SE410965B - Analogiforfarande for framstellning av derivat av m-fenylen-dioxamsyra - Google Patents
Analogiforfarande for framstellning av derivat av m-fenylen-dioxamsyraInfo
- Publication number
- SE410965B SE410965B SE7316994A SE7316994A SE410965B SE 410965 B SE410965 B SE 410965B SE 7316994 A SE7316994 A SE 7316994A SE 7316994 A SE7316994 A SE 7316994A SE 410965 B SE410965 B SE 410965B
- Authority
- SE
- Sweden
- Prior art keywords
- water
- solution
- acid
- filtration
- phenylene
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 8
- VWPKNXPWRGLLAE-UHFFFAOYSA-N 2-[3-(oxaloamino)anilino]-2-oxoacetic acid Chemical class OC(=O)C(=O)NC1=CC=CC(NC(=O)C(O)=O)=C1 VWPKNXPWRGLLAE-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 36
- -1 carboxy, acetyl Chemical group 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 229950001656 dioxamate Drugs 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 14
- OWCAKKIRPJUQFO-UHFFFAOYSA-N (2-methyl-2-nonyl-1,3-dioxolan-4-yl)methyl carbamate Chemical compound CCCCCCCCCC1(C)OCC(COC(N)=O)O1 OWCAKKIRPJUQFO-UHFFFAOYSA-N 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 3
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical class NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 88
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 81
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 78
- 239000000243 solution Substances 0.000 description 75
- 229910052757 nitrogen Inorganic materials 0.000 description 57
- 239000000203 mixture Substances 0.000 description 56
- 238000001914 filtration Methods 0.000 description 54
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- 239000002244 precipitate Substances 0.000 description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 33
- 238000002844 melting Methods 0.000 description 33
- 230000008018 melting Effects 0.000 description 33
- 239000007787 solid Substances 0.000 description 30
- 239000000460 chlorine Substances 0.000 description 27
- 239000000047 product Substances 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 26
- 239000000463 material Substances 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 22
- 238000001953 recrystallisation Methods 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 19
- 238000004458 analytical method Methods 0.000 description 17
- 238000010992 reflux Methods 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 16
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical class NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 15
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 13
- 239000007788 liquid Substances 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- 229960001701 chloroform Drugs 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 238000011282 treatment Methods 0.000 description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 8
- 239000002552 dosage form Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 7
- 238000010790 dilution Methods 0.000 description 7
- 239000012895 dilution Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 239000003380 propellant Substances 0.000 description 7
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 7
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 7
