SE438872B - Forfarande och medel for att elektrolytiskt utfella jern och atminstone en av metallerna nickel och kobolt - Google Patents
Forfarande och medel for att elektrolytiskt utfella jern och atminstone en av metallerna nickel och koboltInfo
- Publication number
- SE438872B SE438872B SE7807154A SE7807154A SE438872B SE 438872 B SE438872 B SE 438872B SE 7807154 A SE7807154 A SE 7807154A SE 7807154 A SE7807154 A SE 7807154A SE 438872 B SE438872 B SE 438872B
- Authority
- SE
- Sweden
- Prior art keywords
- iron
- nickel
- cobalt
- complexing agent
- acid
- Prior art date
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 title claims description 49
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 title claims description 34
- 229910052742 iron Inorganic materials 0.000 title claims description 25
- 229910052751 metal Inorganic materials 0.000 title claims description 18
- 239000002184 metal Substances 0.000 title claims description 18
- 229910052759 nickel Inorganic materials 0.000 title claims description 17
- 238000000034 method Methods 0.000 title claims description 11
- 150000002739 metals Chemical class 0.000 title claims description 10
- 239000010941 cobalt Substances 0.000 title claims description 9
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 title claims description 9
- 229910017052 cobalt Inorganic materials 0.000 title claims description 8
- 239000008139 complexing agent Substances 0.000 claims description 22
- -1 iron (II) compound Chemical class 0.000 claims description 16
- UGKDIUIOSMUOAW-UHFFFAOYSA-N iron nickel Chemical group [Fe].[Ni] UGKDIUIOSMUOAW-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- KGWWEXORQXHJJQ-UHFFFAOYSA-N [Fe].[Co].[Ni] Chemical compound [Fe].[Co].[Ni] KGWWEXORQXHJJQ-UHFFFAOYSA-N 0.000 claims description 5
- 238000004070 electrodeposition Methods 0.000 claims description 5
- 238000009713 electroplating Methods 0.000 claims description 5
- SDGNNLQZAPXALR-UHFFFAOYSA-N 3-sulfophthalic acid Chemical group OC(=O)C1=CC=CC(S(O)(=O)=O)=C1C(O)=O SDGNNLQZAPXALR-UHFFFAOYSA-N 0.000 claims description 4
- YCPXWRQRBFJBPZ-UHFFFAOYSA-N 5-sulfosalicylic acid Chemical group OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O YCPXWRQRBFJBPZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910001313 Cobalt-iron alloy Inorganic materials 0.000 claims description 4
- 230000000536 complexating effect Effects 0.000 claims description 4
- RHLPAVIBWYPLRV-UHFFFAOYSA-N 2-hydroxy-4-sulfobenzoic acid Chemical group OC(=O)C1=CC=C(S(O)(=O)=O)C=C1O RHLPAVIBWYPLRV-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000001869 cobalt compounds Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000002816 nickel compounds Chemical class 0.000 claims description 3
- VKKAMZOUYMSOLZ-UHFFFAOYSA-N 2-hydroxy-5-(3-sulfopropyl)benzoic acid Chemical group OC(=O)C1=CC(CCCS(O)(=O)=O)=CC=C1O VKKAMZOUYMSOLZ-UHFFFAOYSA-N 0.000 claims description 2
- 229910000531 Co alloy Inorganic materials 0.000 claims description 2
- 229910000640 Fe alloy Inorganic materials 0.000 claims description 2
- ZNPFTBFMCCMMJJ-UHFFFAOYSA-N 2-hydroxy-3,5-disulfobenzoic acid Chemical group OC(=O)C1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1O ZNPFTBFMCCMMJJ-UHFFFAOYSA-N 0.000 claims 2
- 229910001030 Iron–nickel alloy Inorganic materials 0.000 claims 2
- 230000002378 acidificating effect Effects 0.000 claims 2
- 230000001376 precipitating effect Effects 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 238000007747 plating Methods 0.000 description 15
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 7
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 6
- 229910045601 alloy Inorganic materials 0.000 description 6
- 239000000956 alloy Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 238000005868 electrolysis reaction Methods 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000010953 base metal Substances 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- NIAGBSSWEZDNMT-UHFFFAOYSA-N hydroxidotrioxidosulfur(.) Chemical class [O]S(O)(=O)=O NIAGBSSWEZDNMT-UHFFFAOYSA-N 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- 150000003456 sulfonamides Chemical class 0.000 description 4
