RO81146B - Compozitie herbicida - Google Patents
Compozitie herbicidaInfo
- Publication number
- RO81146B RO81146B RO87047A RO8704776A RO81146B RO 81146 B RO81146 B RO 81146B RO 87047 A RO87047 A RO 87047A RO 8704776 A RO8704776 A RO 8704776A RO 81146 B RO81146 B RO 81146B
- Authority
- RO
- Romania
- Prior art keywords
- hydrogen
- chlorine
- group
- together represent
- represents hydrogen
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title abstract 2
- 239000004009 herbicide Substances 0.000 title 1
- -1 C1-6 alkyl radical Chemical class 0.000 abstract 5
- 239000001257 hydrogen Substances 0.000 abstract 5
- 229910052739 hydrogen Inorganic materials 0.000 abstract 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 239000000460 chlorine Substances 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 230000001143 conditioned effect Effects 0.000 abstract 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract 1
- 229920002554 vinyl polymer Polymers 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
- C07D207/408—Radicals containing only hydrogen and carbon atoms attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
Compozitie erbicida, caracterizata prin aceea ca, drept substanta activa contine 0,1 si 5% în greutate un compus cu formula generala I:(vezi form. in desc.) în care x reprezinta clor sau metil, n are valoarea 01 sau 2 B1 reprezinta hidrogen, un radical alchil cu 1...6 atomi de carbon metoxi, triclormetil metilic etilio, vinil sau izopropil, R2 reprezinta hidrogen etoximetil sau propioniol sau R1 si R2 reprezinta împreuna gruparea II: (vezi form. in desc.) si y reprezinta hidrogen daca R1 reprezinta tiometil, R2 reprezinta hidrogen si n are valoarea zero, clor daca x, n R si R2 sunt definiti ca mai sus si trifluormetil, daca R1 reprezinta hidrogen metoxi metilic sau etilic daca R1 si R2 luati împreuna reprezinta împreuna gruparea II mentionata, conditionata în mod obisnuit.
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/598,486 US3976470A (en) | 1975-07-23 | 1975-07-23 | Diphenyl ether amides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RO81146A RO81146A (ro) | 1983-02-15 |
| RO81146B true RO81146B (ro) | 1983-02-28 |
Family
ID=24395736
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RO87047A RO81146B (ro) | 1975-07-23 | 1976-07-21 | Compozitie herbicida |
Country Status (3)
| Country | Link |
|---|---|
| US (2) | US3976470A (ro) |
| PL (1) | PL107403B1 (ro) |
| RO (1) | RO81146B (ro) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4174350A (en) * | 1973-05-14 | 1979-11-13 | Stauffer Chemical Company | Herbicidal active carboxanilide derivatives |
| US4045208A (en) * | 1975-07-23 | 1977-08-30 | Stauffer Chemical Company | Diphenyl ether amides |
| DK189677A (da) * | 1976-05-07 | 1977-11-08 | Sumitomo Chemical Co | M-phenoxybenzamid-derivater |
| US4168153A (en) * | 1977-01-21 | 1979-09-18 | Shell Oil Company | Cycloalkanecarboxanilide derivative herbicides |
| US4181519A (en) * | 1977-01-21 | 1980-01-01 | Shell Oil Company | Diphenylamine derivative herbicides |
| US4184867A (en) * | 1977-01-21 | 1980-01-22 | Shell Oil Company | Cycloalkanecarboxanilide derivative herbicides |
| US4166735A (en) * | 1977-01-21 | 1979-09-04 | Shell Oil Company | Cycloalkanecarboxanilide derivative herbicides |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| US4336062A (en) * | 1977-09-19 | 1982-06-22 | Stauffer Chemical Company | Herbicidal cyclohexenone derivatives |
| GB1600840A (en) * | 1978-05-30 | 1981-10-21 | Wellcome Found | Diphenylether derivatives useful as flukicidal agents |
| US4193787A (en) * | 1978-08-31 | 1980-03-18 | Stauffer Chemical Company | Benzodioxane herbicides |
| US4344789A (en) * | 1979-05-11 | 1982-08-17 | Ppg Industries, Inc. | Acids and esters of 5-(2-optionally substituted-4-trifluoromethyl-6-optionally substituted phenoxy)-2-nitro, -halo, or-cyano alpha substituted phenyl carboxy oximes, and method of controlling weeds with them |
| US4263227A (en) * | 1979-05-14 | 1981-04-21 | Ppg Industries, Inc. | 5-(2-Chloro-4-trifluoromethyl)-, or (4-trifluoromethyl or 2,6-dichloro-4-trifluoromethylphenoxy)-2-nitro-substituted carbonyl oxime-O-alkyl ethers |
| US4375981A (en) * | 1979-05-14 | 1983-03-08 | Ppg Industries, Inc. | Method for controlling weed growth using herbicidally 5-(2-chloro-4-trifluoromethyl)-, or (4-trifluoromethyl or 2,6-dichloro-4-trifluoromethylphenoxy)-2-nitro-substituted carbonyl oxime-O-alkyl ethers |