- 241000700159 Rattus Species 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 208000003455 anaphylaxis Diseases 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- RVGLGHVJXCETIO-UHFFFAOYSA-N lodoxamide Chemical compound OC(=O)C(=O)NC1=CC(C#N)=CC(NC(=O)C(O)=O)=C1Cl RVGLGHVJXCETIO-UHFFFAOYSA-N 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 206010002198 Anaphylactic reaction Diseases 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 208000006673 asthma Diseases 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 4
- 238000011321 prophylaxis Methods 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 206010020751 Hypersensitivity Diseases 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000011149 active material Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003708 ampul Substances 0.000 description 3
- 230000036783 anaphylactic response Effects 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 238000011049 filling Methods 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 229910052754 neon Inorganic materials 0.000 description 3
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 3
- 229940092253 ovalbumin Drugs 0.000 description 3
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical compound NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 3
- 239000008024 pharmaceutical diluent Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- GNIGIOGRFVPWCJ-UHFFFAOYSA-N 2,6-diamino-4-methylbenzoic acid Chemical compound CC1=CC(N)=C(C(O)=O)C(N)=C1 GNIGIOGRFVPWCJ-UHFFFAOYSA-N 0.000 description 2
- GUDFEGXIJXTNJG-UHFFFAOYSA-N 2-chloro-3,5-dinitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1Cl GUDFEGXIJXTNJG-UHFFFAOYSA-N 0.000 description 2
- QFGXKJGQMYAPIM-UHFFFAOYSA-N 2-chloro-3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=C(Cl)C([N+]([O-])=O)=C1 QFGXKJGQMYAPIM-UHFFFAOYSA-N 0.000 description 2
- RSCMSACQRPYYRN-UHFFFAOYSA-N 3,5-diaminobenzamide Chemical compound NC(=O)C1=CC(N)=CC(N)=C1 RSCMSACQRPYYRN-UHFFFAOYSA-N 0.000 description 2
- PWINPIZUWNKSPS-UHFFFAOYSA-N 3,5-diaminobenzonitrile Chemical compound NC1=CC(N)=CC(C#N)=C1 PWINPIZUWNKSPS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- RFXLDMCUOMLLHO-UHFFFAOYSA-N NC(C(C=C1)Cl)(C=C1C#N)N Chemical compound NC(C(C=C1)Cl)(C=C1C#N)N RFXLDMCUOMLLHO-UHFFFAOYSA-N 0.000 description 2
- 108010058846 Ovalbumin Proteins 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 230000007815 allergy Effects 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 2
- 238000005574 benzylation reaction Methods 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- AFYPFACVUDMOHA-UHFFFAOYSA-N chlorotrifluoromethane Chemical compound FC(F)(F)Cl AFYPFACVUDMOHA-UHFFFAOYSA-N 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 2
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- AQKHQRNEHINGEQ-UHFFFAOYSA-N ethyl 2-[3-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC=CC(NC(=O)C(=O)OCC)=C1 AQKHQRNEHINGEQ-UHFFFAOYSA-N 0.000 description 2
- XLLVGCSYPFWYFP-UHFFFAOYSA-N ethyl 2-[3-cyano-5-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC(NC(=O)C(=O)OCC)=CC(C#N)=C1 XLLVGCSYPFWYFP-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000006215 rectal suppository Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- WCYFVPXCFSXHKJ-UHFFFAOYSA-N (2-chloro-5-cyano-3-oxamoyloxyphenyl) 2-amino-2-oxoacetate Chemical compound C(C(=O)N)(=O)OC1=C(C(=CC(=C1)C#N)OC(C(=O)N)=O)Cl WCYFVPXCFSXHKJ-UHFFFAOYSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- UJPMYEOUBPIPHQ-UHFFFAOYSA-N 1,1,1-trifluoroethane Chemical compound CC(F)(F)F UJPMYEOUBPIPHQ-UHFFFAOYSA-N 0.000 description 1
