SE443135B - Sett att framstella klorformiat samt tioklorformiat samt foreningar framstellda enligt forfarandet - Google Patents
Sett att framstella klorformiat samt tioklorformiat samt foreningar framstellda enligt forfarandetInfo
- Publication number
- SE443135B SE443135B SE7802063A SE7802063A SE443135B SE 443135 B SE443135 B SE 443135B SE 7802063 A SE7802063 A SE 7802063A SE 7802063 A SE7802063 A SE 7802063A SE 443135 B SE443135 B SE 443135B
- Authority
- SE
- Sweden
- Prior art keywords
- reaction
- chloride
- solvent
- polar
- polarity
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 32
- 239000000126 substance Substances 0.000 title description 4
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 title description 3
- 238000006243 chemical reaction Methods 0.000 claims description 37
- 239000002904 solvent Substances 0.000 claims description 24
- 230000008569 process Effects 0.000 claims description 22
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 15
- 239000000376 reactant Substances 0.000 claims description 13
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 9
- 150000002730 mercury Chemical class 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- AMMGCGVWJMRTQI-UHFFFAOYSA-N prop-1-en-2-yl carbonochloridate Chemical compound CC(=C)OC(Cl)=O AMMGCGVWJMRTQI-UHFFFAOYSA-N 0.000 claims description 8
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 4
- 239000002798 polar solvent Substances 0.000 claims description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- PQLFROTZSIMBKR-UHFFFAOYSA-N ethenyl carbonochloridate Chemical compound ClC(=O)OC=C PQLFROTZSIMBKR-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- PACOTQGTEZMTOT-UHFFFAOYSA-N bis(ethenyl) carbonate Chemical compound C=COC(=O)OC=C PACOTQGTEZMTOT-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- -1 nitrated Chemical class 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- ZIWDBWVCIXXQRF-UHFFFAOYSA-N acetaldehyde;mercury Chemical compound [Hg].CC=O.CC=O ZIWDBWVCIXXQRF-UHFFFAOYSA-N 0.000 description 2
- WRYNUJYAXVDTCB-UHFFFAOYSA-M acetyloxymercury Chemical compound CC(=O)O[Hg] WRYNUJYAXVDTCB-UHFFFAOYSA-M 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- SFWXIKBVPJRJIT-UHFFFAOYSA-N bis(2-oxoethyl)mercury Chemical compound O=CC[Hg]CC=O SFWXIKBVPJRJIT-UHFFFAOYSA-N 0.000 description 2
- NPZKGIMPCUETOK-UHFFFAOYSA-M chloro(2-oxopropyl)mercury Chemical compound CC(=O)C[Hg]Cl NPZKGIMPCUETOK-UHFFFAOYSA-M 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910000474 mercury oxide Inorganic materials 0.000 description 2
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000197 pyrolysis Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VAYTZRYEBVHVLE-UHFFFAOYSA-N 1,3-dioxol-2-one Chemical compound O=C1OC=CO1 VAYTZRYEBVHVLE-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 1
- SDEJDHUOGNMPEF-UHFFFAOYSA-N 3-chloro-2H-pyran-2-carboxylic acid Chemical compound ClC=1C(OC=CC=1)C(=O)O SDEJDHUOGNMPEF-UHFFFAOYSA-N 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 230000035508 accumulation Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 210000003323 beak Anatomy 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical class [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- JDUZKTPDKIJDHY-UHFFFAOYSA-N o-ethenyl chloromethanethioate Chemical compound ClC(=S)OC=C JDUZKTPDKIJDHY-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 125000002348 vinylic group Chemical group 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C68/00—Preparation of esters of carbonic or haloformic acids
