SE124998C1 - - Google Patents
Info
- Publication number
- SE124998C1 SE124998C1 SE124998DA SE124998C1 SE 124998 C1 SE124998 C1 SE 124998C1 SE 124998D A SE124998D A SE 124998DA SE 124998 C1 SE124998 C1 SE 124998C1
- Authority
- SE
- Sweden
- Prior art keywords
- methylpiperidino
- propyl
- halide
- butoxybenzoate
- reacted
- Prior art date
Links
- -1 3- (2'-methylpiperidino) - -propyl Chemical group 0.000 claims description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 230000003444 anaesthetic effect Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- LAUFPZPAKULAGB-UHFFFAOYSA-N 4-butoxybenzoic acid Chemical compound CCCCOC1=CC=C(C(O)=O)C=C1 LAUFPZPAKULAGB-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- RCYHMQUAZXSPSY-UHFFFAOYSA-N 1-(3-chloropropyl)-2-methylpiperidine Chemical compound CC1CCCCN1CCCCl RCYHMQUAZXSPSY-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- KMGCTFHTBKBITO-UHFFFAOYSA-N 4-butoxybenzoyl chloride Chemical compound CCCCOC1=CC=C(C(Cl)=O)C=C1 KMGCTFHTBKBITO-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 206010042496 Sunburn Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000001804 debridement Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Landscapes
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE124998T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE124998C1 true SE124998C1 (enrdf_load_stackoverflow) | 1949-01-01 |
Family
ID=41923751
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE124998D SE124998C1 (enrdf_load_stackoverflow) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE124998C1 (enrdf_load_stackoverflow) |
-
0
- SE SE124998D patent/SE124998C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK156717B (da) | Analogifremgangsmaade til fremstilling af indomethacinderivater | |
| CS204959B2 (en) | Herbicide means and method of making the active component | |
| DK168523B1 (da) | N-substituerede 2-aminothiazoler, fremgangsmåde til deres fremstilling og præparater, der indeholder dem | |
| US3957850A (en) | Phenylacetic acid derivatives | |
| KR890016009A (ko) | 1,2,5,6-테트라히드로 피리딘유도체, 이들의 제조방법, 의약으로서 이들의 용도 및 이들을 함유하는 조성물 | |
| DE2964903D1 (en) | 2-lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds, processes for their preparation and pharmaceutical compositions containing them | |
| JPS59176284A (ja) | ８−アルコキシ−６，７−ジヒドロ−５−メチル−９−フルオロ−１−オキソ−１Ｈ，５Ｈ−ベンゾ〔ｉｊ〕キノリジン−２−カルボン酸 | |
| SU772482A3 (ru) | Способ получени 4-дифенилметилен- 1-оксибензилпиперидинов или их солей | |
| KR930007899A (ko) | 글리신 유도체 일나트륨염 사수화물, 이의 제조 방법, 이를 함유하는 제약학적 조성물, 및 이의 제조에 있어 중간체의 제조 방법 | |
| SE124998C1 (enrdf_load_stackoverflow) | ||
| UA79537C2 (en) | Indazolamides possessing analgesic activity | |
| US4439436A (en) | 1,3-Dioxolo(4,5-G)quinoline compounds | |
| US2454746A (en) | Cyclohexylalkylamines | |
| IE780901L (en) | Tetrazolyl-piperidinyl amides | |
| US2448996A (en) | - methyl piperidino | |
| DE69608699T2 (de) | Fluorsubstituierte benzoylpropionsaürederivate | |
| US2439818A (en) | Substituted esters of benzoic acid | |
| US2650230A (en) | Xanthene-9-carboxylic acid esters of nuclearly alkylated 4-piperidinols and salts thereof | |
| SU503507A3 (ru) | Способ получени 1-(2-циано-5-метилфенокси)-2-окси-3-алкиламинопропанов | |
| US2785195A (en) | Nu-(3-methylcyclopentyl)-sulfamic acid and salts thereof | |
| US2339788A (en) | Substituted para-aminobenzene sulphonamide compound | |
| US2907766A (en) | Piperazine derivatives | |
| US2448997A (en) | Piperidine propanol esters of phenylacetic acid | |
| US12180242B2 (en) | Pharmaceutical crystal of contezolid acefosamil, preparation method therefor, and uses thereof | |
| SE125741C1 (enrdf_load_stackoverflow) |