SE333743B - - Google Patents
Info
- Publication number
- SE333743B SE333743B SE03712/66A SE371266A SE333743B SE 333743 B SE333743 B SE 333743B SE 03712/66 A SE03712/66 A SE 03712/66A SE 371266 A SE371266 A SE 371266A SE 333743 B SE333743 B SE 333743B
- Authority
- SE
- Sweden
- Prior art keywords
- alkyl
- reacting
- alkali metal
- liquid ammonia
- basic
- Prior art date
Links
- -1 piperidino, pyrrolidino Chemical group 0.000 abstract 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- 229910052783 alkali metal Inorganic materials 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 206010011224 Cough Diseases 0.000 abstract 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract 1
- 239000005977 Ethylene Substances 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 150000001350 alkyl halides Chemical class 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 239000000969 carrier Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 229940079593 drug Drugs 0.000 abstract 1
- 239000003814 drug Substances 0.000 abstract 1
- 150000002170 ethers Chemical class 0.000 abstract 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/092—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings with aromatic radicals attached to the chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT255865A AT255400B (de) | 1965-03-22 | 1965-03-22 | Verfahren zur Herstellung von neuen basischen Äthern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE333743B true SE333743B (enFirst) | 1971-03-29 |
Family
ID=3536422
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE03712/66A SE333743B (enFirst) | 1965-03-22 | 1966-03-21 |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US3441602A (enFirst) |
| AT (1) | AT255400B (enFirst) |
| BE (1) | BE678182A (enFirst) |
| CH (1) | CH473768A (enFirst) |
| DE (1) | DE1543729C3 (enFirst) |
| DK (1) | DK119883B (enFirst) |
| FI (1) | FI44801C (enFirst) |
| FR (2) | FR5420M (enFirst) |
| GB (2) | GB1064928A (enFirst) |
| NL (1) | NL6603660A (enFirst) |
| SE (1) | SE333743B (enFirst) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1921453C3 (de) * | 1969-04-26 | 1973-04-19 | Degussa | Basische Dithienylderivate |
| US3960960A (en) * | 1972-09-11 | 1976-06-01 | Chemie Linz Aktiengesellschaft | 1,1-Diphenyl-1-lower alkoxy-amino-alkanes and the salts thereof |
| JPS60132934A (ja) * | 1983-11-21 | 1985-07-16 | Nippon Shinyaku Co Ltd | ブタノ−ル誘導体 |
| US4956388A (en) * | 1986-12-22 | 1990-09-11 | Eli Lilly And Company | 3-aryloxy-3-substituted propanamines |
| KR880007433A (ko) * | 1986-12-22 | 1988-08-27 | 메리 앤 터커 | 3-아릴옥시-3-치환된 프로판아민 |
| WO2006071868A2 (en) * | 2004-12-23 | 2006-07-06 | Teva Pharmaceutical Industries Ltd. | Process for preparing pharmaceutically acceptable salts of duloxetine and intermediates thereof |
| EP1858859A1 (en) * | 2005-03-14 | 2007-11-28 | Teva Pharmaceutical Industries Ltd. | Process for the preparation of optically active (s)-(+)-n,n-dimethyl-3-(1-naphthalenyloxy)-3-(2-thienyl)propanamine |
| US7759500B2 (en) * | 2005-12-05 | 2010-07-20 | Teva Pharmaceutical Industries Ltd. | 2-(N-methyl-propanamine)-3-(2-naphthol)thiophene, an impurity of duloxetine hydrochloride |
| MX2007011611A (es) * | 2006-01-23 | 2007-10-18 | Teva Pharma | Fumarato de dnt y metodos de preparacion de ellos. |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB811659A (en) * | 1955-07-05 | 1959-04-08 | Bayer Ag | Process for producing derivatives of 1-aryl-3-amino propanol-1 |
| US2884456A (en) * | 1956-12-05 | 1959-04-28 | Mead Johnson & Co | N-substituted-1-aminoalkyl-3-arylindenes and indanes |