- C07C68/02—Preparation of esters of carbonic or haloformic acids from phosgene or haloformates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/10—Mercury compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7705641A FR2381739A1 (fr) | 1977-02-25 | 1977-02-25 | Procede de synthese industrielle du chloroformiate de vinyle |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7802063L SE7802063L (sv) | 1978-08-26 |
| SE443135B true SE443135B (sv) | 1986-02-17 |
Family
ID=9187264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7802063A SE443135B (sv) | 1977-02-25 | 1978-02-22 | Sett att framstella klorformiat samt tioklorformiat samt foreningar framstellda enligt forfarandet |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4210598A (hu) |
| JP (2) | JPS53105427A (hu) |
| BE (1) | BE864309A (hu) |
| BR (1) | BR7801129A (hu) |
| CA (1) | CA1113111A (hu) |
| CH (1) | CH627150A5 (hu) |
| DE (1) | DE2807338A1 (hu) |
| DK (1) | DK83678A (hu) |
| ES (1) | ES466909A1 (hu) |
| FR (1) | FR2381739A1 (hu) |
| GB (1) | GB1567429A (hu) |
| HU (1) | HU180527B (hu) |
| IE (1) | IE46548B1 (hu) |
| IL (1) | IL53953A (hu) |
| IT (1) | IT1107028B (hu) |
| LU (1) | LU79111A1 (hu) |
| NL (1) | NL179048C (hu) |
| SE (1) | SE443135B (hu) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2475558A1 (fr) * | 1980-02-07 | 1981-08-14 | Poudres & Explosifs Ste Nale | Procede de synthese de polymeres et de copolymeres a base de chloroformiate de vinyle |
| IL67077A (en) * | 1981-11-10 | 1986-04-29 | Poudres & Explosifs Ste Nale | Preparation of alpha-chloromethyl chloroformate |
| US8273914B1 (en) * | 2011-06-27 | 2012-09-25 | Bausch & Lomb Incorporated | Process for preparing vinyl chloroformate |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2337172A (en) * | 1941-05-21 | 1943-12-21 | Hooker Electrochemical Co | Halogenated alkyl carbonates and process for producing the same |
| US2377085A (en) * | 1943-09-29 | 1945-05-29 | Pittsburgh Plate Glass Co | Unsaturated chlorocarbonates and method of preparation |
| US3118862A (en) * | 1960-07-05 | 1964-01-21 | Du Pont | Copolymers of vinyl chloroformate, with acrylonitrile or vinyl acetate |
| US3165544A (en) * | 1960-09-06 | 1965-01-12 | Stauffer Chemical Co | Chlorothiolformates and preparation thereof |
| US3574699A (en) * | 1966-11-01 | 1971-04-13 | Air Reduction Co Ltd | Process for the preparation of divinyl carbonates |
| US3905981A (en) * | 1973-10-12 | 1975-09-16 | Research Corp | N-dealkylation of tertiary amines |
-
1977
- 1977-02-25 FR FR7705641A patent/FR2381739A1/fr active Granted
-
1978
- 1978-01-26 CH CH84978A patent/CH627150A5/fr not_active IP Right Cessation
- 1978-01-31 IE IE206/78A patent/IE46548B1/en unknown
- 1978-02-01 IL IL53953A patent/IL53953A/xx unknown
- 1978-02-07 GB GB4931/78A patent/GB1567429A/en not_active Expired
- 1978-02-10 US US05/876,688 patent/US4210598A/en not_active Expired - Lifetime
- 1978-02-13 ES ES466909A patent/ES466909A1/es not_active Expired
- 1978-02-13 IT IT67289/78A patent/IT1107028B/it active
- 1978-02-16 NL NLAANVRAGE7801737,A patent/NL179048C/xx not_active IP Right Cessation
- 1978-02-21 DE DE19782807338 patent/DE2807338A1/de active Granted
- 1978-02-22 SE SE7802063A patent/SE443135B/sv not_active IP Right Cessation
- 1978-02-23 LU LU79111A patent/LU79111A1/xx unknown