- NPNPZTNLOVBDOC-UHFFFAOYSA-N 1,1-difluoroethane Chemical compound CC(F)F NPNPZTNLOVBDOC-UHFFFAOYSA-N 0.000 description 1
- WDCYWAQPCXBPJA-UHFFFAOYSA-N 1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1 WDCYWAQPCXBPJA-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- ZPXDNSYFDIHPOJ-UHFFFAOYSA-N 1,5-dichloro-2,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl ZPXDNSYFDIHPOJ-UHFFFAOYSA-N 0.000 description 1
- RFCAUADVODFSLZ-UHFFFAOYSA-N 1-Chloro-1,1,2,2,2-pentafluoroethane Chemical compound FC(F)(F)C(F)(F)Cl RFCAUADVODFSLZ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- KKTUQAYCCLMNOA-UHFFFAOYSA-N 2,3-diaminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1N KKTUQAYCCLMNOA-UHFFFAOYSA-N 0.000 description 1
- DQXCPXVCNOFYSW-UHFFFAOYSA-N 2,4-dichlorobenzene-1,3-diamine Chemical compound NC1=CC=C(Cl)C(N)=C1Cl DQXCPXVCNOFYSW-UHFFFAOYSA-N 0.000 description 1
- HKKWSIQQYJTJLW-UHFFFAOYSA-N 2,6-dinitrobenzoic acid Chemical compound OC(=O)C1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O HKKWSIQQYJTJLW-UHFFFAOYSA-N 0.000 description 1
- TUFLKAATZFUDCY-UHFFFAOYSA-N 2-[2-chloro-3-(oxaloamino)anilino]-2-oxoacetic acid Chemical compound OC(=O)C(=O)NC1=CC=CC(NC(=O)C(O)=O)=C1Cl TUFLKAATZFUDCY-UHFFFAOYSA-N 0.000 description 1
- UCKMFSYWGLKPFY-UHFFFAOYSA-N 2-[3-cyano-5-(oxaloamino)anilino]-2-oxoacetic acid Chemical compound OC(=O)C(=O)NC1=CC(NC(=O)C(O)=O)=CC(C#N)=C1 UCKMFSYWGLKPFY-UHFFFAOYSA-N 0.000 description 1
- UUIYULWYHDSXHL-NSHDSACASA-N 2-[[3-[(2s)-2-amino-2-carboxyethyl]-2,6-dioxopyrimidin-1-yl]methyl]benzoic acid Chemical compound O=C1N(C[C@H](N)C(O)=O)C=CC(=O)N1CC1=CC=CC=C1C(O)=O UUIYULWYHDSXHL-NSHDSACASA-N 0.000 description 1
- 229940058020 2-amino-2-methyl-1-propanol Drugs 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- HFHAVERNVFNSHL-UHFFFAOYSA-N 2-chloro-1,3-dinitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1Cl HFHAVERNVFNSHL-UHFFFAOYSA-N 0.000 description 1
- ADTKEYLCJYYHHH-UHFFFAOYSA-N 2-chloro-3,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1Cl ADTKEYLCJYYHHH-UHFFFAOYSA-N 0.000 description 1
- GXBZQHWSOAJTLZ-UHFFFAOYSA-N 2-chloro-3,5-dinitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=C(Cl)C([N+]([O-])=O)=C1 GXBZQHWSOAJTLZ-UHFFFAOYSA-N 0.000 description 1
- QANVSXSFEIMCHX-UHFFFAOYSA-N 2-chloro-5-methylbenzene-1,3-diamine Chemical compound CC1=CC(N)=C(Cl)C(N)=C1 QANVSXSFEIMCHX-UHFFFAOYSA-N 0.000 description 1
- LDNRLIILWFLOKE-UHFFFAOYSA-N 3,3-dinitrocyclohexa-1,5-diene-1-carboxamide Chemical compound [N+](=O)([O-])C1(CC=CC(C(=O)N)=C1)[N+](=O)[O-] LDNRLIILWFLOKE-UHFFFAOYSA-N 0.000 description 1
- IRGCUCUBSVLAPG-UHFFFAOYSA-N 3,5-bis(oxaloamino)benzoic acid Chemical compound OC(=O)C(=O)NC1=CC(NC(=O)C(O)=O)=CC(C(O)=O)=C1 IRGCUCUBSVLAPG-UHFFFAOYSA-N 0.000 description 1
- LGSOOGJMJMQFBY-UHFFFAOYSA-N 3,5-bis[(2-ethoxy-2-oxoacetyl)amino]benzoic acid Chemical compound CCOC(=O)C(=O)NC1=CC(NC(=O)C(=O)OCC)=CC(C(O)=O)=C1 LGSOOGJMJMQFBY-UHFFFAOYSA-N 0.000 description 1
- JNRZRTXBIBNNFS-UHFFFAOYSA-N 3,5-diamino-2-chlorobenzonitrile Chemical compound NC1=CC(N)=C(Cl)C(C#N)=C1 JNRZRTXBIBNNFS-UHFFFAOYSA-N 0.000 description 1
