SE426397B - Herbar blanding pa basis av epoxidforening, dimerkaptoforening och polykarbonsyraanhydrid - Google Patents
Herbar blanding pa basis av epoxidforening, dimerkaptoforening och polykarbonsyraanhydridInfo
- Publication number
- SE426397B SE426397B SE7802709A SE7802709A SE426397B SE 426397 B SE426397 B SE 426397B SE 7802709 A SE7802709 A SE 7802709A SE 7802709 A SE7802709 A SE 7802709A SE 426397 B SE426397 B SE 426397B
- Authority
- SE
- Sweden
- Prior art keywords
- compound
- epoxide
- adduct
- contain
- mercapto groups
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 34
- 239000000203 mixture Substances 0.000 title claims description 23
- 150000008065 acid anhydrides Chemical class 0.000 title 1
- -1 epoxide compound Chemical class 0.000 claims description 20
- 150000008064 anhydrides Chemical class 0.000 claims description 19
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 18
- 150000002118 epoxides Chemical group 0.000 claims description 16
- 125000001931 aliphatic group Chemical group 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000004593 Epoxy Substances 0.000 claims 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 claims 1
- 239000002243 precursor Substances 0.000 claims 1
- 238000005266 casting Methods 0.000 description 10
- 229920005989 resin Polymers 0.000 description 9
- 239000011347 resin Substances 0.000 description 9
- MWSKJDNQKGCKPA-UHFFFAOYSA-N 6-methyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1CC(C)=CC2C(=O)OC(=O)C12 MWSKJDNQKGCKPA-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002170 ethers Chemical class 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 3
- 229920003986 novolac Polymers 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- MUTGBJKUEZFXGO-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@@H]21 MUTGBJKUEZFXGO-OLQVQODUSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- VYKXQOYUCMREIS-UHFFFAOYSA-N methylhexahydrophthalic anhydride Chemical compound C1CCCC2C(=O)OC(=O)C21C VYKXQOYUCMREIS-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- JAYXSROKFZAHRQ-UHFFFAOYSA-N n,n-bis(oxiran-2-ylmethyl)aniline Chemical compound C1OC1CN(C=1C=CC=CC=1)CC1CO1 JAYXSROKFZAHRQ-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- KMOUUZVZFBCRAM-OLQVQODUSA-N (3as,7ar)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1C=CC[C@@H]2C(=O)OC(=O)[C@@H]21 KMOUUZVZFBCRAM-OLQVQODUSA-N 0.000 description 1
- LFTMJBWNOFFSRW-UHFFFAOYSA-N 1,2-Butanedithiol Chemical compound CCC(S)CS LFTMJBWNOFFSRW-UHFFFAOYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- YGKHJWTVMIMEPQ-UHFFFAOYSA-N 1,2-propanedithiol Chemical compound CC(S)CS YGKHJWTVMIMEPQ-UHFFFAOYSA-N 0.000 description 1
- OUPZKGBUJRBPGC-UHFFFAOYSA-N 1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound O=C1N(CC2OC2)C(=O)N(CC2OC2)C(=O)N1CC1CO1 OUPZKGBUJRBPGC-UHFFFAOYSA-N 0.000 description 1
- LYHOXXIAOMFHBS-UHFFFAOYSA-N 1,3-bis(oxiran-2-ylmethyl)-5-propan-2-ylimidazolidine-2,4-dione Chemical compound O=C1N(CC2OC2)C(=O)C(C(C)C)N1CC1CO1 LYHOXXIAOMFHBS-UHFFFAOYSA-N 0.000 description 1
- SRZXCOWFGPICGA-UHFFFAOYSA-N 1,6-Hexanedithiol Chemical compound SCCCCCCS SRZXCOWFGPICGA-UHFFFAOYSA-N 0.000 description 1
- PGTWZHXOSWQKCY-UHFFFAOYSA-N 1,8-Octanedithiol Chemical compound SCCCCCCCCS PGTWZHXOSWQKCY-UHFFFAOYSA-N 0.000 description 1
- GJRCLMJHPWCJEI-UHFFFAOYSA-N 1,9-Nonanedithiol Chemical compound SCCCCCCCCCS GJRCLMJHPWCJEI-UHFFFAOYSA-N 0.000 description 1
- KSJBMDCFYZKAFH-UHFFFAOYSA-N 2-(2-sulfanylethylsulfanyl)ethanethiol Chemical compound SCCSCCS KSJBMDCFYZKAFH-UHFFFAOYSA-N 0.000 description 1
- AYHLPQOWRMPEKH-UHFFFAOYSA-N 2-(6-methylheptoxymethyl)oxirane Chemical compound CC(C)CCCCCOCC1CO1 AYHLPQOWRMPEKH-UHFFFAOYSA-N 0.000 description 1
