RU2738646C2 - Модуляторы эстрогеновых рецепторов - Google Patents
Модуляторы эстрогеновых рецепторов Download PDFInfo
- Publication number
- RU2738646C2 RU2738646C2 RU2018132037A RU2018132037A RU2738646C2 RU 2738646 C2 RU2738646 C2 RU 2738646C2 RU 2018132037 A RU2018132037 A RU 2018132037A RU 2018132037 A RU2018132037 A RU 2018132037A RU 2738646 C2 RU2738646 C2 RU 2738646C2
- Authority
- RU
- Russia
- Prior art keywords
- mmol
- methyl
- indol
- compound
- group
- Prior art date
Links
- 239000002834 estrogen receptor modulator Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 170
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 63
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 62
- 239000001257 hydrogen Substances 0.000 claims abstract description 62
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 62
- 150000003839 salts Chemical class 0.000 claims abstract description 58
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 40
- 102100038595 Estrogen receptor Human genes 0.000 claims abstract description 37
- 108010038795 estrogen receptors Proteins 0.000 claims abstract description 29
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 23
- 150000002367 halogens Chemical class 0.000 claims abstract description 23
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 17
- 230000001419 dependent effect Effects 0.000 claims abstract description 17
- 206010006187 Breast cancer Diseases 0.000 claims abstract description 16
- 208000026310 Breast neoplasm Diseases 0.000 claims abstract description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 16
- 230000001404 mediated effect Effects 0.000 claims abstract description 16
- 108010007005 Estrogen Receptor alpha Proteins 0.000 claims abstract description 15
- 239000003814 drug Substances 0.000 claims abstract description 14
- 102000015694 estrogen receptors Human genes 0.000 claims abstract description 8
- 239000000262 estrogen Substances 0.000 claims abstract description 7
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims abstract description 6
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 138
- -1 difluorocyclobutyl Chemical group 0.000 claims description 102
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 83
- 238000000034 method Methods 0.000 claims description 36
- 150000002431 hydrogen Chemical class 0.000 claims description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 28
- 238000011282 treatment Methods 0.000 claims description 25
- 239000008194 pharmaceutical composition Substances 0.000 claims description 24
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 claims description 22
- 206010028980 Neoplasm Diseases 0.000 claims description 19
- 201000011510 cancer Diseases 0.000 claims description 17
- 239000003085 diluting agent Substances 0.000 claims description 10
- MAWOHFOSAIXURX-UHFFFAOYSA-N cyclopentylcyclopentane Chemical group C1CCCC1C1CCCC1 MAWOHFOSAIXURX-UHFFFAOYSA-N 0.000 claims description 8
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 8
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 5
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- GDGULTXZDPTNNZ-NSCUHMNNSA-N methyl (E)-3-(3,5-difluoro-4-formylphenyl)prop-2-enoate Chemical compound COC(=O)\C=C\c1cc(F)c(C=O)c(F)c1 GDGULTXZDPTNNZ-NSCUHMNNSA-N 0.000 claims description 5
- 206010008342 Cervix carcinoma Diseases 0.000 claims description 4
- 206010033128 Ovarian cancer Diseases 0.000 claims description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 4
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 claims description 4
- 230000010261 cell growth Effects 0.000 claims description 4
- 201000010881 cervical cancer Diseases 0.000 claims description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 206010014733 Endometrial cancer Diseases 0.000 claims description 3
- 206010014759 Endometrial neoplasm Diseases 0.000 claims description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 3
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims description 3
- 238000007918 intramuscular administration Methods 0.000 claims description 3
- 238000001990 intravenous administration Methods 0.000 claims description 3
- 238000007920 subcutaneous administration Methods 0.000 claims description 3
- 230000000699 topical effect Effects 0.000 claims description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 230000002401 inhibitory effect Effects 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 168
- 201000010099 disease Diseases 0.000 abstract description 21
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 21
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 14
- 239000000126 substance Substances 0.000 abstract description 9
- 230000000694 effects Effects 0.000 abstract description 6
- 102000005962 receptors Human genes 0.000 abstract description 5
- 108020003175 receptors Proteins 0.000 abstract description 5
- 229940011871 estrogen Drugs 0.000 abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract description 3
- 230000004663 cell proliferation Effects 0.000 abstract description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 390
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 258
- 239000000243 solution Substances 0.000 description 198
- 235000019439 ethyl acetate Nutrition 0.000 description 159
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 136
- 239000011541 reaction mixture Substances 0.000 description 131
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 115
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 114
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 110
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 100
- 239000012044 organic layer Substances 0.000 description 99
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 96
- 239000007787 solid Substances 0.000 description 78
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 71
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 70
- 229910004298 SiO 2 Inorganic materials 0.000 description 70
- 229910052938 sodium sulfate Inorganic materials 0.000 description 70
- 235000011152 sodium sulphate Nutrition 0.000 description 70
- 125000001072 heteroaryl group Chemical group 0.000 description 48
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 43
- 125000003118 aryl group Chemical group 0.000 description 43
- 238000003818 flash chromatography Methods 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- 239000011734 sodium Substances 0.000 description 34
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 32
- 238000003756 stirring Methods 0.000 description 32
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 31
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 31
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 30
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 30
- 229960000583 acetic acid Drugs 0.000 description 29
- 125000004429 atom Chemical group 0.000 description 29
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 28
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 27
- 125000000392 cycloalkenyl group Chemical group 0.000 description 26
- 210000004027 cell Anatomy 0.000 description 25
- 238000002347 injection Methods 0.000 description 25
- 239000007924 injection Substances 0.000 description 25
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 25
- 229920006395 saturated elastomer Polymers 0.000 description 24
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 23
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 22
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 21
- 238000004440 column chromatography Methods 0.000 description 21
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 20
- 239000007864 aqueous solution Substances 0.000 description 20
- 238000004808 supercritical fluid chromatography Methods 0.000 description 19
- 239000010410 layer Substances 0.000 description 18
- 125000003342 alkenyl group Chemical group 0.000 description 17
- 125000000304 alkynyl group Chemical group 0.000 description 17
- 239000007788 liquid Substances 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- QSQQQURBVYWZKJ-MRVPVSSYSA-N (2r)-1-(1h-indol-3-yl)propan-2-amine Chemical compound C1=CC=C2C(C[C@H](N)C)=CNC2=C1 QSQQQURBVYWZKJ-MRVPVSSYSA-N 0.000 description 16