- AEQDJSLRWYMAQI-UHFFFAOYSA-N 2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline Chemical compound C1CN2CC(C(=C(OC)C=C3)OC)=C3CC2C2=C1C=C(OC)C(OC)=C2 AEQDJSLRWYMAQI-UHFFFAOYSA-N 0.000 description 3
- CIWBSHSKHKDKBQ-DUZGATOHSA-N D-isoascorbic acid Chemical compound OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-DUZGATOHSA-N 0.000 description 3
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 3
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001720 carbohydrates Chemical class 0.000 description 3
- FQMNUIZEFUVPNU-UHFFFAOYSA-N cobalt iron Chemical compound [Fe].[Co].[Co] FQMNUIZEFUVPNU-UHFFFAOYSA-N 0.000 description 3
- 239000000356 contaminant Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000007857 degradation product Substances 0.000 description 3
- 235000010350 erythorbic acid Nutrition 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229940026239 isoascorbic acid Drugs 0.000 description 3
- 229910001453 nickel ion Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000176 sodium gluconate Substances 0.000 description 3
- 235000012207 sodium gluconate Nutrition 0.000 description 3
- 229940005574 sodium gluconate Drugs 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WXHLLJAMBQLULT-UHFFFAOYSA-N 2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-n-(2-methyl-6-sulfanylphenyl)-1,3-thiazole-5-carboxamide;hydrate Chemical compound O.C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1S WXHLLJAMBQLULT-UHFFFAOYSA-N 0.000 description 2
- JHUFGBSGINLPOW-UHFFFAOYSA-N 3-chloro-4-(trifluoromethoxy)benzoyl cyanide Chemical compound FC(F)(F)OC1=CC=C(C(=O)C#N)C=C1Cl JHUFGBSGINLPOW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 2
- 241000080590 Niso Species 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- DLDJFQGPPSQZKI-UHFFFAOYSA-N but-2-yne-1,4-diol Chemical class OCC#CCO DLDJFQGPPSQZKI-UHFFFAOYSA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 229940050410 gluconate Drugs 0.000 description 2
- 239000002932 luster Substances 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- 150000002815 nickel Chemical class 0.000 description 2
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 2
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- 229910000881 Cu alloy Inorganic materials 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical class O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QXZUUHYBWMWJHK-UHFFFAOYSA-N [Co].[Ni] Chemical compound [Co].[Ni] QXZUUHYBWMWJHK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- YXMOSSLNQKBZCQ-UHFFFAOYSA-N benzene iron(3+) Chemical compound C1=CC=CC=C1.[Fe+3] YXMOSSLNQKBZCQ-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- CSVUNXDXKHELCR-UHFFFAOYSA-L disodium;3-carboxy-4-oxidobenzenesulfonate Chemical compound [Na+].[Na+].OC(=O)C1=CC(S([O-])(=O)=O)=CC=C1[O-] CSVUNXDXKHELCR-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000006056 electrooxidation reaction Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229910001447 ferric ion Inorganic materials 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- UCNNJGDEJXIUCC-UHFFFAOYSA-L hydroxy(oxo)iron;iron Chemical compound [Fe].O[Fe]=O.O[Fe]=O UCNNJGDEJXIUCC-UHFFFAOYSA-L 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002506 iron compounds Chemical class 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/56—Electroplating: Baths therefor from solutions of alloys
- C25D3/562—Electroplating: Baths therefor from solutions of alloys containing more than 50% by weight of iron or nickel or cobalt
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electroplating And Plating Baths Therefor (AREA)
- Coating With Molten Metal (AREA)
- Electroplating Methods And Accessories (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/809,558 US4129482A (en) | 1977-06-24 | 1977-06-24 | Electroplating iron group metal alloys |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7807154L SE7807154L (sv) | 1978-12-25 |