- 1978-02-24 BE BE185471A patent/BE864309A/xx not_active IP Right Cessation
- 1978-02-24 CA CA297,705A patent/CA1113111A/en not_active Expired
- 1978-02-24 BR BR7801129A patent/BR7801129A/pt unknown
- 1978-02-24 HU HU78SO1211A patent/HU180527B/hu not_active IP Right Cessation
- 1978-02-24 DK DK83678A patent/DK83678A/da not_active Application Discontinuation
- 1978-02-24 JP JP1995678A patent/JPS53105427A/ja active Granted
-
1980
- 1980-10-29 JP JP15086780A patent/JPS5686135A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS625422B2 (hu) | 1987-02-04 |
| BE864309A (fr) | 1978-08-24 |
| IL53953A0 (en) | 1978-04-30 |
| IE780206L (en) | 1978-08-25 |
| JPS53105427A (en) | 1978-09-13 |
| DE2807338C2 (hu) | 1988-08-18 |
| NL179048B (nl) | 1986-02-03 |
| CH627150A5 (hu) | 1981-12-31 |
| JPS5686135A (en) | 1981-07-13 |
| US4210598A (en) | 1980-07-01 |
| IL53953A (en) | 1981-05-20 |
| FR2381739B1 (hu) | 1980-11-28 |
| DE2807338A1 (de) | 1978-08-31 |
| LU79111A1 (fr) | 1979-09-06 |
| NL7801737A (nl) | 1978-08-29 |
| BR7801129A (pt) | 1979-01-02 |
| NL179048C (nl) | 1986-07-01 |
| SE7802063L (sv) | 1978-08-26 |
| FR2381739A1 (fr) | 1978-09-22 |
| IT1107028B (it) | 1985-11-18 |
| DK83678A (da) | 1978-08-26 |
| IT7867289A0 (it) | 1978-02-13 |
| HU180527B (en) | 1983-03-28 |
| GB1567429A (en) | 1980-05-14 |
| ES466909A1 (es) | 1978-10-01 |
| CA1113111A (en) | 1981-11-24 |
| JPS5751821B2 (hu) | 1982-11-04 |
| IE46548B1 (en) | 1983-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4196289A (en) | Process for producing triallyl isocyanurate | |
| US3065231A (en) | Production of triallyl isocyanurate | |
| US3170946A (en) | Preparation of arylchloroformates | |
| US2436311A (en) | Preparation of n, n'ethyleneurea | |
| US4764309A (en) | Preparation of chlorocarboxylic acid chlorides | |
| SE443135B (sv) | Sett att framstella klorformiat samt tioklorformiat samt foreningar framstellda enligt forfarandet | |
| US3850924A (en) | Process for preparing herbicidal triazines | |
| SU516341A3 (ru) | Способ получени замещенных бензофенонов | |
| US4238404A (en) | Process for the preparation of isocyanate derivatives of aliphatic, cycloaliphatic, and araliphatic compounds | |
| US3671556A (en) | Manufacturing process for esters of dihalo-hydroxybenzonitriles | |
| US3998886A (en) | Production of halogen-containing tertiary phosphine oxides | |
| US2623069A (en) | Method of producing 4-chlorobutane-1-sulfonyl chloride | |
| US4278799A (en) | Continuous process for the production of dichloroacetamides | |
| US3137694A (en) | Method for isolating tetrameric cyanogen halide from its reaction mixture | |
| DK160272B (da) | Fremgangsmaade til fremstilling af furfurylalkoholer | |
| EP0148145A1 (en) | Process for making nitrodiarylamines | |
| US4489006A (en) | Iodopentahydroperfluoroalkyl borates | |
| US3998841A (en) | Chlorothio-n-phthalimide and process therefor | |
| US3737435A (en) | Cyclic nitrile carbonate group containing chloroformates | |
| US3274226A (en) | Bis(alkoxyisocyanatophenyl)methane compounds | |
| JPH0222079B2 (hu) | ||
| US2899429A (en) | Nitroethylenes | |
| EP0346881B1 (en) | A process for producing furylpropargylcarbinol and a derivate thereof | |
| DK158038B (da) | Fremgangsmaade til fremstilling af di-n-propylacetonitril | |
| EP0432745B1 (en) | Process for producing furylpropargylcarbinols |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7802063-3 Effective date: 19920904 Format of ref document f/p: F |