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 16
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 15
- 239000012043 crude product Substances 0.000 description 15
- 235000019253 formic acid Nutrition 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 239000012267 brine Substances 0.000 description 14
- 229910002091 carbon monoxide Inorganic materials 0.000 description 14
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- 238000000746 purification Methods 0.000 description 13
- 125000001424 substituent group Chemical group 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 125000003545 alkoxy group Chemical group 0.000 description 11
- 239000006184 cosolvent Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- 125000002947 alkylene group Chemical group 0.000 description 10
- 229910052786 argon Inorganic materials 0.000 description 10
- 125000001188 haloalkyl group Chemical group 0.000 description 10
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 10
- 238000004007 reversed phase HPLC Methods 0.000 description 10
- 239000012279 sodium borohydride Substances 0.000 description 10
- 229910000033 sodium borohydride Inorganic materials 0.000 description 10
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 238000011068 loading method Methods 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- VWUXBMIQPBEWFH-WCCTWKNTSA-N Fulvestrant Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)CC2=C1 VWUXBMIQPBEWFH-WCCTWKNTSA-N 0.000 description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 8
- 229940079593 drug Drugs 0.000 description 8
- 229960002258 fulvestrant Drugs 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- 125000000547 substituted alkyl group Chemical group 0.000 description 8
- OJFXAMILNHYNSV-UHFFFAOYSA-N (2-fluoro-2-methylpropyl) trifluoromethanesulfonate Chemical compound CC(C)(F)COS(=O)(=O)C(F)(F)F OJFXAMILNHYNSV-UHFFFAOYSA-N 0.000 description 7
- VKLJLIUSOUUEQR-LYIQJEATSA-N (E)-3-[3-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1-bicyclo[1.1.1]pentanyl]prop-2-enoic acid Chemical compound FC(CN1[C@@H](C=2NC3=CC=CC=C3C=2C[C@H]1C)C12CC(C1)(C2)/C=C/C(=O)O)(C)C VKLJLIUSOUUEQR-LYIQJEATSA-N 0.000 description 7
- 229940125944 selective estrogen receptor degrader Drugs 0.000 description 7
- 125000003107 substituted aryl group Chemical group 0.000 description 7
- HGFYTUMJTQXEII-JMAUQWQESA-N (E)-3-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1C12CC(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F HGFYTUMJTQXEII-JMAUQWQESA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 230000015556 catabolic process Effects 0.000 description 6
- 125000004122 cyclic group Chemical group 0.000 description 6
- 238000006731 degradation reaction Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 230000001988 toxicity Effects 0.000 description 6
- 231100000419 toxicity Toxicity 0.000 description 6
- 238000010626 work up procedure Methods 0.000 description 6
- DFBDRVGWBHBJNR-BBNFHIFMSA-N (e)-3-[3,5-difluoro-4-[(1r,3r)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C1([C@@H]2C3=C(C4=CC=CC=C4N3)C[C@H](N2CC(C)(C)F)C)=C(F)C=C(\C=C\C(O)=O)C=C1F DFBDRVGWBHBJNR-BBNFHIFMSA-N 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 5
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 5
- BVOINHANKYWPHF-OPGSHWCFSA-N N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]bicyclo[1.1.1]pentan-1-amine Chemical compound C[C@H](Cc1c[nH]c2ccccc12)NC12CC(C1)C2 BVOINHANKYWPHF-OPGSHWCFSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- ORCXPYPDHLVQFP-UHFFFAOYSA-N bicyclo[1.1.1]pentane-3-carboxylic acid Chemical compound C1C2CC1(C(=O)O)C2 ORCXPYPDHLVQFP-UHFFFAOYSA-N 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 125000001153 fluoro group Chemical group F* 0.000 description 5
- 238000004108 freeze drying Methods 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 125000005647 linker group Chemical group 0.000 description 5
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 5
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000002953 preparative HPLC Methods 0.000 description 5
- 230000002441 reversible effect Effects 0.000 description 5
- 229940095743 selective estrogen receptor modulator Drugs 0.000 description 5
- 239000000333 selective estrogen receptor modulator Substances 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- VKLJLIUSOUUEQR-RRDDARCESA-N (E)-3-[3-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1-bicyclo[1.1.1]pentanyl]prop-2-enoic acid Chemical compound FC(CN1[C@H](C=2NC3=CC=CC=C3C=2C[C@H]1C)C12CC(C1)(C2)/C=C/C(=O)O)(C)C VKLJLIUSOUUEQR-RRDDARCESA-N 0.000 description 4
- HGFYTUMJTQXEII-BNZUIEHPSA-N (E)-3-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-1-deuterio-3-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C12(CC(C1)C2)N1[C@](C=2NC3=CC=CC=C3C=2C[C@H]1C)([2H])C1=C(C=C(C=C1F)/C=C/C(=O)O)F HGFYTUMJTQXEII-BNZUIEHPSA-N 0.000 description 4
- LUQRDINNYDJOKA-UEVJZNBISA-N (E)-3-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C12(CC(C1)C2)N1[C@@H](C=2NC3=CC=CC=C3C=2C[C@H]1CC)C1=C(C=C(C=C1F)/C=C/C(=O)O)F LUQRDINNYDJOKA-UEVJZNBISA-N 0.000 description 4
- QGMBBUQAILNYNG-HDYINOBESA-N (E)-3-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanylmethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1CC12CC(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F QGMBBUQAILNYNG-HDYINOBESA-N 0.000 description 4
- SLEUIFQTJNKMKX-KJVJQDTNSA-N (E)-3-[4-[(1R,3R)-2-[(3,3-difluorocyclobutyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound FC1(CC(C1)CN1[C@@H](C=2NC3=CC=CC=C3C=2C[C@H]1C)C1=C(C=C(C=C1F)/C=C/C(=O)O)F)F SLEUIFQTJNKMKX-KJVJQDTNSA-N 0.000 description 4
- NFNBXIDRCPCPMO-VSFWEXNUSA-N (E)-3-[4-[(1R,3R)-3-ethyl-2-[(3R)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound CC[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1[C@@H]1CCOC1)c1c(F)cc(\C=C\C(O)=O)cc1F NFNBXIDRCPCPMO-VSFWEXNUSA-N 0.000 description 4
- NLLTWNLLLIZPHC-XTTYOXLRSA-N (E)-3-[4-[(3S)-3-(difluoromethyl)-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound FC([C@@H]1CC2=C(NC3=CC=CC=C23)C(N1C1COCC1)C1=C(C=C(C=C1F)/C=C/C(=O)O)F)F NLLTWNLLLIZPHC-XTTYOXLRSA-N 0.000 description 4
- RUSLAUZFXNAOQD-BQYQJAHWSA-N (E)-3-[4-[2-(1-bicyclo[1.1.1]pentanylmethyl)-3,3-dimethyl-4,9-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound CC1(C)Cc2c([nH]c3ccccc23)C(N1CC12CC(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F RUSLAUZFXNAOQD-BQYQJAHWSA-N 0.000 description 4
- BURHGPHDEVGCEZ-KJGLQBJMSA-N (e)-3-[4-[(e)-2-(2-chloro-4-fluorophenyl)-1-(1h-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid Chemical compound C=1C=C(F)C=C(Cl)C=1C(/CC)=C(C=1C=C2C=NNC2=CC=1)\C1=CC=C(\C=C\C(O)=O)C=C1 BURHGPHDEVGCEZ-KJGLQBJMSA-N 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- 102000007594 Estrogen Receptor alpha Human genes 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 230000004071 biological effect Effects 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 230000014759 maintenance of location Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 230000036470 plasma concentration Effects 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 4
- 125000005415 substituted alkoxy group Chemical group 0.000 description 4
- 208000024891 symptom Diseases 0.000 description 4
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- QRYFNEVDHFVBLZ-CQSZACIVSA-N (2R)-N-benzyl-1-(1H-indol-3-yl)propan-2-amine Chemical compound C(C1=CC=CC=C1)N[C@@H](CC1=CNC2=CC=CC=C12)C QRYFNEVDHFVBLZ-CQSZACIVSA-N 0.000 description 3
- UDQCRUSSQAXPJY-VIFPVBQESA-N (2s)-2-amino-3-(1h-indol-3-yl)propan-1-ol Chemical compound C1=CC=C2C(C[C@@H](CO)N)=CNC2=C1 UDQCRUSSQAXPJY-VIFPVBQESA-N 0.000 description 3
- SIFNOOUKXBRGGB-AREMUKBSSA-N (6r)-6-[2-[ethyl-[[4-[2-(ethylamino)ethyl]phenyl]methyl]amino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol Chemical compound C1=CC(CCNCC)=CC=C1CN(CC)C1=CC(OC)=CC=C1[C@H]1CC2=CC=C(O)C=C2CC1 SIFNOOUKXBRGGB-AREMUKBSSA-N 0.000 description 3