| SE438872B true SE438872B (sv) | 1985-05-13 |
Family
ID=25201614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7807154A SE438872B (sv) | 1977-06-24 | 1978-06-22 | Forfarande och medel for att elektrolytiskt utfella jern och atminstone en av metallerna nickel och kobolt |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4129482A (Sortimente) |
| JP (1) | JPS5410238A (Sortimente) |
| AU (1) | AU520137B2 (Sortimente) |
| BE (1) | BE868254A (Sortimente) |
| BR (1) | BR7803921A (Sortimente) |
| CA (1) | CA1132088A (Sortimente) |
| CH (1) | CH636909A5 (Sortimente) |
| DE (1) | DE2826464A1 (Sortimente) |
| DK (1) | DK284778A (Sortimente) |
| ES (1) | ES470940A1 (Sortimente) |
| FR (1) | FR2395335A1 (Sortimente) |
| GB (1) | GB1577699A (Sortimente) |
| IT (1) | IT1103069B (Sortimente) |
| NL (1) | NL7806706A (Sortimente) |
| NO (1) | NO782166L (Sortimente) |
| NZ (1) | NZ187558A (Sortimente) |
| SE (1) | SE438872B (Sortimente) |
| ZA (1) | ZA783060B (Sortimente) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS215178B1 (en) * | 1980-03-07 | 1982-07-30 | Vaclav Landa | Electrolyte for catodic separation of the alloys of nickel and iron |
| US4767508A (en) * | 1986-02-27 | 1988-08-30 | Nippon Mining Co., Ltd. | Strike plating solution useful in applying primer plating to electronic parts |
| US5853556A (en) * | 1996-03-14 | 1998-12-29 | Enthone-Omi, Inc. | Use of hydroxy carboxylic acids as ductilizers for electroplating nickel-tungsten alloys |
| US5944975A (en) * | 1996-03-26 | 1999-08-31 | Texas Instruments Incorporated | Method of forming a lift-off layer having controlled adhesion strength |
| US6911068B2 (en) * | 2001-10-02 | 2005-06-28 | Shipley Company, L.L.C. | Plating bath and method for depositing a metal layer on a substrate |
| US7144489B1 (en) | 2001-10-27 | 2006-12-05 | Enpirion, Inc. | Photochemical reduction of Fe(III) for electroless or electrodeposition of iron alloys |
| JP2004152454A (ja) * | 2002-11-01 | 2004-05-27 | Hitachi Ltd | 磁気ヘッド及びその製造方法 |
| US7320832B2 (en) * | 2004-12-17 | 2008-01-22 | Integran Technologies Inc. | Fine-grained metallic coatings having the coefficient of thermal expansion matched to the one of the substrate |
| JP6296491B2 (ja) * | 2013-03-14 | 2018-03-20 | セイコーインスツル株式会社 | 金属構造体、金属構造体の製造方法、ばね部品、時計用発停レバーおよび時計 |
| DE102019107416A1 (de) * | 2019-03-22 | 2020-09-24 | RIAG Oberflächentechnik AG | Zusammensetzung zur elektrolytischen Vernickelung und Verfahren zur elektrolytischen Vernickelung mit einer solchen Zusammensetzung |
| US12006587B2 (en) * | 2020-02-19 | 2024-06-11 | Mark R. Schroeder | Highly magnetically permeable alloy deposition method for magnetic sensors |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2800440A (en) * | 1955-10-04 | 1957-07-23 | Udylite Res Corp | Electrodeposition of nickel |
| US3354059A (en) * | 1964-08-12 | 1967-11-21 | Ibm | Electrodeposition of nickel-iron magnetic alloy films |
| US3795591A (en) * | 1972-07-03 | 1974-03-05 | Oxy Metal Finishing Corp | Electrodeposition of bright nickel iron deposits employing a compound containing a sulfide and a sulfonate |
| US3806429A (en) * | 1972-07-03 | 1974-04-23 | Oxy Metal Finishing Corp | Electrodeposition of bright nickel-iron deposits,electrolytes therefor and coating an article with a composite nickel-iron,chromium coating |
| ZA755497B (en) * | 1974-09-16 | 1976-08-25 | M & T Chemicals Inc | Alloy plating |
| US3969198A (en) * | 1975-01-09 | 1976-07-13 | Permalite Chemicals Ltd. | Ni-Fe electro-plating |
| US3974044A (en) * | 1975-03-31 | 1976-08-10 | Oxy Metal Industries Corporation | Bath and method for the electrodeposition of bright nickel-iron deposits |
| US4036709A (en) * | 1975-09-22 | 1977-07-19 | M & T Chemicals Inc. | Electroplating nickel, cobalt, nickel-cobalt alloys and binary or ternary alloys of nickel, cobalt and iron |
| US4046647A (en) * | 1976-06-17 | 1977-09-06 | M&T Chemicals Inc. | Additive for improved electroplating process |
-
1977
- 1977-06-24 US US05/809,558 patent/US4129482A/en not_active Expired - Lifetime