- YSUQLAYJZDEMOT-UHFFFAOYSA-N 2-(butoxymethyl)oxirane Chemical compound CCCCOCC1CO1 YSUQLAYJZDEMOT-UHFFFAOYSA-N 0.000 description 1
- CUFXMPWHOWYNSO-UHFFFAOYSA-N 2-[(4-methylphenoxy)methyl]oxirane Chemical compound C1=CC(C)=CC=C1OCC1OC1 CUFXMPWHOWYNSO-UHFFFAOYSA-N 0.000 description 1
- OVEUFHOBGCSKSH-UHFFFAOYSA-N 2-methyl-n,n-bis(oxiran-2-ylmethyl)aniline Chemical compound CC1=CC=CC=C1N(CC1OC1)CC1OC1 OVEUFHOBGCSKSH-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- FAUAZXVRLVIARB-UHFFFAOYSA-N 4-[[4-[bis(oxiran-2-ylmethyl)amino]phenyl]methyl]-n,n-bis(oxiran-2-ylmethyl)aniline Chemical compound C1OC1CN(C=1C=CC(CC=2C=CC(=CC=2)N(CC2OC2)CC2OC2)=CC=1)CC1CO1 FAUAZXVRLVIARB-UHFFFAOYSA-N 0.000 description 1
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 1
- AXXCMMDHXJCEON-UHFFFAOYSA-N 5,5-dimethyl-1,3-bis(oxiran-2-ylmethyl)-6-propan-2-yl-1,3-diazinane-2,4-dione Chemical compound O=C1N(CC2OC2)C(=O)C(C)(C)C(C(C)C)N1CC1CO1 AXXCMMDHXJCEON-UHFFFAOYSA-N 0.000 description 1
- RZJKZTPKSRPUFJ-UHFFFAOYSA-N 5,5-dimethyl-1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione Chemical compound O=C1N(CC2OC2)C(=O)C(C)(C)N1CC1CO1 RZJKZTPKSRPUFJ-UHFFFAOYSA-N 0.000 description 1
- 241000438098 Angela Species 0.000 description 1
- ADAHGVUHKDNLEB-UHFFFAOYSA-N Bis(2,3-epoxycyclopentyl)ether Chemical compound C1CC2OC2C1OC1CCC2OC21 ADAHGVUHKDNLEB-UHFFFAOYSA-N 0.000 description 1
- LCFVJGUPQDGYKZ-UHFFFAOYSA-N Bisphenol A diglycidyl ether Chemical compound C=1C=C(OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC1CO1 LCFVJGUPQDGYKZ-UHFFFAOYSA-N 0.000 description 1
- ZBRPUZSVISWQTL-UHFFFAOYSA-N CN(C)CC1(C(C(=CC=C1)CN(C)C)O)CN(C)C Chemical compound CN(C)CC1(C(C(=CC=C1)CN(C)C)O)CN(C)C ZBRPUZSVISWQTL-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- XFUOBHWPTSIEOV-UHFFFAOYSA-N bis(oxiran-2-ylmethyl) cyclohexane-1,2-dicarboxylate Chemical compound C1CCCC(C(=O)OCC2OC2)C1C(=O)OCC1CO1 XFUOBHWPTSIEOV-UHFFFAOYSA-N 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- SMTOKHQOVJRXLK-UHFFFAOYSA-N butane-1,4-dithiol Chemical compound SCCCCS SMTOKHQOVJRXLK-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 239000011353 cycloaliphatic epoxy resin Substances 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- VCUWJPJPQDKSHA-UHFFFAOYSA-N decane-1,2-dithiol Chemical compound CCCCCCCCC(S)CS VCUWJPJPQDKSHA-UHFFFAOYSA-N 0.000 description 1
- 238000000280 densification Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- WQABCVAJNWAXTE-UHFFFAOYSA-N dimercaprol Chemical compound OCC(S)CS WQABCVAJNWAXTE-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000374 eutectic mixture Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical compound SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000005987 sulfurization reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/42—Polycarboxylic acids; Anhydrides, halides or low molecular weight esters thereof
- C08G59/4284—Polycarboxylic acids; Anhydrides, halides or low molecular weight esters thereof together with other curing agents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/182—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing using pre-adducts of epoxy compounds with curing agents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/66—Mercaptans
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH302877A CH628074A5 (de) | 1977-03-10 | 1977-03-10 | Haertbare mischungen auf basis von epoxidverbindungen. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7802709L SE7802709L (sv) | 1978-09-11 |
| SE426397B true SE426397B (sv) | 1983-01-17 |
Family