- PDPQZDZLSUTUJK-PYHKZKJUSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-7-hydroxy-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3cc(O)ccc23)[C@H](N1CC(C)(C)F)c1c(F)cc(\C=C\C(O)=O)cc1F PDPQZDZLSUTUJK-PYHKZKJUSA-N 0.000 description 3
- RBBGLHGAYXANGV-WJPHSNCVSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(3-fluoro-1-bicyclo[1.1.1]pentanyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1CC12CC(F)(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F RBBGLHGAYXANGV-WJPHSNCVSA-N 0.000 description 3
- DDXSLZCHKOKRTR-OZFANJHYSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1CC1(F)COC1)c1c(F)cc(\C=C\C(O)=O)cc1F DDXSLZCHKOKRTR-OZFANJHYSA-N 0.000 description 3
- MEJWPFGHPOHNKZ-BETNPCIISA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(4-methoxyphenyl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound COc1ccc(CN2[C@H](C)Cc3c([nH]c4ccccc34)[C@H]2c2c(F)cc(\C=C\C(O)=O)cc2F)cc1 MEJWPFGHPOHNKZ-BETNPCIISA-N 0.000 description 3
- WPZPXTYQSYNBQJ-UWTOEBBYSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(oxan-4-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1C1CCOCC1)c1c(F)cc(\C=C\C(O)=O)cc1F WPZPXTYQSYNBQJ-UWTOEBBYSA-N 0.000 description 3
- MENJPORUUIOTHB-GFLQYKCBSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(oxetan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1C1COC1)c1c(F)cc(\C=C\C(O)=O)cc1F MENJPORUUIOTHB-GFLQYKCBSA-N 0.000 description 3
- VGHGZKWXLYGRCW-KJVJQDTNSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-(oxetan-3-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound FC=1C=C(C=C(C=1[C@H]1N([C@@H](CC2=C1NC1=CC=CC=C21)C)CC1COC1)F)/C=C/C(=O)O VGHGZKWXLYGRCW-KJVJQDTNSA-N 0.000 description 3
- IUBCVULGFAYPCY-IKYCUZHVSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-[(3-methyloxetan-3-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1CC1(C)COC1)c1c(F)cc(\C=C\C(O)=O)cc1F IUBCVULGFAYPCY-IKYCUZHVSA-N 0.000 description 3
- DHDOJNNISYPJQP-LAKVKKFXSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-[(3S)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1[C@H]1CCOC1)c1c(F)cc(\C=C\C(O)=O)cc1F DHDOJNNISYPJQP-LAKVKKFXSA-N 0.000 description 3
- KKOGARBCFBXFKP-WJPHSNCVSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-[[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1CC12CC(C1)(C2)C(F)(F)F)c1c(F)cc(\C=C\C(O)=O)cc1F KKOGARBCFBXFKP-WJPHSNCVSA-N 0.000 description 3
- ABNJPIFXICOEIP-PYHKZKJUSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound FC=1C=C(C=C(C=1[C@H]1N([C@@H](CC2=C1NC1=CC=C(C=C21)F)C)CC(C)(C)F)F)/C=C/C(=O)O ABNJPIFXICOEIP-PYHKZKJUSA-N 0.000 description 3
- XZSQKRWMNNBJPA-DMYBTJMXSA-N (E)-3-[3,5-difluoro-4-[(1S,3S)-2-(2-fluoro-2-methylpropyl)-6-hydroxy-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@H]1Cc2c([nH]c3ccc(O)cc23)[C@@H](N1CC(C)(C)F)c1c(F)cc(\C=C\C(O)=O)cc1F XZSQKRWMNNBJPA-DMYBTJMXSA-N 0.000 description 3
- NQRJMQANZGNNCP-AATRIKPKSA-N (E)-3-[3,5-difluoro-4-[2-(oxolan-3-yl)spiro[4,9-dihydro-1H-pyrido[3,4-b]indole-3,1'-cyclopropane]-1-yl]phenyl]prop-2-enoic acid Chemical compound OC(=O)\C=C\c1cc(F)c(C2N(C3CCOC3)C3(CC3)Cc3c2[nH]c2ccccc32)c(F)c1 NQRJMQANZGNNCP-AATRIKPKSA-N 0.000 description 3
- RSENFKFUMSIUAR-UPEJEEEKSA-N (E)-3-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C12(CC(C1)C2)N1[C@@H](C=2N(C3=CC=CC=C3C=2C[C@H]1C)C)C1=C(C=C(C=C1F)/C=C/C(=O)O)F RSENFKFUMSIUAR-UPEJEEEKSA-N 0.000 description 3
- CAFRZFBQTREPKF-GFLQYKCBSA-N (E)-3-[4-[(1R,3R)-2-(3,3-difluorocyclobutyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1C1CC(F)(F)C1)c1c(F)cc(\C=C\C(O)=O)cc1F CAFRZFBQTREPKF-GFLQYKCBSA-N 0.000 description 3
- NFNBXIDRCPCPMO-AKASAYQYSA-N (E)-3-[4-[(1R,3R)-3-ethyl-2-[(3S)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound CC[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1[C@H]1CCOC1)c1c(F)cc(\C=C\C(O)=O)cc1F NFNBXIDRCPCPMO-AKASAYQYSA-N 0.000 description 3
- HGFYTUMJTQXEII-YISAXGRYSA-N (E)-3-[4-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](N1C12CC(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F HGFYTUMJTQXEII-YISAXGRYSA-N 0.000 description 3
- LUQRDINNYDJOKA-UBMWZVCNSA-N (E)-3-[4-[(1S,3S)-2-(1-bicyclo[1.1.1]pentanyl)-3-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound CC[C@H]1Cc2c([nH]c3ccccc23)[C@@H](N1C12CC(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F LUQRDINNYDJOKA-UBMWZVCNSA-N 0.000 description 3
- HGFYTUMJTQXEII-CCEMPJODSA-N (E)-3-[4-[(1S,3S)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C[C@H]1Cc2c([nH]c3ccccc23)[C@@H](N1C12CC(C1)C2)c1c(F)cc(\C=C\C(O)=O)cc1F HGFYTUMJTQXEII-CCEMPJODSA-N 0.000 description 3
- CAFRZFBQTREPKF-ZJQBCQQHSA-N (E)-3-[4-[(1S,3S)-2-(3,3-difluorocyclobutyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C[C@H]1Cc2c([nH]c3ccccc23)[C@@H](N1C1CC(F)(F)C1)c1c(F)cc(\C=C\C(O)=O)cc1F CAFRZFBQTREPKF-ZJQBCQQHSA-N 0.000 description 3
- KTWRJVSIGWSPQU-BQYQJAHWSA-N (E)-3-[4-[2-(1-bicyclo[1.1.1]pentanylmethyl)-3-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C12(CC(C1)C2)CN1C(C=2NC3=CC=CC=C3C=2CC1CC)C1=C(C=C(C=C1F)/C=C/C(=O)O)F KTWRJVSIGWSPQU-BQYQJAHWSA-N 0.000 description 3
- LDVHYJKRIKBISQ-UHFFFAOYSA-N 1-(1h-indol-3-yl)propan-2-one Chemical compound C1=CC=C2C(CC(=O)C)=CNC2=C1 LDVHYJKRIKBISQ-UHFFFAOYSA-N 0.000 description 3
- YFPJPQYUCYKTIZ-UHFFFAOYSA-N 1-(1h-indol-3-ylmethyl)cyclopropan-1-amine Chemical compound C=1NC2=CC=CC=C2C=1CC1(N)CC1 YFPJPQYUCYKTIZ-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- PBIVLMHOKZWHEW-LLVKDONJSA-N 2-fluoro-N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]-2-methylpropan-1-amine Chemical compound C[C@H](Cc1c[nH]c2ccccc12)NCC(C)(C)F PBIVLMHOKZWHEW-LLVKDONJSA-N 0.000 description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 3
- 239000005695 Ammonium acetate Substances 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 3
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 3
- 101710196141 Estrogen receptor Proteins 0.000 description 3
- 239000007821 HATU Substances 0.000 description 3
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 3
- KNUSIMFDBLKJJX-TVIZTDCDSA-N N-[(2S)-1-(1H-indol-3-yl)butan-2-yl]bicyclo[1.1.1]pentan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@H](CC)NC12CC(C1)C2 KNUSIMFDBLKJJX-TVIZTDCDSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 125000005631 S-sulfonamido group Chemical group 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 235000019257 ammonium acetate Nutrition 0.000 description 3
- 229940043376 ammonium acetate Drugs 0.000 description 3
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 3
- 239000001099 ammonium carbonate Substances 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 3
- 229910052805 deuterium Inorganic materials 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 125000003566 oxetanyl group Chemical group 0.000 description 3
- JLPJFSCQKHRSQR-UHFFFAOYSA-N oxolan-3-one Chemical compound O=C1CCOC1 JLPJFSCQKHRSQR-UHFFFAOYSA-N 0.000 description 3
- 238000004806 packaging method and process Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 description 3
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 3
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 229910052727 yttrium Inorganic materials 0.000 description 3
- KKHZIJUWKMPGFM-LLVKDONJSA-N (2R)-1-(1H-indol-3-yl)-N-(oxetan-3-ylmethyl)propan-2-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NCC1COC1 KKHZIJUWKMPGFM-LLVKDONJSA-N 0.000 description 2
- UHURVTIYFVSZNU-GFCCVEGCSA-N (2R)-1-(1H-indol-3-yl)-N-[(3-methyloxetan-3-yl)methyl]propan-2-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NCC1(COC1)C UHURVTIYFVSZNU-GFCCVEGCSA-N 0.000 description 2
- HMHCSSPGQLLBOD-CQSZACIVSA-N (2R)-1-(1H-indol-3-yl)-N-[(4-methoxyphenyl)methyl]propan-2-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NCC1=CC=C(C=C1)OC HMHCSSPGQLLBOD-CQSZACIVSA-N 0.000 description 2
- PJPIIPSXTNEWOG-AXOLYNHLSA-N (2R)-1-(1H-indol-3-yl)-N-[[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]methyl]propan-2-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NCC12CC(C1)(C2)C(F)(F)F PJPIIPSXTNEWOG-AXOLYNHLSA-N 0.000 description 2
- WBUFEEYZIRDWTL-CYBMUJFWSA-N (2R)-1-(6-phenylmethoxy-1H-indol-3-yl)propan-2-amine Chemical compound C(C1=CC=CC=C1)OC1=CC=C2C(=CNC2=C1)C[C@@H](C)N WBUFEEYZIRDWTL-CYBMUJFWSA-N 0.000 description 2