| US4263041A (en) * | 1980-02-25 | 1981-04-21 | Ppg Industries, Inc. | Optionally substituted phenyl, and alkyl N-[5-(2-chloro-4-trifluoromethyl-6-optionally substituted phenoxy)-2-nitro, halo, or cyanobenzoyl]carbamates |
| DE3008985A1 (de) * | 1980-03-08 | 1981-10-01 | Basf Ag, 6700 Ludwigshafen | N-aryl(thiol)carbamate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| US4288243A (en) * | 1980-07-07 | 1981-09-08 | Ppg Industries, Inc. | 2',5'-Dioxo-1'-pyrrolydinyl 5-(2-halo-4-trifluoromethylphenoxy)-2-halo-, cyano- or nitrobenzoates |
| DE3123733A1 (de) * | 1981-06-15 | 1982-12-30 | Basf Ag, 6700 Ludwigshafen | Anilide, verfahren zu ihrer herstellung und diese enthaltende herbizide |
| DE3628082A1 (de) * | 1986-08-19 | 1988-03-03 | Basf Ag | Carboxamide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| CA2021194A1 (en) * | 1989-07-17 | 1991-01-18 | Naoki Inui | Rubber composition useful for tires |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE593743A (ro) * | 1959-08-05 | |||
| NL123536C (ro) * | 1963-07-09 | |||
| US3442945A (en) * | 1967-05-22 | 1969-05-06 | Monsanto Co | Phytotoxic alpha-halo-acetanilides |
| US3632631A (en) * | 1967-09-08 | 1972-01-04 | Ethyl Corp | Sterically hindered bisphenyl carbamates |
| CH532891A (de) * | 1969-03-26 | 1973-01-31 | Ciba Geigy Ag | Verwendung von Phenylharnstoffen zum selektiven Bekämpfen von Unkräutern in Kulturen von Nutzpflanzen |
| US3547620A (en) * | 1969-01-23 | 1970-12-15 | Monsanto Co | N-(oxamethyl)alpha-halo-acetanilide herbicides |
| US3903155A (en) * | 1971-03-15 | 1975-09-02 | Stauffer Chemical Co | Phenoxy acetals and their utility as herbicides |
| US3769301A (en) * | 1971-06-01 | 1973-10-30 | Monsanto Co | Herbicidal-n-(acyl-tertiary-amidoalkyl)anilides |
| JPS539688B2 (ro) * | 1972-06-09 | 1978-04-07 |
-
1975
- 1975-07-23 US US05/598,486 patent/US3976470A/en not_active Expired - Lifetime
-
1976
- 1976-06-14 US US05/695,357 patent/US4090865A/en not_active Expired - Lifetime
- 1976-07-21 RO RO87047A patent/RO81146B/ro unknown
- 1976-07-23 PL PL1976191393A patent/PL107403B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4090865A (en) | 1978-05-23 |
| PL107403B1 (pl) | 1980-02-29 |
| RO81146A (ro) | 1983-02-15 |
| US3976470A (en) | 1976-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RO81146B (ro) | Compozitie herbicida | |
| NO923081D0 (no) | Neurobeskyttende 3-piperidino-4-hydroksykromanderivater og analoger derav | |
| GB1522869A (en) | Substituted 4- halomethyl 2- pyrrolidinones and the use thereof as herbicides | |
| DE3161760D1 (en) | 1,4-dihydropyridines with different substituents in positions 2 and 6, processes for their preparation and their use in medicines | |
| ES466436A1 (es) | Un procedimiento para la preparacion de nuevos derivados de 3-(2-aril-2-propil)urea. | |
| ES453881A1 (es) | Un procedimiento para la produccion de 1,3-ditiolo (4,5-b) pirazin-2-ilidempropanodinitrilo. | |
| ES8505955A1 (es) | Un procedimiento para preparar nuevas 5-acil-2-(1h)-piridinonas. | |
| ES457833A1 (es) | Procedimiento para la obtencion de agentes parasiticidas. | |
| RO86272B (ro) | Compozitie erbicida cu antidot | |
| FR2355500A1 (fr) | Composition antimicrobienne a base de 1-acyloxy-2-imidazolyl-1-phenylethanes | |
| ES511168A1 (es) | Procedimiento para la obtencion de acetanilidas sustituidas. | |
| RO81224B (ro) | Compozitie erbicida cu antidot | |
| FR2430946A1 (fr) | Derives imidazolylethoxyles de pyrazolo (3,4-b)-pyridine-5-methanols, a action antifongique et antibacterienne | |
| DE2962824D1 (en) | Herbicidal compositions and their use | |
| JPS5347432A (en) | Antifouling coating composition | |
| AU557979B2 (en) | Thiazolidin-and hydrothiazin-derivatives | |
| ES513881A0 (es) | Productos halogenados. | |
| IL87601A0 (en) | Diphenyl ether derivatives,their preparation and their use as herbicides | |
| ES341990A1 (es) | Procedimiento para preparar compuestos sinergeticos insec- ticidas. | |
| JPS51123821A (en) | An algicide and protective agent | |
| GB1518858A (en) | 2-pheny-1,2-dihydronaphthalenes and their use to prepare 3-tetrahydronaphthyl-4-hydroxycoumarin derivatives | |
| GB2013678A (en) | 1,4-Benzoxazine derivatives | |
| AR248401A1 (es) | Un microbiocida de 3-halo-5-halometil-2-oxazolidinona, su preparacion e intermediario 5-halometil-2-oxazolidinona y control de un microorganismo en un sistema acuoso y sobre una superficie. | |
| ES8201988A1 (es) | Procedimiento para la obtencion de acetanilidas sustituidas de efecto herbicida | |
| JPS53141217A (en) | New gamma-mercaptopropyl compound |