- UENRXLSRMCSUSN-UHFFFAOYSA-N 3,5-diaminobenzoic acid Chemical compound NC1=CC(N)=CC(C(O)=O)=C1 UENRXLSRMCSUSN-UHFFFAOYSA-N 0.000 description 1
- PCTFIHOVQYYAMH-UHFFFAOYSA-N 3,5-dinitro-4-chlorobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1 PCTFIHOVQYYAMH-UHFFFAOYSA-N 0.000 description 1
- SSDNULNTQAUNFQ-UHFFFAOYSA-N 3,5-dinitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC([N+]([O-])=O)=C1 SSDNULNTQAUNFQ-UHFFFAOYSA-N 0.000 description 1
- SSXPQLXWKPOYLJ-UHFFFAOYSA-N 4,6-dichlorobenzene-1,3-diamine Chemical compound NC1=CC(N)=C(Cl)C=C1Cl SSXPQLXWKPOYLJ-UHFFFAOYSA-N 0.000 description 1
- SCGDEDHSPCXGEC-UHFFFAOYSA-N 4-chloro-3,5-dinitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC([N+]([O-])=O)=C1Cl SCGDEDHSPCXGEC-UHFFFAOYSA-N 0.000 description 1
- XJECLNKDUIATFG-UHFFFAOYSA-N 4-chloro-3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=CC([N+]([O-])=O)=C1Cl XJECLNKDUIATFG-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GQYCZEQVVBVADT-UHFFFAOYSA-N C1=CC(=CC(C1Cl)([N+](=O)[O-])[N+](=O)[O-])C(=O)O Chemical compound C1=CC(=CC(C1Cl)([N+](=O)[O-])[N+](=O)[O-])C(=O)O GQYCZEQVVBVADT-UHFFFAOYSA-N 0.000 description 1
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 1
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010008583 Chloroma Diseases 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 101100441092 Danio rerio crlf3 gene Proteins 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000004262 Food Hypersensitivity Diseases 0.000 description 1
- 206010016946 Food allergy Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- RYXPMWYHEBGTRV-UHFFFAOYSA-N Omeprazole sodium Chemical compound [Na+].N=1C2=CC(OC)=CC=C2[N-]C=1S(=O)CC1=NC=C(C)C(OC)=C1C RYXPMWYHEBGTRV-UHFFFAOYSA-N 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 240000003801 Sigesbeckia orientalis Species 0.000 description 1
- 235000003407 Sigesbeckia orientalis Nutrition 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000019406 chloropentafluoroethane Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- UMNKXPULIDJLSU-UHFFFAOYSA-N dichlorofluoromethane Chemical compound FC(Cl)Cl UMNKXPULIDJLSU-UHFFFAOYSA-N 0.000 description 1
- 229940099364 dichlorofluoromethane Drugs 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- NSNHWTBQMQIDCF-UHFFFAOYSA-N dihydrate;hydrochloride Chemical compound O.O.Cl NSNHWTBQMQIDCF-UHFFFAOYSA-N 0.000 description 1
- 239000012971 dimethylpiperazine Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- SMSKWQREPCWFLT-UHFFFAOYSA-N ethyl 2-[2-chloro-3-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC=CC(NC(=O)C(=O)OCC)=C1Cl SMSKWQREPCWFLT-UHFFFAOYSA-N 0.000 description 1
- BNTAPIYHWPPFBW-UHFFFAOYSA-N ethyl 2-[2-chloro-5-cyano-3-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC(C#N)=CC(NC(=O)C(=O)OCC)=C1Cl BNTAPIYHWPPFBW-UHFFFAOYSA-N 0.000 description 1
- PGNXXYASNORBJH-UHFFFAOYSA-N ethyl 2-[3-[(2-ethoxy-2-oxoacetyl)amino]-4-methoxyanilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC=C(OC)C(NC(=O)C(=O)OCC)=C1 PGNXXYASNORBJH-UHFFFAOYSA-N 0.000 description 1
- TYDMMEHQLSLJCJ-UHFFFAOYSA-N ethyl 2-[3-[butyl-(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)N(CCCC)C1=CC=CC(NC(=O)C(=O)OCC)=C1 TYDMMEHQLSLJCJ-UHFFFAOYSA-N 0.000 description 1