- MLVKFNIYSNKUSZ-LLVKDONJSA-N (2R)-N-[(3,3-difluorocyclobutyl)methyl]-1-(1H-indol-3-yl)propan-2-amine Chemical compound FC1(CC(C1)CN[C@@H](CC1=CNC2=CC=CC=C12)C)F MLVKFNIYSNKUSZ-LLVKDONJSA-N 0.000 description 2
- VYPWGWVSBMJISW-AXOLYNHLSA-N (2R)-N-[(3-fluoro-1-bicyclo[1.1.1]pentanyl)methyl]-1-(1H-indol-3-yl)propan-2-amine Chemical compound FC12CC(C1)(C2)CN[C@@H](CC1=CNC2=CC=CC=C12)C VYPWGWVSBMJISW-AXOLYNHLSA-N 0.000 description 2
- UHFIFDXRJRYDSN-LLVKDONJSA-N (2R)-N-[(3-fluorooxetan-3-yl)methyl]-1-(1H-indol-3-yl)propan-2-amine Chemical compound FC1(COC1)CN[C@@H](CC1=CNC2=CC=CC=C12)C UHFIFDXRJRYDSN-LLVKDONJSA-N 0.000 description 2
- ZXUMUPVQYAFTLF-SNVBAGLBSA-N (2r)-1-(1h-indol-3-yl)butan-2-amine Chemical compound C1=CC=C2C(C[C@H](N)CC)=CNC2=C1 ZXUMUPVQYAFTLF-SNVBAGLBSA-N 0.000 description 2
- CTGFDWBZMCPVED-SSDOTTSWSA-N (2r)-1-(5-fluoro-1h-indol-3-yl)propan-2-amine Chemical compound C1=C(F)C=C2C(C[C@H](N)C)=CNC2=C1 CTGFDWBZMCPVED-SSDOTTSWSA-N 0.000 description 2
- QWXZOFZKSQXPDC-LLVKDONJSA-N (2r)-2-(9h-fluoren-9-ylmethoxycarbonylamino)propanoic acid Chemical compound C1=CC=C2C(COC(=O)N[C@H](C)C(O)=O)C3=CC=CC=C3C2=C1 QWXZOFZKSQXPDC-LLVKDONJSA-N 0.000 description 2
- GJNPRSKPMFBAOH-QFIPXVFZSA-N (2s)-1-[tert-butyl(diphenyl)silyl]oxy-3-(1h-indol-3-yl)propan-2-amine Chemical compound C([C@@H](N)CC=1C2=CC=CC=C2NC=1)O[Si](C(C)(C)C)(C=1C=CC=CC=1)C1=CC=CC=C1 GJNPRSKPMFBAOH-QFIPXVFZSA-N 0.000 description 2
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 description 2
- XZSQKRWMNNBJPA-PYHKZKJUSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-6-hydroxy-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccc(O)cc23)[C@H](N1CC(C)(C)F)c1c(F)cc(\C=C\C(O)=O)cc1F XZSQKRWMNNBJPA-PYHKZKJUSA-N 0.000 description 2
- DHDOJNNISYPJQP-LNOCUEDDSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-[(3R)-oxolan-3-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound FC=1C=C(C=C(C=1[C@H]1N([C@@H](CC2=C1NC1=CC=CC=C21)C)[C@H]1COCC1)F)/C=C/C(=O)O DHDOJNNISYPJQP-LNOCUEDDSA-N 0.000 description 2
- GEQHMAYJMJQCEI-IGKPSVHFSA-N (E)-3-[3,5-difluoro-4-[(1R,3R)-3-methyl-2-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1C12CC(C1)(C2)C(F)(F)F)c1c(F)cc(\C=C\C(O)=O)cc1F GEQHMAYJMJQCEI-IGKPSVHFSA-N 0.000 description 2
- GEQHMAYJMJQCEI-QMRBCTIKSA-N (E)-3-[3,5-difluoro-4-[(1S,3S)-3-methyl-2-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid Chemical compound C[C@H]1Cc2c([nH]c3ccccc23)[C@@H](N1C12CC(C1)(C2)C(F)(F)F)c1c(F)cc(\C=C\C(O)=O)cc1F GEQHMAYJMJQCEI-QMRBCTIKSA-N 0.000 description 2
- RCRVZCIUKQNOIS-UHFFFAOYSA-N 1,1-dibromo-2,2-bis(chloromethyl)cyclopropane Chemical compound ClCC1(CCl)CC1(Br)Br RCRVZCIUKQNOIS-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 2
- PSWJGLHYGWQYDS-UHFFFAOYSA-N 1-(1h-indol-3-yl)butan-2-one Chemical compound C1=CC=C2C(CC(=O)CC)=CNC2=C1 PSWJGLHYGWQYDS-UHFFFAOYSA-N 0.000 description 2
- VZEOVICMIOOXPI-UHFFFAOYSA-N 1-(5-phenylmethoxy-1h-indol-3-yl)propan-2-amine Chemical compound C1=C2C(CC(N)C)=CNC2=CC=C1OCC1=CC=CC=C1 VZEOVICMIOOXPI-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 2
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 2
- AIHWIEBDIWCQCA-UHFFFAOYSA-N 2-(1h-indol-3-yl)-n-methoxy-n-methylacetamide Chemical compound C1=CC=C2C(CC(=O)N(C)OC)=CNC2=C1 AIHWIEBDIWCQCA-UHFFFAOYSA-N 0.000 description 2
- QTEGPMCOZSWQFF-UHFFFAOYSA-N 2-fluoro-2-methyl-N-[1-(5-phenylmethoxy-1H-indol-3-yl)propan-2-yl]propan-1-amine Chemical compound CC(CC1=CNC2=CC=C(OCC3=CC=CC=C3)C=C12)NCC(C)(C)F QTEGPMCOZSWQFF-UHFFFAOYSA-N 0.000 description 2
- VQDNMKWCOYVVJH-UHFFFAOYSA-N 2-fluoro-2-methylpropan-1-ol Chemical compound CC(C)(F)CO VQDNMKWCOYVVJH-UHFFFAOYSA-N 0.000 description 2
- GBHLHEWPXCSVCN-SNVBAGLBSA-N 2-fluoro-N-[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]-2-methylpropan-1-amine Chemical compound FC(CN[C@@H](CC1=CNC2=CC=C(C=C12)F)C)(C)C GBHLHEWPXCSVCN-SNVBAGLBSA-N 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- JVRJIRGWBVLLNJ-SNVBAGLBSA-N 3-[(2R)-2-[(2-fluoro-2-methylpropyl)amino]propyl]-1H-indol-6-ol Chemical compound FC(CN[C@@H](CC1=CNC2=CC(=CC=C12)O)C)(C)C JVRJIRGWBVLLNJ-SNVBAGLBSA-N 0.000 description 2
- HSOUFOPNUUIFGU-LCYFTJDESA-N 3-[(Z)-2-nitroprop-1-enyl]-5-phenylmethoxy-1H-indole Chemical compound C\C(=C\C1=CNC2=CC=C(OCC3=CC=CC=C3)C=C12)[N+]([O-])=O HSOUFOPNUUIFGU-LCYFTJDESA-N 0.000 description 2
- LOSTXOUVFLDVHJ-UHFFFAOYSA-N 3-[2-[(2-fluoro-2-methylpropyl)amino]propyl]-1H-indol-5-ol Chemical compound FC(CNC(CC1=CNC2=CC=C(C=C12)O)C)(C)C LOSTXOUVFLDVHJ-UHFFFAOYSA-N 0.000 description 2
- QYIMSQZLLPDFSK-UHFFFAOYSA-N 3-[[tert-butyl(dimethyl)silyl]oxymethyl]bicyclo[1.1.1]pentane-1-carbaldehyde Chemical compound CC(C)(C)[Si](C)(C)OCC12CC(C1)(C2)C=O QYIMSQZLLPDFSK-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- LQKLVOWNBKJRJE-UHFFFAOYSA-N 3-bicyclo[1.1.1]pentanylazanium;chloride Chemical compound Cl.C1C2CC1(N)C2 LQKLVOWNBKJRJE-UHFFFAOYSA-N 0.000 description 2
- CZGVAISJIQNQEJ-UHFFFAOYSA-N 4-bromo-2,6-difluorobenzaldehyde Chemical compound FC1=CC(Br)=CC(F)=C1C=O CZGVAISJIQNQEJ-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- OIVLITBTBDPEFK-UHFFFAOYSA-N 5,6-dihydrouracil Chemical compound O=C1CCNC(=O)N1 OIVLITBTBDPEFK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 102100031181 Glyceraldehyde-3-phosphate dehydrogenase Human genes 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 101000882584 Homo sapiens Estrogen receptor Proteins 0.000 description 2
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- UWOINUSUEVZWSH-UHFFFAOYSA-N N-(1-bicyclo[1.1.1]pentanylmethyl)-1-(1H-indol-3-yl)-2-methylpropan-2-amine Chemical compound C12(CC(C1)C2)CNC(CC1=CNC2=CC=CC=C12)(C)C UWOINUSUEVZWSH-UHFFFAOYSA-N 0.000 description 2
- BRXJQONQZOONDV-UHFFFAOYSA-N N-(1-bicyclo[1.1.1]pentanylmethyl)-1-(1H-indol-3-ylmethyl)cyclopropan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)CC1(CC1)NCC12CC(C1)C2 BRXJQONQZOONDV-UHFFFAOYSA-N 0.000 description 2
- KNUSIMFDBLKJJX-KDJCLPLCSA-N N-[(2R)-1-(1H-indol-3-yl)butan-2-yl]bicyclo[1.1.1]pentan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](CC)NC12CC(C1)C2 KNUSIMFDBLKJJX-KDJCLPLCSA-N 0.000 description 2
- CJJOPINVVCRCGJ-KWCCSABGSA-N N-[(2R)-1-(1H-indol-3-yl)butan-2-yl]oxolan-3-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](CC)NC1COCC1 CJJOPINVVCRCGJ-KWCCSABGSA-N 0.000 description 2
- QAJZTEKICRWAKX-LLVKDONJSA-N N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]-3-methyloxetane-3-carboxamide Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NC(=O)C1(COC1)C QAJZTEKICRWAKX-LLVKDONJSA-N 0.000 description 2
- GLCKOXHYFWOYKD-ZBFVHZJFSA-N N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]bicyclo[1.1.1]pentane-1-carboxamide Chemical compound C[C@H](Cc1c[nH]c2ccccc12)NC(=O)C12CC(C1)C2 GLCKOXHYFWOYKD-ZBFVHZJFSA-N 0.000 description 2
- QFONFRWKCGUXHC-SNVBAGLBSA-N N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]oxetan-3-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NC1COC1 QFONFRWKCGUXHC-SNVBAGLBSA-N 0.000 description 2
- SABXRIZHAUWWBQ-JTDNENJMSA-N N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]oxolan-3-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NC1COCC1 SABXRIZHAUWWBQ-JTDNENJMSA-N 0.000 description 2
- YNYJOJSJCCFCBG-AMVUTOCUSA-N N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(1H-indol-3-yl)propan-2-yl]oxolan-3-amine Chemical compound [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(C(C)(C)C)OC[C@H](CC1=CNC2=CC=CC=C12)NC1COCC1 YNYJOJSJCCFCBG-AMVUTOCUSA-N 0.000 description 2
- UUNKPRAJICWWIC-UHFFFAOYSA-N N-[1-(1H-indol-3-yl)-2-methylpropan-2-yl]bicyclo[1.1.1]pentane-1-carboxamide Chemical compound N1C=C(C2=CC=CC=C12)CC(C)(C)NC(=O)C12CC(C1)C2 UUNKPRAJICWWIC-UHFFFAOYSA-N 0.000 description 2
- KNUSIMFDBLKJJX-UHFFFAOYSA-N N-[1-(1H-indol-3-yl)butan-2-yl]bicyclo[1.1.1]pentan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)CC(CC)NC12CC(C1)C2 KNUSIMFDBLKJJX-UHFFFAOYSA-N 0.000 description 2
- DKRPGAUPBTVIOT-UHFFFAOYSA-N N-[1-(1H-indol-3-yl)propan-2-yl]-3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)CC(C)NC12CC(C1)(C2)C(F)(F)F DKRPGAUPBTVIOT-UHFFFAOYSA-N 0.000 description 2
- BVOINHANKYWPHF-UHFFFAOYSA-N N-[1-(1H-indol-3-yl)propan-2-yl]bicyclo[1.1.1]pentan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)CC(C)NC12CC(C1)C2 BVOINHANKYWPHF-UHFFFAOYSA-N 0.000 description 2