ID=4247012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7802709A SE426397B (sv) | 1977-03-10 | 1978-03-09 | Herbar blanding pa basis av epoxidforening, dimerkaptoforening och polykarbonsyraanhydrid |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4136086A (show.php) |
| JP (1) | JPS53112999A (show.php) |
| CA (1) | CA1122744A (show.php) |
| CH (1) | CH628074A5 (show.php) |
| DE (1) | DE2809799A1 (show.php) |
| FR (1) | FR2383206A1 (show.php) |
| GB (1) | GB1563774A (show.php) |
| SE (1) | SE426397B (show.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4260720A (en) * | 1979-10-31 | 1981-04-07 | Ppg Industries, Inc. | Novel mercapto chain extended products and their use in cationic electrodeposition |
| US4292155A (en) * | 1979-10-31 | 1981-09-29 | Ppg Industries, Inc. | Cationic electrodeposition employing novel mercapto chain extended products |
| EP0200674B1 (de) * | 1985-02-01 | 1988-05-25 | Ciba-Geigy Ag | (Acylthiopropyl)-Polyphenole |
| US4829133A (en) * | 1987-06-23 | 1989-05-09 | The Dow Chemical Company | Sulfide containing aliphatic epoxy resins |
| US4816546A (en) * | 1987-06-23 | 1989-03-28 | The Dow Chemical Company | Mixed epoxy resins comprising sulfide containing aliphatic epoxy resins |
| US4921927A (en) * | 1988-08-19 | 1990-05-01 | The Dow Chemical Company | Sulfide containing aliphatic epoxy resins |
| US4983692A (en) * | 1989-01-23 | 1991-01-08 | The Dow Chemical Company | Sulfide containing aliphatic epoxy resins |
| ATE139627T1 (de) * | 1990-06-13 | 1996-07-15 | Ppg Industries Inc | Polymere mit hohem brechungsindex und hoher erweichungstemperatur |
| DE19534594B4 (de) * | 1995-09-19 | 2007-07-26 | Delo Industrieklebstoffe Gmbh & Co. Kg | Kationisch härtende, flexible Epoxidharzmassen und ihre Verwendung zum Auftragen dünner Schichten |
| US6312725B1 (en) * | 1999-04-16 | 2001-11-06 | Cohesion Technologies, Inc. | Rapid gelling biocompatible polymer composition |
| DE19926629A1 (de) * | 1999-06-11 | 2000-12-14 | Cognis Deutschland Gmbh | Epoxidharzhärter-Zusammensetzungen |
| DE60111370T2 (de) * | 2000-03-09 | 2005-11-10 | Advanced Chemistry and Technology, Inc., Garden Grove | Hochfeste polymere und raumfahrtversiegelungen daraus |
| WO2006078282A2 (en) | 2004-04-28 | 2006-07-27 | Angiotech Biomaterials Corporation | Compositions and systems for forming crosslinked biomaterials and associated methods of preparation and use |
| KR20170116114A (ko) | 2015-02-13 | 2017-10-18 | 쓰리엠 이노베이티브 프로퍼티즈 컴파니 | 내한성 실란트 및 그의 성분 |
| WO2020191579A1 (en) | 2019-03-25 | 2020-10-01 | 3M Innovative Properties Company | Curable compositions, articles therefrom, and methods of making and using same |
| JP2024105744A (ja) * | 2021-06-02 | 2024-08-07 | 旭化学工業株式会社 | 熱可塑性エポキシ樹脂、接着剤、改質剤、および、熱可塑性エポキシ樹脂の製造方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL173809B (nl) * | 1951-11-17 | Rca Corp | Beeldopneeminrichting met kleurcodeerstrookfilterstelsel. | |
| US2849416A (en) * | 1952-07-12 | 1958-08-26 | Union Carbide Corp | Addition products of polyglycidyl ethers of phenolic resins and polythiols |
| US3355512A (en) * | 1963-06-20 | 1967-11-28 | Shell Oil Co | Process for curing polyepoxides with the reaction product of h2s and tri or poly functional polyepoxides |
| US3361723A (en) * | 1965-02-04 | 1968-01-02 | Synergy Chemicals Inc | Thiol containing polyether and process for preparation thereof |
| GB1082565A (en) * | 1965-04-07 | 1967-09-06 | Ciba Ltd | Epoxy resin compositions |
| US3472913A (en) * | 1967-12-14 | 1969-10-14 | Dow Chemical Co | Polythiol composition and preparation thereof |
| US3670046A (en) * | 1969-06-16 | 1972-06-13 | Dow Chemical Co | Copolymers of bis-oxazolines and dithiol compounds as curing agents for polyepoxides |