- QMAUTTRMBGIADG-UHFFFAOYSA-N ethyl 2-[3-carbamoyl-5-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC(NC(=O)C(=O)OCC)=CC(C(N)=O)=C1 QMAUTTRMBGIADG-UHFFFAOYSA-N 0.000 description 1
- DTINMXKOAPRTQS-UHFFFAOYSA-N ethyl 2-[4-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate Chemical compound CCOC(=O)C(=O)NC1=CC=C(NC(=O)C(=O)OCC)C=C1 DTINMXKOAPRTQS-UHFFFAOYSA-N 0.000 description 1
- 229960003699 evans blue Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000020932 food allergy Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- KERBAAIBDHEFDD-UHFFFAOYSA-N n-ethylformamide Chemical compound CCNC=O KERBAAIBDHEFDD-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical class CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 235000020004 porter Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229940100618 rectal suppository Drugs 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 102000012498 secondary active transmembrane transporter activity proteins Human genes 0.000 description 1
- 108040003878 secondary active transmembrane transporter activity proteins Proteins 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Pulmonology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Chemical Or Physical Treatment Of Fibers (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31700572A | 1972-12-20 | 1972-12-20 | |
| US05/382,762 US3993679A (en) | 1972-12-20 | 1973-07-26 | Cyano phenylene dioxamic molecules |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE410965B true SE410965B (sv) | 1979-11-19 |
Family
ID=26980710
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7316994A SE410965B (sv) | 1972-12-20 | 1973-12-17 | Analogiforfarande for framstellning av derivat av m-fenylen-dioxamsyra |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3993679A (cs) |
| JP (1) | JPS5761028B2 (cs) |
| CA (1) | CA1030156A (cs) |
| CH (1) | CH605662A5 (cs) |
| DE (1) | DE2362409C3 (cs) |
| ES (1) | ES421536A1 (cs) |
| FR (1) | FR2211230B1 (cs) |
| GB (2) | GB1454778A (cs) |
| HK (1) | HK10982A (cs) |
| HU (1) | HU168135B (cs) |
| NL (1) | NL177487C (cs) |
| SE (1) | SE410965B (cs) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4191840A (en) * | 1973-03-23 | 1980-03-04 | American Home Products Corporation | Oxamic acid derivatives |
| CA1058209A (en) * | 1974-06-10 | 1979-07-10 | John B. Wright | Cyano phenylene-dioxamates |
| US4011337A (en) * | 1975-07-07 | 1977-03-08 | The Upjohn Company | Oxamide-oxamic compounds, compositions and methods of use |
| US4055414A (en) * | 1976-03-11 | 1977-10-25 | Monsanto Company | Herbicidal composition and method of use |
| US4057556A (en) * | 1976-06-17 | 1977-11-08 | Ayerst, Mckenna & Harrison Ltd. | Troponyl-oxamic acid derivatives |
| US4119783A (en) * | 1977-02-18 | 1978-10-10 | The Upjohn Company | 3'Lower alkylcarbonyl oxanilic acid esters |
| US4089974A (en) * | 1977-06-13 | 1978-05-16 | American Cyanamid Company | 5-Carboxy-phenylenebis(carbonylimino)benzene carboxylic and dicarboxylic acids and salts |
| DE2861051D1 (en) * | 1977-06-28 | 1981-11-26 | Sandoz Ag | Oxaminic acids and esters, process for their preparation and pharmaceutical compositions containing them |
| US4204970A (en) * | 1978-12-07 | 1980-05-27 | Standard Oil Company (Indiana) | Lubricant compositions containing alkylated aromatic amino acid antioxidants |