- APBRLLHHQIXIGF-UHFFFAOYSA-N N-[1-(1H-indol-3-ylmethyl)cyclopropyl]bicyclo[1.1.1]pentane-1-carboxamide Chemical compound N1C=C(C2=CC=CC=C12)CC1(CC1)NC(=O)C12CC(C1)C2 APBRLLHHQIXIGF-UHFFFAOYSA-N 0.000 description 2
- XRJPCHYTGVEWFT-UHFFFAOYSA-N N-[1-(1H-indol-3-ylmethyl)cyclopropyl]oxolan-3-amine Chemical compound N1C=C(C2=CC=CC=C12)CC1(CC1)NC1COCC1 XRJPCHYTGVEWFT-UHFFFAOYSA-N 0.000 description 2
- QLGREKRMSADVJI-IMHYJWESSA-N N-benzyl-N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]bicyclo[1.1.1]pentan-1-amine Chemical compound C[C@H](Cc1c[nH]c2ccccc12)N(Cc1ccccc1)C12CC(C1)C2 QLGREKRMSADVJI-IMHYJWESSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 239000000020 Nitrocellulose Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 2
- 241000720974 Protium Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- TXUZVZSFRXZGTL-QPLCGJKRSA-N afimoxifene Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=C(O)C=C1 TXUZVZSFRXZGTL-QPLCGJKRSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- CUFNKYGDVFVPHO-UHFFFAOYSA-N azulene Chemical compound C1=CC=CC2=CC=CC2=C1 CUFNKYGDVFVPHO-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- OWMVSZAMULFTJU-UHFFFAOYSA-N bis-tris Chemical compound OCCN(CCO)C(CO)(CO)CO OWMVSZAMULFTJU-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000008004 cell lysis buffer Substances 0.000 description 2
- 238000012054 celltiter-glo Methods 0.000 description 2
- 239000002738 chelating agent Substances 0.000 description 2
- 125000003636 chemical group Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 229960003964 deoxycholic acid Drugs 0.000 description 2
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 108020004445 glyceraldehyde-3-phosphate dehydrogenase Proteins 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 230000000155 isotopic effect Effects 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- BYTLJVZXUYVJKN-UHFFFAOYSA-N methyl 1-(hydroxymethyl)bicyclo[1.1.1]pentane-3-carboxylate Chemical compound C1C2(CO)CC1(C(=O)OC)C2 BYTLJVZXUYVJKN-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 229920001220 nitrocellulos Polymers 0.000 description 2
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 2
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- JLFNLZLINWHATN-UHFFFAOYSA-N pentaethylene glycol Chemical compound OCCOCCOCCOCCOCCO JLFNLZLINWHATN-UHFFFAOYSA-N 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- FHHPUSMSKHSNKW-SMOYURAASA-M sodium deoxycholate Chemical compound [Na+].C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC([O-])=O)C)[C@@]2(C)[C@@H](O)C1 FHHPUSMSKHSNKW-SMOYURAASA-M 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 125000003003 spiro group Chemical group 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- 239000012855 volatile organic compound Substances 0.000 description 2
- 238000001262 western blot Methods 0.000 description 2
- MJVVUSXXRAQVIT-SFYCDEOASA-N (2R)-N-(1-bicyclo[1.1.1]pentanylmethyl)-1-(1H-indol-3-yl)propan-2-amine Chemical compound C12(CC(C1)C2)CN[C@@H](CC1=CNC2=CC=CC=C12)C MJVVUSXXRAQVIT-SFYCDEOASA-N 0.000 description 1
- XQIRYUNKLVPVRR-QGZVFWFLSA-N (2r)-2-(9h-fluoren-9-ylmethoxycarbonylamino)butanoic acid Chemical compound C1=CC=C2C(COC(=O)N[C@H](CC)C(O)=O)C3=CC=CC=C3C2=C1 XQIRYUNKLVPVRR-QGZVFWFLSA-N 0.000 description 1
- KJAAPZIFCQQQKX-NDEPHWFRSA-N (2s)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2h-chromen-6-ol Chemical compound C1=CC([C@H]2C(=C(C3=CC(O)=CC=C3O2)C)C=2C=C(O)C=CC=2)=CC=C1OCCN1CC(CF)C1 KJAAPZIFCQQQKX-NDEPHWFRSA-N 0.000 description 1
- WLXXTHPAORBNIG-UHFFFAOYSA-N (3,3-difluorocyclobutyl)azanium;chloride Chemical compound Cl.NC1CC(F)(F)C1 WLXXTHPAORBNIG-UHFFFAOYSA-N 0.000 description 1
- NFNBXIDRCPCPMO-FZUWVQIUSA-N (E)-3-[4-[(1R,3R)-3-ethyl-2-(oxolan-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid Chemical compound C(C)[C@@H]1CC2=C(NC3=CC=CC=C23)[C@H](N1C1COCC1)C1=C(C=C(C=C1F)/C=C/C(=O)O)F NFNBXIDRCPCPMO-FZUWVQIUSA-N 0.000 description 1
- YKFOEKMRPDCTOX-YJZJGKSESA-N (E)-3-[4-[(1S,3S)-2-(1-bicyclo[1.1.1]pentanyl)-3-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-2-methylprop-2-enoic acid Chemical compound C/C(/C(=O)O)=C\C1=CC(=C(C(=C1)F)[C@@H]1N([C@H](CC2=C1NC1=CC=CC=C21)CC)C12CC(C1)C2)F YKFOEKMRPDCTOX-YJZJGKSESA-N 0.000 description 1
- SJXNPGGVGZXKKI-NYYWCZLTSA-N (E)-3-[4-[[2-[2-(1,1-difluoroethyl)-4-fluorophenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid Chemical compound FC(C)(F)C1=C(C=CC(=C1)F)C1=C(C2=C(S1)C=C(C=C2)O)OC1=CC=C(C=C1)/C=C/C(=O)O SJXNPGGVGZXKKI-NYYWCZLTSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical compound C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- CIISBYKBBMFLEZ-UHFFFAOYSA-N 1,2-oxazolidine Chemical compound C1CNOC1 CIISBYKBBMFLEZ-UHFFFAOYSA-N 0.000 description 1
- LKLLNYWECKEQIB-UHFFFAOYSA-N 1,3,5-triazinane Chemical compound C1NCNCN1 LKLLNYWECKEQIB-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- SILNNFMWIMZVEQ-UHFFFAOYSA-N 1,3-dihydrobenzimidazol-2-one Chemical compound C1=CC=C2NC(O)=NC2=C1 SILNNFMWIMZVEQ-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- IMLSAISZLJGWPP-UHFFFAOYSA-N 1,3-dithiolane Chemical compound C1CSCS1 IMLSAISZLJGWPP-UHFFFAOYSA-N 0.000 description 1
- IVJFXSLMUSQZMC-UHFFFAOYSA-N 1,3-dithiole Chemical compound C1SC=CS1 IVJFXSLMUSQZMC-UHFFFAOYSA-N 0.000 description 1
- QVFHFKPGBODJJB-UHFFFAOYSA-N 1,3-oxathiane Chemical compound C1COCSC1 QVFHFKPGBODJJB-UHFFFAOYSA-N 0.000 description 1
- WJJSZTJGFCFNKI-UHFFFAOYSA-N 1,3-oxathiolane Chemical compound C1CSCO1 WJJSZTJGFCFNKI-UHFFFAOYSA-N 0.000 description 1
- JBYHSSAVUBIJMK-UHFFFAOYSA-N 1,4-oxathiane Chemical compound C1CSCCO1 JBYHSSAVUBIJMK-UHFFFAOYSA-N 0.000 description 1
- CPRVXMQHLPTWLY-UHFFFAOYSA-N 1,4-oxathiine Chemical compound O1C=CSC=C1 CPRVXMQHLPTWLY-UHFFFAOYSA-N 0.000 description 1
- WREHPEFXXFJIIJ-UHFFFAOYSA-N 1-(1h-indol-3-yl)-2-methylpropan-2-amine Chemical compound C1=CC=C2C(CC(C)(N)C)=CNC2=C1 WREHPEFXXFJIIJ-UHFFFAOYSA-N 0.000 description 1
- XQLPDYULYMGLGG-UHFFFAOYSA-N 1-(trifluoromethyl)bicyclo[1.1.1]pentan-3-amine Chemical compound C1C2(C(F)(F)F)CC1(N)C2 XQLPDYULYMGLGG-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- QXQAPNSHUJORMC-UHFFFAOYSA-N 1-chloro-4-propylbenzene Chemical compound CCCC1=CC=C(Cl)C=C1 QXQAPNSHUJORMC-UHFFFAOYSA-N 0.000 description 1
- CUCJJMLDIUSNPU-UHFFFAOYSA-N 1-oxidopiperidin-1-ium Chemical compound [O-][NH+]1CCCCC1 CUCJJMLDIUSNPU-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- UDSAJFSYJMHNFI-UHFFFAOYSA-N 2,6-diazaspiro[3.3]heptane Chemical compound C1NCC11CNC1 UDSAJFSYJMHNFI-UHFFFAOYSA-N 0.000 description 1
- QPEJAHMNOVMSOZ-UHFFFAOYSA-N 2-azaspiro[3.3]heptane Chemical group C1CCC21CNC2 QPEJAHMNOVMSOZ-UHFFFAOYSA-N 0.000 description 1
- PSNDWZOXFDKLLH-UHFFFAOYSA-N 2-azaspiro[3.4]octane Chemical compound C1NCC11CCCC1 PSNDWZOXFDKLLH-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- LXSDJMBBZHZXRM-MRXNPFEDSA-N 2-fluoro-2-methyl-N-[(2R)-1-(6-phenylmethoxy-1H-indol-3-yl)propan-2-yl]propan-1-amine Chemical compound C(C1=CC=CC=C1)OC1=CC=C2C(=CNC2=C1)C[C@@H](C)NCC(C)(C)F LXSDJMBBZHZXRM-MRXNPFEDSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- SUSDYISRJSLTST-UHFFFAOYSA-N 2-oxaspiro[3.3]heptane Chemical compound C1CCC21COC2 SUSDYISRJSLTST-UHFFFAOYSA-N 0.000 description 1
- NTMUDPWGPGZGQW-UHFFFAOYSA-N 2-oxaspiro[3.4]octane Chemical compound C1OCC11CCCC1 NTMUDPWGPGZGQW-UHFFFAOYSA-N 0.000 description 1
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- RVBUGGBMJDPOST-UHFFFAOYSA-N 2-thiobarbituric acid Chemical compound O=C1CC(=O)NC(=S)N1 RVBUGGBMJDPOST-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- QDCPHZUTFPEKQC-SNVBAGLBSA-N 3,3-difluoro-N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]cyclobutane-1-carboxamide Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NC(=O)C1CC(C1)(F)F QDCPHZUTFPEKQC-SNVBAGLBSA-N 0.000 description 1
- POQCIKGYRCVJCW-UHFFFAOYSA-N 3,3-difluoro-N-[1-(1H-indol-3-yl)propan-2-yl]cyclobutan-1-amine Chemical compound N1C=C(C2=CC=CC=C12)CC(C)NC1CC(C1)(F)F POQCIKGYRCVJCW-UHFFFAOYSA-N 0.000 description 1
- PLRCVBKYFLWAAT-UHFFFAOYSA-N 3,3-difluorocyclobutane-1-carboxylic acid Chemical compound OC(=O)C1CC(F)(F)C1 PLRCVBKYFLWAAT-UHFFFAOYSA-N 0.000 description 1