| DE1111208B (de) * | 1957-07-18 | 1961-07-20 | Hoechst Ag | Verfahren zur Herstellung von hustenreizstillend wirkenden, basisch substituierten Diphenylcarbinolestern |
| DE1083277B (de) * | 1958-03-19 | 1960-06-15 | Bayer Ag | Verfahren zur Herstellung von neuen 1-Phenyl-1-o-chlorphenyl-3-tert.-aminopropan-1-olen mit hustenreizstillenden Eigenschaften |
| US3157656A (en) * | 1960-07-20 | 1964-11-17 | Olin Mathieson | Heterocyclic compounds |
-
1965
- 1965-03-22 AT AT255865A patent/AT255400B/de active
-
1966
- 1966-02-18 DE DE1543729A patent/DE1543729C3/de not_active Expired
- 1966-02-22 CH CH253966A patent/CH473768A/de not_active IP Right Cessation
- 1966-03-03 FI FI660530A patent/FI44801C/fi active
- 1966-03-08 DK DK120066AA patent/DK119883B/da unknown
- 1966-03-17 GB GB11865/66A patent/GB1064928A/en not_active Expired
- 1966-03-17 GB GB11866/66A patent/GB1064900A/en not_active Expired
- 1966-03-21 NL NL6603660A patent/NL6603660A/xx unknown
- 1966-03-21 FR FR54251A patent/FR5420M/fr not_active Expired
- 1966-03-21 SE SE03712/66A patent/SE333743B/xx unknown
- 1966-03-21 FR FR54252A patent/FR5421M/fr not_active Expired
- 1966-03-21 US US535715A patent/US3441602A/en not_active Expired - Lifetime
- 1966-03-21 US US535695A patent/US3433804A/en not_active Expired - Lifetime
- 1966-03-21 BE BE678182D patent/BE678182A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI44801C (fi) | 1972-01-10 |
| FI44801B (enFirst) | 1971-09-30 |
| BE678182A (enFirst) | 1966-09-21 |
| US3441602A (en) | 1969-04-29 |
| AT255400B (de) | 1967-07-10 |
| DE1543729A1 (de) | 1969-12-18 |
| CH473768A (de) | 1969-06-15 |
| FR5420M (enFirst) | 1967-10-02 |
| DE1543729B2 (de) | 1973-04-05 |
| US3433804A (en) | 1969-03-18 |
| DE1543729C3 (de) | 1973-10-31 |
| NL6603660A (enFirst) | 1966-09-23 |
| FR5421M (enFirst) | 1967-10-02 |
| GB1064900A (en) | 1967-04-12 |
| GB1064928A (en) | 1967-04-12 |
| DK119883B (da) | 1971-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1022032A (en) | Basic ethers | |
| SE333743B (enFirst) | ||
| GB1120463A (en) | Derivatives of 1,3-diazafluoranthene-1-oxide | |
| GB1003535A (en) | Preparation of amine oxides | |
| GB940599A (en) | Piperidinecarboxamides | |
| ATE41848T1 (de) | Pflanzenwachstumsregulierende mittel. | |
| GB1074918A (en) | Method of preparing thiazolidines | |
| GB1033588A (en) | Preparation of amine oxides | |
| GB1086338A (en) | Basically substituted derivatives of 5,6-dihydro-dibenzo-[b,e]-azepine-6,11-dione-11-oxime | |
| GB917078A (en) | Improvements in or relating to piperidine derivatives | |
| SE321467B (enFirst) | ||
| ES319942A1 (es) | Procedimiento para la obtencion de 3 ',4',5'-trimetoxi-3-aminoacrilofenona. | |
| GB1003802A (en) | Pyrimidinone derivatives | |
| ES360860A1 (es) | Procedimiento para la preparacion de nuevos derivados de tiazepina. | |
| GB1097057A (en) | Imidazolinonesulphonamide derivatives | |
| GB1041698A (en) | Novel 3,4-dihydro-isoquinolinium salts | |
| ES348211A1 (es) | Procedimiento de preparacion de nuevas 11-h-dibenzotriaze- pinas-1, 2, 5. | |
| GB1241847A (en) | Organotin compounds | |
| YU237582A (en) | Process for stabilizing formaldehde solutions | |
| GB1163921A (en) | Azadibenzocycloheptene Derivatives | |
| GB880140A (en) | Substituted piperidines and the preparation thereof | |
| GB1104328A (en) | Process for the preparation of xanthine derivatives | |
| GB1097720A (en) | Method of preparing new iodinated x-ray contrast agent | |
| GB1071815A (en) | Phenothiazine derivatives | |
| GB1119836A (en) | Pharmaceutical compositions containing basic ethers |