| EP0018100B1 (en) * | 1979-04-12 | 1984-01-18 | Imperial Chemical Industries Plc | Substituted aromatic biologically active compound, a process for its preparation and its use as biocide |
| CA1181070A (en) * | 1979-11-28 | 1985-01-15 | Kiyoshi Murase | Process of producing 2-hydroxyoxanilic acid derivatives |
| US4296129A (en) * | 1980-10-29 | 1981-10-20 | Pfizer, Inc. | (Carboxyacylamino)phenylalkenamides and esters thereof as SRS-A antagonists |
| US4342781A (en) * | 1981-05-29 | 1982-08-03 | Pfizer Inc. | Diphenylpropenamides as SRS-A antagonists |
| US4584315A (en) * | 1981-11-16 | 1986-04-22 | The Upjohn Company | Method of treating ischemic states |
| US4447449A (en) * | 1981-11-16 | 1984-05-08 | The Upjohn Company | Methods of treating ischemic states |
| DE3229539A1 (de) * | 1982-08-07 | 1984-02-09 | Basf Ag, 6700 Ludwigshafen | Neue oxamidsaeure-derivate, verfahren zu ihrer herstellung und diese enthaltende therapeutische mittel |
| DE3474817D1 (en) * | 1983-09-01 | 1988-12-01 | Boehringer Ingelheim Ltd | Diazine-ethenylphenyl oxamic acids and esters and salts thereof |
| US4788198A (en) * | 1983-09-01 | 1988-11-29 | Boehringer Ingelheim Pharmaceuticals, Inc. | Diazine-ethyenylphenyl oxamic acids and esters and salts thereof |
| US4681884A (en) * | 1983-09-01 | 1987-07-21 | Boehringer Ingelheim Pharmaceuticals, Inc. | Diazine-ethenylphenyl oxamic acids and esters and salts thereof |
| US5457126A (en) * | 1986-11-18 | 1995-10-10 | Alcon Laboratories, Inc. | Use of lodoxamide to treat ophthalmic allergic conditions |
| US6225327B1 (en) | 1996-04-18 | 2001-05-01 | Alcon Laboratories, Inc. | Compounds which inhibit human conjunctival mast cell degranulation for treating ocular allergic-type complications |
| US6225332B1 (en) | 1997-10-21 | 2001-05-01 | Alcon Laboratories, Inc. | Compositions containing histamine H2 agonists and methods of use in treating allergy and inflammation |
| US6596284B1 (en) | 2002-04-30 | 2003-07-22 | Thomas E. Fleming | Treating eczema with a combination of isotonic saline ocean® and nasal mast cell stabilizers |
| CN101182372B (zh) * | 2002-07-05 | 2010-12-01 | 沙伯基础创新塑料知识产权有限公司 | 含n,n'-草酰二苯胺结构单元的耐气候性聚碳酸酯、其制造方法及由其制得的制品 |
| CN108863846B (zh) * | 2017-05-09 | 2020-11-06 | 武汉先路医药科技股份有限公司 | 一种洛度沙胺氨丁三醇中间体的制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH485485A (de) * | 1966-02-07 | 1970-02-15 | Ciba Geigy | Verwendung von Oxalsäure-esteramiden als Ultraviolettschutzmittel ausserhalb der Textilindustrie |
| US3532737A (en) * | 1967-02-02 | 1970-10-06 | Sterling Drug Inc | Esters of arylglyoxylic acids |
| CH500260A (de) * | 1967-05-16 | 1971-01-29 | Ciba Geigy Ag | Verwendung von Bis-oxalsäure-esteramiden als Stabilisierungsmittel ausserhalb der Textilindustrie |
| US3781329A (en) * | 1971-12-23 | 1973-12-25 | American Cyanamid Co | Electronegatively substituted carboxy-phenyl oxalates as superior chemiluminescent materials |
| US3852324A (en) * | 1972-12-20 | 1974-12-03 | Upjohn Co | N,n-(cyano-phenylene) dioxamic acids |
-
1973
- 1973-07-26 US US05/382,762 patent/US3993679A/en not_active Expired - Lifetime
- 1973-11-13 CH CH1594873A patent/CH605662A5/fr not_active IP Right Cessation
- 1973-11-19 CA CA186,095A patent/CA1030156A/en not_active Expired
- 1973-11-28 GB GB4817075A patent/GB1454778A/en not_active Expired
- 1973-11-28 GB GB5520873A patent/GB1454777A/en not_active Expired