- CGISBZCYXGUFNK-UHFFFAOYSA-N 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid Chemical compound C1C2(C(F)(F)F)CC1(C(=O)O)C2 CGISBZCYXGUFNK-UHFFFAOYSA-N 0.000 description 1
- VUUYOQHYZSREJQ-LBWKMTJJSA-N 3-fluoro-N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]bicyclo[1.1.1]pentane-1-carboxamide Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NC(=O)C12CC(C1)(C2)F VUUYOQHYZSREJQ-LBWKMTJJSA-N 0.000 description 1
- CQOUAQUBJPKQON-UHFFFAOYSA-N 3-fluorobicyclo[1.1.1]pentane-1-carboxylic acid Chemical compound C1C2(F)CC1(C(=O)O)C2 CQOUAQUBJPKQON-UHFFFAOYSA-N 0.000 description 1
- UJZHYIMESNWEQA-UHFFFAOYSA-N 3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylic acid Chemical compound C1C2(C(O)=O)CC1(C(=O)OC)C2 UJZHYIMESNWEQA-UHFFFAOYSA-N 0.000 description 1
- PMPZEEUNGQSAIQ-UHFFFAOYSA-N 3-methyloxetane-3-carboxylic acid Chemical compound OC(=O)C1(C)COC1 PMPZEEUNGQSAIQ-UHFFFAOYSA-N 0.000 description 1
- ROADCYAOHVSOLQ-UHFFFAOYSA-N 3-oxetanone Chemical compound O=C1COC1 ROADCYAOHVSOLQ-UHFFFAOYSA-N 0.000 description 1
- WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical compound C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 description 1
- MRUWJENAYHTDQG-UHFFFAOYSA-N 4H-pyran Chemical compound C1C=COC=C1 MRUWJENAYHTDQG-UHFFFAOYSA-N 0.000 description 1
- UCZQXJKDCHCTAI-UHFFFAOYSA-N 4h-1,3-dioxine Chemical group C1OCC=CO1 UCZQXJKDCHCTAI-UHFFFAOYSA-N 0.000 description 1
- ODFFPRGJZRXNHZ-UHFFFAOYSA-N 5-fluoroindole Chemical compound FC1=CC=C2NC=CC2=C1 ODFFPRGJZRXNHZ-UHFFFAOYSA-N 0.000 description 1
- DJGNUBADRQIDNQ-UHFFFAOYSA-N 5-phenylmethoxy-1h-indole-3-carbaldehyde Chemical compound C1=C2C(C=O)=CNC2=CC=C1OCC1=CC=CC=C1 DJGNUBADRQIDNQ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- LFRYVKXHKZPNED-UHFFFAOYSA-N 6-chloro-n-methylpyridin-3-amine Chemical group CNC1=CC=C(Cl)N=C1 LFRYVKXHKZPNED-UHFFFAOYSA-N 0.000 description 1
- FPMICYBCFBLGOZ-UHFFFAOYSA-N 6-phenylmethoxy-1h-indole Chemical compound C=1C=C2C=CNC2=CC=1OCC1=CC=CC=C1 FPMICYBCFBLGOZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 206010055113 Breast cancer metastatic Diseases 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 1
- 125000005915 C6-C14 aryl group Chemical group 0.000 description 1
- PCCVDCLKQOONOX-BYTLDJTHSA-N CO[C@@H](CCC(CC(C1C=O)F)C=C1F)O Chemical compound CO[C@@H](CCC(CC(C1C=O)F)C=C1F)O PCCVDCLKQOONOX-BYTLDJTHSA-N 0.000 description 1
- SCHMOVKROXFKOF-DCIXDDQASA-N C[C@H](C1)N2C3(CC4C3)C4c3cc(/C=C/C(O)=O)cc(F)c3[C@@H]2c2c1c(cccc1)c1[nH]2 Chemical compound C[C@H](C1)N2C3(CC4C3)C4c3cc(/C=C/C(O)=O)cc(F)c3[C@@H]2c2c1c(cccc1)c1[nH]2 SCHMOVKROXFKOF-DCIXDDQASA-N 0.000 description 1
- RSVHQPLZYJNYJP-SVMLNYGMSA-N C[C@H](C1)N2C3(CC4C3)C4c3cc(/C=C/C(OC)=O)cc(F)c3[C@@H]2c2c1c(cccc1)c1[nH]2 Chemical compound C[C@H](C1)N2C3(CC4C3)C4c3cc(/C=C/C(OC)=O)cc(F)c3[C@@H]2c2c1c(cccc1)c1[nH]2 RSVHQPLZYJNYJP-SVMLNYGMSA-N 0.000 description 1
- JSURXTCAETWFHJ-SFYCDEOASA-N C[C@H](Cc1c[nH]c2ccccc12)NC1(C2)CCC2C1 Chemical compound C[C@H](Cc1c[nH]c2ccccc12)NC1(C2)CCC2C1 JSURXTCAETWFHJ-SFYCDEOASA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- BURHGPHDEVGCEZ-UHFFFAOYSA-N ClC1=C(C=CC(=C1)F)C(=C(C=1C=C2C=NNC2=CC=1)C1=CC=C(C=C1)C=CC(=O)O)CC Chemical compound ClC1=C(C=CC(=C1)F)C(=C(C=1C=C2C=NNC2=CC=1)C1=CC=C(C=C1)C=CC(=O)O)CC BURHGPHDEVGCEZ-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- JQKQMVLDVNSHRL-GFCCVEGCSA-N N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]oxan-4-amine Chemical compound N1C=C(C2=CC=CC=C12)C[C@@H](C)NC1CCOCC1 JQKQMVLDVNSHRL-GFCCVEGCSA-N 0.000 description 1
- JQKQMVLDVNSHRL-UHFFFAOYSA-N N-[1-(1H-indol-3-yl)propan-2-yl]oxan-4-amine Chemical compound N1C=C(C2=CC=CC=C12)CC(C)NC1CCOCC1 JQKQMVLDVNSHRL-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 206010053159 Organ failure Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 101100520074 Oryza sativa subsp. japonica PIK-1 gene Proteins 0.000 description 1
- 101100520077 Oryza sativa subsp. japonica PIK-2 gene Proteins 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-M Pyruvate Chemical compound CC(=O)C([O-])=O LCTONWCANYUPML-UHFFFAOYSA-M 0.000 description 1
- 229940119564 Selective estrogen receptor downregulator Drugs 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- LKJACIUAXUOFJX-UWTATZPHSA-N [(2R)-1-chloro-1-oxopropan-2-yl] carbamate Chemical compound C(N)(O[C@@H](C(=O)Cl)C)=O LKJACIUAXUOFJX-UWTATZPHSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001270 agonistic effect Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N anhydrous n-heptane Natural products CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 238000013475 authorization Methods 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000008366 buffered solution Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- FGNLEIGUMSBZQP-UHFFFAOYSA-N cadaverine dihydrochloride Chemical compound Cl.Cl.NCCCCCN FGNLEIGUMSBZQP-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- QBLPAZNBFFURKB-UHFFFAOYSA-N carbanide;propan-2-ol;titanium Chemical compound [CH3-].[Ti].CC(C)O.CC(C)O.CC(C)O QBLPAZNBFFURKB-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000005323 carbonate salts Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000013592 cell lysate Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 229940124301 concurrent medication Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000005508 decahydronaphthalenyl group Chemical group 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 125000006009 dihaloalkoxy group Chemical group 0.000 description 1
- 125000004982 dihaloalkyl group Chemical group 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- SNQXJPARXFUULZ-UHFFFAOYSA-N dioxolane Chemical compound C1COOC1 SNQXJPARXFUULZ-UHFFFAOYSA-N 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229960005309 estradiol Drugs 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- CJRQQJKWNULSFQ-UHFFFAOYSA-N ethyl 2-fluoro-2-methylpropanoate Chemical compound CCOC(=O)C(C)(C)F CJRQQJKWNULSFQ-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- JKFAIQOWCVVSKC-UHFFFAOYSA-N furazan Chemical compound C=1C=NON=1 JKFAIQOWCVVSKC-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N glycerol 1-phosphate Chemical compound OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- DMCPFOBLJMLSNX-UHFFFAOYSA-N indole-3-acetonitrile Chemical compound C1=CC=C2C(CC#N)=CNC2=C1 DMCPFOBLJMLSNX-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- DBYQHFPBWKKZAT-UHFFFAOYSA-N lithium;benzene Chemical compound [Li+].C1=CC=[C-]C=C1 DBYQHFPBWKKZAT-UHFFFAOYSA-N 0.000 description 1
- DBTNVRCCIDISMV-UHFFFAOYSA-L lithium;magnesium;propane;dichloride Chemical compound [Li+].[Mg+2].[Cl-].[Cl-].C[CH-]C DBTNVRCCIDISMV-UHFFFAOYSA-L 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 210000005075 mammary gland Anatomy 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000006682 monohaloalkyl group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001326 naphthylalkyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000005593 norbornanyl group Chemical group 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 210000004789 organ system Anatomy 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- ZCGAIDLGTWHJDV-UHFFFAOYSA-N oxetan-3-ylmethyl trifluoromethanesulfonate Chemical compound FC(S(=O)(=O)OCC1COC1)(F)F ZCGAIDLGTWHJDV-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- JTHRRMFZHSDGNJ-UHFFFAOYSA-N piperazine-2,3-dione Chemical compound O=C1NCCNC1=O JTHRRMFZHSDGNJ-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000955 prescription drug Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- MPHJCYMVCWTKDY-UHFFFAOYSA-N pyridine;quinoline Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.N1=CC=CC2=CC=CC=C21 MPHJCYMVCWTKDY-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000013077 scoring method Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical class [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- LBJQKYPPYSCCBH-UHFFFAOYSA-N spiro[3.3]heptane Chemical group C1CCC21CCC2 LBJQKYPPYSCCBH-UHFFFAOYSA-N 0.000 description 1
