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU523563B2 (en) | 1982-08-05 |
| FR2426458A1 (fr) | 1979-12-21 |
| MY8300102A (en) | 1983-12-31 |
| SE7902993L (sv) | 1979-11-26 |
| BR7903126A (pt) | 1979-12-11 |
| DE2918132A1 (de) | 1979-11-29 |
| MX153894A (es) | 1987-02-11 |
| NO147859B (no) | 1983-03-21 |
| GB1599689A (en) | 1981-10-07 |
| JPS6256125B2 (enExample) | 1987-11-24 |
| NL7903191A (nl) | 1979-11-27 |
| IE48240B1 (en) | 1984-11-14 |
| NO147859C (no) | 1983-06-29 |
| ZA791715B (en) | 1980-11-26 |
| NO791702L (no) | 1979-11-27 |
| JPS54157843A (en) | 1979-12-13 |
| AR218540A1 (es) | 1980-06-13 |
| DE2918132C2 (enExample) | 1989-03-23 |
| IE791009L (en) | 1979-11-25 |
| FR2426458B1 (fr) | 1985-08-30 |
| CH641955A5 (en) | 1984-03-30 |
| DK157900B (da) | 1990-03-05 |
| MY8300101A (en) | 1983-12-31 |
| ATA347279A (de) | 1981-01-15 |
| IT1116852B (it) | 1986-02-10 |
| PT69497A (en) | 1979-05-01 |
| IT7948996A0 (it) | 1979-05-10 |
| DK178579A (da) | 1979-11-26 |
| AU4611179A (en) | 1979-11-29 |
| CA1118360A (en) | 1982-02-16 |
| NZ190071A (en) | 1981-03-16 |
| BE876425A (fr) | 1979-09-17 |
| PH15533A (en) | 1983-02-09 |
| AT363602B (de) | 1981-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4264580A (en) | Dental cream composition | |
| US4314990A (en) | Toothpaste compositions | |
| US3935305A (en) | Toothpaste | |
| US4891211A (en) | Stable hydrogen peroxide-releasing dentifice | |
| US3937804A (en) | Toothpaste | |
| US4160022A (en) | Toothpaste | |
| US3935304A (en) | Dental creams | |
| US3943240A (en) | Toothpaste | |
| NO163667B (no) | Tann- og munnpleiemiddel. | |
| JPS5826814A (ja) | 改良された可溶性弗化物有効性を有する歯磨剤 | |
| US3937321A (en) | Toothpaste | |
| US4301143A (en) | Dental cream composition | |
| FI58066B (fi) | Fluorhaltigt tandvaordsmedel | |
| US3937803A (en) | Flavored dental creams | |
| GB810345A (en) | Dentifrice abrasive material | |
| SE444763B (sv) | Tandkremskomposition | |
| US3034967A (en) | Fluoride dentifrice with insoluble alkali metal metaphosphate and aluminum compound polishing material | |
| JPH0764713B2 (ja) | 新規組成物 | |
| DE69901022T2 (de) | Mundpflegezusammensetzungen | |
| JPH0237325B2 (enExample) | ||
| SE442586B (sv) | Opak sprutbar tandkrem | |
| US4448766A (en) | Dentifrice composition | |
| CA1042804A (en) | Toothpaste | |
| US5037636A (en) | Fluoride stability in dicalcium phosphate dihydrate composition | |
| WO2001093821A2 (en) | Toothpaste composition having reduced dentin abrasivity |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7902993-0 Effective date: 19910117 Format of ref document f/p: F |