-
1978
- 1978-05-29 ZA ZA00783060A patent/ZA783060B/xx unknown
- 1978-05-30 GB GB23882/78A patent/GB1577699A/en not_active Expired
- 1978-06-05 JP JP6755578A patent/JPS5410238A/ja active Granted
- 1978-06-14 NZ NZ187558A patent/NZ187558A/xx unknown
- 1978-06-16 AU AU37190/78A patent/AU520137B2/en not_active Expired
- 1978-06-16 DE DE19782826464 patent/DE2826464A1/de active Granted
- 1978-06-19 IT IT09506/78A patent/IT1103069B/it active
- 1978-06-19 BE BE188681A patent/BE868254A/xx not_active IP Right Cessation
- 1978-06-20 ES ES470940A patent/ES470940A1/es not_active Expired
- 1978-06-20 FR FR7818431A patent/FR2395335A1/fr active Granted
- 1978-06-20 BR BR787803921A patent/BR7803921A/pt unknown
- 1978-06-21 NO NO782166A patent/NO782166L/no unknown
- 1978-06-21 NL NL7806706A patent/NL7806706A/xx not_active Application Discontinuation
- 1978-06-21 CH CH675878A patent/CH636909A5/de not_active IP Right Cessation
- 1978-06-22 SE SE7807154A patent/SE438872B/sv not_active IP Right Cessation
- 1978-06-23 CA CA306,117A patent/CA1132088A/en not_active Expired
- 1978-06-23 DK DK284778A patent/DK284778A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5410238A (en) | 1979-01-25 |
| NZ187558A (en) | 1979-10-25 |
| ES470940A1 (es) | 1979-02-01 |
| NL7806706A (nl) | 1978-12-28 |
| IT1103069B (it) | 1985-10-14 |
| US4129482A (en) | 1978-12-12 |
| DK284778A (da) | 1978-12-25 |
| NO782166L (no) | 1978-12-28 |
| JPS6141999B2 (Sortimente) | 1986-09-18 |
| CA1132088A (en) | 1982-09-21 |
| CH636909A5 (de) | 1983-06-30 |
| BR7803921A (pt) | 1979-01-16 |
| DE2826464C2 (Sortimente) | 1988-12-29 |
| GB1577699A (en) | 1980-10-29 |
| BE868254A (fr) | 1978-10-16 |
| FR2395335A1 (fr) | 1979-01-19 |
| DE2826464A1 (de) | 1979-01-11 |
| AU520137B2 (en) | 1982-01-14 |
| SE7807154L (sv) | 1978-12-25 |
| AU3719078A (en) | 1979-12-20 |
| ZA783060B (en) | 1979-06-27 |
| IT7809506A0 (it) | 1978-06-19 |
| FR2395335B1 (Sortimente) | 1984-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USRE31508E (en) | Electrodeposition of chromium | |
| US3804726A (en) | Electroplating processes and compositions | |
| US4053373A (en) | Electroplating of nickel, cobalt, nickel-cobalt, nickel-iron, cobalt-iron and nickel-iron-cobalt deposits | |
| US4036709A (en) | Electroplating nickel, cobalt, nickel-cobalt alloys and binary or ternary alloys of nickel, cobalt and iron | |
| CN1926265B (zh) | 铁磷电镀浴及方法 | |
| SE438872B (sv) | Forfarande och medel for att elektrolytiskt utfella jern och atminstone en av metallerna nickel och kobolt | |
| EP1068374A2 (en) | Ductility agents for nickel-tungsten alloys | |
| US3879270A (en) | Compositions and process for the electrodeposition of metals | |
| US4104137A (en) | Alloy plating | |
| US4014759A (en) | Electroplating iron alloys containing nickel, cobalt or nickel and cobalt | |
| US4046647A (en) | Additive for improved electroplating process | |
| US4119502A (en) | Acid zinc electroplating process and composition | |
| EP0892087A2 (en) | Electroplating of low-stress nickel | |
| US4014761A (en) | Bright acid zinc plating | |
| US4521282A (en) | Cyanide-free copper electrolyte and process | |
| US7329334B2 (en) | Controlling the hardness of electrodeposited copper coatings by variation of current profile | |
| CA1114768A (en) | Addition of rare earth metal compounds in nickel, cobalt, or iron plating | |
| US3969399A (en) | Electroplating processes and compositions | |
| US4069112A (en) | Electroplating of nickel, cobalt, mutual alloys thereof or ternary alloys thereof with iron | |
| US4138294A (en) | Acid zinc electroplating process and composition | |
| US3972788A (en) | Zinc anode benefaction | |
| EP0025694B1 (en) | Bright nickel plating bath and process and composition therefor | |
| US4764262A (en) | High quality, bright nickel plating | |
| AU638512B2 (en) | Protection of lead-containing anodes during chromium electroplating | |
| KR820000032B1 (ko) | 산성 도금 수용액 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7807154-5 Effective date: 19910131 Format of ref document f/p: F |