- CTDQAGUNKPRERK-UHFFFAOYSA-N spirodecane Chemical compound C1CCCC21CCCCC2 CTDQAGUNKPRERK-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 230000009747 swallowing Effects 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 238000004885 tandem mass spectrometry Methods 0.000 description 1
- 238000002626 targeted therapy Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MHYGQXWCZAYSLJ-UHFFFAOYSA-N tert-butyl-chloro-diphenylsilane Chemical compound C=1C=CC=CC=1[Si](Cl)(C(C)(C)C)C1=CC=CC=C1 MHYGQXWCZAYSLJ-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000004952 trihaloalkoxy group Chemical group 0.000 description 1
- 125000004385 trihaloalkyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229960004799 tryptophan Drugs 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 230000036642 wellbeing Effects 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/438—The ring being spiro-condensed with carbocyclic or heterocyclic ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/437—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a five-membered ring having nitrogen as a ring hetero atom, e.g. indolizine, beta-carboline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/24—Drugs for disorders of the endocrine system of the sex hormones
- A61P5/30—Oestrogens
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B59/00—Introduction of isotopes of elements into organic compounds ; Labelled organic compounds per se
- C07B59/002—Heterocyclic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/732—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids of unsaturated hydroxy carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/738—Esters of keto-carboxylic acids or aldehydo-carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/757—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/07—Optical isomers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/36—Systems containing two condensed rings the rings having more than two atoms in common
- C07C2602/38—Systems containing two condensed rings the rings having more than two atoms in common the bicyclo ring system containing five carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/56—Ring systems containing bridged rings
- C07C2603/58—Ring systems containing bridged rings containing three rings
- C07C2603/60—Ring systems containing bridged rings containing three rings containing at least one ring with less than six members
- C07C2603/62—Ring systems containing bridged rings containing three rings containing at least one ring with less than six members containing three- or four-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Endocrinology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Steroid Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201662317254P | 2016-04-01 | 2016-04-01 | |
| US62/317,254 | 2016-04-01 | ||
| PCT/US2017/024809 WO2017172957A1 (en) | 2016-04-01 | 2017-03-29 | Estrogen receptor modulators |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| RU2018132037A RU2018132037A (ru) | 2020-05-12 |
| RU2018132037A3 RU2018132037A3 (cg-RX-API-DMAC7.html) | 2020-05-15 |
| RU2738646C2 true RU2738646C2 (ru) | 2020-12-15 |
Family
ID=59966438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2018132037A RU2738646C2 (ru) | 2016-04-01 | 2017-03-29 | Модуляторы эстрогеновых рецепторов |
Country Status (15)
| Country | Link |
|---|---|
| US (5) | US20190142811A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP3442971B1 (cg-RX-API-DMAC7.html) |
| JP (2) | JP6926189B2 (cg-RX-API-DMAC7.html) |
| KR (2) | KR20220071293A (cg-RX-API-DMAC7.html) |
| CN (4) | CN113717170A (cg-RX-API-DMAC7.html) |
| AR (1) | AR108011A1 (cg-RX-API-DMAC7.html) |
| AU (3) | AU2017242027B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA3017388C (cg-RX-API-DMAC7.html) |
| ES (1) | ES2991862T3 (cg-RX-API-DMAC7.html) |
| IL (3) | IL285318B (cg-RX-API-DMAC7.html) |
| MX (2) | MX392461B (cg-RX-API-DMAC7.html) |
| RU (1) | RU2738646C2 (cg-RX-API-DMAC7.html) |
| SG (1) | SG11201807708SA (cg-RX-API-DMAC7.html) |
| TW (2) | TW202235418A (cg-RX-API-DMAC7.html) |
| WO (1) | WO2017172957A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102479822B1 (ko) | 2016-02-05 | 2022-12-21 | 인벤티스바이오 엘엘씨 | 선택적 에스트로겐 수용체 분해제 및 이들의 용도 |
| KR20220071293A (ko) | 2016-04-01 | 2022-05-31 | 리커리엄 아이피 홀딩스, 엘엘씨 | 에스트로겐 수용체 조절제 |
| CN107814798B (zh) * | 2016-09-14 | 2020-11-03 | 四川科伦博泰生物医药股份有限公司 | 3-取代丙烯酸类化合物及其制备方法和用途 |
| WO2018130124A1 (zh) * | 2017-01-11 | 2018-07-19 | 南京圣和药业股份有限公司 | 作为选择性雌激素受体下调剂的三环类化合物及其应用 |
| IL272875B2 (en) | 2017-09-11 | 2023-10-01 | Recurium Ip Holdings Llc | Continuous flow processes for the preparation of bicyclic compounds |
| EP3709997A1 (en) * | 2017-11-16 | 2020-09-23 | Novartis AG | Pharmaceutical combination comprising lsz102 and ribociclib |
| CN114929696A (zh) * | 2019-05-24 | 2022-08-19 | 浙江海正药业股份有限公司 | 丙烯酸类衍生物的晶型及其制备方法和用途 |
| KR20220044528A (ko) * | 2019-08-06 | 2022-04-08 | 리커리엄 아이피 홀딩스, 엘엘씨 | 돌연변이체를 치료하기 위한 에스트로겐 수용체 조절제 |
| AU2020380211A1 (en) * | 2019-11-04 | 2022-05-19 | Recurium Ip Holdings, Llc | Salts and forms of an estrogen receptor modulator |
| CA3165477A1 (en) * | 2019-12-20 | 2021-06-24 | Recurium Ip Holdings, Llc | Combinations |
| JP2023507797A (ja) * | 2019-12-20 | 2023-02-27 | リキュリウム アイピー ホールディングス リミテッド ライアビリティー カンパニー | 組み合わせ |
| EP4069225A4 (en) * | 2019-12-20 | 2023-12-27 | Recurium IP Holdings, LLC | COMBINATIONS |
| IL294067A (en) * | 2019-12-20 | 2022-08-01 | Recurium Ip Holdings Llc | Combinations |
| WO2021127042A1 (en) * | 2019-12-20 | 2021-06-24 | Recurium Ip Holdings, Llc | Combinations |
| WO2021216671A1 (en) * | 2020-04-22 | 2021-10-28 | Recurium Ip Holdings, Llc | Preparation of an selective estrogen receptor degrader |
| WO2021253380A1 (en) * | 2020-06-19 | 2021-12-23 | InventisBio Co., Ltd. | Oral formulations and uses thereof |
| AU2021343525A1 (en) * | 2020-09-20 | 2023-05-18 | Tactogen Inc | Advantageous tryptamine compositions for mental disorders or enhancement |
| WO2022133446A1 (en) * | 2020-12-16 | 2022-06-23 | Recurium Ip Holdings, Llc | Combinations |
| EP4267578A4 (en) | 2020-12-23 | 2024-11-20 | Recurium IP Holdings, LLC | ESTROGEN RECEPTOR MODULATORS |
| US12534441B2 (en) | 2021-01-15 | 2026-01-27 | Beckley Psytech Limited | Tryptamine analogues |
| WO2023283329A1 (en) * | 2021-07-08 | 2023-01-12 | Olema Pharmaceuticals, Inc. | Methods of treating estrogen receptor-associated diseases |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2008127715A1 (en) * | 2007-04-13 | 2008-10-23 | Ptc Therapeutics, Inc. | Carboline derivatives useful in the treatment of cancer and other diseases |
| WO2010083136A1 (en) * | 2009-01-16 | 2010-07-22 | Merck Sharp & Dohme Corp. | Oxadiazole beta carboline derivatives as antidiabetic compounds |
| RU2472782C2 (ru) * | 2006-05-31 | 2013-01-20 | Институто Ди Ричерке Ди Биолоджиа Молеколаре П. Анджелетти Спа | Производные пиридинона и пиридазинона в качестве ингибиторов поли(adp-рибоза) полимеразы (parp) |
| WO2014191726A1 (en) * | 2013-05-28 | 2014-12-04 | Astrazeneca Ab | Chemical compounds |
| US20150315198A1 (en) * | 2014-05-05 | 2015-11-05 | Global Blood Therapeutics, Inc. | Pyrazolopyridine pyrazolopyrimidine and related compounds |
Family Cites Families (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU679635B2 (en) | 1994-03-11 | 1997-07-03 | Eli Lilly And Company | Method for treating 5HT-2B receptor related conditions |
| GB9604996D0 (en) | 1996-03-08 | 1996-05-08 | Black James Foundation | Benzodiazonine derivatives |
| EP1113007A1 (en) * | 1999-12-24 | 2001-07-04 | Pfizer Inc. | Tetrahydroisoquinoline compounds as estrogen agonists/antagonists |
| JP2005508968A (ja) | 2001-10-19 | 2005-04-07 | トランス テック ファーマ,インコーポレイテッド | PTP阻害剤としてのβ−カルボリン誘導体 |
| US20080103164A1 (en) | 2004-08-02 | 2008-05-01 | Kristjan Gudmundsson | Useful compounds for hpv infection |
| WO2007002051A1 (en) | 2005-06-22 | 2007-01-04 | Smithkline Beecham Corporation | Carboline derivatives and their use as inhibitors of flaviviridae infections |
| WO2008002490A2 (en) | 2006-06-23 | 2008-01-03 | Radius Health, Inc. | Treatment of vasomotor symptoms with selective estrogen receptor modulators |
| US20100158858A1 (en) | 2007-04-13 | 2010-06-24 | Liangxian Cao | Administration of carboline derivatives useful in the treatment of cancer and other diseases |