- 1973-12-11 NL NLAANVRAGE7316916,A patent/NL177487C/xx not_active IP Right Cessation
- 1973-12-15 ES ES421536A patent/ES421536A1/es not_active Expired
- 1973-12-15 DE DE2362409A patent/DE2362409C3/de not_active Expired
- 1973-12-17 JP JP48139732A patent/JPS5761028B2/ja not_active Expired
- 1973-12-17 SE SE7316994A patent/SE410965B/sv unknown
- 1973-12-19 HU HUUO98A patent/HU168135B/hu unknown
- 1973-12-19 FR FR7345462A patent/FR2211230B1/fr not_active Expired
-
1982
- 1982-03-11 HK HK109/82A patent/HK10982A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU6298073A (en) | 1975-05-29 |
| GB1454778A (en) | 1976-11-03 |
| FR2211230B1 (cs) | 1977-04-15 |
| HK10982A (en) | 1982-03-19 |
| CH605662A5 (cs) | 1978-10-13 |
| NL177487C (nl) | 1985-10-01 |
| JPS49108029A (cs) | 1974-10-14 |
| NL177487B (nl) | 1985-05-01 |
| FR2211230A1 (cs) | 1974-07-19 |
| HU168135B (cs) | 1976-02-28 |
| JPS5761028B2 (cs) | 1982-12-22 |
| ES421536A1 (es) | 1976-07-16 |
| DE2362409C3 (de) | 1980-05-14 |
| NL7316916A (cs) | 1974-06-24 |
| CA1030156A (en) | 1978-04-25 |
| US3993679A (en) | 1976-11-23 |
| DE2362409B2 (de) | 1979-08-09 |
| GB1454777A (en) | 1976-11-03 |
| DE2362409A1 (de) | 1974-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE410965B (sv) | Analogiforfarande for framstellning av derivat av m-fenylen-dioxamsyra | |
| Paget et al. | Heterocyclic substituted ureas. I. Immunosuppression and virus inhibition by benzimidazolylureas | |
| JPH05117276A (ja) | 新規な3環性キノキサリンジオン誘導体 | |
| US4159341A (en) | Anti-allergic bis-phenylene compositions and methods of using same | |
| US4089973A (en) | Cyano phenylene dioxamic acid compounds used in the treatment of allergy | |
| US3852324A (en) | N,n-(cyano-phenylene) dioxamic acids | |
| SE446267B (sv) | Nya kinolylguanidinderivat, forfaranden for framstellning derav samt farmaceutiska kompositioner innehallande nemnda derivat | |
| Smith Jr et al. | Some substituted benzimidazoles | |
| US4159278A (en) | Dioxamic acids and salts | |
| US4150140A (en) | Benzothiazolyl oxanic acids, esters and salts | |
| US3982006A (en) | M-Phenylene dioxamic acid derivatives | |
| US3972911A (en) | N,N'(Cyano-phenylene)dioxamic acids and esters | |
| Jacobs et al. | Methods for the Acylation of Aromatic Amino Compounds and Ureas, with Especial Reference to Chloroacetylation. | |
| FI71560C (fi) | Foerfarande foer framstaellning av nya analgetiska, antiflogistiska och antipyretiska 1,4,9,10-tetrahydropyrazolo -/4,3-e/pyrido/3,2-b//1,4/diazepin-10-oner. | |
| CA1058208A (en) | Pharmaceutical n,n'(phenylphenylene) dioxamic acid derivatives | |
| US4067995A (en) | Compounds, compositions and methods of use | |
| US4035368A (en) | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds | |
| US4186127A (en) | N-Hetero substituted dioxamic acid compounds | |
| US3963660A (en) | Pyridine dioxamic acids and esters | |
| US4044148A (en) | Compounds, compositions and methods of use | |
| US4281151A (en) | Phenylene dioxamate esters | |
| SU1235867A1 (ru) | 2-(0-Карбоксифениламино)-6 @ -пиримидо (2,1- @ )хиназолон-6 сол нокислый,про вл ющий противовоспалительную активность | |
| US4011337A (en) | Oxamide-oxamic compounds, compositions and methods of use | |
| CA1041100A (en) | Pyridine-diyldioxamic acid and derivatives | |
| US3953598A (en) | Compounds, compositions and methods of use |