| US3746685A (en) * | 1971-01-18 | 1973-07-17 | Ciba Geigy Ag | Curable mixtures of epoxide resins and polymercaptans |
| US3978151A (en) * | 1973-01-10 | 1976-08-31 | Diamond Shamrock Corporation | High-functional polymercaptan resins in epoxy/anhydride resin compositions |
| CH589115A5 (show.php) * | 1973-01-10 | 1977-06-30 | Diamond Shamrock Corp |
-
1977
- 1977-03-10 CH CH302877A patent/CH628074A5/de not_active IP Right Cessation
-
1978
- 1978-02-21 US US05/879,282 patent/US4136086A/en not_active Expired - Lifetime
- 1978-03-07 DE DE19782809799 patent/DE2809799A1/de active Granted
- 1978-03-08 CA CA298,529A patent/CA1122744A/en not_active Expired
- 1978-03-09 FR FR7806762A patent/FR2383206A1/fr active Granted
- 1978-03-09 SE SE7802709A patent/SE426397B/sv not_active IP Right Cessation
- 1978-03-09 GB GB9360/78A patent/GB1563774A/en not_active Expired
- 1978-03-10 JP JP2759078A patent/JPS53112999A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2809799A1 (de) | 1978-09-14 |
| SE7802709L (sv) | 1978-09-11 |
| DE2809799C2 (show.php) | 1988-09-22 |
| US4136086A (en) | 1979-01-23 |
| CH628074A5 (de) | 1982-02-15 |
| JPS6131132B2 (show.php) | 1986-07-18 |
| CA1122744A (en) | 1982-04-27 |
| FR2383206B1 (show.php) | 1980-04-18 |
| FR2383206A1 (fr) | 1978-10-06 |
| JPS53112999A (en) | 1978-10-02 |
| GB1563774A (en) | 1980-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE426397B (sv) | Herbar blanding pa basis av epoxidforening, dimerkaptoforening och polykarbonsyraanhydrid | |
| US4284574A (en) | Diglycidyl ethers of di-secondary alcohols, their preparation, and curable compositions containing them | |
| EP0057327B1 (en) | Cyclic perfluoroaliphatic disulfonimides | |
| US4694096A (en) | (Acylthiopropyl)phenols | |
| EP0014745B1 (en) | Curing agent for polyepoxides, curable epoxy resin compositions, hardened products therefrom and process for curing a polyepoxide | |
| EP0293977B1 (en) | Process for preparing phenolic curing agents for epoxy resins | |
| US3793248A (en) | Adducts,containing epoxide groups,from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| US4894431A (en) | Accelerated curing systems for epoxy resins | |
| US3793247A (en) | Curable epoxide resin compositions containing boron-trichloride-tertiary amine complexes | |
| US4845172A (en) | Co-advanced resins from copolymers of polyethers of polyhydric phenols and diglycidyl ethers of di-secondary alcohols | |
| KR900006913B1 (ko) | 에폭시 수지의 작용성을 증가시키는 방법 | |
| US4130511A (en) | Curable epoxide resin compositions | |
| US4721814A (en) | Mercaptan-containing polyphenols | |
| US4672101A (en) | Polyepoxy aromatic hydantoins | |
| US4296231A (en) | Curable epoxide resin mixtures | |
| US3948916A (en) | Diglycidyl compounds of N-heterocyclic compounds | |
| JP3448713B2 (ja) | 脂肪族多官能性第2アルコールのポリグリシジルエーテル、該化合物の製造法および該化合物を含む硬化性組成物 | |
| US3530095A (en) | Curable mixtures of epoxide resins and cyclic urea derivatives | |
| US4429093A (en) | Cyclic perfluoroaliphaticdisulfonimides as polymerization catalysts | |
| US3799894A (en) | Adducts,containing epoxide groups,from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| US3554968A (en) | Storage-stable hot-curable compositions of polyepoxides and acyl substituted urea derivatives | |
| US4169177A (en) | Polyether diureide epoxy additives | |
| US4689376A (en) | Heat-hardenable epoxide resin mixtures | |
| EP0305325B1 (en) | Co-advanced epoxy resins from polyglycidyl ethers of polyhydric phenols and diglycidyl ethers of di-secondary alcohols | |
| US3767617A (en) | Polycarboxylic acid curing agent for polyepoxide resin mixtures |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7802709-1 Effective date: 19890426 Format of ref document f/p: F |