| DE102007028515A1 (de) | 2007-06-21 | 2008-12-24 | Merck Patent Gmbh | 6-(Pyrrolopyridinyl)-pyrimidinyl-2-amin-derivate |
| WO2010107485A1 (en) | 2009-03-17 | 2010-09-23 | The Trustees Of Columbia University In The City Of New York | E3 ligase inhibitors |
| US20120202801A1 (en) * | 2009-05-27 | 2012-08-09 | Liangxian Cao | Methods for treating breast cancer |
| MX373926B (es) * | 2009-05-27 | 2020-07-10 | Ptc Therapeutics Inc | Metodos para tratar cancer y estados no neoplasicos. |
| RU2540330C2 (ru) * | 2009-07-28 | 2015-02-10 | Оно Фармасьютикал Ко., Лтд. | Бициклическое соединение и его применение для медицинских целей |
| WO2011088025A1 (en) | 2010-01-15 | 2011-07-21 | Merck Sharp & Dohme Corp. | Oxadiazole beta carboline derivatives as antidiabetic compounds |
| NZ602266A (en) * | 2010-02-11 | 2014-05-30 | Bristol Myers Squibb Co | Macrocycles as factor xia inhibitors |
| WO2011103487A1 (en) | 2010-02-18 | 2011-08-25 | Medivation Technologies, Inc. | Pyrido[4,3-b]indole and pyrido[3,4-b]indole derivatives and methods of use |
| RS56042B1 (sr) | 2010-06-10 | 2017-09-29 | Seragon Pharmaceuticals Inc | Modulatori estrogenih receptora i njihove upotrebe |
| JP5835236B2 (ja) * | 2011-01-27 | 2015-12-24 | 小野薬品工業株式会社 | 二環式化合物およびその医薬用途 |
| CN102432608B (zh) | 2011-11-01 | 2013-04-17 | 浙江大学 | 手性螺环磷酸催化合成光学活性四氢-β-咔啉衍生物的方法 |
| WO2013090829A1 (en) | 2011-12-14 | 2013-06-20 | Aragon Pharmaceuticals, Inc. | Estrogen receptor modulators and uses thereof |
| MX353578B (es) * | 2011-12-31 | 2018-01-19 | Beigene Ltd | Dihidrodiazpinocarbazolonas tetra o penta-ciclicas fusionadas como inhibidores de poli (adp-ribosa) polimerasa (parp). |
| CA2863413A1 (en) * | 2012-02-07 | 2013-08-15 | Eolas Therapeutics, Inc. | Substituted prolines / piperidines as orexin receptor antagonists |
| US9499538B2 (en) | 2012-03-20 | 2016-11-22 | Seragon Pharmaceuticals, Inc. | Estrogen receptor modulators and uses thereof |
| LT2872482T (lt) | 2012-07-13 | 2020-12-28 | Oncternal Therapeutics, Inc. | Krūties vėžių gydymo būdas selektyviu androgeno receptoriaus moduliatoriumi |
| ES2671516T3 (es) | 2013-02-19 | 2018-06-06 | Novartis Ag | Derivados de benzotiofeno y composiciones de los mismos como degradantes selectivos de los receptores de estrógeno |
| MX2015011132A (es) | 2013-03-14 | 2015-11-30 | Seragon Pharmaceuticals Inc | Moduladores policiclicos del receptor de estrogenos y sus usos. |
| EP3089747A1 (en) | 2013-12-06 | 2016-11-09 | F. Hoffmann-La Roche AG | Estrogen receptor modulator for the treatment of locally advanced or metastatic estrogen receptor positive breast cancer |
| CN104693211A (zh) | 2013-12-10 | 2015-06-10 | 南京明德新药研发股份有限公司 | 作为抗病毒剂的咪唑衍生物及其制药用途 |
| TW201613891A (en) * | 2014-02-12 | 2016-04-16 | Eolas Therapeutics Inc | Substituted prolines / piperidines as orexin receptor antagonists |
| CA2948077A1 (en) | 2014-05-16 | 2015-11-19 | Actelion Pharmaceuticals Ltd | Antibacterial quinazoline-4(3h)-one derivatives |
| MX388871B (es) | 2014-06-27 | 2025-03-20 | Nogra Pharma Ltd | Moduladores del receptor arilo y metodos para elaborar y usar los mismos. |
| WO2016054971A1 (zh) | 2014-10-09 | 2016-04-14 | 南京明德新药研发股份有限公司 | 羟基嘌呤类化合物及其应用 |
| CN107709290B (zh) | 2015-04-21 | 2023-02-28 | Gtx公司 | 选择性雄激素受体降解剂(sard)配体和其使用方法 |
| US10654809B2 (en) | 2016-06-10 | 2020-05-19 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10087191B2 (en) * | 2015-06-16 | 2018-10-02 | Jiangsu Hengrui Medicine Co., Ltd. | Piperidine derivative and preparation method and pharmaceutical use thereof |
| JP6592197B2 (ja) | 2015-11-12 | 2019-10-16 | 浙江海正薬業股▲ふん▼有限公司Zhejiang Hisun Pharmaceutical CO.,LTD. | アクリル酸誘導体、製造方法、および医薬としてのその使用 |
| KR102479822B1 (ko) * | 2016-02-05 | 2022-12-21 | 인벤티스바이오 엘엘씨 | 선택적 에스트로겐 수용체 분해제 및 이들의 용도 |
| KR20220071293A (ko) * | 2016-04-01 | 2022-05-31 | 리커리엄 아이피 홀딩스, 엘엘씨 | 에스트로겐 수용체 조절제 |
| CN109310664A (zh) | 2016-06-10 | 2019-02-05 | 田纳西大学研究基金会 | 选择性雄激素受体降解剂(sard)配体和其使用方法 |
| WO2018001232A1 (zh) * | 2016-06-29 | 2018-01-04 | 浙江海正药业股份有限公司 | 丙烯酸类衍生物及其制备方法和其在医药上的用途 |
| JP7050770B2 (ja) * | 2016-10-05 | 2022-04-08 | エフ・ホフマン-ラ・ロシュ・アクチェンゲゼルシャフト | 抗体薬物コンジュゲートの調製方法 |
| WO2018130124A1 (zh) | 2017-01-11 | 2018-07-19 | 南京圣和药业股份有限公司 | 作为选择性雌激素受体下调剂的三环类化合物及其应用 |
-
2017
- 2017-03-29 KR KR1020227016946A patent/KR20220071293A/ko not_active Ceased
- 2017-03-29 IL IL285318A patent/IL285318B/en unknown
- 2017-03-29 US US16/086,434 patent/US20190142811A1/en not_active Abandoned
- 2017-03-29 CN CN202111035485.4A patent/CN113717170A/zh active Pending
- 2017-03-29 CN CN202011582784.5A patent/CN112745316A/zh active Pending
- 2017-03-29 KR KR1020187030841A patent/KR102401841B1/ko active Active
- 2017-03-29 WO PCT/US2017/024809 patent/WO2017172957A1/en not_active Ceased
- 2017-03-29 CN CN202011582762.9A patent/CN112679495B/zh active Active
- 2017-03-29 JP JP2019503398A patent/JP6926189B2/ja active Active
- 2017-03-29 EP EP17776574.0A patent/EP3442971B1/en active Active
- 2017-03-29 IL IL295050A patent/IL295050A/en unknown
- 2017-03-29 AU AU2017242027A patent/AU2017242027B2/en active Active
- 2017-03-29 SG SG11201807708SA patent/SG11201807708SA/en unknown
- 2017-03-29 CN CN201780033815.1A patent/CN109311870B/zh active Active
- 2017-03-29 RU RU2018132037A patent/RU2738646C2/ru active
- 2017-03-29 MX MX2018011419A patent/MX392461B/es unknown
- 2017-03-29 ES ES17776574T patent/ES2991862T3/es active Active
- 2017-03-29 CA CA3017388A patent/CA3017388C/en active Active
- 2017-03-30 AR ARP170100788A patent/AR108011A1/es unknown
- 2017-03-30 TW TW110145253A patent/TW202235418A/zh unknown
- 2017-03-30 TW TW106110662A patent/TWI746535B/zh active
-
2018
- 2018-09-06 IL IL261654A patent/IL261654B/en unknown
- 2018-09-24 MX MX2022005780A patent/MX2022005780A/es unknown
-
2020
- 2020-05-05 US US16/866,900 patent/US11065233B2/en active Active
- 2020-05-05 US US16/866,995 patent/US10959989B2/en active Active
- 2020-05-05 US US16/867,017 patent/US11065234B2/en active Active
- 2020-12-22 AU AU2020294196A patent/AU2020294196B2/en active Active
-
2021
- 2021-07-06 US US17/305,369 patent/US20210330651A1/en not_active Abandoned
- 2021-08-04 JP JP2021127863A patent/JP2021176911A/ja active Pending
-
2022
- 2022-06-09 AU AU2022204025A patent/AU2022204025A1/en not_active Abandoned
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2472782C2 (ru) * | 2006-05-31 | 2013-01-20 | Институто Ди Ричерке Ди Биолоджиа Молеколаре П. Анджелетти Спа | Производные пиридинона и пиридазинона в качестве ингибиторов поли(adp-рибоза) полимеразы (parp) |
| WO2008127715A1 (en) * | 2007-04-13 | 2008-10-23 | Ptc Therapeutics, Inc. | Carboline derivatives useful in the treatment of cancer and other diseases |
| WO2010083136A1 (en) * | 2009-01-16 | 2010-07-22 | Merck Sharp & Dohme Corp. | Oxadiazole beta carboline derivatives as antidiabetic compounds |
| WO2014191726A1 (en) * | 2013-05-28 | 2014-12-04 | Astrazeneca Ab | Chemical compounds |
| US20150315198A1 (en) * | 2014-05-05 | 2015-11-05 | Global Blood Therapeutics, Inc. | Pyrazolopyridine pyrazolopyrimidine and related compounds |
Non-Patent Citations (1)
| Title |
|---|
| De Savi, C., Bradbury, R. H., Rabow, A. A., Norman, R. A., de Almeida, C., Andrews, D. M. Wilson, Z. (2015). Optimization of a Novel Binding Motif to (E)-3-(3,5-Difluoro-4-((1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl)acrylic Acid (AZD9496), a Potent and Orally Bioavailable Selective Estrogen Receptor Downregulator and Antagonist. Journal of Medicinal Chemistry, 58(20), 8128-8140. doi:10.1021/acs.jmedchem.5b00984. * |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2738646C2 (ru) | Модуляторы эстрогеновых рецепторов | |
| CN115038450A (zh) | 组合 | |
| JP2024502270A (ja) | エストロゲン受容体調節薬 | |
| HK40064960A (en) | Estrogen receptor modulators | |
| HK40052769A (en) | Estrogen receptor modulators | |
| BR112018070161B1 (pt) | Composto ou sal farmaceuticamente aceitável do mesmo, composição farmacêutica, uso dos mesmos e método para inibir o crescimento de célula | |
| RU2845443C1 (ru) | Комбинации | |
| HK40004087B (en) | Estrogen receptor modulators | |
| HK40004087A (en) | Estrogen receptor modulators | |
| JP2020529403A (ja) | アクリル酸類似体 |